diff --git a/Gemfile b/Gemfile index dad5b951d..4f56f0973 100644 --- a/Gemfile +++ b/Gemfile @@ -1,9 +1,9 @@ -source 'https://rubygems.org' +source 'http://rubygems.org' gem 'rails', '3.2.2' # Bundle edge Rails instead: -# gem 'rails', :git => 'git://github.com/rails/rails.git' +#gem 'rails', :git => 'git://github.com/rails/rails.git' gem 'sqlite3' @@ -12,24 +12,34 @@ gem 'json' # Gems used only for assets and not required # in production environments by default. group :assets do - gem 'sass-rails', '~> 3.2.3' - gem 'coffee-rails', '~> 3.2.1' - - # See https://github.com/sstephenson/execjs#readme for more supported runtimes - # gem 'therubyracer' - - gem 'uglifier', '>= 1.0.3' + gem 'sass-rails', '~> 3.2.4' + gem 'coffee-rails', '~> 3.2.2' + gem 'uglifier', '>= 1.2.3' end gem 'jquery-rails' +# Optional support for eco templates +gem 'eco' + +gem "omniauth" +gem "omniauth-twitter" +gem "omniauth-facebook" +gem "omniauth-linkedin" + +gem "twitter" +gem "koala" +gem "mail" + +gem "mime-types" + +gem 'delayed_job_active_record' +gem "daemons" + # To use ActiveModel has_secure_password # gem 'bcrypt-ruby', '~> 3.0.0' -# To use Jbuilder templates for JSON -# gem 'jbuilder' - -# Use unicorn as the app server +# Use unicorn as the web server # gem 'unicorn' # Deploy with Capistrano @@ -37,3 +47,4 @@ gem 'jquery-rails' # To use debugger # gem 'ruby-debug' + diff --git a/app/assets/images/close.png b/app/assets/images/close.png new file mode 100644 index 000000000..81a24d89c Binary files /dev/null and b/app/assets/images/close.png differ diff --git a/app/assets/images/glyphicons-halflings.png b/app/assets/images/glyphicons-halflings.png new file mode 100644 index 000000000..92d4445df Binary files /dev/null and b/app/assets/images/glyphicons-halflings.png differ diff --git a/app/assets/javascripts/app/controllers/.gitkeep b/app/assets/javascripts/app/controllers/.gitkeep new file mode 100644 index 000000000..e69de29bb diff --git a/app/assets/javascripts/app/controllers/_application_controller.js.coffee b/app/assets/javascripts/app/controllers/_application_controller.js.coffee new file mode 100644 index 000000000..b93a692b9 --- /dev/null +++ b/app/assets/javascripts/app/controllers/_application_controller.js.coffee @@ -0,0 +1,698 @@ +class App.Controller extends Spine.Controller + + # add @title methode to set title + title: (name) -> + $('html head title').html( Config.product_name + ' - ' + name ) + + # add @notify methode to create notification + notify: (data) -> + Spine.trigger 'notify', data + + # add @navupdate methode to update navigation + navupdate: (url) -> + Spine.trigger 'navupdate', url + +# # extend delegateEvents to unbind and undelegate +# delegateEvents: -> +# +# # here unbind and undelegate while @el +# @el.unbind() +# @el.undelegate() +# +# for key, method of @events +# unless typeof(method) is 'function' +# method = @proxy(@[method]) +# +# match = key.match(@eventSplitter) +# eventName = match[1] +# selector = match[2] +# +# if selector is '' +# @el.bind(eventName, method) +# else +# @el.delegate(selector, eventName, method) + + formGen: (data) -> + form = $('
') + fieldset = $('
') + fieldset.appendTo(form) + autofocus = 1; + if data.autofocus isnt undefined + autofocus = data.autofocus + + attributes = clone( data.model.configure_attributes || [] ) + for attribute in attributes + + if !attribute.readonly && ( !data.required || data.required && attribute[data.required] ) + + # set autofocus + if autofocus is 1 + attribute.autofocus = 'autofocus' + autofocus = 0 + + # set required option + if !attribute.null + attribute.required = 'required' + else + attribute.required = '' + + # set multible option + if attribute.multiple + attribute.multiple = 'multiple' + else + attribute.multiple = '' + + # set autocapitalize option + if attribute.autocapitalize is undefined || attribute.autocapitalize + attribute.autocapitalize = '' + else + attribute.autocapitalize = 'autocapitalize="off"' + + # set value + if data.params + if attribute.name of data.params + attribute.value = data.params[attribute.name] + + # set default value + else + if 'default' of attribute + @log 'default', attribute.default + attribute.value = attribute.default + else + attribute.value = '' + + # add item + item = $( @formGenItem(attribute, data.model.className) ) + item.appendTo(fieldset) + + # if password, add confirm password item + if attribute.type is 'password' + + attribute.display = attribute.display + ' (confirm)' + attribute.name = attribute.name + '_confirm'; + + item = $( @formGenItem(attribute, data.model.className) ) + item.appendTo(fieldset) + + # return form + return form.html() + + formGenItem: (attribute, classname) -> + + # create item id + attribute.id = classname + '_' + attribute.name + + # build options list based on config + selection = [] + if attribute.options + if attribute.nulloption + attribute.options[''] = '-' + for key of attribute.options + selection.push { + name: attribute.options[key], + value: key, + } + + # build options list based on relation + attribute.options = selection || [] + if attribute.relation && App[attribute.relation] + attribute.options = [] + if attribute.nulloption + attribute.options[''] = '-' + attribute.options.push { + name: '-', + value: '', + } + + list = [] + if attribute.filter && attribute.filter[attribute.name] + filter = attribute.filter[attribute.name] + + # check all records + for record in App[attribute.relation].all() + + # check all filter attributes + for key of filter + + # check all filter values as array + for value in filter[key] + + # if it's matching, use it for selection + if record[key] is value + list.push record + else + list = App[attribute.relation].all() + + list.forEach( (item) => + if item.active + name = '???' + if item.name + name = item.name + else if item.firstname + name = item.firstname + if item.lastname + if name + name = name + ' ' + name = name + item.lastname + + attribute.options.push { + name: name, + value: item.id, + note: item.note, + } + ) + + # finde selected/checked item of list + if attribute.options + for record in attribute.options + if typeof attribute.value is 'string' || typeof attribute.value is 'number' || typeof attribute.value is 'boolean' + + # if name or value is matching + if record.value.toString() is attribute.value.toString() || record.name.toString() is attribute.value.toString() + record.selected = 'selected' + record.checked = 'checked' +# if record.name.toString() is attribute.value.toString() +# record.selected = 'selected' +# record.checked = 'checked' + if ( attribute.value && record.value && _.include(attribute.value, record.value) ) || ( attribute.value && record.name && _.include(attribute.value, record.name) ) + record.selected = 'selected' + record.checked = 'checked' + + # boolean + if attribute.tag is 'boolean' + + # build options list + attribute.options = [ + { name: 'active', value: true } + { name: 'inactive', value: false } + ] || [] + + # finde selected item of list + for record in attribute.options + if record.value is attribute.value + record.selected = 'selected' + + # return item + item = App.view('generic/select')( attribute: attribute ) + + # select + else if attribute.tag is 'select' + item = App.view('generic/select')( attribute: attribute ) + + # checkbox + else if attribute.tag is 'checkbox' + item = App.view('generic/checkbox')( attribute: attribute ) + + # radio + else if attribute.tag is 'radio' + item = App.view('generic/radio')( attribute: attribute ) + + # textarea + else if attribute.tag is 'textarea' + item = App.view('generic/textarea')( attribute: attribute ) + + # autocompletion + else if attribute.tag is 'autocompletion' + item = App.view('generic/autocompletion')( attribute: attribute ) + + a = -> +# if attribute.relation && App[attribute.relation] +# @log '1312312333333333333', App[attribute.relation] +# @log '1231231231', '#' + attribute.id + '_autocompletion' + @local_attribute = '#' + attribute.id + @local_attribute_full = '#' + attribute.id + '_autocompletion' + @callback = attribute.callback + + b = (event, key) => +# @log 'zzzz', event, item, key, @local_attribute + $(@local_attribute).val(key) + if @callback + @callback( user_id: key ) + ### + $(@local_attribute_full).tagsInput( + autocomplete_url: '/user_search', + height: '30px', + width: '530px', + auto: { + source: '/user_search', + minLength: 2, + select: ( event, ui ) => + @log 'selected', event, ui + b(event, ui.item.id) + } + ) + ### + $(@local_attribute_full).autocomplete( + source: '/user_search', + minLength: 2, + select: ( event, ui ) => + @log 'selected', event, ui + b(event, ui.item.id) + ) + + @delay(a, 800) + + # input + else + item = App.view('generic/input')( attribute: attribute ) + + return App.view('generic/attribute')( + attribute: attribute, + item: item, + ) + + # get all params of the form + formParam: (form, errors) -> + param = {} + + # find form based on sub elements + if $(form).children()[0] + form = $(form).children().parents('form') + + # find form based on parents next + else if $(form).parents('form')[0] + form = $(form).parents('form') + + # find form based on parents next , not really good! + else if $(form).parents().find('form')[0] + form = $(form).parents().find('form') + else + @log 'ERROR, no form found!', form + + for key in form.serializeArray() + if param[key.name] + if typeof param[key.name] is 'string' + param[key.name] = [ param[key.name], key.value] + else + param[key.name].push key.value + else + param[key.name] = key.value + + @log 'formParam', form, param + return param + + formDisable: (form) -> + @log 'disable...', $(form.target).parent() + $(form.target).parent().find('[type="submit"]').attr('disabled', true) + $(form.target).parent().find('[type="reset"]').attr('disabled', true) + + formEnable: (form) -> + @log 'enable...', $(form).parent() + $(form).parent().find('[type="submit"]').attr('disabled', false) + $(form).parent().find('[type="reset"]').attr('disabled', false) + + table: (data) -> + overview = data.overview || data.model.configure_overview || [] + attributes = data.attributes || data.model.configure_attributes || [] + + # define normal header + header = [] + for row in overview + for attribute in attributes + if row is attribute.name + header.push(attribute.display) + else + rowWithoutId = row + '_id' + if rowWithoutId is attribute.name + header.push(attribute.display) + + data_types = [] + for row in overview + data_types.push { + name: row, + link: 1, + } + + # extended table format + if data.overview_extended + header = [] + for row in data.overview_extended + for attribute in attributes + if row.name is attribute.name + header.push(attribute.display) + else + rowWithoutId = row.name + '_id' + if rowWithoutId is attribute.name + header.push(attribute.display) + + data_types = data.overview_extended + + # generate content data + objects = clone( data.objects ) + for object in objects + for row in data_types + + # check if data is a object + if typeof object[row.name] is 'object' + if !object[row.name] + object[row.name] = { + name: '-', + } + + # if no content exists, try firstname/lastname + if !object[row.name]['name'] + if object[row.name]['firstname'] || object[row.name]['lastname'] + object[row.name]['name'] = (object[row.name]['firstname'] || '') + ' ' + (object[row.name]['lastname'] || '') + + # if it isnt a object, create one + else if typeof object[row.name] isnt 'object' + object[row.name] = { + name: object[row.name], + } + + # fallback if it's something else + else + object[row.name] = { + name: '????', + } + + # execute callback on content + if row.callback + object[row.name]['name'] = row.callback(object[row.name]['name']) + +# @log 'table', 'header', header, 'overview', data_types, 'objects', objects + table = App.view('generic/table')( + header: header, + overview: data_types, + objects: objects, + checkbox: data.checkbox, + ) +# @log 'ttt', $(table).find('span') +# $(table).find('span').bind('click', -> +# console.log('----------click---------') +# ) + + # convert to jquery object + table = $(table) + + # enable checkbox bulk selection + if data.checkbox + table.delegate('[name="bulk_all"]', 'click', (e) -> + if $(e.target).attr('checked') + $(e.target).parents().find('[name="bulk"]').attr('checked', true); + else + $(e.target).parents().find('[name="bulk"]').attr('checked', false); + ) + + return table + + ticketTableAttributes: (attributes) => + all_attributes = [ + { name: 'number', link: true }, + { name: 'title', link: true }, + { name: 'customer', class: 'user-data', data: { id: true } }, + { name: 'ticket_state' }, + { name: 'ticket_priority' }, + { name: 'group' }, + { name: 'owner', class: 'user-data', data: { id: true } }, + { name: 'created_at', callback: @humanTime }, + { name: 'last_contact', callback: @humanTime }, + { name: 'last_contact_agent', callback: @humanTime }, + { name: 'last_contact_customer', callback: @humanTime }, + { name: 'first_response', callback: @humanTime }, + { name: 'close_time', callback: @humanTime }, + ] + shown_all_attributes = [] + for all_attribute in all_attributes + for attribute in attributes + if all_attribute['name'] is attribute + shown_all_attributes.push all_attribute + break + return shown_all_attributes + + validateForm: (data) -> + + # remove all errors + $(data.form).parents().find('.error').removeClass('error') + $(data.form).parents().find('.help-inline').html('') + + # show new errors + for key, msg of data.errors + $(data.form).parents().find('[name*="' + key + '"]').parents('div .control-group').addClass('error') + $(data.form).parents().find('[name*="' + key + '"]').parent().find('.help-inline').html(msg); + + # set autofocus + $(data.form).parents().find('.error').find('input, textarea').first().focus() + +# # enable form again +# if $(data.form).parents().find('.error').html() +# @formEnable(data.form) + +# redirectToLogin: (data) -> +# + + # human readable file size + humanFileSize: (size) => + if size > ( 1024 * 1024 ) + size = Math.round( size / ( 1024 * 1024 ) ) + ' MBytes' + else if size > 1024 + size = Math.round( size / 1024 ) + ' KBytes' + else + size = size + ' Bytes' + return size + + # human readable time + humanTime: (time) => + current = new Date() + created = new Date(time) + diff = (current - created) / 1000 + if diff >= 86400 + unit = Math.round( (diff / 86400) ) + if unit > 1 + return unit + ' days' + else + return unit + ' day' + if diff >= 3600 + unit = Math.round( (diff / 3600) ) + if unit > 1 + return unit + ' hours' + else + return unit + ' hour' + if diff <= 3600 + unit = Math.round( (diff / 60) ) + if unit > 1 + return unit + ' minutes' + else + return unit + ' minute' + + userInfo: (data) => + # start customer info controller + new App.UserInfo( + el: data.el || $('#customer_info'), + user_id: data.user_id, + ) + + authenticate: -> + console.log 'authenticate', window.Session + return true if window.Session['id'] + + # redirect to login + @navigate '#login' + return false + + clone = (obj) -> + if not obj? or typeof obj isnt 'object' + return obj + + newInstance = new obj.constructor() + + for key of obj + newInstance[key] = clone obj[key] + + return newInstance + + userPopups: (position = 'right') -> + # show user popup + $('.user-data').popover( + delay: { show: 500, hide: 1200 }, +# placement: 'bottom', + placement: position, + title: (e) => + user_id = $(e).data('id') + user = App.User.find(user_id) + (user.firstname || '') + ' ' + (user.lastname || '') + content: (e) => + user_id = $(e).data('id') + user = App.User.find(user_id) + + # get display data + data = [] + for item in App.User.configure_attributes + if user[item.name] + if item.name isnt 'firstname' + if item.name isnt 'lastname' + if item.info #&& ( @user[item.name] || item.name isnt 'note' ) + data.push item + + # insert data + App.view('user_info_small')( + user: user, + data: data, + ) + ) + + userTicketPopups: (data) -> + # get data + @tickets = {} + ajax = new App.Ajax + ajax.ajax( + type: 'GET', + url: '/ticket_customer', + data: { + customer_id: data.user_id, + } + processData: true, + success: (data, status, xhr) => + @tickets = data.tickets + ) + + if !data.position + data.position = 'left' + + # show user popup + $(data.selector).popover( + delay: { show: 500, hide: 5200 }, + placement: data.position, + title: (e) => + $(e).find('[title="*"]').val() + + content: (e) => + type = $(e).filter('[data-type]').data('type') + data = @tickets[type] || [] + + for ticket in data + + # set human time + ticket.humanTime = @humanTime(ticket.created_at) + + # insert data + App.view('user_ticket_info_small')( + tickets: data, + ) + ) + + loadCollection: (params) -> + + # users + if params.type == 'User' + for user of params.data + if user && !user.image + user.image = 'http://placehold.it/48x48' + App.User.refresh( params.data[user], options: { clear: true } ) + + # tickets + else if params.type == 'Ticket' + for ticket in params.data + # priority + ticket.ticket_priority = App.TicketPriority.find(ticket.ticket_priority_id) + + # state + ticket.ticket_state = App.TicketState.find(ticket.ticket_state_id) + + # group + ticket.group = App.Group.find(ticket.group_id) + + # customer + if ticket.customer_id and App.User.exists(ticket.customer_id) + user = App.User.find(ticket.customer_id) + ticket.customer = user + + # owner + if ticket.owner_id and App.User.exists(ticket.owner_id) + user = App.User.find(ticket.owner_id) + ticket.owner = user + + # load collection + App.Ticket.refresh( ticket, options: { clear: true } ) + + # articles + else if params.type == 'TicketArticle' + for article in params.data + + # add user + article.created_by = App.User.find(article.created_by_id) + + # set human time + article.humanTime = @humanTime(article.created_at) + + # add possible actions + article.article_type = App.TicketArticleType.find( article.ticket_article_type_id ) + article.article_sender = App.TicketArticleSender.find( article.ticket_article_sender_id ) + + App.TicketArticle.refresh( article, options: { clear: true } ) + + # history + else if params.type == 'History' + for histroy in params.data + + # add user + histroy.created_by = App.User.find(histroy.created_by_id) + + # set human time + histroy.humanTime = @humanTime(histroy.created_at) + + # add possible actions + if histroy.history_attribute_id + histroy.attribute = App.HistoryAttribute.find( histroy.history_attribute_id ) + if histroy.history_type_id + histroy.type = App.HistoryType.find( histroy.history_type_id ) + if histroy.history_object_id + histroy.object = App.HistoryObject.find( histroy.history_object_id ) + + App.History.refresh( histroy, options: { clear: true } ) + + # all the rest + else + for object in params.data + App[params.type].refresh( object, options: { clear: true } ) + + +class App.ControllerModal extends App.Controller + className: 'modal hide fade', + tag: 'div', + + events: + 'submit form': 'submit', + 'click .submit': 'submit', + 'click .cancel': 'modalHide', + 'click .close': 'modalHide', + + constructor: (options) -> + + # do not use @el, because it's inserted by js + if options + delete options.el + + # callbacks +# @callback = {} +# if options.success +# @callback.success = options.success +# if options.error +# @callback.error = options.error + + super(options) + + modalShow: (params) => + @el.modal({ + backdrop: true, + keyboard: true, + show: true + }) + @el.bind('hidden', => + + # navigate back to home page + if @pageData && @pageData.home + @navigate @pageData.home + + # navigate back + if params && params.navigateBack + window.history.back() + + # remove modal from dom + $('.modal').remove(); + ) + + modalHide: (e) => + if e + e.preventDefault() + @el.modal('hide') diff --git a/app/assets/javascripts/app/controllers/_application_controller_generic.js.coffee b/app/assets/javascripts/app/controllers/_application_controller_generic.js.coffee new file mode 100644 index 000000000..ac2467f6c --- /dev/null +++ b/app/assets/javascripts/app/controllers/_application_controller_generic.js.coffee @@ -0,0 +1,230 @@ +$ = jQuery.sub() +$.fn.item = (genericObject) -> + elementID = $(@).data('id') + elementID or= $(@).parents('[data-id]').data('id') + genericObject.find(elementID) + +class App.ControllerGenericNew extends App.ControllerModal + constructor: (params) -> + super + @render() + + render: -> + @log 'ren new', @el + @html App.view('generic/admin/new')( + form: @formGen( model: @genericObject ), + head: 'New ' + @pageData.object + ) + @modalShow() + + submit: (e) -> + @log 'submit' + e.preventDefault() + params = @formParam(e.target) + ### + for num in [1..199] + user = new User + params.login = 'login_c' + num + user.updateAttributes(params) + return false + ### + object = new @genericObject + object.load(params) + + # validate + errors = object.validate( form: true ) + if errors + @log 'error new', errors + @validateForm( form: e.target, errors: errors ) + return false + + # save object + object.save( + success: => + @modalHide() + error: => + @log 'errors' + @modalHide() + ) + +class App.ControllerGenericEdit extends App.ControllerModal + constructor: (params) -> + super + @log 'ControllerGenericEditWindow', params + + # fetch item on demand + if @genericObject.exists(params.id) + @item = @genericObject.find(params.id) + @render() + else + @genericObject.bind 'refresh', => + @log 'changed....' + @item = @genericObject.find(params.id) + @render() + @genericObject.unbind 'refresh' + @genericObject.fetch( id: params.id) + + render: -> + @html App.view('generic/admin/edit')( + form: @formGen( model: @genericObject, params: @item ), + head: 'Edit ' + @pageData.object + ) + @modalShow() + + submit: (e) -> + e.preventDefault() + params = @formParam(e.target) + @item.load(params) + + # validate + errors = @item.validate( form: true ) + if errors + @log 'error new', errors + @validateForm( form: e.target, errors: errors ) + return false + + @log 'save....' + # save object + @item.save( + success: => + @modalHide() + error: => + @log 'errors' + @modalHide() + ) + +class App.ControllerGenericIndex extends App.Controller + events: + 'click [data-type=edit]': 'edit' + 'click [data-type=destroy]': 'destroy' + 'click [data-type=new]': 'new' + + constructor: -> + super + + # set controller to active + Config['ActiveController'] = @pageData.navupdate + + + # set title + @title @pageData.title + + # set nav bar + @navupdate @pageData.navupdate + + # bind render after a change is done + @genericObject.bind 'refresh change', @render + @genericObject.bind 'ajaxError', (rec, msg) => + @log 'ajax notice', msg.status + if msg.status is 401 + @log 'ajax error', rec, msg, msg.status +# @navigate @pageData.navupdate +# alert('relogin') + @navigate 'login' + + # execute fetch, if needed + if !@genericObject.count() || true +# if !@genericObject.count() + + # prerender without content + @render() + + # fetch all + @genericObject.fetch() + else + @render() + + render: => + + return if Config['ActiveController'] isnt @pageData.navupdate + + objects = @genericObject.all() + + # remove ignored items from collection + if @ignoreObjectIDs + objects = _.filter(objects, (item) -> + return if item.id is 1 + return item + ) + + @html App.view('generic/admin/index')( + head: @pageData.objects, + notes: @pageData.notes, + buttons: @pageData.buttons, + menus: @pageData.menus, + ) + + # append content table + table = @table( + model: @genericObject, + objects: objects, + ) + @el.find('.table-overview').append(table) + + edit: (e) => + e.preventDefault() + item = $(e.target).item(@genericObject) + new App.ControllerGenericEdit( + id: item.id, + pageData: @pageData, + genericObject: @genericObject + ) + + destroy: (e) -> + item = $(e.target).item(@genericObject) + item.destroy() if confirm('Sure?') + + new: (e) -> + e.preventDefault() + new App.ControllerGenericNew( + pageData: @pageData, + genericObject: @genericObject + ) + +class App.ControllerLevel2 extends App.Controller + events: + 'click [data-toggle="tabnav"]': 'toggle', + + constructor: -> + super + + return if !@authenticate() + + render: -> + @log 'ttt', @target, @ + # set title + @title @page.title + @navupdate @page.nav + + @html App.view('generic/admin_level2/index')( + page: @page, + menus: @menu, + type: @type, + target: @target, + ) + for menu in @menu + @el.find('.nav-tab-content').append('') + if menu.controller + params = menu.params || {} + params.el = @el.find( '#' + menu.target ) + new menu.controller( params ) + + @el.find('.tabbable').addClass('hide') + if @target + @el.find( '#' + @target ).removeClass('hide') + else + @el.find('.tabbable:first').removeClass('hide') + + @el.find('[data-toggle="tabnav"]:first').addClass('active') + + + toggle: (e) -> + return true if @toggleable is false + e.preventDefault() + target = $(e.target).data('target') + $(e.target).parents('ul').find('li').removeClass('active') + $(e.target).parents('li').addClass('active') + @el.find('.tabbable').addClass('hide') + @el.find('#' + target).removeClass('hide') +# window.scrollTo(0,0) + \ No newline at end of file diff --git a/app/assets/javascripts/app/controllers/_channel/chat.js.coffee b/app/assets/javascripts/app/controllers/_channel/chat.js.coffee new file mode 100644 index 000000000..b3448039b --- /dev/null +++ b/app/assets/javascripts/app/controllers/_channel/chat.js.coffee @@ -0,0 +1,18 @@ +$ = jQuery.sub() + +class App.ChannelChat extends App.Controller + events: + 'click [data-toggle="tabnav"]': 'toggle', + + constructor: -> + super + + # render page + @render() + + render: -> + + @html App.view('channel/chat')( + head: 'some header' + ) + diff --git a/app/assets/javascripts/app/controllers/_channel/email.js.coffee b/app/assets/javascripts/app/controllers/_channel/email.js.coffee new file mode 100644 index 000000000..733d2df4d --- /dev/null +++ b/app/assets/javascripts/app/controllers/_channel/email.js.coffee @@ -0,0 +1,18 @@ +$ = jQuery.sub() + +class App.ChannelEmail extends App.Controller + events: + 'click [data-toggle="tabnav"]': 'toggle', + + constructor: -> + super + + # render page + @render() + + render: -> + + @html App.view('channel/email')( + head: 'some header' + ) + diff --git a/app/assets/javascripts/app/controllers/_channel/facebook.js.coffee b/app/assets/javascripts/app/controllers/_channel/facebook.js.coffee new file mode 100644 index 000000000..a0ab7151f --- /dev/null +++ b/app/assets/javascripts/app/controllers/_channel/facebook.js.coffee @@ -0,0 +1,18 @@ +$ = jQuery.sub() + +class App.ChannelFacebook extends App.Controller + events: + 'click [data-toggle="tabnav"]': 'toggle', + + constructor: -> + super + + # render page + @render() + + render: -> + + @html App.view('channel/facebook')( + head: 'some header' + ) + diff --git a/app/assets/javascripts/app/controllers/_channel/twitter.js.coffee b/app/assets/javascripts/app/controllers/_channel/twitter.js.coffee new file mode 100644 index 000000000..7c220ec25 --- /dev/null +++ b/app/assets/javascripts/app/controllers/_channel/twitter.js.coffee @@ -0,0 +1,18 @@ +$ = jQuery.sub() + +class App.ChannelTwitter extends App.Controller + events: + 'click [data-toggle="tabnav"]': 'toggle', + + constructor: -> + super + + # render page + @render() + + render: -> + + @html App.view('channel/twitter')( + head: 'some header' + ) + diff --git a/app/assets/javascripts/app/controllers/_channel/web.js.coffee b/app/assets/javascripts/app/controllers/_channel/web.js.coffee new file mode 100644 index 000000000..7688ecbfb --- /dev/null +++ b/app/assets/javascripts/app/controllers/_channel/web.js.coffee @@ -0,0 +1,18 @@ +$ = jQuery.sub() + +class App.ChannelWeb extends App.Controller + events: + 'click [data-toggle="tabnav"]': 'toggle', + + constructor: -> + super + + # render page + @render() + + render: -> + + @html App.view('channel/web')( + head: 'some header' + ) + diff --git a/app/assets/javascripts/app/controllers/_dashboard/activity_stream.js.coffee b/app/assets/javascripts/app/controllers/_dashboard/activity_stream.js.coffee new file mode 100644 index 000000000..55fd75835 --- /dev/null +++ b/app/assets/javascripts/app/controllers/_dashboard/activity_stream.js.coffee @@ -0,0 +1,61 @@ +$ = jQuery.sub() + +class App.DashboardActivityStream extends App.Controller + events: + 'click [data-type=edit]': 'zoom' + + constructor: -> + super +# @log 'aaaa', @el + + @items = [] + + # get data + @ajax = new App.Ajax + @ajax.ajax( + type: 'GET', + url: '/activity_stream', + data: { + limit: 10, + } + processData: true, +# data: JSON.stringify( view: @view ), + success: (data, status, xhr) => + @items = data.activity_stream + + # load user collection + @loadCollection( type: 'User', data: data.users ) + + # load ticket collection + @loadCollection( type: 'Ticket', data: data.tickets ) + + @render() + ) + + + render: -> + + # load user data + for item in @items + item.created_by = App.User.find(item.created_by_id) + + # load ticket data + for item in @items + item.ticket = App.Ticket.find(item.o_id) + + html = App.view('dashboard/activity_stream')( + head: 'Activity Stream', + items: @items + ) + html = $(html) + + @html html + + # start user popups + @userPopups('left') + + zoom: (e) => + e.preventDefault() + id = $(e.target).parents('[data-id]').data('id') + @log 'goto zoom!' + @navigate 'ticket/zoom/' + id diff --git a/app/assets/javascripts/app/controllers/_dashboard/recent_viewed.js.coffee b/app/assets/javascripts/app/controllers/_dashboard/recent_viewed.js.coffee new file mode 100644 index 000000000..cb12c9ab9 --- /dev/null +++ b/app/assets/javascripts/app/controllers/_dashboard/recent_viewed.js.coffee @@ -0,0 +1,63 @@ +$ = jQuery.sub() + +class App.DashboardRecentViewed extends App.Controller + events: + 'click [data-type=edit]': 'zoom' + + constructor: -> + super +# @log 'aaaa', @el + + @items = [] + + # get data + @ajax = new App.Ajax + @ajax.ajax( + type: 'GET', + url: '/recent_viewed', + data: { + limit: 5, + } + processData: true, +# data: JSON.stringify( view: @view ), + success: (data, status, xhr) => + @items = data.recent_viewed + + # load user collection + @loadCollection( type: 'User', data: data.users ) + + # load ticket collection + @loadCollection( type: 'Ticket', data: data.tickets ) + + @render() + ) + + + render: -> + + # load user data + for item in @items +# @log 'load', item.created_by_id + item.created_by = App.User.find(item.created_by_id) + + # load ticket data + for item in @items +# @log 'load', item.o_id + item.ticket = App.Ticket.find(item.o_id) + + html = App.view('dashboard/recent_viewed')( + head: 'Recent Viewed', + items: @items + ) + html = $(html) + + @html html + + # start user popups + @userPopups('left') + + zoom: (e) => + e.preventDefault() + id = $(e.target).parents('[data-id]').data('id') + @log 'goto zoom!' + @navigate 'ticket/zoom/' + id diff --git a/app/assets/javascripts/app/controllers/_dashboard/ticket.js.coffee b/app/assets/javascripts/app/controllers/_dashboard/ticket.js.coffee new file mode 100644 index 000000000..20a65c5ba --- /dev/null +++ b/app/assets/javascripts/app/controllers/_dashboard/ticket.js.coffee @@ -0,0 +1,235 @@ +$ = jQuery.sub() + +class App.DashboardTicket extends App.Controller + events: + 'click [data-type=edit]': 'zoom' + 'click [data-type=settings]': 'settings' + 'click [data-type=page]': 'page' + + constructor: -> + super + @tickets = [] + @tickets_count = 0 + @start_page = 1 + @navupdate '#' + + @fetch() + + fetch: -> + + # get data + @ajax = new App.Ajax + @ajax.ajax( + type: 'GET', + url: '/ticket_overviews', + data: { + view: @view, + view_mode: 'd', + start_page: @start_page, + } + processData: true, +# data: JSON.stringify( view: @view ), + success: (data, status, xhr) => + + # get meta data + @overview = data.overview + App.Overview.refresh( @overview, options: { clear: true } ) + + App.Overview.unbind('local:rerender') + App.Overview.bind 'local:rerender', (record) => + @log 'rerender...', record + @render() + + App.Overview.unbind('local:refetch') + App.Overview.bind 'local:refetch', (record) => + @log 'refetch...', record + @fetch() + + # load user collection + @loadCollection( type: 'User', data: data.users ) + + # load ticket collection + @loadCollection( type: 'Ticket', data: data.tickets ) + + @tickets = data.tickets + @tickets_count = data.tickets_count + + @render() + ) + + render: -> + + pages_total = parseInt( ( @tickets_count / @overview.view.d.per_page ) + 0.99999 ) || 1 + html = App.view('dashboard/ticket')( + overview: @overview, + pages_total: pages_total, + start_page: @start_page, + ) + html = $(html) + html.find('li').removeClass('active') + html.find("[data-id=\"#{@start_page}\"]").parents('li').addClass('active') + + + shown_all_attributes = @ticketTableAttributes( App.Overview.find(@overview.id).view.d.overview ) + table = @table( + overview_extended: shown_all_attributes, + model: App.Ticket, + objects: @tickets, + checkbox: false, + ) + + if _.isEmpty(@tickets) + table = '' +# table = '-none-' + + # append content table + html.find('.table-overview').append(table) + @html html + + # start user popups + @userPopups() + + zoom: (e) => + e.preventDefault() + id = $(e.target).parents('[data-id]').data('id') + @log 'goto zoom!' + @navigate 'ticket/zoom/' + id + + settings: (e) => + e.preventDefault() + new Settings( + overview: App.Overview.find(@overview.id) + ) + + page: (e) => + e.preventDefault() + id = $(e.target).data('id') + @start_page = id + @fetch() + +class Settings extends App.ControllerModal + constructor: -> + super + @render() + + render: -> + + @html App.view('dashboard/ticket_settings')( + overview: @overview, + ) + @configure_attributes_article = [ +# { name: 'from', display: 'From', tag: 'input', type: 'text', limit: 100, null: false, class: 'span8', }, +# { name: 'to', display: 'To', tag: 'input', type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' }, +# { name: 'ticket_article_type_id', display: 'Type', tag: 'select', multiple: false, null: true, relation: 'TicketArticleType', default: '9', class: 'medium', item_class: 'keepleft' }, +# { name: 'internal', display: 'Visability', tag: 'radio', default: false, null: true, options: { true: 'internal', false: 'public' }, class: 'medium', item_class: 'keepleft' }, + { + name: 'per_page', + display: 'Items per page', + tag: 'select', + multiple: false, + null: false, + default: @overview.view.d.per_page, + options: { + 5: 5, + 10: 10, + 15: 15, + 20: 20, + }, + class: 'medium', +# item_class: 'keepleft', + }, + { + name: 'attributes', + display: 'Attributes', + tag: 'checkbox', + default: @overview.view.d.overview, + null: false, + options: { + number: 'Number', + title: 'Title', + customer: 'Customer', + ticket_state: 'State', + ticket_priority: 'Priority', + group: 'Group', + owner: 'Owner', + created_at: 'Alter', + last_contact: 'Last Contact', + last_contact_agent: 'Last Contact Agent', + last_contact_customer: 'Last Contact Customer', + first_response: 'First Response', + close_time: 'Close Time', + }, + class: 'medium', +# item_class: 'keepleft', + }, + { + name: 'order_by', + display: 'Order', + tag: 'select', + default: @overview.order.by, + null: false, + options: { + number: 'Number', + title: 'Title', + customer: 'Customer', + ticket_state: 'State', + ticket_priority: 'Priority', + group: 'Group', + owner: 'Owner', + created_at: 'Alter', + last_contact: 'Last Contact', + last_contact_agent: 'Last Contact Agent', + last_contact_customer: 'Last Contact Customer', + first_response: 'First Response', + close_time: 'Close Time', + }, + class: 'medium', + }, + { + name: 'order_by_direction', + display: 'Direction', + tag: 'select', + default: @overview.order.direction, + null: false, + options: { + ASC: 'up', + DESC: 'down', + }, + class: 'medium', + }, + ] + form = @formGen( model: { configure_attributes: @configure_attributes_article } ) + + @el.find('.setting').append(form) + + @modalShow() + + submit: (e) => + e.preventDefault() + params = @formParam(e.target) + + # check if refetch is needed + @reload_needed = 0 + if @overview.view['d']['per_page'] isnt params['per_page'] + @overview.view['d']['per_page'] = params['per_page'] + @reload_needed = 1 + + if @overview.order['by'] isnt params['order_by'] + @overview.order['by'] = params['order_by'] + @reload_needed = 1 + + if @overview.order['direction'] isnt params['order_by_direction'] + @overview.order['direction'] = params['order_by_direction'] + @reload_needed = 1 + + @overview.view['d']['overview'] = params['attributes'] + + @overview.save( + success: => + if @reload_needed + @overview.trigger('local:refetch') + else + @overview.trigger('local:rerender') + ) + + @modalHide() diff --git a/app/assets/javascripts/app/controllers/_settings/area.js.coffee b/app/assets/javascripts/app/controllers/_settings/area.js.coffee new file mode 100644 index 000000000..1978f10c7 --- /dev/null +++ b/app/assets/javascripts/app/controllers/_settings/area.js.coffee @@ -0,0 +1,70 @@ +$ = jQuery.sub() + +class App.SettingsArea extends App.Controller + constructor: -> + super + + # check authentication + return if !@authenticate() + + App.Setting.bind 'refresh change', @render + App.Setting.fetch() + + render: => + settings = App.Setting.all() + + html = $('
') + for setting in settings + if setting.area is @area + item = new App.SettingsAreaItem( setting: setting ) + html.append( item.el ) + + @html html + +class App.SettingsAreaItem extends App.Controller + events: + 'submit form': 'update', + + constructor: -> + super + @render() + + render: => + # defaults + for item in @setting.options['form'] + if typeof @setting.state.value is 'object' + item['default'] = @setting.state.value[item.name] + else + item['default'] = @setting.state.value + + # form + @configure_attributes = @setting.options['form'] + form = @formGen( model: { configure_attributes: @configure_attributes, className: '' }, autofocus: false ) + + # item + @html App.view('settings/item')( + setting: @setting, + form: form, + ) + + update: (e) => + e.preventDefault() + params = @formParam(e.target) + @log 'submit', @setting, params, e.target + if typeof @setting.state.value is 'object' + state = { + value: params + } + else + state = { + value: params[@setting.name] + } + + @setting['state'] = state + @setting.save( + success: => + + # login check + auth = new App.Auth + auth.loginCheck() + ) diff --git a/app/assets/javascripts/app/controllers/agent_ticket_create.js.coffee b/app/assets/javascripts/app/controllers/agent_ticket_create.js.coffee new file mode 100644 index 000000000..3c6b40808 --- /dev/null +++ b/app/assets/javascripts/app/controllers/agent_ticket_create.js.coffee @@ -0,0 +1,185 @@ +$ = jQuery.sub() + +class Index extends App.Controller + events: + 'click .customer_new': 'user_new' + 'submit form': 'submit', + 'click .submit': 'submit', + 'click .cancel': 'cancel', + + constructor: -> + super + + # check authentication + return if !@authenticate() + + # set title + @title 'New Ticket' +# @render() + @fetch() + @navupdate '#ticket_create' + + @edit_form = undefined + + fetch: () -> + # get data + @ajax = new App.Ajax + @ajax.ajax( + type: 'GET', + url: '/ticket_create', + data: { +# view: @view + } + processData: true, + success: (data, status, xhr) => + + # get edit form attributes + @edit_form = data.edit_form + + # load user collection + @loadCollection( type: 'User', data: data.users ) + + # render page + @render() + ) + + render: -> + + configure_attributes = [ + { name: 'customer_id', display: 'From', tag: 'autocompletion', type: 'text', limit: 100, null: false, relation: 'User', class: 'span7', autocapitalize: false, help: 'Select the customer of the Ticket or create one.', link: '»', callback: @userInfo }, + { name: 'group_id', display: 'Group', tag: 'select', multiple: false, null: false, filter: @edit_form, nulloption: true, relation: 'Group', class: 'span7', }, + { name: 'owner_id', display: 'Owner', tag: 'select', multiple: false, null: true, filter: @edit_form, nulloption: true, relation: 'User', class: 'span7', }, + { name: 'subject', display: 'Subject', tag: 'input', type: 'text', limit: 100, null: false, class: 'span7', }, + { name: 'body', display: 'Text', tag: 'textarea', rows: 6, limit: 100, null: false, class: 'span7', }, + { name: 'ticket_state_id', display: 'State', tag: 'select', multiple: false, null: false, filter: @edit_form, relation: 'TicketState', default: 'new', class: 'medium' }, + { name: 'ticket_priority_id', display: 'Priority', tag: 'select', multiple: false, null: false, filter: @edit_form, relation: 'TicketPriority', default: '2 normal', class: 'medium' }, + ] + @html App.view('agent_ticket_create')( + head: 'New Ticket', + form: @formGen( model: { configure_attributes: configure_attributes, className: 'create' } ), + ) + +# @modalShow( +# navigateBack: true +# ) + + user_new: (e) => + e.preventDefault() + new UserNew() + + cancel: -> + @render() + + submit: (e) -> + e.preventDefault() + + # get params + params = @formParam(e.target) + + # fillup params + if !params.title + params.title = params.subject + + # create ticket + object = new App.Ticket + @log 'updateAttributes', params + object.load(params) + + # validate form + errors = object.validate() + + # show errors in form + if errors + @log 'error new', errors + @validateForm( form: e.target, errors: errors ) + + # save ticket, create article + else + + # disable form + @formDisable(e) + + object.save( + success: (r) => + + # find sender_id + sender = App.TicketArticleSender.findByAttribute("name", "Customer") + type = App.TicketArticleType.findByAttribute("name", "phone") + + # create article + article = new App.TicketArticle + article.load( + from: 'some guy', + to: 'some group', + subject: params.subject, + body: params.body, + ticket_id: r.id, + ticket_article_type_id: type.id, + ticket_article_sender_id: sender.id, + ) + article.save() +# console.log('params', params) + + # notify UI + @notify + type: 'success', + msg: 'Ticket ' + r.number + ' created!' + + # create new create screen + @render() + + error: => + @log 'save failed!' + ) + + +class UserNew extends App.ControllerModal + constructor: -> + super + @render() + + render: -> + + @html App.view('agent_user_create')( + head: 'New User', + form: @formGen( model: App.User, required: 'quick' ), + ) + @modalShow() + + submit: (e) -> + @log 'submit' + e.preventDefault() + params = @formParam(e.target) + + # if no login is given, use emails as fallback + if !params.login && params.email + params.login = params.email + + user = new App.User + + # find role_id + role = App.Role.findByAttribute("name", "Customer") + params.role_ids = role.id + @log 'updateAttributes', params + user.load(params) + + errors = user.validate() + if errors + @log 'error new', errors + @validateForm( form: e.target, errors: errors ) + return + + # save user + user.save( + success: (r) => + @modalHide() + $('#create_customer_id').val(r.id) + $('#create_customer_id_autocompletion').val(r.firstname) + + # start customer info controller + @userInfo( user_id: r.id ) + error: => + @modalHide() + ) + +Config.Routes['ticket_create'] = Index \ No newline at end of file diff --git a/app/assets/javascripts/app/controllers/agent_ticket_view.js.coffee b/app/assets/javascripts/app/controllers/agent_ticket_view.js.coffee new file mode 100644 index 000000000..9610282bc --- /dev/null +++ b/app/assets/javascripts/app/controllers/agent_ticket_view.js.coffee @@ -0,0 +1,399 @@ +$ = jQuery.sub() + +class Index extends App.Controller + events: + 'click [data-type=edit]': 'zoom' + 'click [data-type=settings]': 'settings' + 'click [data-type=view-mode]': 'view_mode' + 'click [data-type=page]': 'page' + + constructor: -> + super + + # check authentication + return if !@authenticate() + + @log 'view:', @view + @view_mode = localStorage.getItem( "mode:#{@view}" ) || 's' + + # set title + @title '' + @navupdate '#ticket_view' + + @tickets = [] + @tickets_count = 0 + @start_page = 1 + @meta = {} + @bulk = {} + +# @render() + @fetch() + + fetch: -> + + # get data + @ajax = new App.Ajax + @ajax.ajax( + type: 'GET', + url: '/ticket_overviews', + data: { + view: @view, + view_mode: @view_mode, + start_page: @start_page, + } + processData: true, + success: (data, status, xhr) => + + # get meta data + @overview = data.overview + App.Overview.refresh( @overview, options: { clear: true } ) + + App.Overview.unbind('local:rerender') + App.Overview.bind 'local:rerender', (record) => + @log 'rerender...', record + @render() + + App.Overview.unbind('local:refetch') + App.Overview.bind 'local:refetch', (record) => + @log 'refetch...', record + @fetch() + + # set page title + @title @overview.meta.name + + # load user collection + @loadCollection( type: 'User', data: data.users ) + + # load ticket collection + @loadCollection( type: 'Ticket', data: data.tickets ) + + # remember ticket order + @tickets = data.tickets + + # remember ticket count + @tickets_count = data.tickets_count + + + # remeber bulk attributes + @bulk = data.bulk + + # render page + @render() + ) + + # refresh/load default collections +# for key, value of data.default_collections +# App[key].refresh( value, options: { clear: true } ) + + render: -> + + pages_total = parseInt( ( @tickets_count / @overview.view[@view_mode].per_page ) + 0.99999 ) || 1 + + # render init page + view_modes = [ + { + name: 'S', + type: 's', + class: 'active' if @view_mode is 's', + }, + { + name: 'M', + type: 'm', + class: 'active' if @view_mode is 'm', + } + ] + html = App.view('agent_ticket_view')( + overview: @overview, + view_modes: view_modes, + pages_total: pages_total, + start_page: @start_page, + checkbox: true, + ) + html = $(html) +# html.find('li').removeClass('active') + html.find("[data-id=\"#{@start_page}\"]").parents('li').addClass('active') + @html html + + # create table/overview + table = '' + if @view_mode is 'm' + table = App.view('agent_ticket_view/detail')( + overview: @overview, + objects: @tickets, + checkbox: true + ) + table = $(table) + table.delegate('[name="bulk_all"]', 'click', (e) -> + if $(e.target).attr('checked') + $(e.target).parents().find('[name="bulk"]').attr('checked', true); + else + $(e.target).parents().find('[name="bulk"]').attr('checked', false); + ) + else + shown_all_attributes = @ticketTableAttributes( App.Overview.find(@overview.id).view.s.overview ) + table = @table( + overview_extended: shown_all_attributes, + model: App.Ticket, + objects: @tickets, + checkbox: true, + ) + + # append content table + @el.find('.table-overview').append(table) + + # start user popups + @userPopups() + + # start bulk action observ + @el.find('.bulk-action').append( @bulk_form() ) + + # show/hide bulk action + @el.find('.table-overview').delegate('[name="bulk"], [name="bulk_all"]', 'click', (e) => + if @el.find('.table-overview').find('[name="bulk"]:checked').length == 0 + + # hide + @el.find('.bulk-action').addClass('hide') + else + + # show + @el.find('.bulk-action').removeClass('hide') + ) + + page: (e) => + e.preventDefault() + id = $(e.target).data('id') + @start_page = id + @fetch() + + view_mode: (e) => + e.preventDefault() + @start_page = 1 + id = $(e.target).data('mode') + @view_mode = id + localStorage.setItem( "mode:#{@view}", id ) + @fetch() + @render() + + bulk_form: => + @configure_attributes_ticket = [ + { name: 'ticket_state_id', display: 'State', tag: 'select', multiple: false, null: true, relation: 'TicketState', nulloption: true, default: '', class: 'span2', item_class: 'keepleft' }, + { name: 'ticket_priority_id', display: 'Priority', tag: 'select', multiple: false, null: true, relation: 'TicketPriority', nulloption: true, default: '', class: 'span2', item_class: 'keepleft' }, + { name: 'group_id', display: 'Group', tag: 'select', multiple: false, null: true, relation: 'Group', nulloption: true, class: 'span2', item_class: 'keepleft' }, + { name: 'owner_id', display: 'Owner', tag: 'select', multiple: false, null: true, relation: 'User', filter: @bulk, nulloption: true, class: 'span2', item_class: 'keepleft' }, + ] + form_ticket = @formGen( model: { configure_attributes: @configure_attributes_ticket, className: 'create' } ) + @configure_attributes_article = [ +# { name: 'from', display: 'From', tag: 'input', type: 'text', limit: 100, null: false, class: 'span8', }, + { name: 'to', display: 'To', tag: 'input', type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' }, + { name: 'cc', display: 'Cc', tag: 'input', type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' }, + { name: 'subject', display: 'Subject', tag: 'input', type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' }, + { name: 'in_reply_to', display: 'In Reply to', tag: 'input', type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' }, + { name: 'body', display: 'Text', tag: 'textarea', rows: 4, limit: 100, null: true, class: 'span7', }, + { name: 'ticket_article_type_id', display: 'Type', tag: 'select', multiple: false, null: true, relation: 'TicketArticleType', default: '9', class: 'medium', item_class: 'keepleft' }, + { name: 'internal', display: 'Visability', tag: 'radio', default: false, null: true, options: { true: 'internal', false: 'public' }, class: 'medium', item_class: 'keepleft' }, +# { name: 'ticket_article_sender_id', display: 'Sender', tag: 'select', multiple: false, null: true, relation: 'TicketArticleSender', default: '', class: 'medium' }, + ] + form_article = @formGen( model: { configure_attributes: @configure_attributes_article } ) + + # render init page + html = App.view('agent_ticket_view/bulk')( + meta: @overview.meta, + checkbox: true + form_ticket: form_ticket, +# form_article: form_article, + ) + html = $(html) +# html.delegate('.bulk-action-form', 'submit', (e) => + html.bind('submit', (e) => + e.preventDefault() + @bulk_submit(e) + ) + return html + + bulk_submit: (e) => + @bulk_count = @el.find('.table-overview').find('[name="bulk"]:checked').length + @bulk_count_index = 0 + @el.find('.table-overview').find('[name="bulk"]:checked').each( (index, element) => + @log '@bulk_count_index', @bulk_count, @bulk_count_index + ticket_id = $(element).val() + ticket = App.Ticket.find(ticket_id) + params = @formParam(e.target) + + # update ticket + ticket_update = {} + for item of params + if params[item] != '' + ticket_update[item] = params[item] + +# @log 'update', params, ticket_update, ticket + + ticket.load(ticket_update) + ticket.save( + success: (r) => + @bulk_count_index++ + + # refresh view after all tickets are proceeded + if @bulk_count_index == @bulk_count + + @tickets = [] + + # rebuild navbar with updated ticket count of overviews + Spine.trigger 'navupdate_remote' + + # fetch overview data again + @fetch() + ) + ) + + zoom: (e) => + e.preventDefault() + id = $(e.target).parents('[data-id]').data('id') + @navigate 'ticket/zoom/' + id + + settings: (e) => + e.preventDefault() + new Settings( + overview: App.Overview.find(@overview.id), + view_mode: @view_mode, + ) + +class Settings extends App.ControllerModal + constructor: -> + super + @render() + + render: -> + + @html App.view('dashboard/ticket_settings')( + overview: @overview, + ) + @configure_attributes_article = [ +# { name: 'from', display: 'From', tag: 'input', type: 'text', limit: 100, null: false, class: 'span8', }, +# { name: 'to', display: 'To', tag: 'input', type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' }, +# { name: 'ticket_article_type_id', display: 'Type', tag: 'select', multiple: false, null: true, relation: 'TicketArticleType', default: '9', class: 'medium', item_class: 'keepleft' }, +# { name: 'internal', display: 'Visability', tag: 'radio', default: false, null: true, options: { true: 'internal', false: 'public' }, class: 'medium', item_class: 'keepleft' }, + { + name: 'per_page', + display: 'Items per page', + tag: 'select', + multiple: false, + null: false, + default: @overview.view[@view_mode].per_page, + options: { + 15: 15, + 20: 20, + 25: 25, + 30: 30, + 35: 35, + }, + class: 'medium', +# item_class: 'keepleft', + }, + { + name: 'attributes', + display: 'Attributes', + tag: 'checkbox', + default: @overview.view[@view_mode].overview, + null: false, + options: { +# true: 'internal', +# false: 'public', + number: 'Number', + title: 'Title', + customer: 'Customer', + ticket_state: 'State', + ticket_priority: 'Priority', + group: 'Group', + owner: 'Owner', + created_at: 'Alter', + last_contact: 'Last Contact', + last_contact_agent: 'Last Contact Agent', + last_contact_customer: 'Last Contact Customer', + first_response: 'First Response', + close_time: 'Close Time', + }, + class: 'medium', + }, + { + name: 'order_by', + display: 'Order', + tag: 'select', + default: @overview.order.by, + null: false, + options: { + number: 'Number', + title: 'Title', + customer: 'Customer', + ticket_state: 'State', + ticket_priority: 'Priority', + group: 'Group', + owner: 'Owner', + created_at: 'Alter', + last_contact: 'Last Contact', + last_contact_agent: 'Last Contact Agent', + last_contact_customer: 'Last Contact Customer', + first_response: 'First Response', + close_time: 'Close Time', + }, + class: 'medium', + }, + { + name: 'order_by_direction', + display: 'Direction', + tag: 'select', + default: @overview.order.direction, + null: false, + options: { + ASC: 'up', + DESC: 'down', + }, + class: 'medium', + }, +# { +# name: 'condition', +# display: 'Conditions', +# tag: 'select', +# multiple: false, +# null: false, +# relation: 'TicketArticleType', +# default: '9', +# class: 'medium', +# item_class: 'keepleft', +# }, + ] + form = @formGen( model: { configure_attributes: @configure_attributes_article } ) + + @el.find('.setting').append(form) + + @modalShow() + + submit: (e) => + e.preventDefault() + params = @formParam(e.target) + + # check if refetch is needed + @reload_needed = 0 + if @overview.view[@view_mode]['per_page'] isnt params['per_page'] + @overview.view[@view_mode]['per_page'] = params['per_page'] + @reload_needed = 1 + + if @overview.order['by'] isnt params['order_by'] + @overview.order['by'] = params['order_by'] + @reload_needed = 1 + + if @overview.order['direction'] isnt params['order_by_direction'] + @overview.order['direction'] = params['order_by_direction'] + @reload_needed = 1 + + @overview.view[@view_mode]['overview'] = params['attributes'] + + @overview.save( + success: => + if @reload_needed + @overview.trigger('local:refetch') + else + @overview.trigger('local:rerender') + ) + @modalHide() + +Config.Routes['ticket/view/:view'] = Index diff --git a/app/assets/javascripts/app/controllers/agent_ticket_zoom.js.coffee b/app/assets/javascripts/app/controllers/agent_ticket_zoom.js.coffee new file mode 100644 index 000000000..0601517fc --- /dev/null +++ b/app/assets/javascripts/app/controllers/agent_ticket_zoom.js.coffee @@ -0,0 +1,381 @@ +$ = jQuery.sub() + +class Index extends App.Controller + events: + 'click .submit': 'update', + 'click [data-type=reply]': 'reply', + 'click [data-type=reply-all]': 'replyall', + 'click [data-type=public]': 'public_internal', + 'click [data-type=internal]': 'public_internal', + 'click [data-type=history]': 'history_view', + 'change [name="ticket_article_type_id"]': 'form_update', + + constructor: (params) -> + super + @log 'zoom', params + + # check authentication + return if !@authenticate() + + @navupdate '#' + + @edit_form = undefined +# @render() + @ticket_id = params.ticket_id + @fetch(@ticket_id) + + fetch: (ticket_id) -> + # get data + @ajax = new App.Ajax + @ajax.ajax( + type: 'GET', + url: '/ticket_full/' + ticket_id, + data: { + view: @view + } + processData: true, + success: (data, status, xhr) => + # reset old indexes + @ticket = undefined + @articles = undefined + + # get edit form attributes + @edit_form = data.edit_form + + # load user collection + @loadCollection( type: 'User', data: data.users ) + + # load ticket collection + @loadCollection( type: 'Ticket', data: [data.ticket] ) + + # load article collections + @loadCollection( type: 'TicketArticle', data: data.articles || [] ) + + # render page + @render() + ) + + render: => + + if !App.Ticket.exists(@ticket_id) + return + + # get data + if !@ticket + @ticket = App.Ticket.find(@ticket_id) + if !@articles + @articles = [] + for article_id in @ticket.article_ids + @articles.push App.TicketArticle.find(article_id) + + # check attachments + for article in @articles + if article.attachments + for attachment in article.attachments + attachment.size = @humanFileSize(attachment.size) + + # define actions + for article in @articles + actions = [] + if article.internal is true + actions = [ + { + name: 'set to public', + type: 'public', + } + ] + else + actions = [ + { + name: 'set to internal', + type: 'internal', + } + ] + if article.article_type.name is 'note' +# actions.push [] + else + if article.article_sender.name is 'Customer' + actions.push { + name: 'reply', + type: 'reply', + } + actions.push { + name: 'reply all', + type: 'reply-all', + } + article.actions = actions + + # set title + @title 'Ticket Zoom ' + @ticket.number + + @configure_attributes_ticket = [ + { name: 'ticket_state_id', display: 'State', tag: 'select', multiple: false, null: true, relation: 'TicketState', default: 'new', class: 'span2', item_class: 'keepleft' }, + { name: 'ticket_priority_id', display: 'Priority', tag: 'select', multiple: false, null: true, relation: 'TicketPriority', default: '2 normal', class: 'span2', item_class: 'keepleft' }, + { name: 'group_id', display: 'Group', tag: 'select', multiple: false, null: true, relation: 'Group', class: 'span2', item_class: 'keepleft' }, + { name: 'owner_id', display: 'Owner', tag: 'select', multiple: false, null: true, relation: 'User', filter: @edit_form, nulloption: true, class: 'span2', item_class: 'keepleft' }, + ] + form_ticket = @formGen( model: { configure_attributes: @configure_attributes_ticket, className: 'create' }, params: @ticket ) + @configure_attributes_article = [ +# { name: 'from', display: 'From', tag: 'input', type: 'text', limit: 100, null: false, class: 'span8', }, + { name: 'to', display: 'To', tag: 'input', type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' }, + { name: 'cc', display: 'Cc', tag: 'input', type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' }, + { name: 'subject', display: 'Subject', tag: 'input', type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' }, + { name: 'in_reply_to', display: 'In Reply to', tag: 'input', type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' }, + { name: 'body', display: 'Text', tag: 'textarea', rows: 5, limit: 100, null: true, class: 'span7', }, + { name: 'ticket_article_type_id', display: 'Type', tag: 'select', multiple: false, null: true, relation: 'TicketArticleType', default: '9', class: 'medium', item_class: 'keepleft' }, + { name: 'internal', display: 'Visability', tag: 'radio', default: false, null: true, options: { true: 'internal', false: 'public' }, class: 'medium', item_class: 'keepleft' }, +# { name: 'ticket_article_sender_id', display: 'Sender', tag: 'select', multiple: false, null: true, relation: 'TicketArticleSender', default: '', class: 'medium' }, + ] + form_article = @formGen( model: { configure_attributes: @configure_attributes_article } ) + + @html App.view('agent_ticket_zoom')( + ticket: @ticket, + articles: @articles, + form_ticket: form_ticket, + form_article: form_article, + ) + + @userPopups() + + # start customer info controller + new App.UserInfo( + el: @el.find('#customer_info'), + user_id: @ticket.customer_id, + ticket: @ticket, + ) + + @delay(@u, 200) + + u: => + uploader = new qq.FileUploader( + element: document.getElementById('file-uploader'), + action: 'ticket_attachment_new', + params: { + form: 'TicketZoom', + form_id: @ticket.id, + }, + debug: false + ) + + history_view: (e) -> + e.preventDefault() + new History( ticket_id: @ticket_id ) + + public_internal: (e) -> + e.preventDefault() + article_id = $(e.target).parents('[data-id]').data('id') + + # storage update + article = App.TicketArticle.find(article_id) + internal = true + if article.internal == true + internal = false + + article.updateAttributes( + internal: internal + ) + + # runtime update + for article in @articles + if article_id is article.id + article['internal'] = internal + + @render() + + form_update: (e) -> + ticket_article_type_id = $(e.target).find('option:selected').val() + @log 'eeee', e, ticket_article_type_id + article_type = App.TicketArticleType.find( ticket_article_type_id ) + @form_update_execute(article_type) + + form_update_execute: (article_type) => + if article_type.name is 'twitter status' + + # hide to + @el.find('[name="to"]').parents('.control-group').addClass('hide') + @el.find('[name="cc"]').parents('.control-group').addClass('hide') + @el.find('[name="subject"]').parents('.control-group').addClass('hide') + + else if article_type.name is 'twitter direct-message' + + # show + @el.find('[name="to"]').parents('.control-group').removeClass('hide') + @el.find('[name="cc"]').parents('.control-group').addClass('hide') + @el.find('[name="subject"]').parents('.control-group').addClass('hide') + + else if article_type.name is 'note' + + # hide to + @el.find('[name="to"]').parents('.control-group').addClass('hide') + @el.find('[name="cc"]').parents('.control-group').addClass('hide') + @el.find('[name="subject"]').parents('.control-group').addClass('hide') + + else if article_type.name is 'email' + + # show + @el.find('[name="to"]').parents('.control-group').removeClass('hide') + @el.find('[name="cc"]').parents('.control-group').removeClass('hide') +# @el.find('[name="subject"]').parents('.control-group').removeClass('hide') + + reply: (e) => + e.preventDefault() + article_id = $(e.target).parents('[data-id]').data('id') + article = App.TicketArticle.find( article_id ) + article_type = App.TicketArticleType.find( article.ticket_article_type_id ) + customer = App.User.find( article.created_by_id ) + + @log 'reply', e, article_type + + # update form + @form_update_execute(article_type) + + # preselect article type + @el.find('[name="ticket_article_type_id"]').find('option:selected').removeAttr('selected') + @el.find('[name="ticket_article_type_id"]').find('[value="' + article_type.id + '"]').attr('selected',true) + + # empty form + @el.find('[name="to"]').val('') + @el.find('[name="cc"]').val('') + @el.find('[name="subject"]').val('') + @el.find('[name="in_reply_to"]').val('') + + if article.message_id + @el.find('[name="in_reply_to"]').val(article.message_id) + + if article_type.name is 'twitter status' + + # set to in body + to = customer.accounts['twitter'].username || customer.accounts['twitter'].uid + @log 'c', customer + @el.find('[name="body"]').val('@' + to) + + else if article_type.name is 'twitter direct-message' + + # show to + to = customer.accounts['twitter'].username || customer.accounts['twitter'].uid + @el.find('[name="to"]').val(to) + + else if article_type.name is 'email' + @el.find('[name="to"]').val(article.from) +# @log 'reply ', article, @el.find('[name="to"]') + + update: (e) => + e.preventDefault() + params = @formParam(e.target) + @log 'update', params, @ticket + + # update ticket + ticket_update = {} + for item in @configure_attributes_ticket + ticket_update[item.name] = params[item.name] + + # check owner assignment + if !ticket_update['owner_id'] + ticket_update['owner_id'] = 1 + + @ticket.load( ticket_update ) + @log 'update ticket', ticket_update, @ticket + + # disable form + @formDisable(e) + + @ticket.save( + success: (r) => + + # create article + if params['body'] + article = new App.TicketArticle + params.from = window.Session['firstname'] + ' ' + window.Session['lastname'] + params.ticket_id = @ticket.id + + # find sender_id + sender = App.TicketArticleSender.findByAttribute("name", "Agent") + params.ticket_article_sender_id = sender.id + @log 'updateAttributes', params, sender, sender.id + article.load(params) + article.save( + success: (r) => + @fetch(@ticket.id) + ) + else + @fetch(@ticket.id) + ) + +# errors = article.validate() +# @log 'error new', errors +# @validateForm( form: e.target, errors: errors ) + return false + + +class History extends App.ControllerModal + constructor: -> + super + @fetch(@ticket_id) + + fetch: (@ticket_id) -> + # get data + @ajax = new App.Ajax + @ajax.ajax( + type: 'GET', + url: '/ticket_history/' + ticket_id, + data: { +# view: @view + } +# processData: true, + success: (data, status, xhr) => + # remember ticket + @ticket = data.ticket + + # load user collection + @loadCollection( type: 'User', data: data.users ) + + # load ticket collection + @loadCollection( type: 'Ticket', data: [data.ticket] ) + + # load history_type collections + @loadCollection( type: 'HistoryType', data: data.history_types ) + + # load history_object collections + @loadCollection( type: 'HistoryObject', data: data.history_objects ) + + # load history_attributes collections + @loadCollection( type: 'HistoryAttribute', data: data.history_attributes ) + + # load history collections + App.History.deleteAll() + @loadCollection( type: 'History', data: data.history ) + + # render page + @render() + ) + + render: -> + + + # create table/overview + table = @table( + overview_extended: [ + { name: 'type', }, + { name: 'attribute', }, + { name: 'value_from', }, + { name: 'value_to', }, + { name: 'created_by', class: 'user-data', data: { id: 1 } }, + { name: 'created_at', callback: @humanTime }, + ], + model: App.History, + objects: App.History.all(), + ) + + + @html App.view('agent_ticket_history')( +# head: 'New User', +# form: @formGen( model: App.User, required: 'quick' ), + ) + @el.find('.table_history').append(table) + + @modalShow() + + @userPopups() + +Config.Routes['ticket/zoom/:ticket_id'] = Index +Config.Routes['ticket/zoom/:ticket_id/:article_id'] = Index \ No newline at end of file diff --git a/app/assets/javascripts/app/controllers/channel.js.coffee b/app/assets/javascripts/app/controllers/channel.js.coffee new file mode 100644 index 000000000..f773e90a1 --- /dev/null +++ b/app/assets/javascripts/app/controllers/channel.js.coffee @@ -0,0 +1,26 @@ +$ = jQuery.sub() + +class Index extends App.ControllerLevel2 + toggleable: true + + menu: [ + { name: 'Web', 'target': 'web', controller: App.ChannelWeb }, + { name: 'Mail', 'target': 'email', controller: App.ChannelEmail }, + { name: 'Chat', 'target': 'chat', controller: App.ChannelChat }, + { name: 'Twitter', 'target': 'twitter', controller: App.ChannelTwitter }, + { name: 'Facebook', 'target': 'facebook', controller: App.ChannelFacebook }, + ] + page: { + title: 'Channels', + sub_title: 'Management' + nav: '#channels', + } + + constructor: -> + super + + # render page + @render() + +Config.Routes['channels'] = Index + diff --git a/app/assets/javascripts/app/controllers/dashboard.js.coffee b/app/assets/javascripts/app/controllers/dashboard.js.coffee new file mode 100644 index 000000000..51e2d12b3 --- /dev/null +++ b/app/assets/javascripts/app/controllers/dashboard.js.coffee @@ -0,0 +1,60 @@ +$ = jQuery.sub() + +class Index extends App.Controller + + constructor: -> + super + + # check authentication + return if !@authenticate() + + # set title + @title 'Dashboard' + @navupdate '#/' + + @plugins = { + main: { + my_assigned: { + controller: App.DashboardTicket, + params: { + view: 'my_assigned', + }, + }, + all_unassigned: { + controller: App.DashboardTicket, + params: { + view: 'all_unassigned', + }, + }, + }, + side: { + activity_stream: { + controller: App.DashboardActivityStream, + }, + recent_viewed: { + controller: App.DashboardRecentViewed, + } + } + } + + # render page + @render() + + render: -> + + @html App.view('dashboard')( + head: 'Dashboard' + ) + + for area, plugins of @plugins + for name, plugin of plugins + target = area + '_' + name + @el.find('.' + area + '-overviews').append('
') + if plugin.controller + params = plugin.params || {} + params.el = @el.find( '#' + target ) + new plugin.controller( params ) + + +Config.Routes[''] = Index +Config.Routes['/'] = Index diff --git a/app/assets/javascripts/app/controllers/getting_started.js.coffee b/app/assets/javascripts/app/controllers/getting_started.js.coffee new file mode 100644 index 000000000..f9b4398a7 --- /dev/null +++ b/app/assets/javascripts/app/controllers/getting_started.js.coffee @@ -0,0 +1,74 @@ +$ = jQuery.sub() + +class Index extends App.Controller + className: 'container getstarted' + + events: + 'submit form': 'submit', + 'click .submit': 'submit', + + constructor: -> + super + + # check authentication + return if !@authenticate() + + # set title + @title 'Get Started' + + @render() + + @navupdate '#get_started' + + render: -> + @html App.view('getting_started')( + form: @formGen( model: App.User, required: 'invite_agent' ), + ) + + cancel: -> + @log 'cancel....' + @navigate 'login' + + submit: (e) -> + @log 'submit' + e.preventDefault() + @params = @formParam(e.target) + + # if no login is given, use emails as fallback + if !@params.login && @params.email + @params.login = @params.email + + # find agent role + role = App.Role.findByAttribute("name", "Agent") + @params.role_ids = role.id + + # set invite flag + @params.invite = true + + @log 'updateAttributes', @params + user = new App.User + user.load(@params) + + errors = user.validate() + if errors + @log 'error new', errors + @validateForm( form: e.target, errors: errors ) + return false + + # save user + user.save( + success: (r) => + # send email + + # clear form + @render() +# error: => +# @modalHide() + ) + +Config.Routes['getting_started'] = Index + +#class App.GetStarted extends App.Router +# routes: +# 'getting_started': Index +#Config.Controller.push App.GetStarted; \ No newline at end of file diff --git a/app/assets/javascripts/app/controllers/groups.js.coffee b/app/assets/javascripts/app/controllers/groups.js.coffee new file mode 100644 index 000000000..69e433906 --- /dev/null +++ b/app/assets/javascripts/app/controllers/groups.js.coffee @@ -0,0 +1,37 @@ +$ = jQuery.sub() + +class Index extends App.Controller + constructor: -> + super + + # check authentication + return if !@authenticate() + + new App.ControllerGenericIndex( + el: @el, + id: @id, + genericObject: App.Group, + pageData: { + title: 'Groups', + home: 'groups', + object: 'Group', + objects: 'Groups', + navupdate: '#groups', + notes: [ + 'Groups are ...' + ], + buttons: [ + { name: 'New Group', 'data-type': 'new', class: 'primary' }, + ], + }, + ) + + +Config.Routes['groups'] = Index + +#class App.Groups extends App.Router +# routes: +# 'groups/new': New +# 'groups/:id/edit': Edit +# 'groups': Index +#Config.Controller.push App.Groups \ No newline at end of file diff --git a/app/assets/javascripts/app/controllers/login.js.coffee b/app/assets/javascripts/app/controllers/login.js.coffee new file mode 100644 index 000000000..62613a4dc --- /dev/null +++ b/app/assets/javascripts/app/controllers/login.js.coffee @@ -0,0 +1,97 @@ +$ = jQuery.sub() +Note = App.Note + +$.fn.item = -> + elementID = $(@).data('id') + elementID or= $(@).parents('[data-id]').data('id') + Note.find(elementID) + +class Index extends App.Controller + events: + 'submit #login': 'login', + 'click #register': 'register' + + constructor: -> + super + @title 'Sign in' + @render() + @navupdate '#login' + + render: (data = {}) -> + @html App.view('login')(item: data) + if $(@el).find('[name="username"]').val() + $(@el).find('[name="username"]').focus() + + login: (e) -> + e.preventDefault() + e.stopPropagation(); + + @log 'submit', $(e.target) + @username = $(e.target).find('[name="username"]').val() + @password = $(e.target).find('[name="password"]').val() +# @log @username, @password + + # session create with login/password + auth = new App.Auth + auth.login( + data: { + username: @username, + password: @password, + }, + success: @success + error: @error, + ) + + success: (data, status, xhr) => + @log 'login:success', data + + # set avatar + if !data.session.image + data.session.image = 'http://placehold.it/48x48' + + # update config + for key, value of data.config + window.Config[key] = value + + # store user data + for key, value of data.session + window.Session[key] = value + + # refresh default collections + for key, value of data.default_collections + App[key].refresh( value, options: { clear: true } ) + + Spine.trigger 'navrebuild', data.session + + # add notify + Spine.trigger 'notify:removeall' + Spine.trigger 'notify', { + type: 'success', + msg: 'Login successfully! Have a nice day!', + } + + # redirect to # + @navigate '#/' + + error: (xhr, statusText, error) => + console.log 'login:error' + + # add notify + Spine.trigger 'notify:removeall' + Spine.trigger 'notify', { + type: 'warning', + msg: 'Wrong Username and Password combination.', + } + + # rerender login page + @render( + msg: 'Wrong Username and Password combination.', + username: @username + ) + +Config.Routes['login'] = Index + +#class App.Login extends App.Router +# routes: +# 'login': Index +#Config.Controller.push App.Login \ No newline at end of file diff --git a/app/assets/javascripts/app/controllers/logout.js.coffee b/app/assets/javascripts/app/controllers/logout.js.coffee new file mode 100644 index 000000000..6852a877b --- /dev/null +++ b/app/assets/javascripts/app/controllers/logout.js.coffee @@ -0,0 +1,30 @@ +$ = jQuery.sub() + +class Index extends Spine.Controller + + constructor: -> + super + + @signout() + + signout: -> + + # remove remote session + auth = new App.Auth + auth.logout() + + # remoce local session + @log 'Session', window.Session + window.Session = {} + @log 'Session', window.Session + Spine.trigger 'navrebuild' + + # redirect to login + @navigate 'login' + +Config.Routes['logout'] = Index + +#class App.Logout extends App.Router +# routes: +# 'logout': Index +#Config.Controller.push App.Logout \ No newline at end of file diff --git a/app/assets/javascripts/app/controllers/navigation.js.coffee b/app/assets/javascripts/app/controllers/navigation.js.coffee new file mode 100644 index 000000000..c877725be --- /dev/null +++ b/app/assets/javascripts/app/controllers/navigation.js.coffee @@ -0,0 +1,169 @@ +$ = jQuery.sub() +Note = App.Note + +$.fn.item = -> + elementID = $(@).data('id') + elementID or= $(@).parents('[data-id]').data('id') + Note.find(elementID) + +class App.Navigation extends Spine.Controller + events: + 'focusin [data-type=edit]': 'edit_in' + + constructor: -> + super + @log 'nav...' + @render() + + Spine.bind 'navupdate', (data) => + @update(arguments[0]) + + Spine.bind 'navrebuild', (user) => + @log 'navbarrebuild', user + @render(user) + + Spine.bind 'navupdate_remote', (user) => + @log 'navupdate_remote' + @sync + + # rerender if new overview data is there + @delay( @sync, 1800 ) + + render: (user) -> +# @log 'nav render', Config.NavBar +# @log '111', _.keys(Config.NavBar) + navbar = _.values(Config.NavBar) + + level1 = [] + dropdown = {} + + for item in navbar + if !item.parent + match = 0 + if !window.Session['roles'] + match = _.include(item.role, 'Anybody') + if window.Session['roles'] + window.Session['roles'].forEach( (role) => + if !match + match = _.include(item.role, role.name) + ) + + if match + level1.push item + + for item in navbar + if item.parent && !dropdown[ item.parent ] + dropdown[ item.parent ] = [] + + # find all childs and order + for itemSub in navbar + if itemSub.parent is item.parent + match = 0 + if !window.Session['roles'] + match = _.include(itemSub.role, 'Anybody') + if window.Session['roles'] + window.Session['roles'].forEach( (role) => + if !match + match = _.include(itemSub.role, role.name) + ) + + if match + dropdown[ item.parent ].push itemSub + + # find parent + for itemLevel1 in level1 + if itemLevel1.target is item.parent + sub = @getOrder(dropdown[ item.parent ]) + itemLevel1.child = sub + + nav = @getOrder(level1) + @html App.view('navigation')( + navbar: nav, + user: user, + ) + + getOrder: (data) -> + newlist = {} + for item in data + # check if same prio already exists + @addPrioCount newlist, item + + newlist[ item['prio'] ] = item; + + # get keys for sort order + keys = _.keys(newlist) + inorder = keys.sort(@sortit) + + # create new array with prio sort order + inordervalue = [] + for num in inorder + inordervalue.push newlist[ num ] + return inordervalue + + sortit: (a,b) -> + return(a-b) + + addPrioCount: (newlist, item) -> + if newlist[ item['prio'] ] + item['prio']++ + if newlist[ item['prio'] ] + @addPrioCount newlist, item + + update: (url) => + @el.find('li').removeClass('active') +# if url isnt '#' + @el.find("[href=\"#{url}\"]").parents('li').addClass('active') +# @el.find("[href*=\"#{url}\"]").parents('li').addClass('active') + + sync: => + + @ticket_overview() + + # auto save + every = (ms, cb) -> setInterval cb, ms + + # clear auto save + clearInterval(@intervalID) if @intervalID + + # request new data + @intervalID = every 40000, () => + @ticket_overview() + + # get data + ticket_overview: => + + # do no load and rerender if sub-menu is open + open = @el.find('.open').val() + if open isnt undefined + return + + # do no load and rerender if user is not logged in + if !window.Session['id'] + return + + @ajax = new App.Ajax + @ajax.ajax( + type: 'GET', + url: '/ticket_overviews', + data: {}, + processData: true, + success: (data, status, xhr) => + + # remove old views + for key of Config.NavBar + if Config.NavBar[key].parent is '#ticket/view' + delete Config.NavBar[key] + + # add new views + for item in data + Config.NavBar['TicketOverview' + item.url] = { + prio: item.prio, + parent: '#ticket/view', + name: item.name + ' (' + item.count + ')', + target: '#ticket/view/' + item.url, + role: ['Agent'], + } + + # rebuild navbar + Spine.trigger 'navrebuild', window.Session + ) diff --git a/app/assets/javascripts/app/controllers/network.js.coffee b/app/assets/javascripts/app/controllers/network.js.coffee new file mode 100644 index 000000000..bc09a0f41 --- /dev/null +++ b/app/assets/javascripts/app/controllers/network.js.coffee @@ -0,0 +1,71 @@ +$ = jQuery.sub() +Note = App.Note + +$.fn.item = -> + elementID = $(@).data('id') + elementID or= $(@).parents('[data-id]').data('id') + Note.find(elementID) + +class Index extends App.Controller + events: + 'click [data-type=network-new]': 'network_new' + 'click [data-type=network-edit]': 'network_edit' + 'click [data-type=network-destroy]': 'network_destory' + 'click [data-type=network-category-new]': 'network_category_new' + 'click [data-type=network-category-edit]': 'network_category_edit' + 'click [data-type=network-category-destroy]': 'network_category_destroy' + + constructor: -> + super + + # set title + @title 'Network' + @render() + @navupdate '#network' + + render: -> + networks = App.Network.all() + network_categories = App.NetworkCategory.all() + for network in networks + @log 'f', network for network in networks + + for network_category in network_categories + @log 'fc', network_category + + @html App.view('network')( + networks: App.Network.all(), + ) + + network_new: (e) -> + e.preventDefault() + new App.ControllerGenericNewWindow( + pageData: { + object: 'Network', + }, + genericObject: App.Network, + success: => + @render() + ) + + network_edit: (e) -> + e.preventDefault() + @id = $(e.target).parents('[data-id]').data('id') + new App.ControllerGenericEditWindow( + id: @id, + pageData: { + object: 'Network', + }, + genericObject: App.Network, + success: => + @render() + ) + + network_destory: (e) -> + e.preventDefault() + id = $(e.target).parents('[data-id]').data('id') + item = App.Network.find(id) + item.destroy() if confirm('Sure?') + @render() + + +Config.Routes['network'] = Index diff --git a/app/assets/javascripts/app/controllers/notify.js.coffee b/app/assets/javascripts/app/controllers/notify.js.coffee new file mode 100644 index 000000000..4376ac0c8 --- /dev/null +++ b/app/assets/javascripts/app/controllers/notify.js.coffee @@ -0,0 +1,44 @@ +$ = jQuery.sub() +#Post = App.Post + +class App.Notify extends Spine.Controller + events: + 'click .alert': 'destroy' + + className: 'container' + + constructor: -> + super + + Spine.bind 'notify', (data) => +# @log 'bind notify', data + @[data.type] data.msg + + Spine.bind 'notify:removeall', => + @log 'notify:removeall', @ + @destroyAll() + + info: (data) -> + @render( text: arguments[0], type: 'alert-info' ) + + warning: (data) -> + @render( text: arguments[0], type: 'alert-warning' ) + + error: (data) -> + @render( text: arguments[0], type: 'alert-error' ) + + success: (data) -> + @render( text: arguments[0], type: 'alert-success' ) + + render: (data) -> + notify = App.view('notify')(data: data) + @append( notify ) +# notify.html('') + + destroy: (e) -> + e.preventDefault() + $(e.target).parents('.alert').remove(); + + destroyAll: -> + $(@el).find('.alert').remove(); + diff --git a/app/assets/javascripts/app/controllers/organizations.js.coffee b/app/assets/javascripts/app/controllers/organizations.js.coffee new file mode 100644 index 000000000..572f148d5 --- /dev/null +++ b/app/assets/javascripts/app/controllers/organizations.js.coffee @@ -0,0 +1,65 @@ +$ = jQuery.sub() + +class Index extends App.Controller + constructor: -> + super + + # check authentication + return if !@authenticate() + + new App.ControllerGenericIndex( + el: @el, + id: @id, + genericObject: App.Organization, + pageData: { + title: 'Organizations', + home: 'organizations', + object: 'Organization', + objects: 'Organizations', + navupdate: '#organizations', + notes: [ + 'Organizations are for any person in the system. Agents (Owners, Resposbiles, ...) and Customers.' + ], + buttons: [ + { name: 'New Organization', 'data-type': 'new', class: 'primary' }, + ], + }, + ) + +#Config.Routes['organizations/new'] = New +#Config.Routes['organizations/:id/edit'] = Edit +Config.Routes['organizations'] = Index + + +Config.NavBar['Admin'] = { prio: 10000, parent: '', name: 'Manage', target: '#admin', role: ['Admin'] } +Config.NavBar['AdminUser'] = { prio: 1000, parent: '#admin', name: 'Users', target: '#users', role: ['Admin'] } +Config.NavBar['AdminGroup'] = { prio: 1500, parent: '#admin', name: 'Groups', target: '#groups', role: ['Admin'] } +Config.NavBar['AdminOrganization'] = { prio: 2000, parent: '#admin', name: 'Organizations', target: '#organizations', role: ['Admin'] } +Config.NavBar['AdminChannels'] = { prio: 2500, parent: '#admin', name: 'Channels', target: '#channels', role: ['Admin'] } +Config.NavBar['AdminTrigger'] = { prio: 3000, parent: '#admin', name: 'Trigger', target: '#trigger', role: ['Admin'] } +Config.NavBar['AdminScheduler'] = { prio: 3500, parent: '#admin', name: 'Scheduler', target: '#scheduler', role: ['Admin'] } + + +Config.NavBar['Note'] = { prio: 1500, parent: '', name: 'Notes', target: '#notes', role: ['Notes'] } +#Config.NavBar['Post'] = { prio: 1600, parent: '', name: 'Posts', target: '#posts', role: ['Agent'] } + +Config.NavBar['Setting'] = { prio: 20000, parent: '', name: 'Settings', target: '#settings', role: ['Admin'] } +Config.NavBar['SettingSystem'] = { prio: 1400, parent: '#settings', name: 'System', target: '#settings/system', role: ['Admin'] } +Config.NavBar['SettingSecurity'] = { prio: 1500, parent: '#settings', name: 'Security', target: '#settings/security', role: ['Admin'] } +Config.NavBar['SettingTicket'] = { prio: 1600, parent: '#settings', name: 'Ticket', target: '#settings/ticket', role: ['Admin'] } +Config.NavBar['SettingObject'] = { prio: 1700, parent: '#settings', name: 'Objects', target: '#settings/objects', role: ['Admin'] } + +Config.NavBar['Packages'] = { prio: 1800, parent: '#settings', name: 'Packages', target: '#packages', role: ['Admin'] } + + +Config.NavBar['TicketOverview'] = { prio: 1000, parent: '', name: 'Overviews', target: '#ticket/view', role: ['Agent'] } +#Config.NavBar[''] = { prio: 1000, parent: '#ticket/view', name: 'My assigned Tickets (51)', target: '#ticket/view/my_assigned', role: ['Agent'] } +#Config.NavBar[''] = { prio: 1000, parent: '#ticket/view', name: 'Unassigned Tickets (133)', target: '#ticket/view/all_unassigned', role: ['Agent'] } +#Config.NavBar[''] = { prio: 1000, parent: '#ticket/view', name: 'Escalated Tickets (0)', target: '#ticket/view/all_escalated', role: ['Agent'] } +#Config.NavBar[''] = { prio: 1000, parent: '#ticket/view', name: 'My Pending reached Tickets (2)', target: '#ticket/view/my_pending_reached', role: ['Agent'] } + + +#Config.NavBar['Network'] = { prio: 1500, parent: '', name: 'Networking', target: '#network', role: ['Anybody', 'Customer', 'Agent'] } +#Config.NavBar[''] = { prio: 1600, parent: '', name: 'anybody+agent', target: '#aa', role: ['Anybody', 'Agent'] } +#Config.NavBar[''] = { prio: 1600, parent: '', name: 'Anybody', target: '#anybody', role: ['Anybody'] } +Config.NavBar['CustomerTickets'] = { prio: 1600, parent: '', name: 'Tickets', target: '#customer_tickets', role: ['Customer'] } diff --git a/app/assets/javascripts/app/controllers/profile.js.coffee b/app/assets/javascripts/app/controllers/profile.js.coffee new file mode 100644 index 000000000..2211f0ffa --- /dev/null +++ b/app/assets/javascripts/app/controllers/profile.js.coffee @@ -0,0 +1,32 @@ +$ = jQuery.sub() +Note = App.Note + +$.fn.item = -> + elementID = $(@).data('id') + elementID or= $(@).parents('[data-id]').data('id') + Note.find(elementID) + +class Index extends App.Controller + events: + 'focusin [data-type=edit]': 'edit_in' + + constructor: -> + super + + # set title + @title 'Profile' + + @render() + + @navupdate '#profile' + + + render: -> + @html App.view('profile')() + +Config.Routes['profile'] = Index + +#class App.Profile extends App.Router +# routes: +# 'profile': Index +#Config.Controller.push App.Profile \ No newline at end of file diff --git a/app/assets/javascripts/app/controllers/scheduler.js.coffee b/app/assets/javascripts/app/controllers/scheduler.js.coffee new file mode 100644 index 000000000..59f0d973a --- /dev/null +++ b/app/assets/javascripts/app/controllers/scheduler.js.coffee @@ -0,0 +1,23 @@ +$ = jQuery.sub() + +class Index extends App.Controller + constructor: -> + super + + # check authentication + return if !@authenticate() + + # set title + @title 'Scheduler' + @navupdate '#scheduler' + + # render page + @render() + + render: -> + + @html App.view('scheduler')( + head: 'some header' + ) +Config.Routes['scheduler'] = Index + diff --git a/app/assets/javascripts/app/controllers/settings.js.coffee b/app/assets/javascripts/app/controllers/settings.js.coffee new file mode 100644 index 000000000..8e32f73ec --- /dev/null +++ b/app/assets/javascripts/app/controllers/settings.js.coffee @@ -0,0 +1,55 @@ +$ = jQuery.sub() + +class Index extends App.ControllerLevel2 + toggleable: false + toggleable: true + + constructor: -> + super + + # system + if @type is 'system' + @menu = [ + { name: 'Base', 'target': 'base', controller: App.SettingsArea, params: { area: 'System::Base' } }, + # { name: 'Language', 'target': 'language', controller: App.SettingsSystem, params: { area: 'System::Language' } }, + # { name: 'Log', 'target': 'log', controller: App.SettingsSystem, params: { area: 'System::Log' } }, + { name: 'Storage', 'target': 'storage', controller: App.SettingsArea, params: { area: 'System::Storage' } }, + ] + @page = { + title: 'System', + sub_title: 'Settings' + nav: '#settings/system', + } + + # security + if @type is 'security' + @menu = [ + { name: 'Authentication', 'target': 'auth', controller: App.SettingsArea, params: { area: 'Security::Authentication' } }, + { name: 'Password', 'target': 'password', controller: App.SettingsArea, params: { area: 'Security::Password' } }, +# { name: 'Session', 'target': 'session', controller: '' }, + ] + @page = { + title: 'Security', + sub_title: 'Settings' + nav: '#settings/security', + } + + # ticket + if @type is 'ticket' + @menu = [ + { name: 'Base', 'target': 'base', controller: App.SettingsArea, params: { area: 'Ticket::Base' } }, + { name: 'Number', 'target': 'number', controller: App.SettingsArea, params: { area: 'Ticket::Number' } }, + { name: 'Sender Format', 'target': 'sender-format', controller: App.SettingsArea, params: { area: 'Ticket::SenderFormat' } }, + ] + @page = { + title: 'Ticket', + sub_title: 'Settings' + nav: '#settings/ticket', + } + + # render page + @render() + +Config.Routes['settings/:type/:target'] = Index +Config.Routes['settings/:type'] = Index + diff --git a/app/assets/javascripts/app/controllers/signup.js.coffee b/app/assets/javascripts/app/controllers/signup.js.coffee new file mode 100644 index 000000000..73e99dea8 --- /dev/null +++ b/app/assets/javascripts/app/controllers/signup.js.coffee @@ -0,0 +1,121 @@ +$ = jQuery.sub() +User = App.User + +class Index extends App.Controller + className: 'container signup' + + events: + 'submit form': 'submit', + 'click .submit': 'submit', + 'click .cancel': 'cancel', + + constructor: -> + super + + # set title + @title 'Sign up' + + @render() + + @navupdate '#signup' + + + render: -> + + # set password as required + for item in User.configure_attributes + if item.name is 'password' + item.null = false + + @html App.view('signup')( + form: @formGen( model: User, required: 'signup' ), + ) + + cancel: -> + @log 'cancel....' + @navigate 'login' + + submit: (e) -> + @log 'submit' + e.preventDefault() + @params = @formParam(e.target) + ### + for num in [1..199] + user = new User + params.login = 'login_c' + num + user.updateAttributes(params) + return false + ### + + # if no login is given, use emails as fallback + if !@params.login && @params.email + @params.login = @params.email + +# role = App.Role.findByAttribute("name", "Customer") +# @params.role_ids = role.id +# @params.role_ids = 3 + @params.role_ids = [] + @log 'updateAttributes', @params + user = new User + user.load(@params) + + errors = user.validate() + if errors + @log 'error new', errors + @validateForm( form: e.target, errors: errors ) + return false + + # save user + user.save( + success: (r) => + auth = new App.Auth + auth.login( + data: { + username: @params.login, + password: @params.password, + }, + success: @success + error: @error, + ) +# error: => +# @modalHide() + ) + + success: (data, status, xhr) => + @log 'login:success', data + + # login check + auth = new App.Auth + auth.loginCheck() + + # add notify + Spine.trigger 'notify:removeall' + @notify + type: 'success', + msg: 'Thanks for joining. Email sent to "' + @params.email + '". Please verify your email address.' + + # redirect to # + @navigate '#' + + error: (xhr, statusText, error) => + console.log 'login:error' + + # add notify + Spine.trigger 'notify:removeall' + Spine.trigger 'notify', { + type: 'warning', + msg: 'Wrong Username and Password combination.', + } + + # rerender login page + @render( + msg: 'Wrong Username and Password combination.', + username: @username + ) + +Config.Routes['signup'] = Index + +#class App.SignUp extends App.Router +# routes: +# 'signup': Index +#Config.Controller.push App.SignUp \ No newline at end of file diff --git a/app/assets/javascripts/app/controllers/trigger.js.coffee b/app/assets/javascripts/app/controllers/trigger.js.coffee new file mode 100644 index 000000000..612cf01a6 --- /dev/null +++ b/app/assets/javascripts/app/controllers/trigger.js.coffee @@ -0,0 +1,34 @@ +$ = jQuery.sub() + +class Index extends App.Controller + constructor: -> + super + + # check authentication + return if !@authenticate() + + # set title + @title 'Triggers' + @navupdate '#trigger' + + # render page + @render() + + render: -> + + @html App.view('trigger')( + head: 'some header' + ) +Config.Routes['trigger'] = Index + +#class App.Triggers extends App.Router +# routes: +# 'triggers/web': New +# 'triggers/email': New +# 'triggers/twitter': New +# 'triggers/facebook': New +# 'triggers/new': New +# 'triggers/:id/edit': Edit +# 'triggers': Index +# +#Config.Controller.push App.Triggers \ No newline at end of file diff --git a/app/assets/javascripts/app/controllers/user_info.js.coffee b/app/assets/javascripts/app/controllers/user_info.js.coffee new file mode 100644 index 000000000..042103a12 --- /dev/null +++ b/app/assets/javascripts/app/controllers/user_info.js.coffee @@ -0,0 +1,68 @@ +$ = jQuery.sub() + +class App.UserInfo extends App.Controller + events: + 'focusout [data-type=edit]': 'update', + + constructor: -> + super + + # fetch item on demand + fetch_needed = 1 + if App.User.exists(@user_id) + @user = App.User.find(@user_id) + @log 'exists', @user + fetch_needed = 0 + @render() + + if fetch_needed + @reload(@user_id) + + reload: (user_id) => + App.User.bind 'refresh', => + @log 'loading....', user_id + @user = App.User.find(user_id) + @render() + App.User.unbind 'refresh' + App.User.fetch( id: user_id ) + + render: -> + + # define links to linked accounts + if @user['accounts'] + for account of @user['accounts'] + if account == 'twitter' + @user['accounts'][account]['link'] = 'http://twitter.com/' + @user['accounts'][account]['username'] + if account == 'facebook' + @user['accounts'][account]['link'] = 'https://www.facebook.com/profile.php?id=' + @user['accounts'][account]['uid'] + + # set default image url + if !@user.image + @user.image = 'http://placehold.it/48x48' + + # get display data + data = [] + for item in App.User.configure_attributes + if item.name isnt 'firstname' + if item.name isnt 'lastname' + if item.info #&& ( @user[item.name] || item.name isnt 'note' ) + data.push item + + # insert data + @html App.view('user_info')( + user: @user, + data: data, + ) + + @userTicketPopups( + selector: '.user-tickets', + user_id: @user.id, + ) + + update: (e) => + + # update changes + note = $(e.target).parent().find('[data-type=edit]').val() + if @user.note isnt note + @user.updateAttributes( note: note ) + @log 'update', e, note, @user diff --git a/app/assets/javascripts/app/controllers/users.js.coffee b/app/assets/javascripts/app/controllers/users.js.coffee new file mode 100644 index 000000000..22170ac7b --- /dev/null +++ b/app/assets/javascripts/app/controllers/users.js.coffee @@ -0,0 +1,39 @@ +$ = jQuery.sub() + +class Index extends App.Controller + constructor: -> + super + + # check authentication + return if !@authenticate() + + new App.ControllerGenericIndex( + el: @el, + id: @id, + genericObject: App.User, + ignoreObjectIDs: [1], + pageData: { + title: 'Users', + home: 'users', + object: 'User', + objects: 'Users', + navupdate: '#users', + notes: [ + 'Users are for any person in the system. Agents (Owners, Resposbiles, ...) and Customers.' + ], + buttons: [ +# { name: 'List', 'data-type': '', class: 'active' }, + { name: 'New User', 'data-type': 'new', class: 'primary' }, + ], + } + ) + +Config.Routes['users'] = Index + +#class App.Users extends App.Router +# routes: +# 'users/new': New +# 'users/:id/edit': Edit +# 'users': Index +# +#Config.Controller.push App.Users diff --git a/app/assets/javascripts/app/index.js.coffee b/app/assets/javascripts/app/index.js.coffee new file mode 100644 index 000000000..6f137d4f1 --- /dev/null +++ b/app/assets/javascripts/app/index.js.coffee @@ -0,0 +1,195 @@ +#s#= require json2 +#= require jquery + +#= require ./lib/spine/spine.coffee +#= require ./lib/spine/ajax.coffee +#= require ./lib/spine/route.coffee +#not_userd= require ./lib/spine/manager.coffee + +#= require ./lib/bootstrap-dropdown.js +#= require ./lib/bootstrap-tooltip.js +#= require ./lib/bootstrap-popover.js +#= require ./lib/bootstrap-modal.js +#= require ./lib/bootstrap-tab.js + +#= require ./lib/underscore.coffee +#= require ./lib/ba-linkify.js +#= require ./lib/ui/jquery.ui.core.js +#= require ./lib/ui/jquery.ui.widget.js +#= require ./lib/ui/jquery.ui.position.js +#= require ./lib/ui/jquery.ui.autocomplete.js +#not_used= require_tree ./lib/uis +#not_used= require ./lib/jquery.autocomplete.js +#= require ./lib/jquery.tagsinput.js +#= require ./lib/fileuploader.js + +#not_used= require_tree ./lib +#= require_self +#= require_tree ./models +#= require_tree ./controllers +#= require_tree ./views + +class App extends Spine.Controller + @view: (name) -> + JST["app/views/#{name}"] + +### +class App.Config extends Spine.Module + constructor: -> + super + @config = {} + + set: (key, value) => + @config[key] = value + + get: (key) => + @config[key] + + append: (key, value) => + if !@config[key] + @config[key] = [] + + @config[key].push = value + + +Config2 = new App.Config +Config2.set( 'a', 123) +console.log '1112222', Config2.get( 'a') +### + +class App.Ajax + defaults: + contentType: 'application/json' + dataType: 'json' + processData: false + headers: {'X-Requested-With': 'XMLHttpRequest'} + cache: false + + ajax: (params, defaults) -> + $.ajax($.extend({}, @defaults, defaults, params)) + +class App.Auth extends App.Ajax + constructor: -> + console.log 'auth' + + login: (params) -> + console.log 'login(...)', params + @ajax( +# params, + type: 'POST', + url: '/signin', + data: JSON.stringify(params.data), + success: params.success, + error: params.error, + ) + + loginCheck: -> + console.log 'loginCheck(...)' + @ajax( + async: false, + type: 'GET', + url: '/signshow', + success: (data, status, xhr) => + console.log 'logincheck:success', data + + # set avatar + if !data.session.image + data.session.image = 'http://placehold.it/48x48' + + # update config + for key, value of data.config + window.Config[key] = value + + # store user data + for key, value of data.session + window.Session[key] = value + + # refresh/load default collections + for key, value of data.default_collections + App[key].refresh( value, options: { clear: true } ) + + # rebuild navbar with new navbar items + Spine.trigger 'navrebuild', data.session + + # rebuild navbar with updated ticket count of overviews + Spine.trigger 'navupdate_remote' + + + error: (xhr, statusText, error) => + console.log 'loginCheck:error'#, error, statusText, xhr.statusCode + + # empty session + window.Session = {} + + ) + + logout: -> + console.log 'logout(...)' + @ajax( + type: 'DELETE', + url: '/signout', + ) + +class App.Run extends Spine.Controller + constructor: -> + super + @log 'RUN app'#, @ + @el = $('#app') + + # start navigation controller + new App.Navigation( el: @el.find('#navigation') ); + + # check if session already exists/try to get session data from server + auth = new App.Auth + auth.loginCheck() + + # start notify controller + new App.Notify( el: @el.find('#notify') ); + + # start content + new App.Content( el: @el.find('#content') ); + + +#class App.Content extends Spine.Stack +class App.Content extends Spine.Controller + className: 'container' + + constructor: -> +# @controllers = {} +# @routes = {} +# @default = '/' +# for route, controller of Config.Routes +## @log 'route,controller', route, controller +# @controllers[route] = controller +# @routes[route] = route + + super + @log 'RUN content'#, @ + + for route, callback of Config.Routes +# @log 'route,controller', route#, controller + do (route, callback) => + @route(route, (params) -> +# @log 'routing...', route + Config['ActiveController'] = route + + # unbind in controller area + @el.unbind() + @el.undelegate() + + params.el = @el + params.auth = @auth + new callback( params ) + + # scroll to top +# window.scrollTo(0,0) + ) + +# for name, object of Config.Controller +## @log 'new', object, @el +# new object( el: @el, auth: @auth ) + + Spine.Route.setup() + +window.App = App + diff --git a/app/assets/javascripts/app/lib/.gitkeep b/app/assets/javascripts/app/lib/.gitkeep new file mode 100644 index 000000000..e69de29bb diff --git a/app/assets/javascripts/app/lib/ba-linkify.js b/app/assets/javascripts/app/lib/ba-linkify.js new file mode 100644 index 000000000..293dd67af --- /dev/null +++ b/app/assets/javascripts/app/lib/ba-linkify.js @@ -0,0 +1,179 @@ +/*! + * linkify - v0.3 - 6/27/2009 + * http://benalman.com/code/test/js-linkify/ + * + * Copyright (c) 2009 "Cowboy" Ben Alman + * Licensed under the MIT license + * http://benalman.com/about/license/ + * + * Some regexps adapted from http://userscripts.org/scripts/review/7122 + */ + +// Turn text into linkified html. +// +// var html = linkify( text, options ); +// +// options: +// +// callback (Function) - default: undefined - if defined, this will be called +// for each link- or non-link-chunk with two arguments, text and href. If the +// chunk is non-link, href will be omitted. +// +// punct_regexp (RegExp | Boolean) - a RegExp that can be used to trim trailing +// punctuation from links, instead of the default. +// +// This is a work in progress, please let me know if (and how) it fails! + +window.linkify = (function(){ + var + SCHEME = "[a-z\\d.-]+://", + IPV4 = "(?:(?:[0-9]|[1-9]\\d|1\\d{2}|2[0-4]\\d|25[0-5])\\.){3}(?:[0-9]|[1-9]\\d|1\\d{2}|2[0-4]\\d|25[0-5])", + HOSTNAME = "(?:(?:[^\\s!@#$%^&*()_=+[\\]{}\\\\|;:'\",.<>/?]+)\\.)+", + TLD = "(?:ac|ad|aero|ae|af|ag|ai|al|am|an|ao|aq|arpa|ar|asia|as|at|au|aw|ax|az|ba|bb|bd|be|bf|bg|bh|biz|bi|bj|bm|bn|bo|br|bs|bt|bv|bw|by|bz|cat|ca|cc|cd|cf|cg|ch|ci|ck|cl|cm|cn|coop|com|co|cr|cu|cv|cx|cy|cz|de|dj|dk|dm|do|dz|ec|edu|ee|eg|er|es|et|eu|fi|fj|fk|fm|fo|fr|ga|gb|gd|ge|gf|gg|gh|gi|gl|gm|gn|gov|gp|gq|gr|gs|gt|gu|gw|gy|hk|hm|hn|hr|ht|hu|id|ie|il|im|info|int|in|io|iq|ir|is|it|je|jm|jobs|jo|jp|ke|kg|kh|ki|km|kn|kp|kr|kw|ky|kz|la|lb|lc|li|lk|lr|ls|lt|lu|lv|ly|ma|mc|md|me|mg|mh|mil|mk|ml|mm|mn|mobi|mo|mp|mq|mr|ms|mt|museum|mu|mv|mw|mx|my|mz|name|na|nc|net|ne|nf|ng|ni|nl|no|np|nr|nu|nz|om|org|pa|pe|pf|pg|ph|pk|pl|pm|pn|pro|pr|ps|pt|pw|py|qa|re|ro|rs|ru|rw|sa|sb|sc|sd|se|sg|sh|si|sj|sk|sl|sm|sn|so|sr|st|su|sv|sy|sz|tc|td|tel|tf|tg|th|tj|tk|tl|tm|tn|to|tp|travel|tr|tt|tv|tw|tz|ua|ug|uk|um|us|uy|uz|va|vc|ve|vg|vi|vn|vu|wf|ws|xn--0zwm56d|xn--11b5bs3a9aj6g|xn--80akhbyknj4f|xn--9t4b11yi5a|xn--deba0ad|xn--g6w251d|xn--hgbk6aj7f53bba|xn--hlcj6aya9esc7a|xn--jxalpdlp|xn--kgbechtv|xn--zckzah|ye|yt|yu|za|zm|zw)", + HOST_OR_IP = "(?:" + HOSTNAME + TLD + "|" + IPV4 + ")", + PATH = "(?:[;/][^#?<>\\s]*)?", + QUERY_FRAG = "(?:\\?[^#<>\\s]*)?(?:#[^<>\\s]*)?", + URI1 = "\\b" + SCHEME + "[^<>\\s]+", + URI2 = "\\b" + HOST_OR_IP + PATH + QUERY_FRAG + "(?!\\w)", + + MAILTO = "mailto:", + EMAIL = "(?:" + MAILTO + ")?[a-z0-9!#$%&'*+/=?^_`{|}~-]+(?:\\.[a-z0-9!#$%&'*+/=?^_`{|}~-]+)*@" + HOST_OR_IP + QUERY_FRAG + "(?!\\w)", + + URI_RE = new RegExp( "(?:" + URI1 + "|" + URI2 + "|" + EMAIL + ")", "ig" ), + SCHEME_RE = new RegExp( "^" + SCHEME, "i" ), + + quotes = { + "'": "`", + '>': '<', + ')': '(', + ']': '[', + '}': '{', + '»': '«', + '›': '‹' + }, + + default_options = { + callback: function( text, href ) { +// return href ? '' + text + '<\/a>' : text; + return href ? '' + text + '<\/a>' : text; + }, + punct_regexp: /(?:[!?.,:;'"]|(?:&|&)(?:lt|gt|quot|apos|raquo|laquo|rsaquo|lsaquo);)$/ + }; + + return function( txt, options ) { + options = options || {}; + + // me + txt = txt + .replace(/&/g, '&') + .replace(/"/g, '"') + .replace(/'/g, ''') + .replace(//g, '>'); + // me + // Temp variables. + var arr, + i, + link, + href, + + // Output HTML. + html = '', + + // Store text / link parts, in order, for re-combination. + parts = [], + + // Used for keeping track of indices in the text. + idx_prev, + idx_last, + idx, + link_last, + + // Used for trimming trailing punctuation and quotes from links. + matches_begin, + matches_end, + quote_begin, + quote_end; + + // Initialize options. + for ( i in default_options ) { + if ( options[ i ] === undefined ) { + options[ i ] = default_options[ i ]; + } + } + + // Find links. + while ( arr = URI_RE.exec( txt ) ) { + + link = arr[0]; + idx_last = URI_RE.lastIndex; + idx = idx_last - link.length; + + // Not a link if preceded by certain characters. + if ( /[\/:]/.test( txt.charAt( idx - 1 ) ) ) { + continue; + } + + // Trim trailing punctuation. + do { + // If no changes are made, we don't want to loop forever! + link_last = link; + + quote_end = link.substr( -1 ) + quote_begin = quotes[ quote_end ]; + + // Ending quote character? + if ( quote_begin ) { + matches_begin = link.match( new RegExp( '\\' + quote_begin + '(?!$)', 'g' ) ); + matches_end = link.match( new RegExp( '\\' + quote_end, 'g' ) ); + + // If quotes are unbalanced, remove trailing quote character. + if ( ( matches_begin ? matches_begin.length : 0 ) < ( matches_end ? matches_end.length : 0 ) ) { + link = link.substr( 0, link.length - 1 ); + idx_last--; + } + } + + // Ending non-quote punctuation character? + if ( options.punct_regexp ) { + link = link.replace( options.punct_regexp, function(a){ + idx_last -= a.length; + return ''; + }); + } + } while ( link.length && link !== link_last ); + + href = link; + + // Add appropriate protocol to naked links. + if ( !SCHEME_RE.test( href ) ) { + href = ( href.indexOf( '@' ) !== -1 ? ( !href.indexOf( MAILTO ) ? '' : MAILTO ) + : !href.indexOf( 'irc.' ) ? 'irc://' + : !href.indexOf( 'ftp.' ) ? 'ftp://' + : 'http://' ) + + href; + } + + // Push preceding non-link text onto the array. + if ( idx_prev != idx ) { + parts.push([ txt.slice( idx_prev, idx ) ]); + idx_prev = idx_last; + } + + // Push massaged link onto the array + parts.push([ link, href ]); + }; + + // Push remaining non-link text onto the array. + parts.push([ txt.substr( idx_prev ) ]); + + // Process the array items. + for ( i = 0; i < parts.length; i++ ) { + html += options.callback.apply( window, parts[i] ); + } + + // In case of catastrophic failure, return the original text; + return html || txt; + }; + +})(); \ No newline at end of file diff --git a/app/assets/javascripts/app/lib/bootstrap-dropdown.js b/app/assets/javascripts/app/lib/bootstrap-dropdown.js new file mode 100644 index 000000000..48d3ce0f8 --- /dev/null +++ b/app/assets/javascripts/app/lib/bootstrap-dropdown.js @@ -0,0 +1,92 @@ +/* ============================================================ + * bootstrap-dropdown.js v2.0.0 + * http://twitter.github.com/bootstrap/javascript.html#dropdowns + * ============================================================ + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ============================================================ */ + + +!function( $ ){ + + "use strict" + + /* DROPDOWN CLASS DEFINITION + * ========================= */ + + var toggle = '[data-toggle="dropdown"]' + , Dropdown = function ( element ) { + var $el = $(element).on('click.dropdown.data-api', this.toggle) + $('html').on('click.dropdown.data-api', function () { + $el.parent().removeClass('open') + }) + } + + Dropdown.prototype = { + + constructor: Dropdown + + , toggle: function ( e ) { + var $this = $(this) + , selector = $this.attr('data-target') + , $parent + , isActive + + if (!selector) { + selector = $this.attr('href') + selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7 + } + + $parent = $(selector) + $parent.length || ($parent = $this.parent()) + + isActive = $parent.hasClass('open') + + clearMenus() + !isActive && $parent.toggleClass('open') + + return false + } + + } + + function clearMenus() { + $(toggle).parent().removeClass('open') + } + + + /* DROPDOWN PLUGIN DEFINITION + * ========================== */ + + $.fn.dropdown = function ( option ) { + return this.each(function () { + var $this = $(this) + , data = $this.data('dropdown') + if (!data) $this.data('dropdown', (data = new Dropdown(this))) + if (typeof option == 'string') data[option].call($this) + }) + } + + $.fn.dropdown.Constructor = Dropdown + + + /* APPLY TO STANDARD DROPDOWN ELEMENTS + * =================================== */ + + $(function () { + $('html').on('click.dropdown.data-api', clearMenus) + $('body').on('click.dropdown.data-api', toggle, Dropdown.prototype.toggle) + }) + +}( window.jQuery ) diff --git a/app/assets/javascripts/app/lib/bootstrap-modal.js b/app/assets/javascripts/app/lib/bootstrap-modal.js new file mode 100644 index 000000000..ba64368b2 --- /dev/null +++ b/app/assets/javascripts/app/lib/bootstrap-modal.js @@ -0,0 +1,209 @@ +/* ========================================================= + * bootstrap-modal.js v2.0.0 + * http://twitter.github.com/bootstrap/javascript.html#modals + * ========================================================= + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ========================================================= */ + + +!function( $ ){ + + "use strict" + + /* MODAL CLASS DEFINITION + * ====================== */ + + var Modal = function ( content, options ) { + this.options = $.extend({}, $.fn.modal.defaults, options) + this.$element = $(content) + .delegate('[data-dismiss="modal"]', 'click.dismiss.modal', $.proxy(this.hide, this)) + } + + Modal.prototype = { + + constructor: Modal + + , toggle: function () { + return this[!this.isShown ? 'show' : 'hide']() + } + + , show: function () { + var that = this + + if (this.isShown) return + + $('body').addClass('modal-open') + + this.isShown = true + this.$element.trigger('show') + + escape.call(this) + backdrop.call(this, function () { + var transition = $.support.transition && that.$element.hasClass('fade') + + !that.$element.parent().length && that.$element.appendTo(document.body) //don't move modals dom position + + that.$element + .show() + + if (transition) { + that.$element[0].offsetWidth // force reflow + } + + that.$element.addClass('in') + + transition ? + that.$element.one($.support.transition.end, function () { that.$element.trigger('shown') }) : + that.$element.trigger('shown') + + }) + } + + , hide: function ( e ) { + e && e.preventDefault() + + if (!this.isShown) return + + var that = this + this.isShown = false + + $('body').removeClass('modal-open') + + escape.call(this) + + this.$element + .trigger('hide') + .removeClass('in') + + $.support.transition && this.$element.hasClass('fade') ? + hideWithTransition.call(this) : + hideModal.call(this) + } + + } + + + /* MODAL PRIVATE METHODS + * ===================== */ + + function hideWithTransition() { + var that = this + , timeout = setTimeout(function () { + that.$element.off($.support.transition.end) + hideModal.call(that) + }, 500) + + this.$element.one($.support.transition.end, function () { + clearTimeout(timeout) + hideModal.call(that) + }) + } + + function hideModal( that ) { + this.$element + .hide() + .trigger('hidden') + + backdrop.call(this) + } + + function backdrop( callback ) { + var that = this + , animate = this.$element.hasClass('fade') ? 'fade' : '' + + if (this.isShown && this.options.backdrop) { + var doAnimate = $.support.transition && animate + + this.$backdrop = $('
') + .appendTo(document.body) + + if (this.options.backdrop != 'static') { + this.$backdrop.click($.proxy(this.hide, this)) + } + + if (doAnimate) this.$backdrop[0].offsetWidth // force reflow + + this.$backdrop.addClass('in') + + doAnimate ? + this.$backdrop.one($.support.transition.end, callback) : + callback() + + } else if (!this.isShown && this.$backdrop) { + this.$backdrop.removeClass('in') + + $.support.transition && this.$element.hasClass('fade')? + this.$backdrop.one($.support.transition.end, $.proxy(removeBackdrop, this)) : + removeBackdrop.call(this) + + } else if (callback) { + callback() + } + } + + function removeBackdrop() { + this.$backdrop.remove() + this.$backdrop = null + } + + function escape() { + var that = this + if (this.isShown && this.options.keyboard) { + $(document).on('keyup.dismiss.modal', function ( e ) { + e.which == 27 && that.hide() + }) + } else if (!this.isShown) { + $(document).off('keyup.dismiss.modal') + } + } + + + /* MODAL PLUGIN DEFINITION + * ======================= */ + + $.fn.modal = function ( option ) { + return this.each(function () { + var $this = $(this) + , data = $this.data('modal') + , options = typeof option == 'object' && option + if (!data) $this.data('modal', (data = new Modal(this, options))) + if (typeof option == 'string') data[option]() + else data.show() + }) + } + + $.fn.modal.defaults = { + backdrop: true + , keyboard: true + } + + $.fn.modal.Constructor = Modal + + + /* MODAL DATA-API + * ============== */ + + $(function () { + $('body').on('click.modal.data-api', '[data-toggle="modal"]', function ( e ) { + var $this = $(this), href + , $target = $($this.attr('data-target') || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7 + , option = $target.data('modal') ? 'toggle' : $.extend({}, $target.data(), $this.data()) + + e.preventDefault() + $target.modal(option) + }) + }) + +}( window.jQuery ) diff --git a/app/assets/javascripts/app/lib/bootstrap-popover.js b/app/assets/javascripts/app/lib/bootstrap-popover.js new file mode 100644 index 000000000..63d8196b0 --- /dev/null +++ b/app/assets/javascripts/app/lib/bootstrap-popover.js @@ -0,0 +1,96 @@ +/* =========================================================== + * bootstrap-popover.js v2.0.0 + * http://twitter.github.com/bootstrap/javascript.html#popovers + * =========================================================== + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * =========================================================== */ + + +!function( $ ) { + + "use strict" + + var Popover = function ( element, options ) { + this.init('popover', element, options) + } + + /* NOTE: POPOVER EXTENDS BOOTSTRAP-TOOLTIP.js + ========================================== */ + + Popover.prototype = $.extend({}, $.fn.tooltip.Constructor.prototype, { + + constructor: Popover + + , setContent: function () { + var $tip = this.tip() + , title = this.getTitle() + , content = this.getContent() + + $tip.find('.popover-title')[ $.type(title) == 'object' ? 'append' : 'html' ](title) + $tip.find('.popover-content > *')[ $.type(content) == 'object' ? 'append' : 'html' ](content) + + $tip.removeClass('fade top bottom left right in') + } + + , hasContent: function () { + return this.getTitle() || this.getContent() + } + + , getContent: function () { + var content + , $e = this.$element + , o = this.options + + content = $e.attr('data-content') + || (typeof o.content == 'function' ? o.content($e[0]) : o.content) +// || (typeof o.content == 'function' ? o.content.call($e[0]) : o.content) + + content = content.toString().replace(/(^\s*|\s*$)/, "") + + return content + } + + , tip: function() { + if (!this.$tip) { + this.$tip = $(this.options.template) + } + return this.$tip + } + + }) + + + /* POPOVER PLUGIN DEFINITION + * ======================= */ + + $.fn.popover = function ( option ) { + return this.each(function () { + var $this = $(this) + , data = $this.data('popover') + , options = typeof option == 'object' && option + if (!data) $this.data('popover', (data = new Popover(this, options))) + if (typeof option == 'string') data[option]() + }) + } + + $.fn.popover.Constructor = Popover + + $.fn.popover.defaults = $.extend({} , $.fn.tooltip.defaults, { + placement: 'right' + , content: '' + , template: '

' + }) + +}( window.jQuery ) diff --git a/app/assets/javascripts/app/lib/bootstrap-tab.js b/app/assets/javascripts/app/lib/bootstrap-tab.js new file mode 100644 index 000000000..f19db5da1 --- /dev/null +++ b/app/assets/javascripts/app/lib/bootstrap-tab.js @@ -0,0 +1,130 @@ +/* ======================================================== + * bootstrap-tab.js v2.0.0 + * http://twitter.github.com/bootstrap/javascript.html#tabs + * ======================================================== + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ======================================================== */ + + +!function( $ ){ + + "use strict" + + /* TAB CLASS DEFINITION + * ==================== */ + + var Tab = function ( element ) { + this.element = $(element) + } + + Tab.prototype = { + + constructor: Tab + + , show: function () { + var $this = this.element + , $ul = $this.closest('ul:not(.dropdown-menu)') + , selector = $this.attr('data-target') + , previous + , $target + + if (!selector) { + selector = $this.attr('href') + selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7 + } + + if ( $this.parent('li').hasClass('active') ) return + + previous = $ul.find('.active a').last()[0] + + $this.trigger({ + type: 'show' + , relatedTarget: previous + }) + + $target = $(selector) + + this.activate($this.parent('li'), $ul) + this.activate($target, $target.parent(), function () { + $this.trigger({ + type: 'shown' + , relatedTarget: previous + }) + }) + } + + , activate: function ( element, container, callback) { + var $active = container.find('> .active') + , transition = callback + && $.support.transition + && $active.hasClass('fade') + + function next() { + $active + .removeClass('active') + .find('> .dropdown-menu > .active') + .removeClass('active') + + element.addClass('active') + + if (transition) { + element[0].offsetWidth // reflow for transition + element.addClass('in') + } else { + element.removeClass('fade') + } + + if ( element.parent('.dropdown-menu') ) { + element.closest('li.dropdown').addClass('active') + } + + callback && callback() + } + + transition ? + $active.one($.support.transition.end, next) : + next() + + $active.removeClass('in') + } + } + + + /* TAB PLUGIN DEFINITION + * ===================== */ + + $.fn.tab = function ( option ) { + return this.each(function () { + var $this = $(this) + , data = $this.data('tab') + if (!data) $this.data('tab', (data = new Tab(this))) + if (typeof option == 'string') data[option]() + }) + } + + $.fn.tab.Constructor = Tab + + + /* TAB DATA-API + * ============ */ + + $(function () { + $('body').on('click.tab.data-api', '[data-toggle="tab"], [data-toggle="pill"]', function (e) { + e.preventDefault() + $(this).tab('show') + }) + }) + +}( window.jQuery ) diff --git a/app/assets/javascripts/app/lib/bootstrap-tooltip.js b/app/assets/javascripts/app/lib/bootstrap-tooltip.js new file mode 100644 index 000000000..494530e34 --- /dev/null +++ b/app/assets/javascripts/app/lib/bootstrap-tooltip.js @@ -0,0 +1,271 @@ +/* =========================================================== + * bootstrap-tooltip.js v2.0.0 + * http://twitter.github.com/bootstrap/javascript.html#tooltips + * Inspired by the original jQuery.tipsy by Jason Frame + * =========================================================== + * Copyright 2012 Twitter, Inc. + * + * Licensed under the Apache License, Version 2.0 (the "License"); + * you may not use this file except in compliance with the License. + * You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + * ========================================================== */ + +!function( $ ) { + + "use strict" + + /* TOOLTIP PUBLIC CLASS DEFINITION + * =============================== */ + + var Tooltip = function ( element, options ) { + this.init('tooltip', element, options) + } + + Tooltip.prototype = { + + constructor: Tooltip + + , init: function ( type, element, options ) { + var eventIn + , eventOut + + this.type = type + this.$element = $(element) + this.options = this.getOptions(options) + this.enabled = true + + if (this.options.trigger != 'manual') { + eventIn = this.options.trigger == 'hover' ? 'mouseenter' : 'focus' + eventOut = this.options.trigger == 'hover' ? 'mouseleave' : 'blur' + this.$element.on(eventIn, this.options.selector, $.proxy(this.enter, this)) + this.$element.on(eventOut, this.options.selector, $.proxy(this.leave, this)) + } + + this.options.selector ? + (this._options = $.extend({}, this.options, { trigger: 'manual', selector: '' })) : + this.fixTitle() + } + + , getOptions: function ( options ) { + options = $.extend({}, $.fn[this.type].defaults, options, this.$element.data()) + + if (options.delay && typeof options.delay == 'number') { + options.delay = { + show: options.delay + , hide: options.delay + } + } + + return options + } + + , enter: function ( e ) { + var self = $(e.currentTarget)[this.type](this._options).data(this.type) + + if (!self.options.delay || !self.options.delay.show) { + self.show() + } else { + self.hoverState = 'in' + setTimeout(function() { + if (self.hoverState == 'in') { + self.show() + } + }, self.options.delay.show) + } + } + + , leave: function ( e ) { + var self = $(e.currentTarget)[this.type](this._options).data(this.type) + + if (!self.options.delay || !self.options.delay.hide) { + self.hide() + } else { + self.hoverState = 'out' + setTimeout(function() { + if (self.hoverState == 'out') { + self.hide() + } + }, self.options.delay.hide) + } + } + + , show: function () { + var $tip + , inside + , pos + , actualWidth + , actualHeight + , placement + , tp + + if (this.hasContent() && this.enabled) { + $tip = this.tip() + this.setContent() + + if (this.options.animation) { + $tip.addClass('fade') + } + + placement = typeof this.options.placement == 'function' ? + this.options.placement.call(this, $tip[0], this.$element[0]) : + this.options.placement + + inside = /in/.test(placement) + + $tip + .remove() + .css({ top: 0, left: 0, display: 'block' }) + .appendTo(inside ? this.$element : document.body) + + pos = this.getPosition(inside) + + actualWidth = $tip[0].offsetWidth + actualHeight = $tip[0].offsetHeight + + switch (inside ? placement.split(' ')[1] : placement) { + case 'bottom': + tp = {top: pos.top + pos.height, left: pos.left + pos.width / 2 - actualWidth / 2} + break + case 'top': + tp = {top: pos.top - actualHeight, left: pos.left + pos.width / 2 - actualWidth / 2} + break + case 'left': + tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left - actualWidth} + break + case 'right': + tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left + pos.width} + break + } + + $tip + .css(tp) + .addClass(placement) + .addClass('in') + } + } + + , setContent: function () { + var $tip = this.tip() + $tip.find('.tooltip-inner').html(this.getTitle()) + $tip.removeClass('fade in top bottom left right') + } + + , hide: function () { + var that = this + , $tip = this.tip() + + $tip.removeClass('in') + + function removeWithAnimation() { + var timeout = setTimeout(function () { + $tip.off($.support.transition.end).remove() + }, 500) + + $tip.one($.support.transition.end, function () { + clearTimeout(timeout) + $tip.remove() + }) + } + + $.support.transition && this.$tip.hasClass('fade') ? + removeWithAnimation() : + $tip.remove() + } + + , fixTitle: function () { + var $e = this.$element + if ($e.attr('title') || typeof($e.attr('data-original-title')) != 'string') { + $e.attr('data-original-title', $e.attr('title') || '').removeAttr('title') + } + } + + , hasContent: function () { + return this.getTitle() + } + + , getPosition: function (inside) { + return $.extend({}, (inside ? {top: 0, left: 0} : this.$element.offset()), { + width: this.$element[0].offsetWidth + , height: this.$element[0].offsetHeight + }) + } + + , getTitle: function () { + var title + , $e = this.$element + , o = this.options + + title = $e.attr('data-original-title') + || (typeof o.title == 'function' ? o.title($e[0]) : o.title) +// || (typeof o.title == 'function' ? o.title.call($e[0]) : o.title) + + title = title.toString().replace(/(^\s*|\s*$)/, "") + + return title + } + + , tip: function () { + return this.$tip = this.$tip || $(this.options.template) + } + + , validate: function () { + if (!this.$element[0].parentNode) { + this.hide() + this.$element = null + this.options = null + } + } + + , enable: function () { + this.enabled = true + } + + , disable: function () { + this.enabled = false + } + + , toggleEnabled: function () { + this.enabled = !this.enabled + } + + , toggle: function () { + this[this.tip().hasClass('in') ? 'hide' : 'show']() + } + + } + + + /* TOOLTIP PLUGIN DEFINITION + * ========================= */ + + $.fn.tooltip = function ( option ) { + return this.each(function () { + var $this = $(this) + , data = $this.data('tooltip') + , options = typeof option == 'object' && option + if (!data) $this.data('tooltip', (data = new Tooltip(this, options))) + if (typeof option == 'string') data[option]() + }) + } + + $.fn.tooltip.Constructor = Tooltip + + $.fn.tooltip.defaults = { + animation: true + , delay: 0 + , selector: false + , placement: 'top' + , trigger: 'hover' + , title: '' + , template: '
' + } + +}( window.jQuery ) diff --git a/app/assets/javascripts/app/lib/fileuploader.js b/app/assets/javascripts/app/lib/fileuploader.js new file mode 100644 index 000000000..b4eac37e4 --- /dev/null +++ b/app/assets/javascripts/app/lib/fileuploader.js @@ -0,0 +1,1247 @@ +/** + * http://github.com/valums/file-uploader + * + * Multiple file upload component with progress-bar, drag-and-drop. + * © 2010 Andrew Valums ( andrew(at)valums.com ) + * + * Licensed under GNU GPL 2 or later and GNU LGPL 2 or later, see license.txt. + */ + +// +// Helper functions +// + +var qq = qq || {}; + +/** + * Adds all missing properties from second obj to first obj + */ +qq.extend = function(first, second){ + for (var prop in second){ + first[prop] = second[prop]; + } +}; + +/** + * Searches for a given element in the array, returns -1 if it is not present. + * @param {Number} [from] The index at which to begin the search + */ +qq.indexOf = function(arr, elt, from){ + if (arr.indexOf) return arr.indexOf(elt, from); + + from = from || 0; + var len = arr.length; + + if (from < 0) from += len; + + for (; from < len; from++){ + if (from in arr && arr[from] === elt){ + return from; + } + } + return -1; +}; + +qq.getUniqueId = (function(){ + var id = 0; + return function(){ return id++; }; +})(); + +// +// Events + +qq.attach = function(element, type, fn){ + if (element.addEventListener){ + element.addEventListener(type, fn, false); + } else if (element.attachEvent){ + element.attachEvent('on' + type, fn); + } +}; +qq.detach = function(element, type, fn){ + if (element.removeEventListener){ + element.removeEventListener(type, fn, false); + } else if (element.attachEvent){ + element.detachEvent('on' + type, fn); + } +}; + +qq.preventDefault = function(e){ + if (e.preventDefault){ + e.preventDefault(); + } else{ + e.returnValue = false; + } +}; + +// +// Node manipulations + +/** + * Insert node a before node b. + */ +qq.insertBefore = function(a, b){ + b.parentNode.insertBefore(a, b); +}; +qq.remove = function(element){ + element.parentNode.removeChild(element); +}; + +qq.contains = function(parent, descendant){ + // compareposition returns false in this case + if (parent == descendant) return true; + + if (parent.contains){ + return parent.contains(descendant); + } else { + return !!(descendant.compareDocumentPosition(parent) & 8); + } +}; + +/** + * Creates and returns element from html string + * Uses innerHTML to create an element + */ +qq.toElement = (function(){ + var div = document.createElement('div'); + return function(html){ + div.innerHTML = html; + var element = div.firstChild; + div.removeChild(element); + return element; + }; +})(); + +// +// Node properties and attributes + +/** + * Sets styles for an element. + * Fixes opacity in IE6-8. + */ +qq.css = function(element, styles){ + if (styles.opacity != null){ + if (typeof element.style.opacity != 'string' && typeof(element.filters) != 'undefined'){ + styles.filter = 'alpha(opacity=' + Math.round(100 * styles.opacity) + ')'; + } + } + qq.extend(element.style, styles); +}; +qq.hasClass = function(element, name){ + var re = new RegExp('(^| )' + name + '( |$)'); + return re.test(element.className); +}; +qq.addClass = function(element, name){ + if (!qq.hasClass(element, name)){ + element.className += ' ' + name; + } +}; +qq.removeClass = function(element, name){ + var re = new RegExp('(^| )' + name + '( |$)'); + element.className = element.className.replace(re, ' ').replace(/^\s+|\s+$/g, ""); +}; +qq.setText = function(element, text){ + element.innerText = text; + element.textContent = text; +}; + +// +// Selecting elements + +qq.children = function(element){ + var children = [], + child = element.firstChild; + + while (child){ + if (child.nodeType == 1){ + children.push(child); + } + child = child.nextSibling; + } + + return children; +}; + +qq.getByClass = function(element, className){ + if (element.querySelectorAll){ + return element.querySelectorAll('.' + className); + } + + var result = []; + var candidates = element.getElementsByTagName("*"); + var len = candidates.length; + + for (var i = 0; i < len; i++){ + if (qq.hasClass(candidates[i], className)){ + result.push(candidates[i]); + } + } + return result; +}; + +/** + * obj2url() takes a json-object as argument and generates + * a querystring. pretty much like jQuery.param() + * + * how to use: + * + * `qq.obj2url({a:'b',c:'d'},'http://any.url/upload?otherParam=value');` + * + * will result in: + * + * `http://any.url/upload?otherParam=value&a=b&c=d` + * + * @param Object JSON-Object + * @param String current querystring-part + * @return String encoded querystring + */ +qq.obj2url = function(obj, temp, prefixDone){ + var uristrings = [], + prefix = '&', + add = function(nextObj, i){ + var nextTemp = temp + ? (/\[\]$/.test(temp)) // prevent double-encoding + ? temp + : temp+'['+i+']' + : i; + if ((nextTemp != 'undefined') && (i != 'undefined')) { + uristrings.push( + (typeof nextObj === 'object') + ? qq.obj2url(nextObj, nextTemp, true) + : (Object.prototype.toString.call(nextObj) === '[object Function]') + ? encodeURIComponent(nextTemp) + '=' + encodeURIComponent(nextObj()) + : encodeURIComponent(nextTemp) + '=' + encodeURIComponent(nextObj) + ); + } + }; + + if (!prefixDone && temp) { + prefix = (/\?/.test(temp)) ? (/\?$/.test(temp)) ? '' : '&' : '?'; + uristrings.push(temp); + uristrings.push(qq.obj2url(obj)); + } else if ((Object.prototype.toString.call(obj) === '[object Array]') && (typeof obj != 'undefined') ) { + // we wont use a for-in-loop on an array (performance) + for (var i = 0, len = obj.length; i < len; ++i){ + add(obj[i], i); + } + } else if ((typeof obj != 'undefined') && (obj !== null) && (typeof obj === "object")){ + // for anything else but a scalar, we will use for-in-loop + for (var i in obj){ + add(obj[i], i); + } + } else { + uristrings.push(encodeURIComponent(temp) + '=' + encodeURIComponent(obj)); + } + + return uristrings.join(prefix) + .replace(/^&/, '') + .replace(/%20/g, '+'); +}; + +// +// +// Uploader Classes +// +// + +var qq = qq || {}; + +/** + * Creates upload button, validates upload, but doesn't create file list or dd. + */ +qq.FileUploaderBasic = function(o){ + this._options = { + // set to true to see the server response + debug: false, + action: '/server/upload', + params: {}, + button: null, + multiple: true, + maxConnections: 3, + // validation + allowedExtensions: [], + sizeLimit: 0, + minSizeLimit: 0, + // events + // return false to cancel submit + onSubmit: function(id, fileName){}, + onProgress: function(id, fileName, loaded, total){}, + onComplete: function(id, fileName, responseJSON){}, + onCancel: function(id, fileName){}, + // messages + messages: { + typeError: "{file} has invalid extension. Only {extensions} are allowed.", + sizeError: "{file} is too large, maximum file size is {sizeLimit}.", + minSizeError: "{file} is too small, minimum file size is {minSizeLimit}.", + emptyError: "{file} is empty, please select files again without it.", + onLeave: "The files are being uploaded, if you leave now the upload will be cancelled." + }, + showMessage: function(message){ + alert(message); + } + }; + qq.extend(this._options, o); + + // number of files being uploaded + this._filesInProgress = 0; + this._handler = this._createUploadHandler(); + + if (this._options.button){ + this._button = this._createUploadButton(this._options.button); + } + + this._preventLeaveInProgress(); +}; + +qq.FileUploaderBasic.prototype = { + setParams: function(params){ + this._options.params = params; + }, + getInProgress: function(){ + return this._filesInProgress; + }, + _createUploadButton: function(element){ + var self = this; + + return new qq.UploadButton({ + element: element, + multiple: this._options.multiple && qq.UploadHandlerXhr.isSupported(), + onChange: function(input){ + self._onInputChange(input); + } + }); + }, + _createUploadHandler: function(){ + var self = this, + handlerClass; + + if(qq.UploadHandlerXhr.isSupported()){ + handlerClass = 'UploadHandlerXhr'; + } else { + handlerClass = 'UploadHandlerForm'; + } + + var handler = new qq[handlerClass]({ + debug: this._options.debug, + action: this._options.action, + maxConnections: this._options.maxConnections, + onProgress: function(id, fileName, loaded, total){ + self._onProgress(id, fileName, loaded, total); + self._options.onProgress(id, fileName, loaded, total); + }, + onComplete: function(id, fileName, result){ + self._onComplete(id, fileName, result); + self._options.onComplete(id, fileName, result); + }, + onCancel: function(id, fileName){ + self._onCancel(id, fileName); + self._options.onCancel(id, fileName); + } + }); + + return handler; + }, + _preventLeaveInProgress: function(){ + var self = this; + + qq.attach(window, 'beforeunload', function(e){ + if (!self._filesInProgress){return;} + + var e = e || window.event; + // for ie, ff + e.returnValue = self._options.messages.onLeave; + // for webkit + return self._options.messages.onLeave; + }); + }, + _onSubmit: function(id, fileName){ + this._filesInProgress++; + }, + _onProgress: function(id, fileName, loaded, total){ + }, + _onComplete: function(id, fileName, result){ + this._filesInProgress--; + if (result.error){ + this._options.showMessage(result.error); + } + }, + _onCancel: function(id, fileName){ + this._filesInProgress--; + }, + _onInputChange: function(input){ + if (this._handler instanceof qq.UploadHandlerXhr){ + this._uploadFileList(input.files); + } else { + if (this._validateFile(input)){ + this._uploadFile(input); + } + } + this._button.reset(); + }, + _uploadFileList: function(files){ + for (var i=0; i this._options.sizeLimit){ + this._error('sizeError', name); + return false; + + } else if (size && size < this._options.minSizeLimit){ + this._error('minSizeError', name); + return false; + } + + return true; + }, + _error: function(code, fileName){ + var message = this._options.messages[code]; + function r(name, replacement){ message = message.replace(name, replacement); } + + r('{file}', this._formatFileName(fileName)); + r('{extensions}', this._options.allowedExtensions.join(', ')); + r('{sizeLimit}', this._formatSize(this._options.sizeLimit)); + r('{minSizeLimit}', this._formatSize(this._options.minSizeLimit)); + + this._options.showMessage(message); + }, + _formatFileName: function(name){ + if (name.length > 33){ + name = name.slice(0, 19) + '...' + name.slice(-13); + } + return name; + }, + _isAllowedExtension: function(fileName){ + var ext = (-1 !== fileName.indexOf('.')) ? fileName.replace(/.*[.]/, '').toLowerCase() : ''; + var allowed = this._options.allowedExtensions; + + if (!allowed.length){return true;} + + for (var i=0; i 99); + + return Math.max(bytes, 0.1).toFixed(1) + ['kB', 'MB', 'GB', 'TB', 'PB', 'EB'][i]; + } +}; + + +/** + * Class that creates upload widget with drag-and-drop and file list + * @inherits qq.FileUploaderBasic + */ +qq.FileUploader = function(o){ + // call parent constructor + qq.FileUploaderBasic.apply(this, arguments); + + // additional options + qq.extend(this._options, { + element: null, + // if set, will be used instead of qq-upload-list in template + listElement: null, + + template: '
' + + '
Drop files here to upload
' + + '
Upload a file
' + + '
    ' + + '
    ', + + // template for one item in file list + fileTemplate: '
  • ' + + '' + + '' + + '' + + 'Cancel' + + 'Failed' + + '
    • ', + + classes: { + // used to get elements from templates + button: 'qq-upload-button', + drop: 'qq-upload-drop-area', + dropActive: 'qq-upload-drop-area-active', + list: 'qq-upload-list', + + file: 'qq-upload-file', + spinner: 'qq-upload-spinner', + size: 'qq-upload-size', + cancel: 'qq-upload-cancel', + + // added to list item when upload completes + // used in css to hide progress spinner + success: 'qq-upload-success', + fail: 'qq-upload-fail' + } + }); + // overwrite options with user supplied + qq.extend(this._options, o); + + this._element = this._options.element; + this._element.innerHTML = this._options.template; + this._listElement = this._options.listElement || this._find(this._element, 'list'); + + this._classes = this._options.classes; + + this._button = this._createUploadButton(this._find(this._element, 'button')); + + this._bindCancelEvent(); + this._setupDragDrop(); +}; + +// inherit from Basic Uploader +qq.extend(qq.FileUploader.prototype, qq.FileUploaderBasic.prototype); + +qq.extend(qq.FileUploader.prototype, { + /** + * Gets one of the elements listed in this._options.classes + **/ + _find: function(parent, type){ + var element = qq.getByClass(parent, this._options.classes[type])[0]; + if (!element){ + throw new Error('element not found ' + type); + } + + return element; + }, + _setupDragDrop: function(){ + var self = this, + dropArea = this._find(this._element, 'drop'); + + var dz = new qq.UploadDropZone({ + element: dropArea, + onEnter: function(e){ + qq.addClass(dropArea, self._classes.dropActive); + e.stopPropagation(); + }, + onLeave: function(e){ + e.stopPropagation(); + }, + onLeaveNotDescendants: function(e){ + qq.removeClass(dropArea, self._classes.dropActive); + }, + onDrop: function(e){ + dropArea.style.display = 'none'; + qq.removeClass(dropArea, self._classes.dropActive); + self._uploadFileList(e.dataTransfer.files); + } + }); + + dropArea.style.display = 'none'; + + qq.attach(document, 'dragenter', function(e){ + if (!dz._isValidFileDrag(e)) return; + + dropArea.style.display = 'block'; + }); + qq.attach(document, 'dragleave', function(e){ + if (!dz._isValidFileDrag(e)) return; + + var relatedTarget = document.elementFromPoint(e.clientX, e.clientY); + // only fire when leaving document out + if ( ! relatedTarget || relatedTarget.nodeName == "HTML"){ + dropArea.style.display = 'none'; + } + }); + }, + _onSubmit: function(id, fileName){ + qq.FileUploaderBasic.prototype._onSubmit.apply(this, arguments); + this._addToList(id, fileName); + }, + _onProgress: function(id, fileName, loaded, total){ + qq.FileUploaderBasic.prototype._onProgress.apply(this, arguments); + + var item = this._getItemByFileId(id); + var size = this._find(item, 'size'); + size.style.display = 'inline'; + + var text; + if (loaded != total){ + text = Math.round(loaded / total * 100) + '% from ' + this._formatSize(total); + } else { + text = this._formatSize(total); + } + + qq.setText(size, text); + }, + _onComplete: function(id, fileName, result){ + qq.FileUploaderBasic.prototype._onComplete.apply(this, arguments); + + // mark completed + var item = this._getItemByFileId(id); + qq.remove(this._find(item, 'cancel')); + qq.remove(this._find(item, 'spinner')); + + if (result.success){ + qq.addClass(item, this._classes.success); + } else { + qq.addClass(item, this._classes.fail); + } + }, + _addToList: function(id, fileName){ + var item = qq.toElement(this._options.fileTemplate); + item.qqFileId = id; + + var fileElement = this._find(item, 'file'); + qq.setText(fileElement, this._formatFileName(fileName)); + this._find(item, 'size').style.display = 'none'; + + this._listElement.appendChild(item); + }, + _getItemByFileId: function(id){ + var item = this._listElement.firstChild; + + // there can't be txt nodes in dynamically created list + // and we can use nextSibling + while (item){ + if (item.qqFileId == id) return item; + item = item.nextSibling; + } + }, + /** + * delegate click event for cancel link + **/ + _bindCancelEvent: function(){ + var self = this, + list = this._listElement; + + qq.attach(list, 'click', function(e){ + e = e || window.event; + var target = e.target || e.srcElement; + + if (qq.hasClass(target, self._classes.cancel)){ + qq.preventDefault(e); + + var item = target.parentNode; + self._handler.cancel(item.qqFileId); + qq.remove(item); + } + }); + } +}); + +qq.UploadDropZone = function(o){ + this._options = { + element: null, + onEnter: function(e){}, + onLeave: function(e){}, + // is not fired when leaving element by hovering descendants + onLeaveNotDescendants: function(e){}, + onDrop: function(e){} + }; + qq.extend(this._options, o); + + this._element = this._options.element; + + this._disableDropOutside(); + this._attachEvents(); +}; + +qq.UploadDropZone.prototype = { + _disableDropOutside: function(e){ + // run only once for all instances + if (!qq.UploadDropZone.dropOutsideDisabled ){ + + qq.attach(document, 'dragover', function(e){ + if (e.dataTransfer){ + e.dataTransfer.dropEffect = 'none'; + e.preventDefault(); + } + }); + + qq.UploadDropZone.dropOutsideDisabled = true; + } + }, + _attachEvents: function(){ + var self = this; + + qq.attach(self._element, 'dragover', function(e){ + if (!self._isValidFileDrag(e)) return; + + var effect = e.dataTransfer.effectAllowed; + if (effect == 'move' || effect == 'linkMove'){ + e.dataTransfer.dropEffect = 'move'; // for FF (only move allowed) + } else { + e.dataTransfer.dropEffect = 'copy'; // for Chrome + } + + e.stopPropagation(); + e.preventDefault(); + }); + + qq.attach(self._element, 'dragenter', function(e){ + if (!self._isValidFileDrag(e)) return; + + self._options.onEnter(e); + }); + + qq.attach(self._element, 'dragleave', function(e){ + if (!self._isValidFileDrag(e)) return; + + self._options.onLeave(e); + + var relatedTarget = document.elementFromPoint(e.clientX, e.clientY); + // do not fire when moving a mouse over a descendant + if (qq.contains(this, relatedTarget)) return; + + self._options.onLeaveNotDescendants(e); + }); + + qq.attach(self._element, 'drop', function(e){ + if (!self._isValidFileDrag(e)) return; + + e.preventDefault(); + self._options.onDrop(e); + }); + }, + _isValidFileDrag: function(e){ + var dt = e.dataTransfer, + // do not check dt.types.contains in webkit, because it crashes safari 4 + isWebkit = navigator.userAgent.indexOf("AppleWebKit") > -1; + + // dt.effectAllowed is none in Safari 5 + // dt.types.contains check is for firefox + return dt && dt.effectAllowed != 'none' && + (dt.files || (!isWebkit && dt.types.contains && dt.types.contains('Files'))); + + } +}; + +qq.UploadButton = function(o){ + this._options = { + element: null, + // if set to true adds multiple attribute to file input + multiple: false, + // name attribute of file input + name: 'file', + onChange: function(input){}, + hoverClass: 'qq-upload-button-hover', + focusClass: 'qq-upload-button-focus' + }; + + qq.extend(this._options, o); + + this._element = this._options.element; + + // make button suitable container for input + qq.css(this._element, { + position: 'relative', + overflow: 'hidden', + // Make sure browse button is in the right side + // in Internet Explorer + direction: 'ltr' + }); + + this._input = this._createInput(); +}; + +qq.UploadButton.prototype = { + /* returns file input element */ + getInput: function(){ + return this._input; + }, + /* cleans/recreates the file input */ + reset: function(){ + if (this._input.parentNode){ + qq.remove(this._input); + } + + qq.removeClass(this._element, this._options.focusClass); + this._input = this._createInput(); + }, + _createInput: function(){ + var input = document.createElement("input"); + + if (this._options.multiple){ + input.setAttribute("multiple", "multiple"); + } + + input.setAttribute("type", "file"); + input.setAttribute("name", this._options.name); + + qq.css(input, { + position: 'absolute', + // in Opera only 'browse' button + // is clickable and it is located at + // the right side of the input + right: 0, + top: 0, + fontFamily: 'Arial', + // 4 persons reported this, the max values that worked for them were 243, 236, 236, 118 + fontSize: '118px', + margin: 0, + padding: 0, + cursor: 'pointer', + opacity: 0 + }); + + this._element.appendChild(input); + + var self = this; + qq.attach(input, 'change', function(){ + self._options.onChange(input); + }); + + qq.attach(input, 'mouseover', function(){ + qq.addClass(self._element, self._options.hoverClass); + }); + qq.attach(input, 'mouseout', function(){ + qq.removeClass(self._element, self._options.hoverClass); + }); + qq.attach(input, 'focus', function(){ + qq.addClass(self._element, self._options.focusClass); + }); + qq.attach(input, 'blur', function(){ + qq.removeClass(self._element, self._options.focusClass); + }); + + // IE and Opera, unfortunately have 2 tab stops on file input + // which is unacceptable in our case, disable keyboard access + if (window.attachEvent){ + // it is IE or Opera + input.setAttribute('tabIndex', "-1"); + } + + return input; + } +}; + +/** + * Class for uploading files, uploading itself is handled by child classes + */ +qq.UploadHandlerAbstract = function(o){ + this._options = { + debug: false, + action: '/upload.php', + // maximum number of concurrent uploads + maxConnections: 999, + onProgress: function(id, fileName, loaded, total){}, + onComplete: function(id, fileName, response){}, + onCancel: function(id, fileName){} + }; + qq.extend(this._options, o); + + this._queue = []; + // params for files in queue + this._params = []; +}; +qq.UploadHandlerAbstract.prototype = { + log: function(str){ + if (this._options.debug && window.console) console.log('[uploader] ' + str); + }, + /** + * Adds file or file input to the queue + * @returns id + **/ + add: function(file){}, + /** + * Sends the file identified by id and additional query params to the server + */ + upload: function(id, params){ + var len = this._queue.push(id); + + var copy = {}; + qq.extend(copy, params); + this._params[id] = copy; + + // if too many active uploads, wait... + if (len <= this._options.maxConnections){ + this._upload(id, this._params[id]); + } + }, + /** + * Cancels file upload by id + */ + cancel: function(id){ + this._cancel(id); + this._dequeue(id); + }, + /** + * Cancells all uploads + */ + cancelAll: function(){ + for (var i=0; i= max && i < max){ + var nextId = this._queue[max-1]; + this._upload(nextId, this._params[nextId]); + } + } +}; + +/** + * Class for uploading files using form and iframe + * @inherits qq.UploadHandlerAbstract + */ +qq.UploadHandlerForm = function(o){ + qq.UploadHandlerAbstract.apply(this, arguments); + + this._inputs = {}; +}; +// @inherits qq.UploadHandlerAbstract +qq.extend(qq.UploadHandlerForm.prototype, qq.UploadHandlerAbstract.prototype); + +qq.extend(qq.UploadHandlerForm.prototype, { + add: function(fileInput){ + fileInput.setAttribute('name', 'qqfile'); + var id = 'qq-upload-handler-iframe' + qq.getUniqueId(); + + this._inputs[id] = fileInput; + + // remove file input from DOM + if (fileInput.parentNode){ + qq.remove(fileInput); + } + + return id; + }, + getName: function(id){ + // get input value and remove path to normalize + return this._inputs[id].value.replace(/.*(\/|\\)/, ""); + }, + _cancel: function(id){ + this._options.onCancel(id, this.getName(id)); + + delete this._inputs[id]; + + var iframe = document.getElementById(id); + if (iframe){ + // to cancel request set src to something else + // we use src="javascript:false;" because it doesn't + // trigger ie6 prompt on https + iframe.setAttribute('src', 'javascript:false;'); + + qq.remove(iframe); + } + }, + _upload: function(id, params){ + var input = this._inputs[id]; + + if (!input){ + throw new Error('file with passed id was not added, or already uploaded or cancelled'); + } + + var fileName = this.getName(id); + + var iframe = this._createIframe(id); + var form = this._createForm(iframe, params); + form.appendChild(input); + + var self = this; + this._attachLoadEvent(iframe, function(){ + self.log('iframe loaded'); + + var response = self._getIframeContentJSON(iframe); + + self._options.onComplete(id, fileName, response); + self._dequeue(id); + + delete self._inputs[id]; + // timeout added to fix busy state in FF3.6 + setTimeout(function(){ + qq.remove(iframe); + }, 1); + }); + + form.submit(); + qq.remove(form); + + return id; + }, + _attachLoadEvent: function(iframe, callback){ + qq.attach(iframe, 'load', function(){ + // when we remove iframe from dom + // the request stops, but in IE load + // event fires + if (!iframe.parentNode){ + return; + } + + // fixing Opera 10.53 + if (iframe.contentDocument && + iframe.contentDocument.body && + iframe.contentDocument.body.innerHTML == "false"){ + // In Opera event is fired second time + // when body.innerHTML changed from false + // to server response approx. after 1 sec + // when we upload file with iframe + return; + } + + callback(); + }); + }, + /** + * Returns json object received by iframe from server. + */ + _getIframeContentJSON: function(iframe){ + // iframe.contentWindow.document - for IE<7 + var doc = iframe.contentDocument ? iframe.contentDocument: iframe.contentWindow.document, + response; + + this.log("converting iframe's innerHTML to JSON"); + this.log("innerHTML = " + doc.body.innerHTML); + + try { + response = eval("(" + doc.body.innerHTML + ")"); + } catch(err){ + response = {}; + } + + return response; + }, + /** + * Creates iframe with unique name + */ + _createIframe: function(id){ + // We can't use following code as the name attribute + // won't be properly registered in IE6, and new window + // on form submit will open + // var iframe = document.createElement('iframe'); + // iframe.setAttribute('name', id); + + var iframe = qq.toElement('' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
    '; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ''; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += ''; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '
    '; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { + return; + } + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { + return; + } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.17"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); diff --git a/app/assets/javascripts/app/lib/ui/jquery.ui.dialog.js b/app/assets/javascripts/app/lib/ui/jquery.ui.dialog.js new file mode 100755 index 000000000..33119af28 --- /dev/null +++ b/app/assets/javascripts/app/lib/ui/jquery.ui.dialog.js @@ -0,0 +1,878 @@ +/* + * jQuery UI Dialog 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }, + // support for jQuery 1.3.2 - handle common attrFn methods for dialog + attrFn = $.attrFn || { + val: true, + css: true, + html: true, + text: true, + data: true, + width: true, + height: true, + offset: true, + click: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('
    ')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('
    ')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if ( options.modal ) { + uiDialog.bind( "keydown.ui-dialog", function( event ) { + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('
    ') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "
    " ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in attrFn ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.17", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('
    ').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); diff --git a/app/assets/javascripts/app/lib/ui/jquery.ui.draggable.js b/app/assets/javascripts/app/lib/ui/jquery.ui.draggable.js new file mode 100755 index 000000000..41aba9d65 --- /dev/null +++ b/app/assets/javascripts/app/lib/ui/jquery.ui.draggable.js @@ -0,0 +1,825 @@ +/* + * jQuery UI Draggable 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + }, + _create: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + if ( o.iframeFix ) { + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('
    ') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + } + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger('drag', event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is removed, don't bother to continue if helper is set to "original" + if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original") + return false; + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(self._trigger("stop", event) !== false) { + self._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + if (this.options.iframeFix === true) { + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); //Remove frame helpers + } + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var c = $(o.containment); + var ce = c[0]; if(!ce) return; + var co = c.offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; + + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + var containment; + if(this.containment) { + if (this.relative_container){ + var co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } + + if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; + } + + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.extend($.ui.draggable, { + version: "1.8.17" +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + if (!group.length) { return; } + + var min = parseInt(group[0].style.zIndex) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); diff --git a/app/assets/javascripts/app/lib/ui/jquery.ui.droppable.js b/app/assets/javascripts/app/lib/ui/jquery.ui.droppable.js new file mode 100755 index 000000000..afce00aa6 --- /dev/null +++ b/app/assets/javascripts/app/lib/ui/jquery.ui.droppable.js @@ -0,0 +1,296 @@ +/* + * jQuery UI Droppable 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function( $, undefined ) { + +$.widget("ui.droppable", { + widgetEventPrefix: "drop", + options: { + accept: '*', + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: 'default', + tolerance: 'intersect' + }, + _create: function() { + + var o = this.options, accept = o.accept; + this.isover = 0; this.isout = 1; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + destroy: function() { + var drop = $.ui.ddmanager.droppables[this.options.scope]; + for ( var i = 0; i < drop.length; i++ ) + if ( drop[i] == this ) + drop.splice(i, 1); + + this.element + .removeClass("ui-droppable ui-droppable-disabled") + .removeData("droppable") + .unbind(".droppable"); + + return this; + }, + + _setOption: function(key, value) { + + if(key == 'accept') { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.addClass(this.options.activeClass); + (draggable && this._trigger('activate', event, this.ui(draggable))); + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + (draggable && this._trigger('deactivate', event, this.ui(draggable))); + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); + this._trigger('over', event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('out', event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current; + if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element + + var childrenIntersection = false; + this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, 'droppable'); + if( + inst.options.greedy + && !inst.options.disabled + && inst.options.scope == draggable.options.scope + && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) + && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) return false; + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) this.element.removeClass(this.options.activeClass); + if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); + this._trigger('drop', event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.extend($.ui.droppable, { + version: "1.8.17" +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) return false; + + var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; + var l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case 'fit': + return (l <= x1 && x2 <= r + && t <= y1 && y2 <= b); + break; + case 'intersect': + return (l < x1 + (draggable.helperProportions.width / 2) // Right Half + && x2 - (draggable.helperProportions.width / 2) < r // Left Half + && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half + && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + break; + case 'pointer': + var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), + isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); + return isOver; + break; + case 'touch': + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + break; + default: + return false; + break; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { 'default': [] }, + prepareOffsets: function(t, event) { + + var m = $.ui.ddmanager.droppables[t.options.scope] || []; + var type = event ? event.type : null; // workaround for #2317 + var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); + + droppablesLoop: for (var i = 0; i < m.length; i++) { + + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted + for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item + m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue + + if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) return; + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) + dropped = this._drop.call(this, event) || dropped; + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = 1; this.isover = 0; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + }); + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) return; + var intersects = $.ui.intersect(draggable, this, this.options.tolerance); + + var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); + if(!c) return; + + var parentInstance; + if (this.options.greedy) { + var parent = this.element.parents(':data(droppable):eq(0)'); + if (parent.length) { + parentInstance = $.data(parent[0], 'droppable'); + parentInstance.greedyChild = (c == 'isover' ? 1 : 0); + } + } + + // we just moved into a greedy child + if (parentInstance && c == 'isover') { + parentInstance['isover'] = 0; + parentInstance['isout'] = 1; + parentInstance._out.call(parentInstance, event); + } + + this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; + this[c == "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c == 'isout') { + parentInstance['isout'] = 0; + parentInstance['isover'] = 1; + parentInstance._over.call(parentInstance, event); + } + }); + + }, + dragStop: function( draggable, event ) { + draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); + } +}; + +})(jQuery); diff --git a/app/assets/javascripts/app/lib/ui/jquery.ui.mouse.js b/app/assets/javascripts/app/lib/ui/jquery.ui.mouse.js new file mode 100755 index 000000000..6bb65de0b --- /dev/null +++ b/app/assets/javascripts/app/lib/ui/jquery.ui.mouse.js @@ -0,0 +1,162 @@ +/*! + * jQuery UI Mouse 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function( e ) { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + options: { + cancel: ':input,option', + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var self = this; + + this.element + .bind('mousedown.'+this.widgetName, function(event) { + return self._mouseDown(event); + }) + .bind('click.'+this.widgetName, function(event) { + if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { + $.removeData(event.target, self.widgetName + '.preventClickEvent'); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind('.'+this.widgetName); + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return }; + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var self = this, + btnIsLeft = (event.which == 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + self.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { + $.removeData(event.target, this.widgetName + '.preventClickEvent'); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return self._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return self._mouseUp(event); + }; + $(document) + .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) + .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target == this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + '.preventClickEvent', true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(event) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(event) {}, + _mouseDrag: function(event) {}, + _mouseStop: function(event) {}, + _mouseCapture: function(event) { return true; } +}); + +})(jQuery); diff --git a/app/assets/javascripts/app/lib/ui/jquery.ui.position.js b/app/assets/javascripts/app/lib/ui/jquery.ui.position.js new file mode 100755 index 000000000..8eb30f623 --- /dev/null +++ b/app/assets/javascripts/app/lib/ui/jquery.ui.position.js @@ -0,0 +1,298 @@ +/* + * jQuery UI Position 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + support = {}, + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions if jQuery version doesn't support them (see #5280) + if ( !support.fractions ) { + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + } + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +// fraction support test (older versions of jQuery don't support fractions) +(function () { + var body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ), + testElement, testElementParent, testElementStyle, offset, offsetTotal; + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + jQuery.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( var i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; + + offset = $( div ).offset( function( _, offset ) { + return offset; + }).offset(); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); + support.fractions = offsetTotal > 21 && offsetTotal < 22; +})(); + +}( jQuery )); diff --git a/app/assets/javascripts/app/lib/ui/jquery.ui.progressbar.js b/app/assets/javascripts/app/lib/ui/jquery.ui.progressbar.js new file mode 100755 index 000000000..27bae872e --- /dev/null +++ b/app/assets/javascripts/app/lib/ui/jquery.ui.progressbar.js @@ -0,0 +1,109 @@ +/* + * jQuery UI Progressbar 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "
    " ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.17" +}); + +})( jQuery ); diff --git a/app/assets/javascripts/app/lib/ui/jquery.ui.resizable.js b/app/assets/javascripts/app/lib/ui/jquery.ui.resizable.js new file mode 100755 index 000000000..52b1fc4f8 --- /dev/null +++ b/app/assets/javascripts/app/lib/ui/jquery.ui.resizable.js @@ -0,0 +1,842 @@ +/* + * jQuery UI Resizable 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.resizable", $.ui.mouse, { + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + zIndex: 1000 + }, + _create: function() { + + var self = this, o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Opera fix for relative positioning + if (/relative/.test(this.element.css('position')) && $.browser.opera) + this.element.css({ position: 'relative', top: 'auto', left: 'auto' }); + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $('
    ').css({ + position: this.element.css('position'), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css('top'), + left: this.element.css('left') + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "resizable", this.element.data('resizable') + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css('resize'); + this.originalElement.css('resize', 'none'); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css('margin') }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); + if(this.handles.constructor == String) { + + if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; + var n = this.handles.split(","); this.handles = {}; + + for(var i = 0; i < n.length; i++) { + + var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; + var axis = $('
    '); + + // increase zIndex of sw, se, ne, nw axis + //TODO : this modifies original option + if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex }); + + //TODO : What's going on here? + if ('se' == handle) { + axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); + }; + + //Insert into internal handles object and append to element + this.handles[handle] = '.ui-resizable-'+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + target = target || this.element; + + for(var i in this.handles) { + + if(this.handles[i].constructor == String) + this.handles[i] = $(this.handles[i], this.element).show(); + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + var axis = $(this.handles[i], this.element), padWrapper = 0; + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + var padPos = [ 'padding', + /ne|nw|n/.test(i) ? 'Top' : + /se|sw|s/.test(i) ? 'Bottom' : + /^e$/.test(i) ? 'Right' : 'Left' ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) + continue; + + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $('.ui-resizable-handle', this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!self.resizing) { + if (this.className) + var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + //Axis, default = se + self.axis = axis && axis[1] ? axis[1] : 'se'; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .hover(function() { + if (o.disabled) return; + $(this).removeClass("ui-resizable-autohide"); + self._handles.show(); + }, + function(){ + if (o.disabled) return; + if (!self.resizing) { + $(this).addClass("ui-resizable-autohide"); + self._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + destroy: function() { + + this._mouseDestroy(); + + var _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + var wrapper = this.element; + wrapper.after( + this.originalElement.css({ + position: wrapper.css('position'), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css('top'), + left: wrapper.css('left') + }) + ).remove(); + } + + this.originalElement.css('resize', this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var handle = false; + for (var i in this.handles) { + if ($(this.handles[i])[0] == event.target) { + handle = true; + } + } + + return !this.options.disabled && handle; + }, + + _mouseStart: function(event) { + + var o = this.options, iniPos = this.element.position(), el = this.element; + + this.resizing = true; + this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; + + // bugfix for http://dev.jquery.com/ticket/1749 + if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { + el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); + } + + //Opera fixing relative position + if ($.browser.opera && (/relative/).test(el.css('position'))) + el.css({ position: 'relative', top: 'auto', left: 'auto' }); + + this._renderProxy(); + + var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + var cursor = $('.ui-resizable-' + this.axis).css('cursor'); + $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var el = this.helper, o = this.options, props = {}, + self = this, smp = this.originalMousePosition, a = this.axis; + + var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; + var trigger = this._change[a]; + if (!trigger) return false; + + // Calculate the attrs that will be change + var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) + data = this._updateRatio(data, event); + + data = this._respectSize(data, event); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + el.css({ + top: this.position.top + "px", left: this.position.left + "px", + width: this.size.width + "px", height: this.size.height + "px" + }); + + if (!this._helper && this._proportionallyResizeElements.length) + this._proportionallyResize(); + + this._updateCache(data); + + // calling the user callback at the end + this._trigger('resize', event, this.ui()); + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var o = this.options, self = this; + + if(this._helper) { + var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + if (!o.animate) + this.element.css($.extend(s, { top: top, left: left })); + + self.helper.height(self.size.height); + self.helper.width(self.size.width); + + if (this._helper && !o.animate) this._proportionallyResize(); + } + + $('body').css('cursor', 'auto'); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) this.helper.remove(); + return false; + + }, + + _updateVirtualBoundaries: function(forceAspectRatio) { + var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; + + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; + + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; + if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; + if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; + if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; + } + this._vBoundaries = b; + }, + + _updateCache: function(data) { + var o = this.options; + this.offset = this.helper.offset(); + if (isNumber(data.left)) this.position.left = data.left; + if (isNumber(data.top)) this.position.top = data.top; + if (isNumber(data.height)) this.size.height = data.height; + if (isNumber(data.width)) this.size.width = data.width; + }, + + _updateRatio: function(data, event) { + + var o = this.options, cpos = this.position, csize = this.size, a = this.axis; + + if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); + else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); + + if (a == 'sw') { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a == 'nw') { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function(data, event) { + + var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); + + if (isminw) data.width = o.minWidth; + if (isminh) data.height = o.minHeight; + if (ismaxw) data.width = o.maxWidth; + if (ismaxh) data.height = o.maxHeight; + + var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; + var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + + if (isminw && cw) data.left = dw - o.minWidth; + if (ismaxw && cw) data.left = dw - o.maxWidth; + if (isminh && ch) data.top = dh - o.minHeight; + if (ismaxh && ch) data.top = dh - o.maxHeight; + + // fixing jump error on top/left - bug #2330 + var isNotwh = !data.width && !data.height; + if (isNotwh && !data.left && data.top) data.top = null; + else if (isNotwh && !data.top && data.left) data.left = null; + + return data; + }, + + _proportionallyResize: function() { + + var o = this.options; + if (!this._proportionallyResizeElements.length) return; + var element = this.helper || this.element; + + for (var i=0; i < this._proportionallyResizeElements.length; i++) { + + var prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], + p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; + + this.borderDif = $.map(b, function(v, i) { + var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; + return border + padding; + }); + } + + if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) + continue; + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + }; + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $('
    '); + + // fix ie6 offset TODO: This seems broken + var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), + pxyoffset = ( ie6 ? 2 : -1 ); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() + pxyoffset, + height: this.element.outerHeight() + pxyoffset, + position: 'absolute', + left: this.elementOffset.left - ie6offset +'px', + top: this.elementOffset.top - ie6offset +'px', + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx, dy) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var o = this.options, cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n != "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +$.extend($.ui.resizable, { + version: "1.8.17" +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10), + position: el.css('position') // to reset Opera on stop() + }); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; + + var delta = { + height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, + top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) + style[prop] = sum || null; + }); + + // Opera fixing relative position + if ($.browser.opera && /relative/.test(el.css('position'))) { + self._revertToRelativePosition = true; + el.css({ position: 'absolute', top: 'auto', left: 'auto' }); + } + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function (event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var _reset = function (exp) { + $(exp).each(function() { + var el = $(this); + // reset position for Opera - no need to verify it was changed + el.css({ position: el.data("resizable-alsoresize").position }); + }); + }; + + if (self._revertToRelativePosition) { + self._revertToRelativePosition = false; + if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp) { _reset(exp); }); + }else{ + _reset(o.alsoResize); + } + } + + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "animate", { + + stop: function(event, ui) { + var self = $(this).data("resizable"), o = self.options; + + var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, + soffsetw = ista ? 0 : self.sizeDiff.width; + + var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, + left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, + top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; + + self.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(self.element.css('width'), 10), + height: parseInt(self.element.css('height'), 10), + top: parseInt(self.element.css('top'), 10), + left: parseInt(self.element.css('left'), 10) + }; + + if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); + + // propagating resize, and updating values for each animation step + self._updateCache(data); + self._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, el = self.element; + var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + if (!ce) return; + + self.containerElement = $(ce); + + if (/document/.test(oc) || oc == document) { + self.containerOffset = { left: 0, top: 0 }; + self.containerPosition = { left: 0, top: 0 }; + + self.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + var element = $(ce), p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + self.containerOffset = element.offset(); + self.containerPosition = element.position(); + self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + self.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, + ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, + pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; + + if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; + + if (cp.left < (self._helper ? co.left : 0)) { + self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); + if (pRatio) self.size.height = self.size.width / o.aspectRatio; + self.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (self._helper ? co.top : 0)) { + self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); + if (pRatio) self.size.width = self.size.height * o.aspectRatio; + self.position.top = self._helper ? co.top : 0; + } + + self.offset.left = self.parentData.left+self.position.left; + self.offset.top = self.parentData.top+self.position.top; + + var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), + hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); + + var isParent = self.containerElement.get(0) == self.element.parent().get(0), + isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); + + if(isParent && isOffsetRelative) woset -= self.parentData.left; + + if (woset + self.size.width >= self.parentData.width) { + self.size.width = self.parentData.width - woset; + if (pRatio) self.size.height = self.size.width / self.aspectRatio; + } + + if (hoset + self.size.height >= self.parentData.height) { + self.size.height = self.parentData.height - hoset; + if (pRatio) self.size.width = self.size.height * self.aspectRatio; + } + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options, cp = self.position, + co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; + + var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; + + if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + if (self._helper && !o.animate && (/static/).test(ce.css('position'))) + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function(event, ui) { + + var self = $(this).data("resizable"), o = self.options, cs = self.size; + + self.ghost = self.originalElement.clone(); + self.ghost + .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass('ui-resizable-ghost') + .addClass(typeof o.ghost == 'string' ? o.ghost : ''); + + self.ghost.appendTo(self.helper); + + }, + + resize: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); + }, + + stop: function(event, ui){ + var self = $(this).data("resizable"), o = self.options; + if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function(event, ui) { + var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; + o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; + var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); + + if (/^(se|s|e)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + } + else if (/^(ne)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + } + else if (/^(sw)$/.test(a)) { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.left = op.left - ox; + } + else { + self.size.width = os.width + ox; + self.size.height = os.height + oy; + self.position.top = op.top - oy; + self.position.left = op.left - ox; + } + } + +}); + +var num = function(v) { + return parseInt(v, 10) || 0; +}; + +var isNumber = function(value) { + return !isNaN(parseInt(value, 10)); +}; + +})(jQuery); diff --git a/app/assets/javascripts/app/lib/ui/jquery.ui.selectable.js b/app/assets/javascripts/app/lib/ui/jquery.ui.selectable.js new file mode 100755 index 000000000..d790ac0dc --- /dev/null +++ b/app/assets/javascripts/app/lib/ui/jquery.ui.selectable.js @@ -0,0 +1,267 @@ +/* + * jQuery UI Selectable 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + options: { + appendTo: 'body', + autoRefresh: true, + distance: 0, + filter: '*', + tolerance: 'touch' + }, + _create: function() { + var self = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + var selectees; + this.refresh = function() { + selectees = $(self.options.filter, self.element[0]); + selectees.addClass("ui-selectee"); + selectees.each(function() { + var $this = $(this); + var pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass('ui-selected'), + selecting: $this.hasClass('ui-selecting'), + unselecting: $this.hasClass('ui-unselecting') + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("
    "); + }, + + destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled") + .removeData("selectable") + .unbind(".selectable"); + this._mouseDestroy(); + + return this; + }, + + _mouseStart: function(event) { + var self = this; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) + return; + + var options = this.options; + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.clientX, + "top": event.clientY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter('.ui-selected').each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey && !event.ctrlKey) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().andSelf().each(function() { + var selectee = $.data(this, "selectable-item"); + if (selectee) { + var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected'); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + self._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + var self = this; + this.dragged = true; + + if (this.options.disabled) + return; + + var options = this.options; + + var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; + if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"); + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element == self.element[0]) + return; + var hit = false; + if (options.tolerance == 'touch') { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance == 'fit') { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass('ui-selecting'); + selectee.selecting = true; + // selectable SELECTING callback + self._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if ((event.metaKey || event.ctrlKey) && selectee.startselected) { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + selectee.$element.addClass('ui-selected'); + selectee.selected = true; + } else { + selectee.$element.removeClass('ui-selecting'); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { + selectee.$element.removeClass('ui-selected'); + selectee.selected = false; + + selectee.$element.addClass('ui-unselecting'); + selectee.unselecting = true; + // selectable UNSELECTING callback + self._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var self = this; + + this.dragged = false; + + var options = this.options; + + $('.ui-unselecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-unselecting'); + selectee.unselecting = false; + selectee.startselected = false; + self._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $('.ui-selecting', this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + self._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +$.extend($.ui.selectable, { + version: "1.8.17" +}); + +})(jQuery); diff --git a/app/assets/javascripts/app/lib/ui/jquery.ui.slider.js b/app/assets/javascripts/app/lib/ui/jquery.ui.slider.js new file mode 100755 index 000000000..53fdc42ad --- /dev/null +++ b/app/assets/javascripts/app/lib/ui/jquery.ui.slider.js @@ -0,0 +1,666 @@ +/* + * jQuery UI Slider 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "
    " ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var ret = true, + index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + ret = false; + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + + return ret; + + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.propAttr( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.propAttr( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.17" +}); + +}(jQuery)); diff --git a/app/assets/javascripts/app/lib/ui/jquery.ui.sortable.js b/app/assets/javascripts/app/lib/ui/jquery.ui.sortable.js new file mode 100755 index 000000000..26ba85f0e --- /dev/null +++ b/app/assets/javascripts/app/lib/ui/jquery.ui.sortable.js @@ -0,0 +1,1076 @@ +/* + * jQuery UI Sortable 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +$.widget("ui.sortable", $.ui.mouse, { + widgetEventPrefix: "sort", + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: 'auto', + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: '> *', + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000 + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + }, + + destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) + this.items[i].item.removeData(this.widgetName + "-item"); + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget() + [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + var that = this; + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type == 'static') return false; + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { + if($.data(this, that.widgetName + '-item') == self) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, that.widgetName + '-item') == self) currentItem = $(event.target); + + if(!currentItem) return false; + if(this.options.handle && !overrideHandle) { + var validHandle = false; + + $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); + if(!validHandle) return false; + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var o = this.options, self = this; + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] != this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + if(o.cursor) { // cursor option + if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); + $('body').css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') + this.overflowOffset = this.scrollParent.offset(); + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) + this._cacheHelperProportions(); + + + //Post 'activate' events to possible containers + if(!noActivation) { + for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } + } + + //Prepare possible droppables + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + var o = this.options, scrolled = false; + if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + + //Rearrange + for (var i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); + if (!intersection) continue; + + if(itemElement != this.currentItem[0] //cannot intersect with itself + && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before + && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked + && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) + //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container + ) { + + this.direction = intersection == 1 ? "down" : "up"; + + if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + //Call callbacks + this._trigger('sort', event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) return; + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) + $.ui.ddmanager.drop(this, event); + + if(this.options.revert) { + var self = this; + var cur = self.placeholder.offset(); + + self.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + self._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + var self = this; + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper == "original") + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + else + this.currentItem.show(); + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, self._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, self._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var str = []; o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); + if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); + }); + + if(!str.length && o.key) { + str.push(o.key + '='); + } + + return str.join('&'); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected); + var ret = []; o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height; + + var l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height; + + var dyClick = this.offset.click.top, + dxClick = this.offset.click.left; + + var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if( this.options.tolerance == "pointer" + || this.options.forcePointerForContainers + || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) // Right Half + && x2 - (this.helperProportions.width / 2) < r // Left Half + && t < y1 + (this.helperProportions.height / 2) // Bottom Half + && y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) + return false; + + return this.floating ? + ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta != 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta != 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor == String + ? [options.connectWith] + : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var self = this; + var items = []; + var queries = []; + var connectWith = this._connectWith(); + + if(connectWith && connected) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); + } + }; + }; + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); + + for (var i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + }; + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); + + for (var i=0; i < this.items.length; i++) { + + for (var j=0; j < list.length; j++) { + if(list[j] == this.items[i].item[0]) + this.items.splice(i,1); + }; + + }; + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + var items = this.items; + var self = this; + var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; + var connectWith = this._connectWith(); + + if(connectWith) { + for (var i = connectWith.length - 1; i >= 0; i--){ + var cur = $(connectWith[i]); + for (var j = cur.length - 1; j >= 0; j--){ + var inst = $.data(cur[j], this.widgetName); + if(inst && inst != this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + }; + }; + } + + for (var i = queries.length - 1; i >= 0; i--) { + var targetData = queries[i][1]; + var _queries = queries[i][0]; + + for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { + var item = $(_queries[j]); + + item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + }; + }; + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + for (var i = this.items.length - 1; i >= 0; i--){ + var item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) + continue; + + var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + var p = t.offset(); + item.left = p.left; + item.top = p.top; + }; + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (var i = this.containers.length - 1; i >= 0; i--){ + var p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + }; + } + + return this; + }, + + _createPlaceholder: function(that) { + + var self = that || this, o = self.options; + + if(!o.placeholder || o.placeholder.constructor == String) { + var className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(self.currentItem[0].nodeName)) + .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) + el.style.visibility = "hidden"; + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) return; + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; + if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; + } + }; + } + + //Create the placeholder + self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); + + //Append it after the actual current item + self.currentItem.after(self.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(self, self.placeholder); + + }, + + _contactContainers: function(event) { + + // get innermost container that intersects with item + var innermostContainer = null, innermostIndex = null; + + + for (var i = this.containers.length - 1; i >= 0; i--){ + + // never consider a container that's located within the item itself + if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) + continue; + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) + continue; + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) return; + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else if(this.currentContainer != this.containers[innermostIndex]) { + + //When entering a new container, we will find the item with the least distance and append our item near it + var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; + for (var j = this.items.length - 1; j >= 0; j--) { + if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; + var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + } + } + + if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled + return; + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); + + if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already + $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + + if(helper[0] == this.currentItem[0]) + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + + if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); + if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj == 'string') { + obj = obj.split(' '); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ('left' in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ('right' in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ('top' in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ('bottom' in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment)) { + var ce = $(o.containment)[0]; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var self = this, counter = this.counter; + + window.setTimeout(function() { + if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + },0); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var delayedTriggers = [], self = this; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); + this._noFinalSort = null; + + if(this.helper[0] == this.currentItem[0]) { + for(var i in this._storedCSS) { + if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element + if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + for (var i = this.containers.length - 1; i >= 0; i--){ + if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + }; + }; + + //Post events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor + if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity + if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + return false; + } + + if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; + + if(!noPropagation) { + for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(inst) { + var self = inst || this; + return { + helper: self.helper, + placeholder: self.placeholder || $([]), + position: self.position, + originalPosition: self.originalPosition, + offset: self.positionAbs, + item: self.currentItem, + sender: inst ? inst.element : null + }; + } + +}); + +$.extend($.ui.sortable, { + version: "1.8.17" +}); + +})(jQuery); diff --git a/app/assets/javascripts/app/lib/ui/jquery.ui.tabs.js b/app/assets/javascripts/app/lib/ui/jquery.ui.tabs.js new file mode 100755 index 000000000..ff7938cef --- /dev/null +++ b/app/assets/javascripts/app/lib/ui/jquery.ui.tabs.js @@ -0,0 +1,758 @@ +/* + * jQuery UI Tabs 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "
    ", + remove: null, + select: null, + show: null, + spinner: "Loading…", + tabTemplate: "
  • #{label}
    • " + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on
  • + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.17" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + t = o.selected; + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); diff --git a/app/assets/javascripts/app/lib/ui/jquery.ui.widget.js b/app/assets/javascripts/app/lib/ui/jquery.ui.widget.js new file mode 100755 index 000000000..facd77b3f --- /dev/null +++ b/app/assets/javascripts/app/lib/ui/jquery.ui.widget.js @@ -0,0 +1,272 @@ +/*! + * jQuery UI Widget 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function( $, undefined ) { + +// jQuery 1.4+ +if ( $.cleanData ) { + var _cleanData = $.cleanData; + $.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); + }; +} else { + var _remove = $.fn.remove; + $.fn.remove = function( selector, keepData ) { + return this.each(function() { + if ( !keepData ) { + if ( !selector || $.filter( selector, [ this ] ).length ) { + $( "*", this ).add( [ this ] ).each(function() { + try { + $( this ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + }); + } + } + return _remove.call( $(this), selector, keepData ); + }); + }; +} + +$.widget = function( name, base, prototype ) { + var namespace = name.split( "." )[ 0 ], + fullName; + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName ] = function( elem ) { + return !!$.data( elem, name ); + }; + + $[ namespace ] = $[ namespace ] || {}; + $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + + var basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from +// $.each( basePrototype, function( key, val ) { +// if ( $.isPlainObject(val) ) { +// basePrototype[ key ] = $.extend( {}, val ); +// } +// }); + basePrototype.options = $.extend( true, {}, basePrototype.options ); + $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { + namespace: namespace, + widgetName: name, + widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, + widgetBaseClass: fullName + }, prototype ); + + $.widget.bridge( name, $[ namespace ][ name ] ); +}; + +$.widget.bridge = function( name, object ) { + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = Array.prototype.slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.extend.apply( null, [ true, options ].concat(args) ) : + options; + + // prevent calls to internal methods + if ( isMethodCall && options.charAt( 0 ) === "_" ) { + return returnValue; + } + + if ( isMethodCall ) { + this.each(function() { + var instance = $.data( this, name ), + methodValue = instance && $.isFunction( instance[options] ) ? + instance[ options ].apply( instance, args ) : + instance; + // TODO: add this back in 1.9 and use $.error() (see #5972) +// if ( !instance ) { +// throw "cannot call methods on " + name + " prior to initialization; " + +// "attempted to call method '" + options + "'"; +// } +// if ( !$.isFunction( instance[options] ) ) { +// throw "no such method '" + options + "' for " + name + " widget instance"; +// } +// var methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, name ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, name, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( options, element ) { + // allow instantiation without initializing for simple inheritance + if ( arguments.length ) { + this._createWidget( options, element ); + } +}; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + options: { + disabled: false + }, + _createWidget: function( options, element ) { + // $.widget.bridge stores the plugin instance, but we do it anyway + // so that it's stored even before the _create function runs + $.data( element, this.widgetName, this ); + this.element = $( element ); + this.options = $.extend( true, {}, + this.options, + this._getCreateOptions(), + options ); + + var self = this; + this.element.bind( "remove." + this.widgetName, function() { + self.destroy(); + }); + + this._create(); + this._trigger( "create" ); + this._init(); + }, + _getCreateOptions: function() { + return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; + }, + _create: function() {}, + _init: function() {}, + + destroy: function() { + this.element + .unbind( "." + this.widgetName ) + .removeData( this.widgetName ); + this.widget() + .unbind( "." + this.widgetName ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetBaseClass + "-disabled " + + "ui-state-disabled" ); + }, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.extend( {}, this.options ); + } + + if (typeof key === "string" ) { + if ( value === undefined ) { + return this.options[ key ]; + } + options = {}; + options[ key ] = value; + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var self = this; + $.each( options, function( key, value ) { + self._setOption( key, value ); + }); + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + [ value ? "addClass" : "removeClass"]( + this.widgetBaseClass + "-disabled" + " " + + "ui-state-disabled" ) + .attr( "aria-disabled", value ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + + return !( $.isFunction(callback) && + callback.call( this.element[0], event, data ) === false || + event.isDefaultPrevented() ); + } +}; + +})( jQuery ); diff --git a/app/assets/javascripts/app/lib/underscore.coffee b/app/assets/javascripts/app/lib/underscore.coffee new file mode 100644 index 000000000..302913cdd --- /dev/null +++ b/app/assets/javascripts/app/lib/underscore.coffee @@ -0,0 +1,682 @@ +# **Underscore.coffee +# (c) 2011 Jeremy Ashkenas, DocumentCloud Inc.** +# Underscore is freely distributable under the terms of the +# [MIT license](http://en.wikipedia.org/wiki/MIT_License). +# Portions of Underscore are inspired by or borrowed from +# [Prototype.js](http://prototypejs.org/api), Oliver Steele's +# [Functional](http://osteele.com), and John Resig's +# [Micro-Templating](http://ejohn.org). +# For all details and documentation: +# http://documentcloud.github.com/underscore/ + + +# Baseline setup +# -------------- + +# Establish the root object, `window` in the browser, or `global` on the server. +root = this + + +# Save the previous value of the `_` variable. +previousUnderscore = root._ + + +# Establish the object that gets thrown to break out of a loop iteration. +# `StopIteration` is SOP on Mozilla. +breaker = if typeof(StopIteration) is 'undefined' then '__break__' else StopIteration + + +# Helper function to escape **RegExp** contents, because JS doesn't have one. +escapeRegExp = (string) -> string.replace(/([.*+?^${}()|[\]\/\\])/g, '\\$1') + + +# Save bytes in the minified (but not gzipped) version: +ArrayProto = Array.prototype +ObjProto = Object.prototype + + +# Create quick reference variables for speed access to core prototypes. +slice = ArrayProto.slice +unshift = ArrayProto.unshift +toString = ObjProto.toString +hasOwnProperty = ObjProto.hasOwnProperty +propertyIsEnumerable = ObjProto.propertyIsEnumerable + + +# All **ECMA5** native implementations we hope to use are declared here. +nativeForEach = ArrayProto.forEach +nativeMap = ArrayProto.map +nativeReduce = ArrayProto.reduce +nativeReduceRight = ArrayProto.reduceRight +nativeFilter = ArrayProto.filter +nativeEvery = ArrayProto.every +nativeSome = ArrayProto.some +nativeIndexOf = ArrayProto.indexOf +nativeLastIndexOf = ArrayProto.lastIndexOf +nativeIsArray = Array.isArray +nativeKeys = Object.keys + + +# Create a safe reference to the Underscore object for use below. +_ = (obj) -> new wrapper(obj) + + +# Export the Underscore object for **CommonJS**. +if typeof(exports) != 'undefined' then exports._ = _ + + +# Export Underscore to global scope. +root._ = _ + + +# Current version. +_.VERSION = '1.1.0' + + +# Collection Functions +# -------------------- + +# The cornerstone, an **each** implementation. +# Handles objects implementing **forEach**, arrays, and raw objects. +_.each = (obj, iterator, context) -> + try + if nativeForEach and obj.forEach is nativeForEach + obj.forEach iterator, context + else if _.isNumber obj.length + iterator.call context, obj[i], i, obj for i in [0...obj.length] + else + iterator.call context, val, key, obj for own key, val of obj + catch e + throw e if e isnt breaker + obj + + +# Return the results of applying the iterator to each element. Use JavaScript +# 1.6's version of **map**, if possible. +_.map = (obj, iterator, context) -> + return obj.map(iterator, context) if nativeMap and obj.map is nativeMap + results = [] + _.each obj, (value, index, list) -> + results.push iterator.call context, value, index, list + results + + +# **Reduce** builds up a single result from a list of values. Also known as +# **inject**, or **foldl**. Uses JavaScript 1.8's version of **reduce**, if possible. +_.reduce = (obj, iterator, memo, context) -> + if nativeReduce and obj.reduce is nativeReduce + iterator = _.bind iterator, context if context + return obj.reduce iterator, memo + _.each obj, (value, index, list) -> + memo = iterator.call context, memo, value, index, list + memo + + +# The right-associative version of **reduce**, also known as **foldr**. Uses +# JavaScript 1.8's version of **reduceRight**, if available. +_.reduceRight = (obj, iterator, memo, context) -> + if nativeReduceRight and obj.reduceRight is nativeReduceRight + iterator = _.bind iterator, context if context + return obj.reduceRight iterator, memo + reversed = _.clone(_.toArray(obj)).reverse() + _.reduce reversed, iterator, memo, context + + +# Return the first value which passes a truth test. +_.detect = (obj, iterator, context) -> + result = null + _.each obj, (value, index, list) -> + if iterator.call context, value, index, list + result = value + _.breakLoop() + result + + +# Return all the elements that pass a truth test. Use JavaScript 1.6's +# **filter**, if it exists. +_.filter = (obj, iterator, context) -> + return obj.filter iterator, context if nativeFilter and obj.filter is nativeFilter + results = [] + _.each obj, (value, index, list) -> + results.push value if iterator.call context, value, index, list + results + + +# Return all the elements for which a truth test fails. +_.reject = (obj, iterator, context) -> + results = [] + _.each obj, (value, index, list) -> + results.push value if not iterator.call context, value, index, list + results + + +# Determine whether all of the elements match a truth test. Delegate to +# JavaScript 1.6's **every**, if it is present. +_.every = (obj, iterator, context) -> + iterator ||= _.identity + return obj.every iterator, context if nativeEvery and obj.every is nativeEvery + result = true + _.each obj, (value, index, list) -> + _.breakLoop() unless (result = result and iterator.call(context, value, index, list)) + result + + +# Determine if at least one element in the object matches a truth test. Use +# JavaScript 1.6's **some**, if it exists. +_.some = (obj, iterator, context) -> + iterator ||= _.identity + return obj.some iterator, context if nativeSome and obj.some is nativeSome + result = false + _.each obj, (value, index, list) -> + _.breakLoop() if (result = iterator.call(context, value, index, list)) + result + + +# Determine if a given value is included in the array or object, +# based on `===`. +_.include = (obj, target) -> + return _.indexOf(obj, target) isnt -1 if nativeIndexOf and obj.indexOf is nativeIndexOf + return true for own key, val of obj when val is target + false + + +# Invoke a method with arguments on every item in a collection. +_.invoke = (obj, method) -> + args = _.rest arguments, 2 + (if method then val[method] else val).apply(val, args) for val in obj + + +# Convenience version of a common use case of **map**: fetching a property. +_.pluck = (obj, key) -> + _.map(obj, (val) -> val[key]) + + +# Return the maximum item or (item-based computation). +_.max = (obj, iterator, context) -> + return Math.max.apply(Math, obj) if not iterator and _.isArray(obj) + result = computed: -Infinity + _.each obj, (value, index, list) -> + computed = if iterator then iterator.call(context, value, index, list) else value + computed >= result.computed and (result = {value: value, computed: computed}) + result.value + + +# Return the minimum element (or element-based computation). +_.min = (obj, iterator, context) -> + return Math.min.apply(Math, obj) if not iterator and _.isArray(obj) + result = computed: Infinity + _.each obj, (value, index, list) -> + computed = if iterator then iterator.call(context, value, index, list) else value + computed < result.computed and (result = {value: value, computed: computed}) + result.value + + +# Sort the object's values by a criterion produced by an iterator. +_.sortBy = (obj, iterator, context) -> + _.pluck(((_.map obj, (value, index, list) -> + {value: value, criteria: iterator.call(context, value, index, list)} + ).sort((left, right) -> + a = left.criteria; b = right.criteria + if a < b then -1 else if a > b then 1 else 0 + )), 'value') + + +# Use a comparator function to figure out at what index an object should +# be inserted so as to maintain order. Uses binary search. +_.sortedIndex = (array, obj, iterator) -> + iterator ||= _.identity + low = 0 + high = array.length + while low < high + mid = (low + high) >> 1 + if iterator(array[mid]) < iterator(obj) then low = mid + 1 else high = mid + low + + +# Convert anything iterable into a real, live array. +_.toArray = (iterable) -> + return [] if (!iterable) + return iterable.toArray() if (iterable.toArray) + return iterable if (_.isArray(iterable)) + return slice.call(iterable) if (_.isArguments(iterable)) + _.values(iterable) + + +# Return the number of elements in an object. +_.size = (obj) -> _.toArray(obj).length + + +# Array Functions +# --------------- + +# Get the first element of an array. Passing `n` will return the first N +# values in the array. Aliased as **head**. The `guard` check allows it to work +# with **map**. +_.first = (array, n, guard) -> + if n and not guard then slice.call(array, 0, n) else array[0] + + +# Returns everything but the first entry of the array. Aliased as **tail**. +# Especially useful on the arguments object. Passing an `index` will return +# the rest of the values in the array from that index onward. The `guard` +# check allows it to work with **map**. +_.rest = (array, index, guard) -> + slice.call(array, if _.isUndefined(index) or guard then 1 else index) + + +# Get the last element of an array. +_.last = (array) -> array[array.length - 1] + + +# Trim out all falsy values from an array. +_.compact = (array) -> item for item in array when item + + +# Return a completely flattened version of an array. +_.flatten = (array) -> + _.reduce array, (memo, value) -> + return memo.concat(_.flatten(value)) if _.isArray value + memo.push value + memo + , [] + + +# Return a version of the array that does not contain the specified value(s). +_.without = (array) -> + values = _.rest arguments + val for val in _.toArray(array) when not _.include values, val + + +# Produce a duplicate-free version of the array. If the array has already +# been sorted, you have the option of using a faster algorithm. +_.uniq = (array, isSorted) -> + memo = [] + for el, i in _.toArray array + memo.push el if i is 0 || (if isSorted is true then _.last(memo) isnt el else not _.include(memo, el)) + memo + + +# Produce an array that contains every item shared between all the +# passed-in arrays. +_.intersect = (array) -> + rest = _.rest arguments + _.select _.uniq(array), (item) -> + _.all rest, (other) -> + _.indexOf(other, item) >= 0 + + +# Zip together multiple lists into a single array -- elements that share +# an index go together. +_.zip = -> + length = _.max _.pluck arguments, 'length' + results = new Array length + for i in [0...length] + results[i] = _.pluck arguments, String i + results + + +# If the browser doesn't supply us with **indexOf** (I'm looking at you, MSIE), +# we need this function. Return the position of the first occurrence of an +# item in an array, or -1 if the item is not included in the array. +_.indexOf = (array, item) -> + return array.indexOf item if nativeIndexOf and array.indexOf is nativeIndexOf + i = 0; l = array.length + while l - i + if array[i] is item then return i else i++ + -1 + + +# Provide JavaScript 1.6's **lastIndexOf**, delegating to the native function, +# if possible. +_.lastIndexOf = (array, item) -> + return array.lastIndexOf(item) if nativeLastIndexOf and array.lastIndexOf is nativeLastIndexOf + i = array.length + while i + if array[i] is item then return i else i-- + -1 + + +# Generate an integer Array containing an arithmetic progression. A port of +# [the native Python **range** function](http://docs.python.org/library/functions.html#range). +_.range = (start, stop, step) -> + a = arguments + solo = a.length <= 1 + i = start = if solo then 0 else a[0] + stop = if solo then a[0] else a[1] + step = a[2] or 1 + len = Math.ceil((stop - start) / step) + return [] if len <= 0 + range = new Array len + idx = 0 + loop + return range if (if step > 0 then i - stop else stop - i) >= 0 + range[idx] = i + idx++ + i+= step + + +# Function Functions +# ------------------ + +# Create a function bound to a given object (assigning `this`, and arguments, +# optionally). Binding with arguments is also known as **curry**. +_.bind = (func, obj) -> + args = _.rest arguments, 2 + -> func.apply obj or root, args.concat arguments + + +# Bind all of an object's methods to that object. Useful for ensuring that +# all callbacks defined on an object belong to it. +_.bindAll = (obj) -> + funcs = if arguments.length > 1 then _.rest(arguments) else _.functions(obj) + _.each funcs, (f) -> obj[f] = _.bind obj[f], obj + obj + + +# Delays a function for the given number of milliseconds, and then calls +# it with the arguments supplied. +_.delay = (func, wait) -> + args = _.rest arguments, 2 + setTimeout((-> func.apply(func, args)), wait) + + +# Memoize an expensive function by storing its results. +_.memoize = (func, hasher) -> + memo = {} + hasher or= _.identity + -> + key = hasher.apply this, arguments + return memo[key] if key of memo + memo[key] = func.apply this, arguments + + +# Defers a function, scheduling it to run after the current call stack has +# cleared. +_.defer = (func) -> + _.delay.apply _, [func, 1].concat _.rest arguments + + +# Returns the first function passed as an argument to the second, +# allowing you to adjust arguments, run code before and after, and +# conditionally execute the original function. +_.wrap = (func, wrapper) -> + -> wrapper.apply wrapper, [func].concat arguments + + +# Returns a function that is the composition of a list of functions, each +# consuming the return value of the function that follows. +_.compose = -> + funcs = arguments + -> + args = arguments + for i in [funcs.length - 1..0] by -1 + args = [funcs[i].apply(this, args)] + args[0] + + +# Object Functions +# ---------------- + +# Retrieve the names of an object's properties. +_.keys = nativeKeys or (obj) -> + return _.range 0, obj.length if _.isArray(obj) + key for key, val of obj + + +# Retrieve the values of an object's properties. +_.values = (obj) -> + _.map obj, _.identity + + +# Return a sorted list of the function names available in Underscore. +_.functions = (obj) -> + _.filter(_.keys(obj), (key) -> _.isFunction(obj[key])).sort() + + +# Extend a given object with all of the properties in a source object. +_.extend = (obj) -> + for source in _.rest(arguments) + obj[key] = val for key, val of source + obj + + +# Create a (shallow-cloned) duplicate of an object. +_.clone = (obj) -> + return obj.slice 0 if _.isArray obj + _.extend {}, obj + + +# Invokes interceptor with the obj, and then returns obj. +# The primary purpose of this method is to "tap into" a method chain, in order to perform operations on intermediate results within the chain. +_.tap = (obj, interceptor) -> + interceptor obj + obj + + +# Perform a deep comparison to check if two objects are equal. +_.isEqual = (a, b) -> + # Check object identity. + return true if a is b + # Different types? + atype = typeof(a); btype = typeof(b) + return false if atype isnt btype + # Basic equality test (watch out for coercions). + return true if `a == b` + # One is falsy and the other truthy. + return false if (!a and b) or (a and !b) + # One of them implements an `isEqual()`? + return a.isEqual(b) if a.isEqual + # Check dates' integer values. + return a.getTime() is b.getTime() if _.isDate(a) and _.isDate(b) + # Both are NaN? + return false if _.isNaN(a) and _.isNaN(b) + # Compare regular expressions. + if _.isRegExp(a) and _.isRegExp(b) + return a.source is b.source and + a.global is b.global and + a.ignoreCase is b.ignoreCase and + a.multiline is b.multiline + # If a is not an object by this point, we can't handle it. + return false if atype isnt 'object' + # Check for different array lengths before comparing contents. + return false if a.length and (a.length isnt b.length) + # Nothing else worked, deep compare the contents. + aKeys = _.keys(a); bKeys = _.keys(b) + # Different object sizes? + return false if aKeys.length isnt bKeys.length + # Recursive comparison of contents. + return false for key, val of a when !(key of b) or !_.isEqual(val, b[key]) + true + + +# Is a given array or object empty? +_.isEmpty = (obj) -> + return obj.length is 0 if _.isArray(obj) or _.isString(obj) + return false for own key of obj + true + + +# Is a given value a DOM element? +_.isElement = (obj) -> obj and obj.nodeType is 1 + + +# Is a given value an array? +_.isArray = nativeIsArray or (obj) -> !!(obj and obj.concat and obj.unshift and not obj.callee) + + +# Is a given variable an arguments object? +_.isArguments = (obj) -> obj and obj.callee + + +# Is the given value a function? +_.isFunction = (obj) -> !!(obj and obj.constructor and obj.call and obj.apply) + + +# Is the given value a string? +_.isString = (obj) -> !!(obj is '' or (obj and obj.charCodeAt and obj.substr)) + + +# Is a given value a number? +_.isNumber = (obj) -> (obj is +obj) or toString.call(obj) is '[object Number]' + + +# Is a given value a boolean? +_.isBoolean = (obj) -> obj is true or obj is false + + +# Is a given value a Date? +_.isDate = (obj) -> !!(obj and obj.getTimezoneOffset and obj.setUTCFullYear) + + +# Is the given value a regular expression? +_.isRegExp = (obj) -> !!(obj and obj.exec and (obj.ignoreCase or obj.ignoreCase is false)) + + +# Is the given value NaN -- this one is interesting. `NaN != NaN`, and +# `isNaN(undefined) == true`, so we make sure it's a number first. +_.isNaN = (obj) -> _.isNumber(obj) and window.isNaN(obj) + + +# Is a given value equal to null? +_.isNull = (obj) -> obj is null + + +# Is a given variable undefined? +_.isUndefined = (obj) -> typeof obj is 'undefined' + + +# Utility Functions +# ----------------- + +# Run Underscore.js in noConflict mode, returning the `_` variable to its +# previous owner. Returns a reference to the Underscore object. +_.noConflict = -> + root._ = previousUnderscore + this + + +# Keep the identity function around for default iterators. +_.identity = (value) -> value + + +# Run a function `n` times. +_.times = (n, iterator, context) -> + iterator.call context, i for i in [0...n] + + +# Break out of the middle of an iteration. +_.breakLoop = -> throw breaker + + +# Add your own custom functions to the Underscore object, ensuring that +# they're correctly added to the OOP wrapper as well. +_.mixin = (obj) -> + for name in _.functions(obj) + addToWrapper name, _[name] = obj[name] + + +# Generate a unique integer id (unique within the entire client session). +# Useful for temporary DOM ids. +idCounter = 0 +_.uniqueId = (prefix) -> + (prefix or '') + idCounter++ + + +# By default, Underscore uses **ERB**-style template delimiters, change the +# following template settings to use alternative delimiters. +_.templateSettings = { + start: '<%' + end: '%>' + interpolate: /<%=(.+?)%>/g +} + + +# JavaScript templating a-la **ERB**, pilfered from John Resig's +# *Secrets of the JavaScript Ninja*, page 83. +# Single-quote fix from Rick Strahl. +# With alterations for arbitrary delimiters, and to preserve whitespace. +_.template = (str, data) -> + c = _.templateSettings + endMatch = new RegExp("'(?=[^"+c.end.substr(0, 1)+"]*"+escapeRegExp(c.end)+")","g") + fn = new Function 'obj', + 'var p=[],print=function(){p.push.apply(p,arguments);};' + + 'with(obj||{}){p.push(\'' + + str.replace(/\r/g, '\\r') + .replace(/\n/g, '\\n') + .replace(/\t/g, '\\t') + .replace(endMatch,"✄") + .split("'").join("\\'") + .split("✄").join("'") + .replace(c.interpolate, "',$1,'") + .split(c.start).join("');") + .split(c.end).join("p.push('") + + "');}return p.join('');" + if data then fn(data) else fn + + +# Aliases +# ------- + +_.forEach = _.each +_.foldl = _.inject = _.reduce +_.foldr = _.reduceRight +_.select = _.filter +_.all = _.every +_.any = _.some +_.contains = _.include +_.head = _.first +_.tail = _.rest +_.methods = _.functions + + +# Setup the OOP Wrapper +# --------------------- + +# If Underscore is called as a function, it returns a wrapped object that +# can be used OO-style. This wrapper holds altered versions of all the +# underscore functions. Wrapped objects may be chained. +wrapper = (obj) -> + this._wrapped = obj + this + + +# Helper function to continue chaining intermediate results. +result = (obj, chain) -> + if chain then _(obj).chain() else obj + + +# A method to easily add functions to the OOP wrapper. +addToWrapper = (name, func) -> + wrapper.prototype[name] = -> + args = _.toArray arguments + unshift.call args, this._wrapped + result func.apply(_, args), this._chain + + +# Add all ofthe Underscore functions to the wrapper object. +_.mixin _ + + +# Add all mutator Array functions to the wrapper. +_.each ['pop', 'push', 'reverse', 'shift', 'sort', 'splice', 'unshift'], (name) -> + method = Array.prototype[name] + wrapper.prototype[name] = -> + method.apply(this._wrapped, arguments) + result(this._wrapped, this._chain) + + +# Add all accessor Array functions to the wrapper. +_.each ['concat', 'join', 'slice'], (name) -> + method = Array.prototype[name] + wrapper.prototype[name] = -> + result(method.apply(this._wrapped, arguments), this._chain) + + +# Start chaining a wrapped Underscore object. +wrapper::chain = -> + this._chain = true + this + + +# Extracts the result from a wrapped and chained object. +wrapper::value = -> this._wrapped diff --git a/app/assets/javascripts/app/models/.gitkeep b/app/assets/javascripts/app/models/.gitkeep new file mode 100644 index 000000000..e69de29bb diff --git a/app/assets/javascripts/app/models/application_model.js.coffee b/app/assets/javascripts/app/models/application_model.js.coffee new file mode 100644 index 000000000..6747e62dd --- /dev/null +++ b/app/assets/javascripts/app/models/application_model.js.coffee @@ -0,0 +1,32 @@ +class App.Model extends Spine.Model + + validate: (data = {}) -> +# console.log 'vali', @ +# console.log 'vali', params, '@', @ +# console.log 'validate', params, @configure_attributes, @, App.User.configure_attributes + # check if @constructor.configure_attributes is used + return if !@constructor.configure_attributes + + errors = {} + for attribute in @constructor.configure_attributes + if !attribute.readonly + + # check required + if 'null' of attribute && !attribute[null] && !@[attribute.name] + errors[attribute.name] = 'is required' + + # check confirm password + if data.form && attribute.type is 'password' && @[attribute.name] + + # get confirm password + if @[attribute.name] isnt @["#{attribute.name}_confirm"] + console.log 'aaa', @[attribute.name], @["#{attribute.name}_confirm"], attribute[null] + errors[attribute.name] = 'didn\'t match' + errors["#{attribute.name}_confirm"] = '' + + # return error object + for key, msg of errors +# console.log 'e', errors + return errors + + return \ No newline at end of file diff --git a/app/assets/javascripts/app/models/group.js.coffee b/app/assets/javascripts/app/models/group.js.coffee new file mode 100644 index 000000000..5f5864740 --- /dev/null +++ b/app/assets/javascripts/app/models/group.js.coffee @@ -0,0 +1,12 @@ +class App.Group extends App.Model + @configure 'Group', 'name', 'note', 'active' + @extend Spine.Model.Ajax + @configure_attributes = [ + { name: 'name', display: 'Name', tag: 'input', type: 'text', limit: 100, 'null': false, 'class': 'xlarge' }, + { name: 'note', display: 'Note', note: 'Notes are visible to agents only, never to customers.', tag: 'textarea', limit: 250, 'null': true, 'class': 'xlarge' }, + { name: 'updated_at', display: 'Updated', type: 'time', readonly: 1 }, + { name: 'active', display: 'Active', tag: 'boolean', type: 'boolean', 'default': true, 'null': false, 'class': 'xlarge' }, + ] + @configure_overview = [ + 'name', + ] diff --git a/app/assets/javascripts/app/models/history.js.coffee b/app/assets/javascripts/app/models/history.js.coffee new file mode 100644 index 000000000..2c4b2cc17 --- /dev/null +++ b/app/assets/javascripts/app/models/history.js.coffee @@ -0,0 +1,4 @@ +class App.History extends App.Model + @configure 'History', 'name' + @extend Spine.Model.Ajax + @url: '/histories' diff --git a/app/assets/javascripts/app/models/history_attributes.js.coffee b/app/assets/javascripts/app/models/history_attributes.js.coffee new file mode 100644 index 000000000..8d720b912 --- /dev/null +++ b/app/assets/javascripts/app/models/history_attributes.js.coffee @@ -0,0 +1,4 @@ +class App.HistoryAttribute extends App.Model + @configure 'HistoryAttribute', 'name' + @extend Spine.Model.Ajax + @url: '/history_attributes' diff --git a/app/assets/javascripts/app/models/history_object.js.coffee b/app/assets/javascripts/app/models/history_object.js.coffee new file mode 100644 index 000000000..b2ebcf859 --- /dev/null +++ b/app/assets/javascripts/app/models/history_object.js.coffee @@ -0,0 +1,4 @@ +class App.HistoryObject extends App.Model + @configure 'HistoryObject', 'name' + @extend Spine.Model.Ajax + @url: '/history_objects' diff --git a/app/assets/javascripts/app/models/history_type.js.coffee b/app/assets/javascripts/app/models/history_type.js.coffee new file mode 100644 index 000000000..d35389730 --- /dev/null +++ b/app/assets/javascripts/app/models/history_type.js.coffee @@ -0,0 +1,4 @@ +class App.HistoryType extends App.Model + @configure 'HistoryType', 'name' + @extend Spine.Model.Ajax + @url: '/history_types' diff --git a/app/assets/javascripts/app/models/network.js.coffee b/app/assets/javascripts/app/models/network.js.coffee new file mode 100644 index 000000000..4dec6f397 --- /dev/null +++ b/app/assets/javascripts/app/models/network.js.coffee @@ -0,0 +1,9 @@ +class App.Network extends App.Model + @configure 'Network', 'name', 'note', 'active' + @extend Spine.Model.Ajax + @configure_attributes = [ + { name: 'name', display: 'Name', tag: 'input', type: 'text', limit: 100, 'null': false, 'class': 'xlarge' }, + { name: 'note', display: 'Note', note: 'Notes are visible to agents only, never to customers.', tag: 'textarea', limit: 250, 'null': true, 'class': 'xlarge' }, + { name: 'updated_at', display: 'Updated', type: 'time', readonly: 1 }, + { name: 'active', display: 'Active', tag: 'boolean', type: 'boolean', 'default': true, 'null': false, 'class': 'xlarge' }, + ] diff --git a/app/assets/javascripts/app/models/network_category.js.coffee b/app/assets/javascripts/app/models/network_category.js.coffee new file mode 100644 index 000000000..e46f1de1a --- /dev/null +++ b/app/assets/javascripts/app/models/network_category.js.coffee @@ -0,0 +1,3 @@ +class App.NetworkCategory extends App.Model + @configure 'NetworkCategory', 'name', 'network_id', 'network_category_type_id', 'network_privacy_id', 'note', 'allow_comments', 'active' + @extend Spine.Model.Ajax diff --git a/app/assets/javascripts/app/models/network_category_type.js.coffee b/app/assets/javascripts/app/models/network_category_type.js.coffee new file mode 100644 index 000000000..77f7f26f5 --- /dev/null +++ b/app/assets/javascripts/app/models/network_category_type.js.coffee @@ -0,0 +1,3 @@ +class App.NetworkCategoryType extends App.Model + @configure 'NetworkCategoryType', 'name', 'note', 'active' + @extend Spine.Model.Ajax diff --git a/app/assets/javascripts/app/models/network_privacy.js.coffee b/app/assets/javascripts/app/models/network_privacy.js.coffee new file mode 100644 index 000000000..839052311 --- /dev/null +++ b/app/assets/javascripts/app/models/network_privacy.js.coffee @@ -0,0 +1,3 @@ +class App.NetworkPrivacy extends App.Model + @configure 'NetworkPrivacy', 'name', 'key' + @extend Spine.Model.Ajax diff --git a/app/assets/javascripts/app/models/organization.js.coffee b/app/assets/javascripts/app/models/organization.js.coffee new file mode 100644 index 000000000..6fd469baa --- /dev/null +++ b/app/assets/javascripts/app/models/organization.js.coffee @@ -0,0 +1,13 @@ +class App.Organization extends App.Model + @configure 'Organization', 'name', 'shared', 'note', 'active' + @extend Spine.Model.Ajax + @configure_attributes = [ + { name: 'name', display: 'Name', tag: 'input', type: 'text', limit: 100, 'null': false, 'class': 'xlarge' }, + { name: 'note', display: 'Note', note: 'Notes are visible to agents only, never to customers.', tag: 'textarea', limit: 250, 'null': true, 'class': 'xlarge' }, + { name: 'shared', display: 'Shared organiztion', note: 'Customers in the organiztion can view each other items.', tag: 'boolean', type: 'boolean', 'default': true, 'null': false, 'class': 'xlarge' }, + { name: 'updated_at', display: 'Updated', type: 'time', readonly: 1 }, + { name: 'active', display: 'Active', tag: 'boolean', type: 'boolean', 'default': true, 'null': false, 'class': 'xlarge' }, + ] + @configure_overview = [ + 'name', 'shared', + ] diff --git a/app/assets/javascripts/app/models/overview.js.coffee b/app/assets/javascripts/app/models/overview.js.coffee new file mode 100644 index 000000000..7782bee41 --- /dev/null +++ b/app/assets/javascripts/app/models/overview.js.coffee @@ -0,0 +1,3 @@ +class App.Overview extends Spine.Model + @configure 'Overview', 'name', 'meta', 'condition', 'order', 'view', 'user_id', 'group_ids' + @extend Spine.Model.Ajax \ No newline at end of file diff --git a/app/assets/javascripts/app/models/post.js.coffee b/app/assets/javascripts/app/models/post.js.coffee new file mode 100644 index 000000000..651322ccf --- /dev/null +++ b/app/assets/javascripts/app/models/post.js.coffee @@ -0,0 +1,3 @@ +class App.Post extends App.Model + @configure 'Post', 'title', 'content' + @extend Spine.Model.Ajax \ No newline at end of file diff --git a/app/assets/javascripts/app/models/role.js.coffee b/app/assets/javascripts/app/models/role.js.coffee new file mode 100644 index 000000000..d4e11e85c --- /dev/null +++ b/app/assets/javascripts/app/models/role.js.coffee @@ -0,0 +1,12 @@ +class App.Role extends App.Model + @configure 'Role', 'name', 'note', 'active' + @extend Spine.Model.Ajax + @configure_attributes = [ + { name: 'name', display: 'Name', tag: 'input', type: 'text', limit: 100, 'null': false, 'class': 'xlarge' }, + { name: 'note', display: 'Note', note: 'Notes are visible to agents only, never to customers.', tag: 'textarea', limit: 250, 'null': true, 'class': 'xlarge' }, + { name: 'updated_at', display: 'Updated', type: 'time', readonly: 1 }, + { name: 'active', display: 'Active', tag: 'boolean', type: 'boolean', 'default': true, 'null': false, 'class': 'xlarge' }, + ] + @configure_overview = [ + 'name', + ] diff --git a/app/assets/javascripts/app/models/session.js.coffee b/app/assets/javascripts/app/models/session.js.coffee new file mode 100644 index 000000000..ffe6f59d8 --- /dev/null +++ b/app/assets/javascripts/app/models/session.js.coffee @@ -0,0 +1,3 @@ +class App.Session extends App.Model + @configure 'Session', 'data' + @extend Spine.Model.Ajax diff --git a/app/assets/javascripts/app/models/setting.js.coffee b/app/assets/javascripts/app/models/setting.js.coffee new file mode 100644 index 000000000..09bdd3e05 --- /dev/null +++ b/app/assets/javascripts/app/models/setting.js.coffee @@ -0,0 +1,3 @@ +class App.Setting extends App.Model + @configure 'Setting', 'name', 'state' + @extend Spine.Model.Ajax \ No newline at end of file diff --git a/app/assets/javascripts/app/models/ticket.js.coffee b/app/assets/javascripts/app/models/ticket.js.coffee new file mode 100644 index 000000000..b6069b34a --- /dev/null +++ b/app/assets/javascripts/app/models/ticket.js.coffee @@ -0,0 +1,19 @@ +class App.Ticket extends App.Model + @configure 'Ticket', 'number', 'title', 'group_id', 'owner_id', 'customer_id', 'ticket_state_id', 'ticket_priority_id' + @extend Spine.Model.Ajax +# @url: '/tickets' + @configure_attributes = [ + { name: 'number', display: '#', tag: 'input', type: 'text', limit: 100, null: true, read_only: true }, + { name: 'customer_id', display: 'Customer', tag: 'input', type: 'text', limit: 100, null: false, class: 'span8', autocapitalize: false, help: 'Select the customer of the Ticket or create one.', link: '»' }, + { name: 'group_id', display: 'Group', tag: 'select', multiple: false, limit: 100, null: false, class: 'span8', relation: 'Group', }, + { name: 'owner_id', display: 'Owner', tag: 'select', multiple: false, limit: 100, null: true, class: 'span8', relation: 'User', }, + { name: 'title', display: 'Title', tag: 'input', type: 'text', limit: 100, null: false, class: 'span8', }, + { name: 'ticket_state_id', display: 'State', tag: 'select', multiple: false, null: false, relation: 'TicketState', default: 'new', class: 'medium' }, + { name: 'ticket_priority_id', display: 'Priority', tag: 'select', multiple: false, null: false, relation: 'TicketPriority', default: '2 normal', class: 'medium' }, + { name: 'created_at', display: 'Created', tag: 'time', }, + { name: 'last_contact', display: 'Last contact', tag: 'time', null: true }, + { name: 'last_contact_agent', display: 'Last contact (Agent)', tag: 'time', null: true }, + { name: 'last_contact_customer', display: 'Last contact (Customer)', tag: 'time', null: true }, + { name: 'first_response', display: 'First response', tag: 'time', null: true }, + { name: 'close_time', display: 'Close time', tag: 'time', null: true }, + ] \ No newline at end of file diff --git a/app/assets/javascripts/app/models/ticket_article.js.coffee b/app/assets/javascripts/app/models/ticket_article.js.coffee new file mode 100644 index 000000000..2280257ea --- /dev/null +++ b/app/assets/javascripts/app/models/ticket_article.js.coffee @@ -0,0 +1,15 @@ +class App.TicketArticle extends App.Model + @configure 'TicketArticle', 'from', 'to', 'cc', 'subject', 'body', 'ticket_id', 'ticket_article_type_id', 'ticket_article_sender_id', 'internal', 'in_reply_to' + @extend Spine.Model.Ajax + @url: '/ticket_articles' + @configure_attributes = [ + { name: 'ticket_id', display: 'TicketID', null: false, readonly: 1, }, + { name: 'from', display: 'From', tag: 'input', type: 'text', limit: 100, null: false, class: 'span8', }, + { name: 'to', display: 'To', tag: 'input', type: 'text', limit: 100, null: true, class: 'span8', }, + { name: 'cc', display: 'Cc', tag: 'input', type: 'text', limit: 100, null: true, class: 'span8', }, + { name: 'subject', display: 'Subject', tag: 'input', type: 'text', limit: 100, null: true, class: 'span8', }, + { name: 'body', display: 'Text', tag: 'textarea', rows: 5, limit: 100, null: false, class: 'span8', }, + { name: 'ticket_article_type_id', display: 'Type', tag: 'select', multiple: false, null: false, relation: 'TicketArticleType', default: '', class: 'medium' }, + { name: 'ticket_article_sender_id', display: 'Sender', tag: 'select', multiple: false, null: false, relation: 'TicketArticleSender', default: '', class: 'medium' }, + { name: 'internal', display: 'Visability', tag: 'radio', default: false, null: true, options: { true: 'internal', false: 'public' }, class: 'medium' }, + ] \ No newline at end of file diff --git a/app/assets/javascripts/app/models/ticket_article_sender.js.coffee b/app/assets/javascripts/app/models/ticket_article_sender.js.coffee new file mode 100644 index 000000000..b7f95672c --- /dev/null +++ b/app/assets/javascripts/app/models/ticket_article_sender.js.coffee @@ -0,0 +1,4 @@ +class App.TicketArticleSender extends App.Model + @configure 'TicketArticleSender', 'name' + @extend Spine.Model.Ajax + @url: '/ticket_article_senders' diff --git a/app/assets/javascripts/app/models/ticket_article_type.js.coffee b/app/assets/javascripts/app/models/ticket_article_type.js.coffee new file mode 100644 index 000000000..007dc2f53 --- /dev/null +++ b/app/assets/javascripts/app/models/ticket_article_type.js.coffee @@ -0,0 +1,4 @@ +class App.TicketArticleType extends App.Model + @configure 'TicketArticleType', 'name' + @extend Spine.Model.Ajax + @url: '/ticket_article_types' diff --git a/app/assets/javascripts/app/models/ticket_priority.js.coffee b/app/assets/javascripts/app/models/ticket_priority.js.coffee new file mode 100644 index 000000000..6d54b4d28 --- /dev/null +++ b/app/assets/javascripts/app/models/ticket_priority.js.coffee @@ -0,0 +1,4 @@ +class App.TicketPriority extends App.Model + @configure 'TicketPriority', 'name', 'note', 'active' + @extend Spine.Model.Ajax + @url: '/ticket_priorities' diff --git a/app/assets/javascripts/app/models/ticket_state.js.coffee b/app/assets/javascripts/app/models/ticket_state.js.coffee new file mode 100644 index 000000000..56e7aa4e2 --- /dev/null +++ b/app/assets/javascripts/app/models/ticket_state.js.coffee @@ -0,0 +1,4 @@ +class App.TicketState extends App.Model + @configure 'TicketState', 'name', 'note', 'active' + @extend Spine.Model.Ajax + @url: '/ticket_states' diff --git a/app/assets/javascripts/app/models/ticket_state_type.js.coffee b/app/assets/javascripts/app/models/ticket_state_type.js.coffee new file mode 100644 index 000000000..d7c0b9342 --- /dev/null +++ b/app/assets/javascripts/app/models/ticket_state_type.js.coffee @@ -0,0 +1,4 @@ +class App.TicketStateType extends App.Model + @configure 'TicketStateType', 'name', 'note', 'active' + @extend Spine.Model.Ajax + @url: '/ticket_state_types' diff --git a/app/assets/javascripts/app/models/user.js.coffee b/app/assets/javascripts/app/models/user.js.coffee new file mode 100644 index 000000000..59152de76 --- /dev/null +++ b/app/assets/javascripts/app/models/user.js.coffee @@ -0,0 +1,25 @@ +class App.User extends App.Model + @configure 'User', 'login', 'firstname', 'lastname', 'email', 'web', 'password', 'phone', 'fax', 'mobile', 'street', 'zip', 'city', 'country', 'organization_id', 'note', 'role_ids', 'group_ids', 'active', 'invite' + @extend Spine.Model.Ajax +# @hasMany 'roles', 'App.Role' + @configure_attributes = [ + { name: 'login', display: 'Login', tag: 'input', type: 'text', limit: 100, null: false, class: 'xlarge', autocapitalize: false, signup: false, quick: false }, + { name: 'firstname', display: 'Firstname', tag: 'input', type: 'text', limit: 100, null: false, class: 'xlarge', signup: true, quick: true, info: true, invite_agent: true }, + { name: 'lastname', display: 'Lastname', tag: 'input', type: 'text', limit: 100, null: false, class: 'xlarge', signup: true, quick: true, info: true, invite_agent: true }, + { name: 'email', display: 'Email', tag: 'input', type: 'email', limit: 100, null: false, class: 'xlarge', signup: true, quick: true, info: true, invite_agent: true }, + { name: 'web', display: 'Web', tag: 'input', type: 'url', limit: 100, null: true, class: 'xlarge', signup: false, quick: true, info: true }, + { name: 'phone', display: 'Phone', tag: 'input', type: 'phone', limit: 100, null: true, class: 'xlarge', signup: false, quick: true, info: true }, + { name: 'mobile', display: 'Mobile', tag: 'input', type: 'phone', limit: 100, null: true, class: 'xlarge', signup: false, quick: true, info: true }, + { name: 'fax', display: 'Fax', tag: 'input', type: 'phone', limit: 100, null: true, class: 'xlarge', signup: false, quick: true, info: true }, + { name: 'password', display: 'Password', tag: 'input', type: 'password', limit: 50, null: true, class: 'xlarge', signup: true, quick: false, }, + { name: 'organization_id', display: 'Organization', tag: 'select', multiple: false, nulloption: true, null: true, relation: 'Organization', class: 'xlarge' }, + { name: 'note', display: 'Note', tag: 'textarea', note: 'Notes are visible to agents only, never to customers.', limit: 250, null: true, class: 'xlarge', quick: true, info: true }, + { name: 'role_ids', display: 'Roles', tag: 'checkbox', multiple: true, null: false, relation: 'Role', class: 'xlarge' }, + { name: 'group_ids', display: 'Groups', tag: 'checkbox', multiple: true, null: true, relation: 'Group', class: 'xlarge', invite_agent: true }, + { name: 'active', display: 'Active', tag: 'boolean', default: true, null: true, class: 'xlarge' }, + { name: 'updated_at', display: 'Updated', type: 'time', readonly: 1 }, + ] + @configure_overview = [ +# 'login', 'firstname', 'lastname', 'email', 'updated_at', + 'login', 'firstname', 'lastname' + ] diff --git a/app/assets/javascripts/app/views/.gitkeep b/app/assets/javascripts/app/views/.gitkeep new file mode 100644 index 000000000..e69de29bb diff --git a/app/assets/javascripts/app/views/agent_ticket_create.jst.eco b/app/assets/javascripts/app/views/agent_ticket_create.jst.eco new file mode 100644 index 000000000..f07b852c3 --- /dev/null +++ b/app/assets/javascripts/app/views/agent_ticket_create.jst.eco @@ -0,0 +1,27 @@ +
    +

    New Ticket

    +
    + + +
    +
    + <%- @form %> + + +
    +
    +
    +
    +
    +
    +   +
    +
    • diff --git a/app/assets/javascripts/app/views/agent_ticket_history.jst.eco b/app/assets/javascripts/app/views/agent_ticket_history.jst.eco new file mode 100644 index 000000000..4c933e373 --- /dev/null +++ b/app/assets/javascripts/app/views/agent_ticket_history.jst.eco @@ -0,0 +1,10 @@ +
    + × +

    History

    +
    +
    +
    +
    +
    +
    +
    diff --git a/app/assets/javascripts/app/views/agent_ticket_view.jst.eco b/app/assets/javascripts/app/views/agent_ticket_view.jst.eco new file mode 100644 index 000000000..6da495fa6 --- /dev/null +++ b/app/assets/javascripts/app/views/agent_ticket_view.jst.eco @@ -0,0 +1,37 @@ +
    +

    <%- @overview.meta.name %>

    +
    + + + + + +
    +
    +
    + +
    +
    +
    diff --git a/app/assets/javascripts/app/views/agent_ticket_view/bulk.jst.eco b/app/assets/javascripts/app/views/agent_ticket_view/bulk.jst.eco new file mode 100644 index 000000000..fefaf4d3f --- /dev/null +++ b/app/assets/javascripts/app/views/agent_ticket_view/bulk.jst.eco @@ -0,0 +1,5 @@ +
    + <%- @form_ticket %> + <%- @form_article %> + +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/agent_ticket_view/detail.jst.eco b/app/assets/javascripts/app/views/agent_ticket_view/detail.jst.eco new file mode 100644 index 000000000..6b6498f16 --- /dev/null +++ b/app/assets/javascripts/app/views/agent_ticket_view/detail.jst.eco @@ -0,0 +1,27 @@ +
    + +<% for ticket in @objects: %> +
    +
    + + + + + +
    + + + +
    +
    +
    +

    <%= ticket.title %> <%= ticket.number %>

    + State: <%= ticket.ticket_state.name %> + Priority: <%= ticket.ticket_priority.name %> + Group: <%= ticket.group.name %> + Owner: <%= ticket.owner.firstname + ' ' + ticket.owner.lastname %> +
    +
    +
    +<% end %> +
    diff --git a/app/assets/javascripts/app/views/agent_ticket_zoom.jst.eco b/app/assets/javascripts/app/views/agent_ticket_zoom.jst.eco new file mode 100644 index 000000000..e816bced0 --- /dev/null +++ b/app/assets/javascripts/app/views/agent_ticket_zoom.jst.eco @@ -0,0 +1,100 @@ +
    +

    <%= @ticket.title %> <%= @ticket.number %>

    +
    + +
    +
    + +
    +
    + +
    + +
    +
    + +
    + + <%- @form_ticket %> + + <%- @form_article %> + +
    +   + + +
    +
    +
    + +
    + +<% for article in @articles: %> +
    +
    + +
    + +
    + <% if article.from: %> + <%= article.from %> + <% if article.actions: %> + <% for action in article.actions: %> + - + <%= action.name %> + <% end %> + <% end %> + - <%= article.humanTime %> ago +
    + <% end %> + <% if article.to: %> + <%= article.to %> +
    + <% end %> + <% if article.cc: %> + <%= article.cc %> +
    + <% end %> + <% if article.subject: %> + <%= article.subject %> +
    + <% end %> + <% if article.attachments: %> + <% for attachment in article.attachments: %> + <%= attachment.filename %> + <% end %> +
    + <% end %> +
    <%- window.linkify( article.body.trim() ) %>
    +
    +
    +<% end %> + +
    + +
    +
    + +
    +
    +

    Actions

    + +
    +
    + +
    +
    +

    Linked Objects

    + +
    +
    + +
    + +
    diff --git a/app/assets/javascripts/app/views/agent_user_create.jst.eco b/app/assets/javascripts/app/views/agent_user_create.jst.eco new file mode 100644 index 000000000..ec7cf28e7 --- /dev/null +++ b/app/assets/javascripts/app/views/agent_user_create.jst.eco @@ -0,0 +1,13 @@ +
    + × +

    <%= @head %>

    +
    +
    +
    + <%- @form %> +
    +
    +
    + + +
    diff --git a/app/assets/javascripts/app/views/channel/chat.jst.eco b/app/assets/javascripts/app/views/channel/chat.jst.eco new file mode 100644 index 000000000..847e9bdab --- /dev/null +++ b/app/assets/javascripts/app/views/channel/chat.jst.eco @@ -0,0 +1,13 @@ + +
    +
    +

    Enable Chat

    +

    lala alals alals ala.

    +
    +

    Default Greetings

    +

    lala alals alals ala.

    +
    +
    +
    diff --git a/app/assets/javascripts/app/views/channel/email.jst.eco b/app/assets/javascripts/app/views/channel/email.jst.eco new file mode 100644 index 000000000..b060f2760 --- /dev/null +++ b/app/assets/javascripts/app/views/channel/email.jst.eco @@ -0,0 +1,104 @@ + +
    +
    + + + + + + + + + + + + + + + + + + + + + + + +
    HostUserTypeActiveDelete
    lalal.example.comwpt234rwrIMAPtruex
    l31alal.example.comwpt23dd4rwrPOP3truex
    + +
    +
    + + + + + + + + + + + + + + + + + + + + + + +
    HostUserTypeActiveDelete
    lalal.example.comwpt234rwrSMTPtruex
    l31alal.example.comwpt23dd4rwrSendmailtruex
    +
    +
    + + + + + + + + + + + + + + + + +
    NameActiveDelete
    lalal.example.comtruex
    wpt23dd4rwrtruex
    +
    +
    +

    Max. Email Size

    +

    lala alals alals ala.

    +
    +

    PostmasterFollowUpSearchIn

    +

    o References - Executes follow up checks on In-Reply-To or References headers for mails that don't have a ticket number in the subject.

    +

    o Body - Executes follow up mail body checks in mails that don't have a ticket number in the subject.

    +

    o Attachment - Executes follow up mail attachments checks in mails that don't have a ticket number in the subject.

    +

    o Raw - Executes follow up plain/raw mail checks in mails that don't have a ticket number in the subject.

    +
    +

    FollowUpState

    +

    Defines the state of a ticket if it gets a follow-up.

    +
    +

    Blocks Emails

    +

    Blocks all the incoming emails that do not have a valid ticket number in subject with From: @example.com address.

    +

    Subject

    +

    Defines the subject for rejected emails.

    +

    Body

    +

    Defines the body for rejected emails.

    +
    +

    SendNoAutoResponseRegExp

    +

    If this regex matches, no message will be send by the autoresponder.

    +

    (MAILER-DAEMON|postmaster|abuse)@.+?\..+?

    +
    +
    +
    diff --git a/app/assets/javascripts/app/views/channel/facebook.jst.eco b/app/assets/javascripts/app/views/channel/facebook.jst.eco new file mode 100644 index 000000000..1e3959159 --- /dev/null +++ b/app/assets/javascripts/app/views/channel/facebook.jst.eco @@ -0,0 +1,24 @@ + +
    +
    + + + + + + + + + + + + + + + + +
    NameActiveDelete
    lalal.example.comtruex
    wpt23dd4rwrtruex
    +
    +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/channel/twitter.jst.eco b/app/assets/javascripts/app/views/channel/twitter.jst.eco new file mode 100644 index 000000000..b3489bb72 --- /dev/null +++ b/app/assets/javascripts/app/views/channel/twitter.jst.eco @@ -0,0 +1,24 @@ + +
    +
    + + + + + + + + + + + + + + + + +
    NameActiveDelete
    lalal.example.comtruex
    wpt23dd4rwrtruex
    +
    +
    diff --git a/app/assets/javascripts/app/views/channel/web.jst.eco b/app/assets/javascripts/app/views/channel/web.jst.eco new file mode 100644 index 000000000..70ff9a64e --- /dev/null +++ b/app/assets/javascripts/app/views/channel/web.jst.eco @@ -0,0 +1,22 @@ + +
    +
    +

    Enable Ticket creation

    +

    lala alals alals ala.

    +

    Allowed attributes to set and default values

    +

    lala alals alals ala.

    +
    +

    Enable view and update of Tickets

    +

    lala alals alals ala.

    +

    Allowed attributes to see

    +

    lala alals alals ala.

    +

    Allowed attributes to update

    +

    lala alals alals ala.

    +
    +

    Enable view and update of Tickets

    +

    lala alals alals ala.

    +
    +
    +
    diff --git a/app/assets/javascripts/app/views/dashboard.jst.eco b/app/assets/javascripts/app/views/dashboard.jst.eco new file mode 100644 index 000000000..65e9809dd --- /dev/null +++ b/app/assets/javascripts/app/views/dashboard.jst.eco @@ -0,0 +1,21 @@ +
    +

    <%= @head %>

    +
    + +
    +
    + +
    +
    +
    +
    +
    +
    diff --git a/app/assets/javascripts/app/views/dashboard/activity_stream.jst.eco b/app/assets/javascripts/app/views/dashboard/activity_stream.jst.eco new file mode 100644 index 000000000..ea118b818 --- /dev/null +++ b/app/assets/javascripts/app/views/dashboard/activity_stream.jst.eco @@ -0,0 +1,10 @@ +
    +
    +

    <%= @head %>

    + +
    +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/dashboard/recent_viewed.jst.eco b/app/assets/javascripts/app/views/dashboard/recent_viewed.jst.eco new file mode 100644 index 000000000..410fb7334 --- /dev/null +++ b/app/assets/javascripts/app/views/dashboard/recent_viewed.jst.eco @@ -0,0 +1,10 @@ +
    +
    +

    <%= @head %>

    + +
    +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/dashboard/ticket.jst.eco b/app/assets/javascripts/app/views/dashboard/ticket.jst.eco new file mode 100644 index 000000000..b65371201 --- /dev/null +++ b/app/assets/javascripts/app/views/dashboard/ticket.jst.eco @@ -0,0 +1,22 @@ +
    +
    +

    <%= @overview.meta.name %> +

    + +
    +
    +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/dashboard/ticket_settings.jst.eco b/app/assets/javascripts/app/views/dashboard/ticket_settings.jst.eco new file mode 100644 index 000000000..4635d76ca --- /dev/null +++ b/app/assets/javascripts/app/views/dashboard/ticket_settings.jst.eco @@ -0,0 +1,13 @@ +
    + × +

    Edit: <%= @overview.meta.name %>

    +
    +
    +
    +
    +
    +
    +
    + + +
    diff --git a/app/assets/javascripts/app/views/generic/admin/edit.jst.eco b/app/assets/javascripts/app/views/generic/admin/edit.jst.eco new file mode 100644 index 000000000..62d8024be --- /dev/null +++ b/app/assets/javascripts/app/views/generic/admin/edit.jst.eco @@ -0,0 +1,13 @@ +
    + × +

    <%= @head %>

    +
    +
    +
    + <%- @form %> +
    +
    +
    + + +
    diff --git a/app/assets/javascripts/app/views/generic/admin/index.jst.eco b/app/assets/javascripts/app/views/generic/admin/index.jst.eco new file mode 100644 index 000000000..eb69c5b15 --- /dev/null +++ b/app/assets/javascripts/app/views/generic/admin/index.jst.eco @@ -0,0 +1,39 @@ +
    +

    <%= @head %> Management

    +
    + +
    +
    +
      + <% if @menus: %> + <% for menu in @menus: %> +
    • <%= menu.name %>
      • + + <% end %> + <% end %> +
    + + <% for note in @notes: %> +

    <%= note %>

    + <% end %> + + <% if @buttons: %> + <% for button in @buttons: %> +

    <%= button.name %>

    + <% end %> + <% end %> + +
    + +
    + +
    diff --git a/app/assets/javascripts/app/views/generic/admin/new.jst.eco b/app/assets/javascripts/app/views/generic/admin/new.jst.eco new file mode 100644 index 000000000..5c28f8993 --- /dev/null +++ b/app/assets/javascripts/app/views/generic/admin/new.jst.eco @@ -0,0 +1,13 @@ +
    + × +

    <%= @head %>

    +
    +
    +
    + <%- @form %> +
    +
    +
    + + +
    diff --git a/app/assets/javascripts/app/views/generic/admin_level2/index.jst.eco b/app/assets/javascripts/app/views/generic/admin_level2/index.jst.eco new file mode 100644 index 000000000..279e297a6 --- /dev/null +++ b/app/assets/javascripts/app/views/generic/admin_level2/index.jst.eco @@ -0,0 +1,16 @@ +
    +

    <%= @page.head %> <%= @page.sub_head %>

    +
    + +
    +
    +
      + <% if @menus: %> + <% for menu in @menus: %> +
    • <%= menu.name %>
      • + <% end %> + <% end %> +
    +
    +
    +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/generic/attribute.jst.eco b/app/assets/javascripts/app/views/generic/attribute.jst.eco new file mode 100644 index 000000000..a8526e94e --- /dev/null +++ b/app/assets/javascripts/app/views/generic/attribute.jst.eco @@ -0,0 +1,8 @@ +
    + +
    + <%- @item %> + + <%= @attribute.help %> <%- @attribute.link %> +
    +
    diff --git a/app/assets/javascripts/app/views/generic/autocompletion.jst.eco b/app/assets/javascripts/app/views/generic/autocompletion.jst.eco new file mode 100644 index 000000000..c75311d09 --- /dev/null +++ b/app/assets/javascripts/app/views/generic/autocompletion.jst.eco @@ -0,0 +1,2 @@ + /> + <%= @attribute.autofocus %> <%- @attribute.autocapitalize %>/> diff --git a/app/assets/javascripts/app/views/generic/checkbox.jst.eco b/app/assets/javascripts/app/views/generic/checkbox.jst.eco new file mode 100644 index 000000000..8c3eca81c --- /dev/null +++ b/app/assets/javascripts/app/views/generic/checkbox.jst.eco @@ -0,0 +1,5 @@ +
    +<% for row in @attribute.options: %> + > <%= row.name %> <% if row.note: %>- <%= row.note %><% end %>
    +<% end %> +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/generic/input.jst.eco b/app/assets/javascripts/app/views/generic/input.jst.eco new file mode 100644 index 000000000..33ed42bb8 --- /dev/null +++ b/app/assets/javascripts/app/views/generic/input.jst.eco @@ -0,0 +1 @@ + <%= @attribute.autofocus %> <%- @attribute.autocapitalize %>/> \ No newline at end of file diff --git a/app/assets/javascripts/app/views/generic/radio.jst.eco b/app/assets/javascripts/app/views/generic/radio.jst.eco new file mode 100644 index 000000000..a40835788 --- /dev/null +++ b/app/assets/javascripts/app/views/generic/radio.jst.eco @@ -0,0 +1,5 @@ +
    +<% for row in @attribute.options: %> + > <%= row.name %> <% if row.note: %>- <%= row.note %><% end %>
    +<% end %> +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/generic/select.jst.eco b/app/assets/javascripts/app/views/generic/select.jst.eco new file mode 100644 index 000000000..b23b54b55 --- /dev/null +++ b/app/assets/javascripts/app/views/generic/select.jst.eco @@ -0,0 +1,5 @@ + \ No newline at end of file diff --git a/app/assets/javascripts/app/views/generic/table.jst.eco b/app/assets/javascripts/app/views/generic/table.jst.eco new file mode 100644 index 000000000..74e04c081 --- /dev/null +++ b/app/assets/javascripts/app/views/generic/table.jst.eco @@ -0,0 +1,41 @@ + + + + <% if @checkbox: %> + + <% end %> +<% for row in @header: %> + +<% end %> + + + + +<% for object in @objects: %> + + <% if @checkbox: %> + + <% end %> + <% for row in @overview: %> + + <% end %> + + +<% end %> + +
    <%= row %>
    + + + <% if row.link: %> + <%= object[row.name]['name'] %> + <% else: %> + class="<%= row.class %>"<% end %> <% if row.data && row.data.id: %>data-id="<%= object[row.name]['id'] %>"<% end %>><%= object[row.name]['name'] %> + <% end %> +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/generic/textarea.jst.eco b/app/assets/javascripts/app/views/generic/textarea.jst.eco new file mode 100644 index 000000000..6504c8194 --- /dev/null +++ b/app/assets/javascripts/app/views/generic/textarea.jst.eco @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/app/assets/javascripts/app/views/getting_started.jst.eco b/app/assets/javascripts/app/views/getting_started.jst.eco new file mode 100644 index 000000000..428e076a5 --- /dev/null +++ b/app/assets/javascripts/app/views/getting_started.jst.eco @@ -0,0 +1,23 @@ +
    +

    Getting started!

    + +
    + +
    +
    +

    Invite Agents

    +
    + <%- @form %> +
    + +
    +
    +

    Tour

    +

    + Learn all about ... +

    +
    +
    + +
    +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/login.jst.eco b/app/assets/javascripts/app/views/login.jst.eco new file mode 100644 index 000000000..5121bec62 --- /dev/null +++ b/app/assets/javascripts/app/views/login.jst.eco @@ -0,0 +1,52 @@ +
    + +
    +

    Welcome stranger!

    + +
    +
    +
    + Sign in with + +
    +
    + +
    +
    +

    --- or ---

    +
    +
    + +
    +
    + Sign in using + +
    +
    + +
    +
    +

    --- or ---

    +
    +
    + +
    +
    +

    New to <%= Config.product_name %>, join today!

    +

    Sign up +

    +
    + +
    + +
    + +
    diff --git a/app/assets/javascripts/app/views/navigation.jst.eco b/app/assets/javascripts/app/views/navigation.jst.eco new file mode 100644 index 000000000..f7f20f646 --- /dev/null +++ b/app/assets/javascripts/app/views/navigation.jst.eco @@ -0,0 +1,52 @@ +
    +
    +
    + <%- Config.product_name %> + +
    + +
    +<% if @user: %> + +<% else: %> + +<% end %> + +
    +
    +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/network.jst.eco b/app/assets/javascripts/app/views/network.jst.eco new file mode 100644 index 000000000..c4c68680c --- /dev/null +++ b/app/assets/javascripts/app/views/network.jst.eco @@ -0,0 +1,82 @@ +
    +

    Networking

    +
    + +
    +
    + +<% for network in @networks: %> +
    +
    +

    <%= network.name %> <%= network.note %>

    edit | delete | new category +
    +
    +

    Announcements

    + edit | delete + +
    +
    +

    Questions

    + +
    +
    +
    +
    +

    Ideas

    + +
    +
    +

    Bugs

    + +
    +
    +
    +
    +<% end %> + +
    +
    + +
    +
    +

    Actions

    + +
    +
    + +
    +
    +

    Activity Stream

    +
      +
    • New XXX
      • +
    • New XXX
      • +
    • New XXX
      • +
    • New XXX
      • +
    +
    +
    + +
    +
    diff --git a/app/assets/javascripts/app/views/notify.jst.eco b/app/assets/javascripts/app/views/notify.jst.eco new file mode 100644 index 000000000..e0b50e793 --- /dev/null +++ b/app/assets/javascripts/app/views/notify.jst.eco @@ -0,0 +1,4 @@ +
    + × + <%= @data.text %> +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/profile.jst.eco b/app/assets/javascripts/app/views/profile.jst.eco new file mode 100644 index 000000000..8b4e2505d --- /dev/null +++ b/app/assets/javascripts/app/views/profile.jst.eco @@ -0,0 +1,10 @@ +
    +

    Profile

    +
    + +
      +
    • Password
      • +
    • Link Accounts
      • +
    • Notifications
      • +
    • +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/scheduler.jst.eco b/app/assets/javascripts/app/views/scheduler.jst.eco new file mode 100644 index 000000000..faa893a72 --- /dev/null +++ b/app/assets/javascripts/app/views/scheduler.jst.eco @@ -0,0 +1,98 @@ +
    +

    Scheduler Management

    +
    + +
    +
    + +
    +
    + +
    + +
    +
    + + + + + + + + + + + + + + + + + + + + + + + +
    HostUserTypeActiveDelete
    lalal.example.comwpt234rwrIMAPtruex
    l31alal.example.comwpt23dd4rwrPOP3truex
    + +
    +
    + + + + + + + + + + + + + + + + + + + + + + +
    HostUserTypeActiveDelete
    lalal.example.comwpt234rwrSMTPtruex
    l31alal.example.comwpt23dd4rwrSendmailtruex
    +
    +
    + + + + + + + + + + + + + + + + + + + +
    NameActiveLast RunDelete
    lalal.example.comtruetruex
    wpt23dd4rwrtruetruex
    +
    +
    +
    + +
    +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/settings/item.jst.eco b/app/assets/javascripts/app/views/settings/item.jst.eco new file mode 100644 index 000000000..b61475757 --- /dev/null +++ b/app/assets/javascripts/app/views/settings/item.jst.eco @@ -0,0 +1,7 @@ +
    +

    <%= @setting.title %>

    +

    <%= @setting.description %>

    + <%- @form %> + +
    +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/signup.jst.eco b/app/assets/javascripts/app/views/signup.jst.eco new file mode 100644 index 000000000..35ee8098c --- /dev/null +++ b/app/assets/javascripts/app/views/signup.jst.eco @@ -0,0 +1,13 @@ +
    +

    Join <%= Config.product_name %>

    + +
    + +
    + <%- @form %> + + +
    + +
    +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/trigger.jst.eco b/app/assets/javascripts/app/views/trigger.jst.eco new file mode 100644 index 000000000..b90146a16 --- /dev/null +++ b/app/assets/javascripts/app/views/trigger.jst.eco @@ -0,0 +1,96 @@ +
    +

    Trigger Management

    +
    + +
    +
    + +
    +
    + +
    + +
    +
    + + + + + + + + + + + + + + + + + + + + + + + +
    HostUserTypeActiveDelete
    lalal.example.comwpt234rwrIMAPtruex
    l31alal.example.comwpt23dd4rwrPOP3truex
    + +
    +
    + + + + + + + + + + + + + + + + + + + + + + +
    HostUserTypeActiveDelete
    lalal.example.comwpt234rwrSMTPtruex
    l31alal.example.comwpt23dd4rwrSendmailtruex
    +
    +
    + + + + + + + + + + + + + + + + +
    NameActiveDelete
    lalal.example.comtruex
    wpt23dd4rwrtruex
    +
    +
    +
    + +
    +
    \ No newline at end of file diff --git a/app/assets/javascripts/app/views/user_info.jst.eco b/app/assets/javascripts/app/views/user_info.jst.eco new file mode 100644 index 000000000..1f745adaa --- /dev/null +++ b/app/assets/javascripts/app/views/user_info.jst.eco @@ -0,0 +1,55 @@ +
    +

    Customer

    +<% if @user.image: %> + +<% end %> +
    +
    <%= @user['firstname'] %> <%= @user['lastname'] %>
    +
    +<% for row in @data: %> + <% if @user[row.name]: %> +
    + <% if row.tag isnt 'textarea': %> +
    <%- window.linkify( @user[row.name] ) %>
    + <% else: %> +
    + <%= row.display %>
    + +
    + <% end %> +
    + <% end %> +<% end %> +<% if @user['accounts']: %> +
    +
    + Linked Accounts
    + <% for account of @user['accounts']: %> + <%= account %> + <% end %> +
    +
    +<% end %> +<% if @user['links']: %> + <% for link in @user['links']: %> +
    +
    + <%= link['title'] %>
    + <% for item in link['items']: %> + <% if item['url']: %> + target="_blank"<% end %>> + <% else: %> + + <% end %> + <%= item['name'] %> + <% if item['url']: %> + + <% else: %> + + <% end %> + <% end %> +
    +
    + <% end %> +<% end %> +
    diff --git a/app/assets/javascripts/app/views/user_info_small.jst.eco b/app/assets/javascripts/app/views/user_info_small.jst.eco new file mode 100644 index 000000000..9826f9a71 --- /dev/null +++ b/app/assets/javascripts/app/views/user_info_small.jst.eco @@ -0,0 +1,39 @@ +<% for row in @data: %> + <% if @user[row.name]: %> +
    +
    <%- window.linkify( @user[row.name] ) %>
    +
    + <% end %> +<% end %> +<% if @user['accounts']: %> +
    +
    + Linked Accounts
    + <% for account of @user['accounts']: %> + <%= account %> + <% end %> +
    +
    +<% end %> +<% if @user['links']: %> + <% for link in @user['links']: %> +
    +
    + <%= link['title'] %>
    + <% for item in link['items']: %> + <% if item['url']: %> + target="_blank"<% end %>> + <% else: %> + + <% end %> + <%= item['name'] %> + <% if item['url']: %> + + <% else: %> + + <% end %> + <% end %> +
    +
    + <% end %> +<% end %> \ No newline at end of file diff --git a/app/assets/javascripts/app/views/user_ticket_info_small.jst.eco b/app/assets/javascripts/app/views/user_ticket_info_small.jst.eco new file mode 100644 index 000000000..ae25ffead --- /dev/null +++ b/app/assets/javascripts/app/views/user_ticket_info_small.jst.eco @@ -0,0 +1,5 @@ +<% for ticket in @tickets: %> +
    +
    T:<%= ticket.number %> <%= ticket.humanTime %>
    <%= ticket.title %>
    +
    +<% end %> diff --git a/app/assets/javascripts/application.js b/app/assets/javascripts/application.js index 9097d830e..648fcc59c 100644 --- a/app/assets/javascripts/application.js +++ b/app/assets/javascripts/application.js @@ -1,15 +1,12 @@ -// This is a manifest file that'll be compiled into application.js, which will include all the files -// listed below. -// -// Any JavaScript/Coffee file within this directory, lib/assets/javascripts, vendor/assets/javascripts, -// or vendor/assets/javascripts of plugins, if any, can be referenced here using a relative path. -// +// This is a manifest file that'll be compiled into including all the files listed below. +// Add new JavaScript/Coffee code in separate files in this directory and they'll automatically +// be included in the compiled file accessible from http://example.com/assets/application.js // It's not advisable to add code directly here, but if you do, it'll appear at the bottom of the // the compiled file. // -// WARNING: THE FIRST BLANK LINE MARKS THE END OF WHAT'S TO BE PROCESSED, ANY BLANK LINE SHOULD -// GO AFTER THE REQUIRES BELOW. -// + +//= require init.js //= require jquery //= require jquery_ujs -//= require_tree . +//= require app +//not_used#= require_tree . diff --git a/app/assets/javascripts/init.js b/app/assets/javascripts/init.js new file mode 100644 index 000000000..9e66472fd --- /dev/null +++ b/app/assets/javascripts/init.js @@ -0,0 +1,5 @@ +var Config = {}; +Config.Routes = {}; +Config.NavBar = {}; +Config.product_name = 'Zammad' +var Session = {}; diff --git a/app/assets/stylesheets/application.css b/app/assets/stylesheets/application.css index 3b5cc6648..f0ec5f8a5 100644 --- a/app/assets/stylesheets/application.css +++ b/app/assets/stylesheets/application.css @@ -1,13 +1,12 @@ /* - * This is a manifest file that'll be compiled into application.css, which will include all the files - * listed below. - * - * Any CSS and SCSS file within this directory, lib/assets/stylesheets, vendor/assets/stylesheets, - * or vendor/assets/stylesheets of plugins, if any, can be referenced here using a relative path. - * - * You're free to add application-wide styles to this file and they'll appear at the top of the - * compiled file, but it's generally better to create a new file per style scope. - * + * This is a manifest file that'll automatically include all the stylesheets available in this directory + * and any sub-directories. You're free to add application-wide styles to this file and they'll appear at + * the top of the compiled file, but it's generally better to create a new file per style scope. *= require_self - *= require_tree . + *s= require_tree . + *= require bootstrap.css + *= require fileuploader.css + *= require zzz.css + *= require_tree ./ui-lightness/ */ + diff --git a/app/assets/stylesheets/bootstrap.css b/app/assets/stylesheets/bootstrap.css new file mode 100644 index 000000000..495188af7 --- /dev/null +++ b/app/assets/stylesheets/bootstrap.css @@ -0,0 +1,3990 @@ +/*! + * Bootstrap v2.0.2 + * + * Copyright 2012 Twitter, Inc + * Licensed under the Apache License v2.0 + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Designed and built with all the love in the world @twitter by @mdo and @fat. + */ +article, +aside, +details, +figcaption, +figure, +footer, +header, +hgroup, +nav, +section { + display: block; +} +audio, +canvas, +video { + display: inline-block; + *display: inline; + *zoom: 1; +} +audio:not([controls]) { + display: none; +} +html { + font-size: 100%; + -webkit-text-size-adjust: 100%; + -ms-text-size-adjust: 100%; +} +a:focus { + outline: thin dotted #333; + outline: 5px auto -webkit-focus-ring-color; + outline-offset: -2px; +} +a:hover, +a:active { + outline: 0; +} +sub, +sup { + position: relative; + font-size: 75%; + line-height: 0; + vertical-align: baseline; +} +sup { + top: -0.5em; +} +sub { + bottom: -0.25em; +} +img { + height: auto; + border: 0; + -ms-interpolation-mode: bicubic; + vertical-align: middle; +} +button, +input, +select, +textarea { + margin: 0; + font-size: 100%; + vertical-align: middle; +} +button, +input { + *overflow: visible; + line-height: normal; +} +button::-moz-focus-inner, +input::-moz-focus-inner { + padding: 0; + border: 0; +} +button, +input[type="button"], +input[type="reset"], +input[type="submit"] { + cursor: pointer; + -webkit-appearance: button; +} +input[type="search"] { + -webkit-appearance: textfield; + -webkit-box-sizing: content-box; + -moz-box-sizing: content-box; + box-sizing: content-box; +} +input[type="search"]::-webkit-search-decoration, +input[type="search"]::-webkit-search-cancel-button { + -webkit-appearance: none; +} +textarea { + overflow: auto; + vertical-align: top; +} +.clearfix { + *zoom: 1; +} +.clearfix:before, +.clearfix:after { + display: table; + content: ""; +} +.clearfix:after { + clear: both; +} +.hide-text { + overflow: hidden; + text-indent: 100%; + white-space: nowrap; +} +.input-block-level { + display: block; + width: 100%; + min-height: 28px; + /* Make inputs at least the height of their button counterpart */ + + /* Makes inputs behave like true block-level elements */ + + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + -ms-box-sizing: border-box; + box-sizing: border-box; +} +body { + margin: 0; + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-size: 13px; + line-height: 18px; + color: #333333; + background-color: #ffffff; +} +a { + color: #0088cc; + text-decoration: none; +} +a:hover { + color: #005580; + text-decoration: underline; +} +.row { + margin-left: -20px; + *zoom: 1; +} +.row:before, +.row:after { + display: table; + content: ""; +} +.row:after { + clear: both; +} +[class*="span"] { + float: left; + margin-left: 20px; +} +.container, +.navbar-fixed-top .container, +.navbar-fixed-bottom .container { + width: 940px; +} +.span12 { + width: 940px; +} +.span11 { + width: 860px; +} +.span10 { + width: 780px; +} +.span9 { + width: 700px; +} +.span8 { + width: 620px; +} +.span7 { + width: 540px; +} +.span6 { + width: 460px; +} +.span5 { + width: 380px; +} +.span4 { + width: 300px; +} +.span3 { + width: 220px; +} +.span2 { + width: 140px; +} +.span1 { + width: 60px; +} +.offset12 { + margin-left: 980px; +} +.offset11 { + margin-left: 900px; +} +.offset10 { + margin-left: 820px; +} +.offset9 { + margin-left: 740px; +} +.offset8 { + margin-left: 660px; +} +.offset7 { + margin-left: 580px; +} +.offset6 { + margin-left: 500px; +} +.offset5 { + margin-left: 420px; +} +.offset4 { + margin-left: 340px; +} +.offset3 { + margin-left: 260px; +} +.offset2 { + margin-left: 180px; +} +.offset1 { + margin-left: 100px; +} +.row-fluid { + width: 100%; + *zoom: 1; +} +.row-fluid:before, +.row-fluid:after { + display: table; + content: ""; +} +.row-fluid:after { + clear: both; +} +.row-fluid > [class*="span"] { + float: left; + margin-left: 2.127659574%; +} +.row-fluid > [class*="span"]:first-child { + margin-left: 0; +} +.row-fluid > .span12 { + width: 99.99999998999999%; +} +.row-fluid > .span11 { + width: 91.489361693%; +} +.row-fluid > .span10 { + width: 82.97872339599999%; +} +.row-fluid > .span9 { + width: 74.468085099%; +} +.row-fluid > .span8 { + width: 65.95744680199999%; +} +.row-fluid > .span7 { + width: 57.446808505%; +} +.row-fluid > .span6 { + width: 48.93617020799999%; +} +.row-fluid > .span5 { + width: 40.425531911%; +} +.row-fluid > .span4 { + width: 31.914893614%; +} +.row-fluid > .span3 { + width: 23.404255317%; +} +.row-fluid > .span2 { + width: 14.89361702%; +} +.row-fluid > .span1 { + width: 6.382978723%; +} +.container { + margin-left: auto; + margin-right: auto; + *zoom: 1; +} +.container:before, +.container:after { + display: table; + content: ""; +} +.container:after { + clear: both; +} +.container-fluid { + padding-left: 20px; + padding-right: 20px; + *zoom: 1; +} +.container-fluid:before, +.container-fluid:after { + display: table; + content: ""; +} +.container-fluid:after { + clear: both; +} +p { + margin: 0 0 9px; + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-size: 13px; + line-height: 18px; +} +p small { + font-size: 11px; + color: #999999; +} +.lead { + margin-bottom: 18px; + font-size: 20px; + font-weight: 200; + line-height: 27px; +} +h1, +h2, +h3, +h4, +h5, +h6 { + margin: 0; + font-family: inherit; + font-weight: bold; + color: inherit; + text-rendering: optimizelegibility; +} +h1 small, +h2 small, +h3 small, +h4 small, +h5 small, +h6 small { + font-weight: normal; + color: #999999; +} +h1 { + font-size: 30px; + line-height: 36px; +} +h1 small { + font-size: 18px; +} +h2 { + font-size: 24px; + line-height: 36px; +} +h2 small { + font-size: 18px; +} +h3 { + line-height: 27px; + font-size: 18px; +} +h3 small { + font-size: 14px; +} +h4, +h5, +h6 { + line-height: 18px; +} +h4 { + font-size: 14px; +} +h4 small { + font-size: 12px; +} +h5 { + font-size: 12px; +} +h6 { + font-size: 11px; + color: #999999; + text-transform: uppercase; +} +.page-header { + padding-bottom: 17px; + margin: 18px 0; + border-bottom: 1px solid #eeeeee; +} +.page-header h1 { + line-height: 1; +} +ul, +ol { + padding: 0; + margin: 0 0 9px 25px; +} +ul ul, +ul ol, +ol ol, +ol ul { + margin-bottom: 0; +} +ul { + list-style: disc; +} +ol { + list-style: decimal; +} +li { + line-height: 18px; +} +ul.unstyled, +ol.unstyled { + margin-left: 0; + list-style: none; +} +dl { + margin-bottom: 18px; +} +dt, +dd { + line-height: 18px; +} +dt { + font-weight: bold; + line-height: 17px; +} +dd { + margin-left: 9px; +} +.dl-horizontal dt { + float: left; + clear: left; + width: 120px; + text-align: right; +} +.dl-horizontal dd { + margin-left: 130px; +} +hr { + margin: 18px 0; + border: 0; + border-top: 1px solid #eeeeee; + border-bottom: 1px solid #ffffff; +} +strong { + font-weight: bold; +} +em { + font-style: italic; +} +.muted { + color: #999999; +} +abbr[title] { + border-bottom: 1px dotted #ddd; + cursor: help; +} +abbr.initialism { + font-size: 90%; + text-transform: uppercase; +} +blockquote { + padding: 0 0 0 15px; + margin: 0 0 18px; + border-left: 5px solid #eeeeee; +} +blockquote p { + margin-bottom: 0; + font-size: 16px; + font-weight: 300; + line-height: 22.5px; +} +blockquote small { + display: block; + line-height: 18px; + color: #999999; +} +blockquote small:before { + content: '\2014 \00A0'; +} +blockquote.pull-right { + float: right; + padding-left: 0; + padding-right: 15px; + border-left: 0; + border-right: 5px solid #eeeeee; +} +blockquote.pull-right p, +blockquote.pull-right small { + text-align: right; +} +q:before, +q:after, +blockquote:before, +blockquote:after { + content: ""; +} +address { + display: block; + margin-bottom: 18px; + line-height: 18px; + font-style: normal; +} +small { + font-size: 100%; +} +cite { + font-style: normal; +} +code, +pre { + padding: 0 3px 2px; + font-family: Menlo, Monaco, "Courier New", monospace; + font-size: 12px; + color: #333333; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; +} +code { + padding: 2px 4px; + color: #d14; + background-color: #f7f7f9; + border: 1px solid #e1e1e8; +} +pre { + display: block; + padding: 8.5px; + margin: 0 0 9px; + font-size: 12.025px; + line-height: 18px; + background-color: #f5f5f5; + border: 1px solid #ccc; + border: 1px solid rgba(0, 0, 0, 0.15); + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + white-space: pre; + white-space: pre-wrap; + word-break: break-all; + word-wrap: break-word; +} +pre.prettyprint { + margin-bottom: 18px; +} +pre code { + padding: 0; + color: inherit; + background-color: transparent; + border: 0; +} +.pre-scrollable { + max-height: 340px; + overflow-y: scroll; +} +form { + margin: 0 0 18px; +} +fieldset { + padding: 0; + margin: 0; + border: 0; +} +legend { + display: block; + width: 100%; + padding: 0; + margin-bottom: 27px; + font-size: 19.5px; + line-height: 36px; + color: #333333; + border: 0; + border-bottom: 1px solid #eee; +} +legend small { + font-size: 13.5px; + color: #999999; +} +label, +input, +button, +select, +textarea { + font-size: 13px; + font-weight: normal; + line-height: 18px; +} +input, +button, +select, +textarea { + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; +} +label { + display: block; + margin-bottom: 5px; + color: #333333; +} +input, +textarea, +select, +.uneditable-input { + display: inline-block; + width: 210px; + height: 18px; + padding: 4px; + margin-bottom: 9px; + font-size: 13px; + line-height: 18px; + color: #555555; + border: 1px solid #cccccc; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; +} +.uneditable-textarea { + width: auto; + height: auto; +} +label input, +label textarea, +label select { + display: block; +} +input[type="image"], +input[type="checkbox"], +input[type="radio"] { + width: auto; + height: auto; + padding: 0; + margin: 3px 0; + *margin-top: 0; + /* IE7 */ + + line-height: normal; + cursor: pointer; + -webkit-border-radius: 0; + -moz-border-radius: 0; + border-radius: 0; + border: 0 \9; + /* IE9 and down */ + +} +input[type="image"] { + border: 0; +} +input[type="file"] { + width: auto; + padding: initial; + line-height: initial; + border: initial; + background-color: #ffffff; + background-color: initial; + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; +} +input[type="button"], +input[type="reset"], +input[type="submit"] { + width: auto; + height: auto; +} +select, +input[type="file"] { + height: 28px; + /* In IE7, the height of the select element cannot be changed by height, only font-size */ + + *margin-top: 4px; + /* For IE7, add top margin to align select with labels */ + + line-height: 28px; +} +input[type="file"] { + line-height: 18px \9; +} +select { + width: 220px; + background-color: #ffffff; +} +select[multiple], +select[size] { + height: auto; +} +input[type="image"] { + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; +} +textarea { + height: auto; +} +input[type="hidden"] { + display: none; +} +.radio, +.checkbox { + padding-left: 18px; +} +.radio input[type="radio"], +.checkbox input[type="checkbox"] { + float: left; + margin-left: -18px; +} +.controls > .radio:first-child, +.controls > .checkbox:first-child { + padding-top: 5px; +} +.radio.inline, +.checkbox.inline { + display: inline-block; + padding-top: 5px; + margin-bottom: 0; + vertical-align: middle; +} +.radio.inline + .radio.inline, +.checkbox.inline + .checkbox.inline { + margin-left: 10px; +} +input, +textarea { + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); + -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075); + -webkit-transition: border linear 0.2s, box-shadow linear 0.2s; + -moz-transition: border linear 0.2s, box-shadow linear 0.2s; + -ms-transition: border linear 0.2s, box-shadow linear 0.2s; + -o-transition: border linear 0.2s, box-shadow linear 0.2s; + transition: border linear 0.2s, box-shadow linear 0.2s; +} +input:focus, +textarea:focus { + border-color: rgba(82, 168, 236, 0.8); + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.6); + -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.6); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.6); + outline: 0; + outline: thin dotted \9; + /* IE6-9 */ + +} +input[type="file"]:focus, +input[type="radio"]:focus, +input[type="checkbox"]:focus, +select:focus { + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; + outline: thin dotted #333; + outline: 5px auto -webkit-focus-ring-color; + outline-offset: -2px; +} +.input-mini { + width: 60px; +} +.input-small { + width: 90px; +} +.input-medium { + width: 150px; +} +.input-large { + width: 210px; +} +.input-xlarge { + width: 270px; +} +.input-xxlarge { + width: 530px; +} +input[class*="span"], +select[class*="span"], +textarea[class*="span"], +.uneditable-input { + float: none; + margin-left: 0; +} +input, +textarea, +.uneditable-input { + margin-left: 0; +} +input.span12, textarea.span12, .uneditable-input.span12 { + width: 930px; +} +input.span11, textarea.span11, .uneditable-input.span11 { + width: 850px; +} +input.span10, textarea.span10, .uneditable-input.span10 { + width: 770px; +} +input.span9, textarea.span9, .uneditable-input.span9 { + width: 690px; +} +input.span8, textarea.span8, .uneditable-input.span8 { + width: 610px; +} +input.span7, textarea.span7, .uneditable-input.span7 { + width: 530px; +} +input.span6, textarea.span6, .uneditable-input.span6 { + width: 450px; +} +input.span5, textarea.span5, .uneditable-input.span5 { + width: 370px; +} +input.span4, textarea.span4, .uneditable-input.span4 { + width: 290px; +} +input.span3, textarea.span3, .uneditable-input.span3 { + width: 210px; +} +input.span2, textarea.span2, .uneditable-input.span2 { + width: 130px; +} +input.span1, textarea.span1, .uneditable-input.span1 { + width: 50px; +} +input[disabled], +select[disabled], +textarea[disabled], +input[readonly], +select[readonly], +textarea[readonly] { + background-color: #eeeeee; + border-color: #ddd; + cursor: not-allowed; +} +.control-group.warning > label, +.control-group.warning .help-block, +.control-group.warning .help-inline { + color: #c09853; +} +.control-group.warning input, +.control-group.warning select, +.control-group.warning textarea { + color: #c09853; + border-color: #c09853; +} +.control-group.warning input:focus, +.control-group.warning select:focus, +.control-group.warning textarea:focus { + border-color: #a47e3c; + -webkit-box-shadow: 0 0 6px #dbc59e; + -moz-box-shadow: 0 0 6px #dbc59e; + box-shadow: 0 0 6px #dbc59e; +} +.control-group.warning .input-prepend .add-on, +.control-group.warning .input-append .add-on { + color: #c09853; + background-color: #fcf8e3; + border-color: #c09853; +} +.control-group.error > label, +.control-group.error .help-block, +.control-group.error .help-inline { + color: #b94a48; +} +.control-group.error input, +.control-group.error select, +.control-group.error textarea { + color: #b94a48; + border-color: #b94a48; +} +.control-group.error input:focus, +.control-group.error select:focus, +.control-group.error textarea:focus { + border-color: #953b39; + -webkit-box-shadow: 0 0 6px #d59392; + -moz-box-shadow: 0 0 6px #d59392; + box-shadow: 0 0 6px #d59392; +} +.control-group.error .input-prepend .add-on, +.control-group.error .input-append .add-on { + color: #b94a48; + background-color: #f2dede; + border-color: #b94a48; +} +.control-group.success > label, +.control-group.success .help-block, +.control-group.success .help-inline { + color: #468847; +} +.control-group.success input, +.control-group.success select, +.control-group.success textarea { + color: #468847; + border-color: #468847; +} +.control-group.success input:focus, +.control-group.success select:focus, +.control-group.success textarea:focus { + border-color: #356635; + -webkit-box-shadow: 0 0 6px #7aba7b; + -moz-box-shadow: 0 0 6px #7aba7b; + box-shadow: 0 0 6px #7aba7b; +} +.control-group.success .input-prepend .add-on, +.control-group.success .input-append .add-on { + color: #468847; + background-color: #dff0d8; + border-color: #468847; +} +input:focus:required:invalid, +textarea:focus:required:invalid, +select:focus:required:invalid { + color: #b94a48; + border-color: #ee5f5b; +} +input:focus:required:invalid:focus, +textarea:focus:required:invalid:focus, +select:focus:required:invalid:focus { + border-color: #e9322d; + -webkit-box-shadow: 0 0 6px #f8b9b7; + -moz-box-shadow: 0 0 6px #f8b9b7; + box-shadow: 0 0 6px #f8b9b7; +} +.form-actions { + padding: 17px 20px 18px; + margin-top: 18px; + margin-bottom: 18px; + background-color: #eeeeee; + border-top: 1px solid #ddd; + *zoom: 1; +} +.form-actions:before, +.form-actions:after { + display: table; + content: ""; +} +.form-actions:after { + clear: both; +} +.uneditable-input { + display: block; + background-color: #ffffff; + border-color: #eee; + -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.025); + -moz-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.025); + box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.025); + cursor: not-allowed; +} +:-moz-placeholder { + color: #999999; +} +::-webkit-input-placeholder { + color: #999999; +} +.help-block, +.help-inline { + color: #555555; +} +.help-block { + display: block; + margin-bottom: 9px; +} +.help-inline { + display: inline-block; + *display: inline; + /* IE7 inline-block hack */ + + *zoom: 1; + vertical-align: middle; + padding-left: 5px; +} +.input-prepend, +.input-append { + margin-bottom: 5px; +} +.input-prepend input, +.input-append input, +.input-prepend select, +.input-append select, +.input-prepend .uneditable-input, +.input-append .uneditable-input { + *margin-left: 0; + -webkit-border-radius: 0 3px 3px 0; + -moz-border-radius: 0 3px 3px 0; + border-radius: 0 3px 3px 0; +} +.input-prepend input:focus, +.input-append input:focus, +.input-prepend select:focus, +.input-append select:focus, +.input-prepend .uneditable-input:focus, +.input-append .uneditable-input:focus { + position: relative; + z-index: 2; +} +.input-prepend .uneditable-input, +.input-append .uneditable-input { + border-left-color: #ccc; +} +.input-prepend .add-on, +.input-append .add-on { + display: inline-block; + width: auto; + min-width: 16px; + height: 18px; + padding: 4px 5px; + font-weight: normal; + line-height: 18px; + text-align: center; + text-shadow: 0 1px 0 #ffffff; + vertical-align: middle; + background-color: #eeeeee; + border: 1px solid #ccc; +} +.input-prepend .add-on, +.input-append .add-on, +.input-prepend .btn, +.input-append .btn { + -webkit-border-radius: 3px 0 0 3px; + -moz-border-radius: 3px 0 0 3px; + border-radius: 3px 0 0 3px; +} +.input-prepend .active, +.input-append .active { + background-color: #a9dba9; + border-color: #46a546; +} +.input-prepend .add-on, +.input-prepend .btn { + margin-right: -1px; +} +.input-append input, +.input-append select .uneditable-input { + -webkit-border-radius: 3px 0 0 3px; + -moz-border-radius: 3px 0 0 3px; + border-radius: 3px 0 0 3px; +} +.input-append .uneditable-input { + border-left-color: #eee; + border-right-color: #ccc; +} +.input-append .add-on, +.input-append .btn { + margin-left: -1px; + -webkit-border-radius: 0 3px 3px 0; + -moz-border-radius: 0 3px 3px 0; + border-radius: 0 3px 3px 0; +} +.input-prepend.input-append input, +.input-prepend.input-append select, +.input-prepend.input-append .uneditable-input { + -webkit-border-radius: 0; + -moz-border-radius: 0; + border-radius: 0; +} +.input-prepend.input-append .add-on:first-child, +.input-prepend.input-append .btn:first-child { + margin-right: -1px; + -webkit-border-radius: 3px 0 0 3px; + -moz-border-radius: 3px 0 0 3px; + border-radius: 3px 0 0 3px; +} +.input-prepend.input-append .add-on:last-child, +.input-prepend.input-append .btn:last-child { + margin-left: -1px; + -webkit-border-radius: 0 3px 3px 0; + -moz-border-radius: 0 3px 3px 0; + border-radius: 0 3px 3px 0; +} +.search-query { + padding-left: 14px; + padding-right: 14px; + margin-bottom: 0; + -webkit-border-radius: 14px; + -moz-border-radius: 14px; + border-radius: 14px; +} +.form-search input, +.form-inline input, +.form-horizontal input, +.form-search textarea, +.form-inline textarea, +.form-horizontal textarea, +.form-search select, +.form-inline select, +.form-horizontal select, +.form-search .help-inline, +.form-inline .help-inline, +.form-horizontal .help-inline, +.form-search .uneditable-input, +.form-inline .uneditable-input, +.form-horizontal .uneditable-input, +.form-search .input-prepend, +.form-inline .input-prepend, +.form-horizontal .input-prepend, +.form-search .input-append, +.form-inline .input-append, +.form-horizontal .input-append { + display: inline-block; + margin-bottom: 0; +} +.form-search .hide, +.form-inline .hide, +.form-horizontal .hide { + display: none; +} +.form-search label, +.form-inline label { + display: inline-block; +} +.form-search .input-append, +.form-inline .input-append, +.form-search .input-prepend, +.form-inline .input-prepend { + margin-bottom: 0; +} +.form-search .radio, +.form-search .checkbox, +.form-inline .radio, +.form-inline .checkbox { + padding-left: 0; + margin-bottom: 0; + vertical-align: middle; +} +.form-search .radio input[type="radio"], +.form-search .checkbox input[type="checkbox"], +.form-inline .radio input[type="radio"], +.form-inline .checkbox input[type="checkbox"] { + float: left; + margin-left: 0; + margin-right: 3px; +} +.control-group { + margin-bottom: 9px; +} +legend + .control-group { + margin-top: 18px; + -webkit-margin-top-collapse: separate; +} +.form-horizontal .control-group { + margin-bottom: 18px; + *zoom: 1; +} +.form-horizontal .control-group:before, +.form-horizontal .control-group:after { + display: table; + content: ""; +} +.form-horizontal .control-group:after { + clear: both; +} +.form-horizontal .control-label { + float: left; + width: 140px; + padding-top: 5px; + text-align: right; +} +.form-horizontal .controls { + margin-left: 160px; + /* Super jank IE7 fix to ensure the inputs in .input-append and input-prepend don't inherit the margin of the parent, in this case .controls */ + + *display: inline-block; + *margin-left: 0; + *padding-left: 20px; +} +.form-horizontal .help-block { + margin-top: 9px; + margin-bottom: 0; +} +.form-horizontal .form-actions { + padding-left: 160px; +} +table { + max-width: 100%; + border-collapse: collapse; + border-spacing: 0; + background-color: transparent; +} +.table { + width: 100%; + margin-bottom: 18px; +} +.table th, +.table td { + padding: 8px; + line-height: 18px; + text-align: left; + vertical-align: top; + border-top: 1px solid #dddddd; +} +.table th { + font-weight: bold; +} +.table thead th { + vertical-align: bottom; +} +.table colgroup + thead tr:first-child th, +.table colgroup + thead tr:first-child td, +.table thead:first-child tr:first-child th, +.table thead:first-child tr:first-child td { + border-top: 0; +} +.table tbody + tbody { + border-top: 2px solid #dddddd; +} +.table-condensed th, +.table-condensed td { + padding: 4px 5px; +} +.table-bordered { + border: 1px solid #dddddd; + border-left: 0; + border-collapse: separate; + *border-collapse: collapsed; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; +} +.table-bordered th, +.table-bordered td { + border-left: 1px solid #dddddd; +} +.table-bordered thead:first-child tr:first-child th, +.table-bordered tbody:first-child tr:first-child th, +.table-bordered tbody:first-child tr:first-child td { + border-top: 0; +} +.table-bordered thead:first-child tr:first-child th:first-child, +.table-bordered tbody:first-child tr:first-child td:first-child { + -webkit-border-radius: 4px 0 0 0; + -moz-border-radius: 4px 0 0 0; + border-radius: 4px 0 0 0; +} +.table-bordered thead:first-child tr:first-child th:last-child, +.table-bordered tbody:first-child tr:first-child td:last-child { + -webkit-border-radius: 0 4px 0 0; + -moz-border-radius: 0 4px 0 0; + border-radius: 0 4px 0 0; +} +.table-bordered thead:last-child tr:last-child th:first-child, +.table-bordered tbody:last-child tr:last-child td:first-child { + -webkit-border-radius: 0 0 0 4px; + -moz-border-radius: 0 0 0 4px; + border-radius: 0 0 0 4px; +} +.table-bordered thead:last-child tr:last-child th:last-child, +.table-bordered tbody:last-child tr:last-child td:last-child { + -webkit-border-radius: 0 0 4px 0; + -moz-border-radius: 0 0 4px 0; + border-radius: 0 0 4px 0; +} +.table-striped tbody tr:nth-child(odd) td, +.table-striped tbody tr:nth-child(odd) th { + background-color: #f9f9f9; +} +.table tbody tr:hover td, +.table tbody tr:hover th { + background-color: #f5f5f5; +} +table .span1 { + float: none; + width: 44px; + margin-left: 0; +} +table .span2 { + float: none; + width: 124px; + margin-left: 0; +} +table .span3 { + float: none; + width: 204px; + margin-left: 0; +} +table .span4 { + float: none; + width: 284px; + margin-left: 0; +} +table .span5 { + float: none; + width: 364px; + margin-left: 0; +} +table .span6 { + float: none; + width: 444px; + margin-left: 0; +} +table .span7 { + float: none; + width: 524px; + margin-left: 0; +} +table .span8 { + float: none; + width: 604px; + margin-left: 0; +} +table .span9 { + float: none; + width: 684px; + margin-left: 0; +} +table .span10 { + float: none; + width: 764px; + margin-left: 0; +} +table .span11 { + float: none; + width: 844px; + margin-left: 0; +} +table .span12 { + float: none; + width: 924px; + margin-left: 0; +} +table .span13 { + float: none; + width: 1004px; + margin-left: 0; +} +table .span14 { + float: none; + width: 1084px; + margin-left: 0; +} +table .span15 { + float: none; + width: 1164px; + margin-left: 0; +} +table .span16 { + float: none; + width: 1244px; + margin-left: 0; +} +table .span17 { + float: none; + width: 1324px; + margin-left: 0; +} +table .span18 { + float: none; + width: 1404px; + margin-left: 0; +} +table .span19 { + float: none; + width: 1484px; + margin-left: 0; +} +table .span20 { + float: none; + width: 1564px; + margin-left: 0; +} +table .span21 { + float: none; + width: 1644px; + margin-left: 0; +} +table .span22 { + float: none; + width: 1724px; + margin-left: 0; +} +table .span23 { + float: none; + width: 1804px; + margin-left: 0; +} +table .span24 { + float: none; + width: 1884px; + margin-left: 0; +} +[class^="icon-"], +[class*=" icon-"] { + display: inline-block; + width: 14px; + height: 14px; + line-height: 14px; + vertical-align: text-top; + background-image: url("../img/glyphicons-halflings.png"); + background-position: 14px 14px; + background-repeat: no-repeat; + *margin-right: .3em; +} +[class^="icon-"]:last-child, +[class*=" icon-"]:last-child { + *margin-left: 0; +} +.icon-white { + background-image: url("../img/glyphicons-halflings-white.png"); +} +.icon-glass { + background-position: 0 0; +} +.icon-music { + background-position: -24px 0; +} +.icon-search { + background-position: -48px 0; +} +.icon-envelope { + background-position: -72px 0; +} +.icon-heart { + background-position: -96px 0; +} +.icon-star { + background-position: -120px 0; +} +.icon-star-empty { + background-position: -144px 0; +} +.icon-user { + background-position: -168px 0; +} +.icon-film { + background-position: -192px 0; +} +.icon-th-large { + background-position: -216px 0; +} +.icon-th { + background-position: -240px 0; +} +.icon-th-list { + background-position: -264px 0; +} +.icon-ok { + background-position: -288px 0; +} +.icon-remove { + background-position: -312px 0; +} +.icon-zoom-in { + background-position: -336px 0; +} +.icon-zoom-out { + background-position: -360px 0; +} +.icon-off { + background-position: -384px 0; +} +.icon-signal { + background-position: -408px 0; +} +.icon-cog { + background-position: -432px 0; +} +.icon-trash { + background-position: -456px 0; +} +.icon-home { + background-position: 0 -24px; +} +.icon-file { + background-position: -24px -24px; +} +.icon-time { + background-position: -48px -24px; +} +.icon-road { + background-position: -72px -24px; +} +.icon-download-alt { + background-position: -96px -24px; +} +.icon-download { + background-position: -120px -24px; +} +.icon-upload { + background-position: -144px -24px; +} +.icon-inbox { + background-position: -168px -24px; +} +.icon-play-circle { + background-position: -192px -24px; +} +.icon-repeat { + background-position: -216px -24px; +} +.icon-refresh { + background-position: -240px -24px; +} +.icon-list-alt { + background-position: -264px -24px; +} +.icon-lock { + background-position: -287px -24px; +} +.icon-flag { + background-position: -312px -24px; +} +.icon-headphones { + background-position: -336px -24px; +} +.icon-volume-off { + background-position: -360px -24px; +} +.icon-volume-down { + background-position: -384px -24px; +} +.icon-volume-up { + background-position: -408px -24px; +} +.icon-qrcode { + background-position: -432px -24px; +} +.icon-barcode { + background-position: -456px -24px; +} +.icon-tag { + background-position: 0 -48px; +} +.icon-tags { + background-position: -25px -48px; +} +.icon-book { + background-position: -48px -48px; +} +.icon-bookmark { + background-position: -72px -48px; +} +.icon-print { + background-position: -96px -48px; +} +.icon-camera { + background-position: -120px -48px; +} +.icon-font { + background-position: -144px -48px; +} +.icon-bold { + background-position: -167px -48px; +} +.icon-italic { + background-position: -192px -48px; +} +.icon-text-height { + background-position: -216px -48px; +} +.icon-text-width { + background-position: -240px -48px; +} +.icon-align-left { + background-position: -264px -48px; +} +.icon-align-center { + background-position: -288px -48px; +} +.icon-align-right { + background-position: -312px -48px; +} +.icon-align-justify { + background-position: -336px -48px; +} +.icon-list { + background-position: -360px -48px; +} +.icon-indent-left { + background-position: -384px -48px; +} +.icon-indent-right { + background-position: -408px -48px; +} +.icon-facetime-video { + background-position: -432px -48px; +} +.icon-picture { + background-position: -456px -48px; +} +.icon-pencil { + background-position: 0 -72px; +} +.icon-map-marker { + background-position: -24px -72px; +} +.icon-adjust { + background-position: -48px -72px; +} +.icon-tint { + background-position: -72px -72px; +} +.icon-edit { + background-position: -96px -72px; +} +.icon-share { + background-position: -120px -72px; +} +.icon-check { + background-position: -144px -72px; +} +.icon-move { + background-position: -168px -72px; +} +.icon-step-backward { + background-position: -192px -72px; +} +.icon-fast-backward { + background-position: -216px -72px; +} +.icon-backward { + background-position: -240px -72px; +} +.icon-play { + background-position: -264px -72px; +} +.icon-pause { + background-position: -288px -72px; +} +.icon-stop { + background-position: -312px -72px; +} +.icon-forward { + background-position: -336px -72px; +} +.icon-fast-forward { + background-position: -360px -72px; +} +.icon-step-forward { + background-position: -384px -72px; +} +.icon-eject { + background-position: -408px -72px; +} +.icon-chevron-left { + background-position: -432px -72px; +} +.icon-chevron-right { + background-position: -456px -72px; +} +.icon-plus-sign { + background-position: 0 -96px; +} +.icon-minus-sign { + background-position: -24px -96px; +} +.icon-remove-sign { + background-position: -48px -96px; +} +.icon-ok-sign { + background-position: -72px -96px; +} +.icon-question-sign { + background-position: -96px -96px; +} +.icon-info-sign { + background-position: -120px -96px; +} +.icon-screenshot { + background-position: -144px -96px; +} +.icon-remove-circle { + background-position: -168px -96px; +} +.icon-ok-circle { + background-position: -192px -96px; +} +.icon-ban-circle { + background-position: -216px -96px; +} +.icon-arrow-left { + background-position: -240px -96px; +} +.icon-arrow-right { + background-position: -264px -96px; +} +.icon-arrow-up { + background-position: -289px -96px; +} +.icon-arrow-down { + background-position: -312px -96px; +} +.icon-share-alt { + background-position: -336px -96px; +} +.icon-resize-full { + background-position: -360px -96px; +} +.icon-resize-small { + background-position: -384px -96px; +} +.icon-plus { + background-position: -408px -96px; +} +.icon-minus { + background-position: -433px -96px; +} +.icon-asterisk { + background-position: -456px -96px; +} +.icon-exclamation-sign { + background-position: 0 -120px; +} +.icon-gift { + background-position: -24px -120px; +} +.icon-leaf { + background-position: -48px -120px; +} +.icon-fire { + background-position: -72px -120px; +} +.icon-eye-open { + background-position: -96px -120px; +} +.icon-eye-close { + background-position: -120px -120px; +} +.icon-warning-sign { + background-position: -144px -120px; +} +.icon-plane { + background-position: -168px -120px; +} +.icon-calendar { + background-position: -192px -120px; +} +.icon-random { + background-position: -216px -120px; +} +.icon-comment { + background-position: -240px -120px; +} +.icon-magnet { + background-position: -264px -120px; +} +.icon-chevron-up { + background-position: -288px -120px; +} +.icon-chevron-down { + background-position: -313px -119px; +} +.icon-retweet { + background-position: -336px -120px; +} +.icon-shopping-cart { + background-position: -360px -120px; +} +.icon-folder-close { + background-position: -384px -120px; +} +.icon-folder-open { + background-position: -408px -120px; +} +.icon-resize-vertical { + background-position: -432px -119px; +} +.icon-resize-horizontal { + background-position: -456px -118px; +} +.dropdown { + position: relative; +} +.dropdown-toggle { + *margin-bottom: -3px; +} +.dropdown-toggle:active, +.open .dropdown-toggle { + outline: 0; +} +.caret { + display: inline-block; + width: 0; + height: 0; + vertical-align: top; + border-left: 4px solid transparent; + border-right: 4px solid transparent; + border-top: 4px solid #000000; + opacity: 0.3; + filter: alpha(opacity=30); + content: ""; +} +.dropdown .caret { + margin-top: 8px; + margin-left: 2px; +} +.dropdown:hover .caret, +.open.dropdown .caret { + opacity: 1; + filter: alpha(opacity=100); +} +.dropdown-menu { + position: absolute; + top: 100%; + left: 0; + z-index: 1000; + float: left; + display: none; + min-width: 160px; + padding: 4px 0; + margin: 0; + list-style: none; + background-color: #ffffff; + border-color: #ccc; + border-color: rgba(0, 0, 0, 0.2); + border-style: solid; + border-width: 1px; + -webkit-border-radius: 0 0 5px 5px; + -moz-border-radius: 0 0 5px 5px; + border-radius: 0 0 5px 5px; + -webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2); + -moz-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2); + box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2); + -webkit-background-clip: padding-box; + -moz-background-clip: padding; + background-clip: padding-box; + *border-right-width: 2px; + *border-bottom-width: 2px; +} +.dropdown-menu.pull-right { + right: 0; + left: auto; +} +.dropdown-menu .divider { + height: 1px; + margin: 8px 1px; + overflow: hidden; + background-color: #e5e5e5; + border-bottom: 1px solid #ffffff; + *width: 100%; + *margin: -5px 0 5px; +} +.dropdown-menu a { + display: block; + padding: 3px 15px; + clear: both; + font-weight: normal; + line-height: 18px; + color: #333333; + white-space: nowrap; +} +.dropdown-menu li > a:hover, +.dropdown-menu .active > a, +.dropdown-menu .active > a:hover { + color: #ffffff; + text-decoration: none; + background-color: #0088cc; +} +.dropdown.open { + *z-index: 1000; +} +.dropdown.open .dropdown-toggle { + color: #ffffff; + background: #ccc; + background: rgba(0, 0, 0, 0.3); +} +.dropdown.open .dropdown-menu { + display: block; +} +.pull-right .dropdown-menu { + left: auto; + right: 0; +} +.dropup .caret, +.navbar-fixed-bottom .dropdown .caret { + border-top: 0; + border-bottom: 4px solid #000000; + content: "\2191"; +} +.dropup .dropdown-menu, +.navbar-fixed-bottom .dropdown .dropdown-menu { + top: auto; + bottom: 100%; + margin-bottom: 1px; +} +.typeahead { + margin-top: 2px; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; +} +.well { + min-height: 20px; + padding: 19px; + margin-bottom: 20px; + background-color: #f5f5f5; + border: 1px solid #eee; + border: 1px solid rgba(0, 0, 0, 0.05); + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05); + -moz-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05); + box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05); +} +.well blockquote { + border-color: #ddd; + border-color: rgba(0, 0, 0, 0.15); +} +.well-large { + padding: 24px; + -webkit-border-radius: 6px; + -moz-border-radius: 6px; + border-radius: 6px; +} +.well-small { + padding: 9px; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; +} +.fade { + -webkit-transition: opacity 0.15s linear; + -moz-transition: opacity 0.15s linear; + -ms-transition: opacity 0.15s linear; + -o-transition: opacity 0.15s linear; + transition: opacity 0.15s linear; + opacity: 0; +} +.fade.in { + opacity: 1; +} +.collapse { + -webkit-transition: height 0.35s ease; + -moz-transition: height 0.35s ease; + -ms-transition: height 0.35s ease; + -o-transition: height 0.35s ease; + transition: height 0.35s ease; + position: relative; + overflow: hidden; + height: 0; +} +.collapse.in { + height: auto; +} +.close { + float: right; + font-size: 20px; + font-weight: bold; + line-height: 18px; + color: #000000; + text-shadow: 0 1px 0 #ffffff; + opacity: 0.2; + filter: alpha(opacity=20); +} +.close:hover { + color: #000000; + text-decoration: none; + opacity: 0.4; + filter: alpha(opacity=40); + cursor: pointer; +} +.btn { + display: inline-block; + *display: inline; + /* IE7 inline-block hack */ + + *zoom: 1; + padding: 4px 10px 4px; + margin-bottom: 0; + font-size: 13px; + line-height: 18px; + color: #333333; + text-align: center; + text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75); + vertical-align: middle; + background-color: #f5f5f5; + background-image: -moz-linear-gradient(top, #ffffff, #e6e6e6); + background-image: -ms-linear-gradient(top, #ffffff, #e6e6e6); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), to(#e6e6e6)); + background-image: -webkit-linear-gradient(top, #ffffff, #e6e6e6); + background-image: -o-linear-gradient(top, #ffffff, #e6e6e6); + background-image: linear-gradient(top, #ffffff, #e6e6e6); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#e6e6e6', GradientType=0); + border-color: #e6e6e6 #e6e6e6 #bfbfbf; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + filter: progid:dximagetransform.microsoft.gradient(enabled=false); + border: 1px solid #cccccc; + border-bottom-color: #b3b3b3; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + cursor: pointer; + *margin-left: .3em; +} +.btn:hover, +.btn:active, +.btn.active, +.btn.disabled, +.btn[disabled] { + background-color: #e6e6e6; +} +.btn:active, +.btn.active { + background-color: #cccccc \9; +} +.btn:first-child { + *margin-left: 0; +} +.btn:hover { + color: #333333; + text-decoration: none; + background-color: #e6e6e6; + background-position: 0 -15px; + -webkit-transition: background-position 0.1s linear; + -moz-transition: background-position 0.1s linear; + -ms-transition: background-position 0.1s linear; + -o-transition: background-position 0.1s linear; + transition: background-position 0.1s linear; +} +.btn:focus { + outline: thin dotted #333; + outline: 5px auto -webkit-focus-ring-color; + outline-offset: -2px; +} +.btn.active, +.btn:active { + background-image: none; + -webkit-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05); + -moz-box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05); + box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05); + background-color: #e6e6e6; + background-color: #d9d9d9 \9; + outline: 0; +} +.btn.disabled, +.btn[disabled] { + cursor: default; + background-image: none; + background-color: #e6e6e6; + opacity: 0.65; + filter: alpha(opacity=65); + -webkit-box-shadow: none; + -moz-box-shadow: none; + box-shadow: none; +} +.btn-large { + padding: 9px 14px; + font-size: 15px; + line-height: normal; + -webkit-border-radius: 5px; + -moz-border-radius: 5px; + border-radius: 5px; +} +.btn-large [class^="icon-"] { + margin-top: 1px; +} +.btn-small { + padding: 5px 9px; + font-size: 11px; + line-height: 16px; +} +.btn-small [class^="icon-"] { + margin-top: -1px; +} +.btn-mini { + padding: 2px 6px; + font-size: 11px; + line-height: 14px; +} +.btn-primary, +.btn-primary:hover, +.btn-warning, +.btn-warning:hover, +.btn-danger, +.btn-danger:hover, +.btn-success, +.btn-success:hover, +.btn-info, +.btn-info:hover, +.btn-inverse, +.btn-inverse:hover { + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + color: #ffffff; +} +.btn-primary.active, +.btn-warning.active, +.btn-danger.active, +.btn-success.active, +.btn-info.active, +.btn-inverse.active { + color: rgba(255, 255, 255, 0.75); +} +.btn-primary { + background-color: #0074cc; + background-image: -moz-linear-gradient(top, #0088cc, #0055cc); + background-image: -ms-linear-gradient(top, #0088cc, #0055cc); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#0088cc), to(#0055cc)); + background-image: -webkit-linear-gradient(top, #0088cc, #0055cc); + background-image: -o-linear-gradient(top, #0088cc, #0055cc); + background-image: linear-gradient(top, #0088cc, #0055cc); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#0088cc', endColorstr='#0055cc', GradientType=0); + border-color: #0055cc #0055cc #003580; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + filter: progid:dximagetransform.microsoft.gradient(enabled=false); +} +.btn-primary:hover, +.btn-primary:active, +.btn-primary.active, +.btn-primary.disabled, +.btn-primary[disabled] { + background-color: #0055cc; +} +.btn-primary:active, +.btn-primary.active { + background-color: #004099 \9; +} +.btn-warning { + background-color: #faa732; + background-image: -moz-linear-gradient(top, #fbb450, #f89406); + background-image: -ms-linear-gradient(top, #fbb450, #f89406); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#fbb450), to(#f89406)); + background-image: -webkit-linear-gradient(top, #fbb450, #f89406); + background-image: -o-linear-gradient(top, #fbb450, #f89406); + background-image: linear-gradient(top, #fbb450, #f89406); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#fbb450', endColorstr='#f89406', GradientType=0); + border-color: #f89406 #f89406 #ad6704; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + filter: progid:dximagetransform.microsoft.gradient(enabled=false); +} +.btn-warning:hover, +.btn-warning:active, +.btn-warning.active, +.btn-warning.disabled, +.btn-warning[disabled] { + background-color: #f89406; +} +.btn-warning:active, +.btn-warning.active { + background-color: #c67605 \9; +} +.btn-danger { + background-color: #da4f49; + background-image: -moz-linear-gradient(top, #ee5f5b, #bd362f); + background-image: -ms-linear-gradient(top, #ee5f5b, #bd362f); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ee5f5b), to(#bd362f)); + background-image: -webkit-linear-gradient(top, #ee5f5b, #bd362f); + background-image: -o-linear-gradient(top, #ee5f5b, #bd362f); + background-image: linear-gradient(top, #ee5f5b, #bd362f); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ee5f5b', endColorstr='#bd362f', GradientType=0); + border-color: #bd362f #bd362f #802420; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + filter: progid:dximagetransform.microsoft.gradient(enabled=false); +} +.btn-danger:hover, +.btn-danger:active, +.btn-danger.active, +.btn-danger.disabled, +.btn-danger[disabled] { + background-color: #bd362f; +} +.btn-danger:active, +.btn-danger.active { + background-color: #942a25 \9; +} +.btn-success { + background-color: #5bb75b; + background-image: -moz-linear-gradient(top, #62c462, #51a351); + background-image: -ms-linear-gradient(top, #62c462, #51a351); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#62c462), to(#51a351)); + background-image: -webkit-linear-gradient(top, #62c462, #51a351); + background-image: -o-linear-gradient(top, #62c462, #51a351); + background-image: linear-gradient(top, #62c462, #51a351); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#62c462', endColorstr='#51a351', GradientType=0); + border-color: #51a351 #51a351 #387038; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + filter: progid:dximagetransform.microsoft.gradient(enabled=false); +} +.btn-success:hover, +.btn-success:active, +.btn-success.active, +.btn-success.disabled, +.btn-success[disabled] { + background-color: #51a351; +} +.btn-success:active, +.btn-success.active { + background-color: #408140 \9; +} +.btn-info { + background-color: #49afcd; + background-image: -moz-linear-gradient(top, #5bc0de, #2f96b4); + background-image: -ms-linear-gradient(top, #5bc0de, #2f96b4); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#5bc0de), to(#2f96b4)); + background-image: -webkit-linear-gradient(top, #5bc0de, #2f96b4); + background-image: -o-linear-gradient(top, #5bc0de, #2f96b4); + background-image: linear-gradient(top, #5bc0de, #2f96b4); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#5bc0de', endColorstr='#2f96b4', GradientType=0); + border-color: #2f96b4 #2f96b4 #1f6377; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + filter: progid:dximagetransform.microsoft.gradient(enabled=false); +} +.btn-info:hover, +.btn-info:active, +.btn-info.active, +.btn-info.disabled, +.btn-info[disabled] { + background-color: #2f96b4; +} +.btn-info:active, +.btn-info.active { + background-color: #24748c \9; +} +.btn-inverse { + background-color: #414141; + background-image: -moz-linear-gradient(top, #555555, #222222); + background-image: -ms-linear-gradient(top, #555555, #222222); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#555555), to(#222222)); + background-image: -webkit-linear-gradient(top, #555555, #222222); + background-image: -o-linear-gradient(top, #555555, #222222); + background-image: linear-gradient(top, #555555, #222222); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#555555', endColorstr='#222222', GradientType=0); + border-color: #222222 #222222 #000000; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + filter: progid:dximagetransform.microsoft.gradient(enabled=false); +} +.btn-inverse:hover, +.btn-inverse:active, +.btn-inverse.active, +.btn-inverse.disabled, +.btn-inverse[disabled] { + background-color: #222222; +} +.btn-inverse:active, +.btn-inverse.active { + background-color: #080808 \9; +} +button.btn, +input[type="submit"].btn { + *padding-top: 2px; + *padding-bottom: 2px; +} +button.btn::-moz-focus-inner, +input[type="submit"].btn::-moz-focus-inner { + padding: 0; + border: 0; +} +button.btn.btn-large, +input[type="submit"].btn.btn-large { + *padding-top: 7px; + *padding-bottom: 7px; +} +button.btn.btn-small, +input[type="submit"].btn.btn-small { + *padding-top: 3px; + *padding-bottom: 3px; +} +button.btn.btn-mini, +input[type="submit"].btn.btn-mini { + *padding-top: 1px; + *padding-bottom: 1px; +} +.btn-group { + position: relative; + *zoom: 1; + *margin-left: .3em; +} +.btn-group:before, +.btn-group:after { + display: table; + content: ""; +} +.btn-group:after { + clear: both; +} +.btn-group:first-child { + *margin-left: 0; +} +.btn-group + .btn-group { + margin-left: 5px; +} +.btn-toolbar { + margin-top: 9px; + margin-bottom: 9px; +} +.btn-toolbar .btn-group { + display: inline-block; + *display: inline; + /* IE7 inline-block hack */ + + *zoom: 1; +} +.btn-group .btn { + position: relative; + float: left; + margin-left: -1px; + -webkit-border-radius: 0; + -moz-border-radius: 0; + border-radius: 0; +} +.btn-group .btn:first-child { + margin-left: 0; + -webkit-border-top-left-radius: 4px; + -moz-border-radius-topleft: 4px; + border-top-left-radius: 4px; + -webkit-border-bottom-left-radius: 4px; + -moz-border-radius-bottomleft: 4px; + border-bottom-left-radius: 4px; +} +.btn-group .btn:last-child, +.btn-group .dropdown-toggle { + -webkit-border-top-right-radius: 4px; + -moz-border-radius-topright: 4px; + border-top-right-radius: 4px; + -webkit-border-bottom-right-radius: 4px; + -moz-border-radius-bottomright: 4px; + border-bottom-right-radius: 4px; +} +.btn-group .btn.large:first-child { + margin-left: 0; + -webkit-border-top-left-radius: 6px; + -moz-border-radius-topleft: 6px; + border-top-left-radius: 6px; + -webkit-border-bottom-left-radius: 6px; + -moz-border-radius-bottomleft: 6px; + border-bottom-left-radius: 6px; +} +.btn-group .btn.large:last-child, +.btn-group .large.dropdown-toggle { + -webkit-border-top-right-radius: 6px; + -moz-border-radius-topright: 6px; + border-top-right-radius: 6px; + -webkit-border-bottom-right-radius: 6px; + -moz-border-radius-bottomright: 6px; + border-bottom-right-radius: 6px; +} +.btn-group .btn:hover, +.btn-group .btn:focus, +.btn-group .btn:active, +.btn-group .btn.active { + z-index: 2; +} +.btn-group .dropdown-toggle:active, +.btn-group.open .dropdown-toggle { + outline: 0; +} +.btn-group .dropdown-toggle { + padding-left: 8px; + padding-right: 8px; + -webkit-box-shadow: inset 1px 0 0 rgba(255, 255, 255, 0.125), inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + -moz-box-shadow: inset 1px 0 0 rgba(255, 255, 255, 0.125), inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + box-shadow: inset 1px 0 0 rgba(255, 255, 255, 0.125), inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05); + *padding-top: 3px; + *padding-bottom: 3px; +} +.btn-group .btn-mini.dropdown-toggle { + padding-left: 5px; + padding-right: 5px; + *padding-top: 1px; + *padding-bottom: 1px; +} +.btn-group .btn-small.dropdown-toggle { + *padding-top: 4px; + *padding-bottom: 4px; +} +.btn-group .btn-large.dropdown-toggle { + padding-left: 12px; + padding-right: 12px; +} +.btn-group.open { + *z-index: 1000; +} +.btn-group.open .dropdown-menu { + display: block; + margin-top: 1px; + -webkit-border-radius: 5px; + -moz-border-radius: 5px; + border-radius: 5px; +} +.btn-group.open .dropdown-toggle { + background-image: none; + -webkit-box-shadow: inset 0 1px 6px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05); + -moz-box-shadow: inset 0 1px 6px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05); + box-shadow: inset 0 1px 6px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05); +} +.btn .caret { + margin-top: 7px; + margin-left: 0; +} +.btn:hover .caret, +.open.btn-group .caret { + opacity: 1; + filter: alpha(opacity=100); +} +.btn-mini .caret { + margin-top: 5px; +} +.btn-small .caret { + margin-top: 6px; +} +.btn-large .caret { + margin-top: 6px; + border-left: 5px solid transparent; + border-right: 5px solid transparent; + border-top: 5px solid #000000; +} +.btn-primary .caret, +.btn-warning .caret, +.btn-danger .caret, +.btn-info .caret, +.btn-success .caret, +.btn-inverse .caret { + border-top-color: #ffffff; + border-bottom-color: #ffffff; + opacity: 0.75; + filter: alpha(opacity=75); +} +.alert { + padding: 8px 35px 8px 14px; + margin-bottom: 18px; + text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5); + background-color: #fcf8e3; + border: 1px solid #fbeed5; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + color: #c09853; +} +.alert-heading { + color: inherit; +} +.alert .close { + position: relative; + top: -2px; + right: -21px; + line-height: 18px; +} +.alert-success { + background-color: #dff0d8; + border-color: #d6e9c6; + color: #468847; +} +.alert-danger, +.alert-error { + background-color: #f2dede; + border-color: #eed3d7; + color: #b94a48; +} +.alert-info { + background-color: #d9edf7; + border-color: #bce8f1; + color: #3a87ad; +} +.alert-block { + padding-top: 14px; + padding-bottom: 14px; +} +.alert-block > p, +.alert-block > ul { + margin-bottom: 0; +} +.alert-block p + p { + margin-top: 5px; +} +.nav { + margin-left: 0; + margin-bottom: 18px; + list-style: none; +} +.nav > li > a { + display: block; +} +.nav > li > a:hover { + text-decoration: none; + background-color: #eeeeee; +} +.nav .nav-header { + display: block; + padding: 3px 15px; + font-size: 11px; + font-weight: bold; + line-height: 18px; + color: #999999; + text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5); + text-transform: uppercase; +} +.nav li + .nav-header { + margin-top: 9px; +} +.nav-list { + padding-left: 15px; + padding-right: 15px; + margin-bottom: 0; +} +.nav-list > li > a, +.nav-list .nav-header { + margin-left: -15px; + margin-right: -15px; + text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5); +} +.nav-list > li > a { + padding: 3px 15px; +} +.nav-list > .active > a, +.nav-list > .active > a:hover { + color: #ffffff; + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.2); + background-color: #0088cc; +} +.nav-list [class^="icon-"] { + margin-right: 2px; +} +.nav-list .divider { + height: 1px; + margin: 8px 1px; + overflow: hidden; + background-color: #e5e5e5; + border-bottom: 1px solid #ffffff; + *width: 100%; + *margin: -5px 0 5px; +} +.nav-tabs, +.nav-pills { + *zoom: 1; +} +.nav-tabs:before, +.nav-pills:before, +.nav-tabs:after, +.nav-pills:after { + display: table; + content: ""; +} +.nav-tabs:after, +.nav-pills:after { + clear: both; +} +.nav-tabs > li, +.nav-pills > li { + float: left; +} +.nav-tabs > li > a, +.nav-pills > li > a { + padding-right: 12px; + padding-left: 12px; + margin-right: 2px; + line-height: 14px; +} +.nav-tabs { + border-bottom: 1px solid #ddd; +} +.nav-tabs > li { + margin-bottom: -1px; +} +.nav-tabs > li > a { + padding-top: 8px; + padding-bottom: 8px; + line-height: 18px; + border: 1px solid transparent; + -webkit-border-radius: 4px 4px 0 0; + -moz-border-radius: 4px 4px 0 0; + border-radius: 4px 4px 0 0; +} +.nav-tabs > li > a:hover { + border-color: #eeeeee #eeeeee #dddddd; +} +.nav-tabs > .active > a, +.nav-tabs > .active > a:hover { + color: #555555; + background-color: #ffffff; + border: 1px solid #ddd; + border-bottom-color: transparent; + cursor: default; +} +.nav-pills > li > a { + padding-top: 8px; + padding-bottom: 8px; + margin-top: 2px; + margin-bottom: 2px; + -webkit-border-radius: 5px; + -moz-border-radius: 5px; + border-radius: 5px; +} +.nav-pills > .active > a, +.nav-pills > .active > a:hover { + color: #ffffff; + background-color: #0088cc; +} +.nav-stacked > li { + float: none; +} +.nav-stacked > li > a { + margin-right: 0; +} +.nav-tabs.nav-stacked { + border-bottom: 0; +} +.nav-tabs.nav-stacked > li > a { + border: 1px solid #ddd; + -webkit-border-radius: 0; + -moz-border-radius: 0; + border-radius: 0; +} +.nav-tabs.nav-stacked > li:first-child > a { + -webkit-border-radius: 4px 4px 0 0; + -moz-border-radius: 4px 4px 0 0; + border-radius: 4px 4px 0 0; +} +.nav-tabs.nav-stacked > li:last-child > a { + -webkit-border-radius: 0 0 4px 4px; + -moz-border-radius: 0 0 4px 4px; + border-radius: 0 0 4px 4px; +} +.nav-tabs.nav-stacked > li > a:hover { + border-color: #ddd; + z-index: 2; +} +.nav-pills.nav-stacked > li > a { + margin-bottom: 3px; +} +.nav-pills.nav-stacked > li:last-child > a { + margin-bottom: 1px; +} +.nav-tabs .dropdown-menu, +.nav-pills .dropdown-menu { + margin-top: 1px; + border-width: 1px; +} +.nav-pills .dropdown-menu { + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; +} +.nav-tabs .dropdown-toggle .caret, +.nav-pills .dropdown-toggle .caret { + border-top-color: #0088cc; + border-bottom-color: #0088cc; + margin-top: 6px; +} +.nav-tabs .dropdown-toggle:hover .caret, +.nav-pills .dropdown-toggle:hover .caret { + border-top-color: #005580; + border-bottom-color: #005580; +} +.nav-tabs .active .dropdown-toggle .caret, +.nav-pills .active .dropdown-toggle .caret { + border-top-color: #333333; + border-bottom-color: #333333; +} +.nav > .dropdown.active > a:hover { + color: #000000; + cursor: pointer; +} +.nav-tabs .open .dropdown-toggle, +.nav-pills .open .dropdown-toggle, +.nav > .open.active > a:hover { + color: #ffffff; + background-color: #999999; + border-color: #999999; +} +.nav .open .caret, +.nav .open.active .caret, +.nav .open a:hover .caret { + border-top-color: #ffffff; + border-bottom-color: #ffffff; + opacity: 1; + filter: alpha(opacity=100); +} +.tabs-stacked .open > a:hover { + border-color: #999999; +} +.tabbable { + *zoom: 1; +} +.tabbable:before, +.tabbable:after { + display: table; + content: ""; +} +.tabbable:after { + clear: both; +} +.tab-content { + display: table; + width: 100%; +} +.tabs-below .nav-tabs, +.tabs-right .nav-tabs, +.tabs-left .nav-tabs { + border-bottom: 0; +} +.tab-content > .tab-pane, +.pill-content > .pill-pane { + display: none; +} +.tab-content > .active, +.pill-content > .active { + display: block; +} +.tabs-below .nav-tabs { + border-top: 1px solid #ddd; +} +.tabs-below .nav-tabs > li { + margin-top: -1px; + margin-bottom: 0; +} +.tabs-below .nav-tabs > li > a { + -webkit-border-radius: 0 0 4px 4px; + -moz-border-radius: 0 0 4px 4px; + border-radius: 0 0 4px 4px; +} +.tabs-below .nav-tabs > li > a:hover { + border-bottom-color: transparent; + border-top-color: #ddd; +} +.tabs-below .nav-tabs .active > a, +.tabs-below .nav-tabs .active > a:hover { + border-color: transparent #ddd #ddd #ddd; +} +.tabs-left .nav-tabs > li, +.tabs-right .nav-tabs > li { + float: none; +} +.tabs-left .nav-tabs > li > a, +.tabs-right .nav-tabs > li > a { + min-width: 74px; + margin-right: 0; + margin-bottom: 3px; +} +.tabs-left .nav-tabs { + float: left; + margin-right: 19px; + border-right: 1px solid #ddd; +} +.tabs-left .nav-tabs > li > a { + margin-right: -1px; + -webkit-border-radius: 4px 0 0 4px; + -moz-border-radius: 4px 0 0 4px; + border-radius: 4px 0 0 4px; +} +.tabs-left .nav-tabs > li > a:hover { + border-color: #eeeeee #dddddd #eeeeee #eeeeee; +} +.tabs-left .nav-tabs .active > a, +.tabs-left .nav-tabs .active > a:hover { + border-color: #ddd transparent #ddd #ddd; + *border-right-color: #ffffff; +} +.tabs-right .nav-tabs { + float: right; + margin-left: 19px; + border-left: 1px solid #ddd; +} +.tabs-right .nav-tabs > li > a { + margin-left: -1px; + -webkit-border-radius: 0 4px 4px 0; + -moz-border-radius: 0 4px 4px 0; + border-radius: 0 4px 4px 0; +} +.tabs-right .nav-tabs > li > a:hover { + border-color: #eeeeee #eeeeee #eeeeee #dddddd; +} +.tabs-right .nav-tabs .active > a, +.tabs-right .nav-tabs .active > a:hover { + border-color: #ddd #ddd #ddd transparent; + *border-left-color: #ffffff; +} +.navbar { + *position: relative; + *z-index: 2; + overflow: visible; + margin-bottom: 18px; +} +.navbar-inner { + padding-left: 20px; + padding-right: 20px; + background-color: #2c2c2c; + background-image: -moz-linear-gradient(top, #333333, #222222); + background-image: -ms-linear-gradient(top, #333333, #222222); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#333333), to(#222222)); + background-image: -webkit-linear-gradient(top, #333333, #222222); + background-image: -o-linear-gradient(top, #333333, #222222); + background-image: linear-gradient(top, #333333, #222222); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#333333', endColorstr='#222222', GradientType=0); + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + -webkit-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1); + -moz-box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1); + box-shadow: 0 1px 3px rgba(0, 0, 0, 0.25), inset 0 -1px 0 rgba(0, 0, 0, 0.1); +} +.navbar .container { + width: auto; +} +.btn-navbar { + display: none; + float: right; + padding: 7px 10px; + margin-left: 5px; + margin-right: 5px; + background-color: #2c2c2c; + background-image: -moz-linear-gradient(top, #333333, #222222); + background-image: -ms-linear-gradient(top, #333333, #222222); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#333333), to(#222222)); + background-image: -webkit-linear-gradient(top, #333333, #222222); + background-image: -o-linear-gradient(top, #333333, #222222); + background-image: linear-gradient(top, #333333, #222222); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#333333', endColorstr='#222222', GradientType=0); + border-color: #222222 #222222 #000000; + border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); + filter: progid:dximagetransform.microsoft.gradient(enabled=false); + -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.075); + -moz-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.075); + box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.075); +} +.btn-navbar:hover, +.btn-navbar:active, +.btn-navbar.active, +.btn-navbar.disabled, +.btn-navbar[disabled] { + background-color: #222222; +} +.btn-navbar:active, +.btn-navbar.active { + background-color: #080808 \9; +} +.btn-navbar .icon-bar { + display: block; + width: 18px; + height: 2px; + background-color: #f5f5f5; + -webkit-border-radius: 1px; + -moz-border-radius: 1px; + border-radius: 1px; + -webkit-box-shadow: 0 1px 0 rgba(0, 0, 0, 0.25); + -moz-box-shadow: 0 1px 0 rgba(0, 0, 0, 0.25); + box-shadow: 0 1px 0 rgba(0, 0, 0, 0.25); +} +.btn-navbar .icon-bar + .icon-bar { + margin-top: 3px; +} +.nav-collapse.collapse { + height: auto; +} +.navbar { + color: #999999; +} +.navbar .brand:hover { + text-decoration: none; +} +.navbar .brand { + float: left; + display: block; + padding: 8px 20px 12px; + margin-left: -20px; + font-size: 20px; + font-weight: 200; + line-height: 1; + color: #ffffff; +} +.navbar .navbar-text { + margin-bottom: 0; + line-height: 40px; +} +.navbar .btn, +.navbar .btn-group { + margin-top: 5px; +} +.navbar .btn-group .btn { + margin-top: 0; +} +.navbar-form { + margin-bottom: 0; + *zoom: 1; +} +.navbar-form:before, +.navbar-form:after { + display: table; + content: ""; +} +.navbar-form:after { + clear: both; +} +.navbar-form input, +.navbar-form select, +.navbar-form .radio, +.navbar-form .checkbox { + margin-top: 5px; +} +.navbar-form input, +.navbar-form select { + display: inline-block; + margin-bottom: 0; +} +.navbar-form input[type="image"], +.navbar-form input[type="checkbox"], +.navbar-form input[type="radio"] { + margin-top: 3px; +} +.navbar-form .input-append, +.navbar-form .input-prepend { + margin-top: 6px; + white-space: nowrap; +} +.navbar-form .input-append input, +.navbar-form .input-prepend input { + margin-top: 0; +} +.navbar-search { + position: relative; + float: left; + margin-top: 6px; + margin-bottom: 0; +} +.navbar-search .search-query { + padding: 4px 9px; + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-size: 13px; + font-weight: normal; + line-height: 1; + color: #ffffff; + background-color: #626262; + border: 1px solid #151515; + -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1), 0 1px 0px rgba(255, 255, 255, 0.15); + -moz-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1), 0 1px 0px rgba(255, 255, 255, 0.15); + box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1), 0 1px 0px rgba(255, 255, 255, 0.15); + -webkit-transition: none; + -moz-transition: none; + -ms-transition: none; + -o-transition: none; + transition: none; +} +.navbar-search .search-query:-moz-placeholder { + color: #cccccc; +} +.navbar-search .search-query::-webkit-input-placeholder { + color: #cccccc; +} +.navbar-search .search-query:focus, +.navbar-search .search-query.focused { + padding: 5px 10px; + color: #333333; + text-shadow: 0 1px 0 #ffffff; + background-color: #ffffff; + border: 0; + -webkit-box-shadow: 0 0 3px rgba(0, 0, 0, 0.15); + -moz-box-shadow: 0 0 3px rgba(0, 0, 0, 0.15); + box-shadow: 0 0 3px rgba(0, 0, 0, 0.15); + outline: 0; +} +.navbar-fixed-top, +.navbar-fixed-bottom { + position: fixed; + right: 0; + left: 0; + z-index: 1030; + margin-bottom: 0; +} +.navbar-fixed-top .navbar-inner, +.navbar-fixed-bottom .navbar-inner { + padding-left: 0; + padding-right: 0; + -webkit-border-radius: 0; + -moz-border-radius: 0; + border-radius: 0; +} +.navbar-fixed-top .container, +.navbar-fixed-bottom .container { + width: 940px; +} +.navbar-fixed-top { + top: 0; +} +.navbar-fixed-bottom { + bottom: 0; +} +.navbar .nav { + position: relative; + left: 0; + display: block; + float: left; + margin: 0 10px 0 0; +} +.navbar .nav.pull-right { + float: right; +} +.navbar .nav > li { + display: block; + float: left; +} +.navbar .nav > li > a { + float: none; + padding: 10px 10px 11px; + line-height: 19px; + color: #999999; + text-decoration: none; + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); +} +.navbar .nav > li > a:hover { + background-color: transparent; + color: #ffffff; + text-decoration: none; +} +.navbar .nav .active > a, +.navbar .nav .active > a:hover { + color: #ffffff; + text-decoration: none; + background-color: #222222; +} +.navbar .divider-vertical { + height: 40px; + width: 1px; + margin: 0 9px; + overflow: hidden; + background-color: #222222; + border-right: 1px solid #333333; +} +.navbar .nav.pull-right { + margin-left: 10px; + margin-right: 0; +} +.navbar .dropdown-menu { + margin-top: 1px; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; +} +.navbar .dropdown-menu:before { + content: ''; + display: inline-block; + border-left: 7px solid transparent; + border-right: 7px solid transparent; + border-bottom: 7px solid #ccc; + border-bottom-color: rgba(0, 0, 0, 0.2); + position: absolute; + top: -7px; + left: 9px; +} +.navbar .dropdown-menu:after { + content: ''; + display: inline-block; + border-left: 6px solid transparent; + border-right: 6px solid transparent; + border-bottom: 6px solid #ffffff; + position: absolute; + top: -6px; + left: 10px; +} +.navbar-fixed-bottom .dropdown-menu:before { + border-top: 7px solid #ccc; + border-top-color: rgba(0, 0, 0, 0.2); + border-bottom: 0; + bottom: -7px; + top: auto; +} +.navbar-fixed-bottom .dropdown-menu:after { + border-top: 6px solid #ffffff; + border-bottom: 0; + bottom: -6px; + top: auto; +} +.navbar .nav .dropdown-toggle .caret, +.navbar .nav .open.dropdown .caret { + border-top-color: #ffffff; + border-bottom-color: #ffffff; +} +.navbar .nav .active .caret { + opacity: 1; + filter: alpha(opacity=100); +} +.navbar .nav .open > .dropdown-toggle, +.navbar .nav .active > .dropdown-toggle, +.navbar .nav .open.active > .dropdown-toggle { + background-color: transparent; +} +.navbar .nav .active > .dropdown-toggle:hover { + color: #ffffff; +} +.navbar .nav.pull-right .dropdown-menu, +.navbar .nav .dropdown-menu.pull-right { + left: auto; + right: 0; +} +.navbar .nav.pull-right .dropdown-menu:before, +.navbar .nav .dropdown-menu.pull-right:before { + left: auto; + right: 12px; +} +.navbar .nav.pull-right .dropdown-menu:after, +.navbar .nav .dropdown-menu.pull-right:after { + left: auto; + right: 13px; +} +.breadcrumb { + padding: 7px 14px; + margin: 0 0 18px; + list-style: none; + background-color: #fbfbfb; + background-image: -moz-linear-gradient(top, #ffffff, #f5f5f5); + background-image: -ms-linear-gradient(top, #ffffff, #f5f5f5); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), to(#f5f5f5)); + background-image: -webkit-linear-gradient(top, #ffffff, #f5f5f5); + background-image: -o-linear-gradient(top, #ffffff, #f5f5f5); + background-image: linear-gradient(top, #ffffff, #f5f5f5); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#f5f5f5', GradientType=0); + border: 1px solid #ddd; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: inset 0 1px 0 #ffffff; + -moz-box-shadow: inset 0 1px 0 #ffffff; + box-shadow: inset 0 1px 0 #ffffff; +} +.breadcrumb li { + display: inline-block; + *display: inline; + /* IE7 inline-block hack */ + + *zoom: 1; + text-shadow: 0 1px 0 #ffffff; +} +.breadcrumb .divider { + padding: 0 5px; + color: #999999; +} +.breadcrumb .active a { + color: #333333; +} +.pagination { + height: 36px; + margin: 18px 0; +} +.pagination ul { + display: inline-block; + *display: inline; + /* IE7 inline-block hack */ + + *zoom: 1; + margin-left: 0; + margin-bottom: 0; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; + -webkit-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.05); + -moz-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.05); + box-shadow: 0 1px 2px rgba(0, 0, 0, 0.05); +} +.pagination li { + display: inline; +} +.pagination a { + float: left; + padding: 0 14px; + line-height: 34px; + text-decoration: none; + border: 1px solid #ddd; + border-left-width: 0; +} +.pagination a:hover, +.pagination .active a { + background-color: #f5f5f5; +} +.pagination .active a { + color: #999999; + cursor: default; +} +.pagination .disabled span, +.pagination .disabled a, +.pagination .disabled a:hover { + color: #999999; + background-color: transparent; + cursor: default; +} +.pagination li:first-child a { + border-left-width: 1px; + -webkit-border-radius: 3px 0 0 3px; + -moz-border-radius: 3px 0 0 3px; + border-radius: 3px 0 0 3px; +} +.pagination li:last-child a { + -webkit-border-radius: 0 3px 3px 0; + -moz-border-radius: 0 3px 3px 0; + border-radius: 0 3px 3px 0; +} +.pagination-centered { + text-align: center; +} +.pagination-right { + text-align: right; +} +.pager { + margin-left: 0; + margin-bottom: 18px; + list-style: none; + text-align: center; + *zoom: 1; +} +.pager:before, +.pager:after { + display: table; + content: ""; +} +.pager:after { + clear: both; +} +.pager li { + display: inline; +} +.pager a { + display: inline-block; + padding: 5px 14px; + background-color: #fff; + border: 1px solid #ddd; + -webkit-border-radius: 15px; + -moz-border-radius: 15px; + border-radius: 15px; +} +.pager a:hover { + text-decoration: none; + background-color: #f5f5f5; +} +.pager .next a { + float: right; +} +.pager .previous a { + float: left; +} +.pager .disabled a, +.pager .disabled a:hover { + color: #999999; + background-color: #fff; + cursor: default; +} +.modal-open .dropdown-menu { + z-index: 2050; +} +.modal-open .dropdown.open { + *z-index: 2050; +} +.modal-open .popover { + z-index: 2060; +} +.modal-open .tooltip { + z-index: 2070; +} +.modal-backdrop { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1040; + background-color: #000000; +} +.modal-backdrop.fade { + opacity: 0; +} +.modal-backdrop, +.modal-backdrop.fade.in { + opacity: 0.8; + filter: alpha(opacity=80); +} +.modal { + position: fixed; + top: 50%; + left: 50%; + z-index: 1050; + overflow: auto; + width: 560px; + margin: -250px 0 0 -280px; + background-color: #ffffff; + border: 1px solid #999; + border: 1px solid rgba(0, 0, 0, 0.3); + *border: 1px solid #999; + /* IE6-7 */ + + -webkit-border-radius: 6px; + -moz-border-radius: 6px; + border-radius: 6px; + -webkit-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3); + -moz-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3); + box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3); + -webkit-background-clip: padding-box; + -moz-background-clip: padding-box; + background-clip: padding-box; +} +.modal.fade { + -webkit-transition: opacity .3s linear, top .3s ease-out; + -moz-transition: opacity .3s linear, top .3s ease-out; + -ms-transition: opacity .3s linear, top .3s ease-out; + -o-transition: opacity .3s linear, top .3s ease-out; + transition: opacity .3s linear, top .3s ease-out; + top: -25%; +} +.modal.fade.in { + top: 50%; +} +.modal-header { + padding: 9px 15px; + border-bottom: 1px solid #eee; +} +.modal-header .close { + margin-top: 2px; +} +.modal-body { + overflow-y: auto; + max-height: 400px; + padding: 15px; +} +.modal-form { + margin-bottom: 0; +} +.modal-footer { + padding: 14px 15px 15px; + margin-bottom: 0; + text-align: right; + background-color: #f5f5f5; + border-top: 1px solid #ddd; + -webkit-border-radius: 0 0 6px 6px; + -moz-border-radius: 0 0 6px 6px; + border-radius: 0 0 6px 6px; + -webkit-box-shadow: inset 0 1px 0 #ffffff; + -moz-box-shadow: inset 0 1px 0 #ffffff; + box-shadow: inset 0 1px 0 #ffffff; + *zoom: 1; +} +.modal-footer:before, +.modal-footer:after { + display: table; + content: ""; +} +.modal-footer:after { + clear: both; +} +.modal-footer .btn + .btn { + margin-left: 5px; + margin-bottom: 0; +} +.modal-footer .btn-group .btn + .btn { + margin-left: -1px; +} +.tooltip { + position: absolute; + z-index: 1020; + display: block; + visibility: visible; + padding: 5px; + font-size: 11px; + opacity: 0; + filter: alpha(opacity=0); +} +.tooltip.in { + opacity: 0.8; + filter: alpha(opacity=80); +} +.tooltip.top { + margin-top: -2px; +} +.tooltip.right { + margin-left: 2px; +} +.tooltip.bottom { + margin-top: 2px; +} +.tooltip.left { + margin-left: -2px; +} +.tooltip.top .tooltip-arrow { + bottom: 0; + left: 50%; + margin-left: -5px; + border-left: 5px solid transparent; + border-right: 5px solid transparent; + border-top: 5px solid #000000; +} +.tooltip.left .tooltip-arrow { + top: 50%; + right: 0; + margin-top: -5px; + border-top: 5px solid transparent; + border-bottom: 5px solid transparent; + border-left: 5px solid #000000; +} +.tooltip.bottom .tooltip-arrow { + top: 0; + left: 50%; + margin-left: -5px; + border-left: 5px solid transparent; + border-right: 5px solid transparent; + border-bottom: 5px solid #000000; +} +.tooltip.right .tooltip-arrow { + top: 50%; + left: 0; + margin-top: -5px; + border-top: 5px solid transparent; + border-bottom: 5px solid transparent; + border-right: 5px solid #000000; +} +.tooltip-inner { + max-width: 200px; + padding: 3px 8px; + color: #ffffff; + text-align: center; + text-decoration: none; + background-color: #000000; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; +} +.tooltip-arrow { + position: absolute; + width: 0; + height: 0; +} +.popover { + position: absolute; + top: 0; + left: 0; + z-index: 1010; + display: none; + padding: 5px; +} +.popover.top { + margin-top: -5px; +} +.popover.right { + margin-left: 5px; +} +.popover.bottom { + margin-top: 5px; +} +.popover.left { + margin-left: -5px; +} +.popover.top .arrow { + bottom: 0; + left: 50%; + margin-left: -5px; + border-left: 5px solid transparent; + border-right: 5px solid transparent; + border-top: 5px solid #000000; +} +.popover.right .arrow { + top: 50%; + left: 0; + margin-top: -5px; + border-top: 5px solid transparent; + border-bottom: 5px solid transparent; + border-right: 5px solid #000000; +} +.popover.bottom .arrow { + top: 0; + left: 50%; + margin-left: -5px; + border-left: 5px solid transparent; + border-right: 5px solid transparent; + border-bottom: 5px solid #000000; +} +.popover.left .arrow { + top: 50%; + right: 0; + margin-top: -5px; + border-top: 5px solid transparent; + border-bottom: 5px solid transparent; + border-left: 5px solid #000000; +} +.popover .arrow { + position: absolute; + width: 0; + height: 0; +} +.popover-inner { + padding: 3px; + width: 280px; + overflow: hidden; + background: #000000; + background: rgba(0, 0, 0, 0.8); + -webkit-border-radius: 6px; + -moz-border-radius: 6px; + border-radius: 6px; + -webkit-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3); + -moz-box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3); + box-shadow: 0 3px 7px rgba(0, 0, 0, 0.3); +} +.popover-title { + padding: 9px 15px; + line-height: 1; + background-color: #f5f5f5; + border-bottom: 1px solid #eee; + -webkit-border-radius: 3px 3px 0 0; + -moz-border-radius: 3px 3px 0 0; + border-radius: 3px 3px 0 0; +} +.popover-content { + padding: 14px; + background-color: #ffffff; + -webkit-border-radius: 0 0 3px 3px; + -moz-border-radius: 0 0 3px 3px; + border-radius: 0 0 3px 3px; + -webkit-background-clip: padding-box; + -moz-background-clip: padding-box; + background-clip: padding-box; +} +.popover-content p, +.popover-content ul, +.popover-content ol { + margin-bottom: 0; +} +.thumbnails { + margin-left: -20px; + list-style: none; + *zoom: 1; +} +.thumbnails:before, +.thumbnails:after { + display: table; + content: ""; +} +.thumbnails:after { + clear: both; +} +.thumbnails > li { + float: left; + margin: 0 0 18px 20px; +} +.thumbnail { + display: block; + padding: 4px; + line-height: 1; + border: 1px solid #ddd; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; + -webkit-box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075); + -moz-box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075); + box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075); +} +a.thumbnail:hover { + border-color: #0088cc; + -webkit-box-shadow: 0 1px 4px rgba(0, 105, 214, 0.25); + -moz-box-shadow: 0 1px 4px rgba(0, 105, 214, 0.25); + box-shadow: 0 1px 4px rgba(0, 105, 214, 0.25); +} +.thumbnail > img { + display: block; + max-width: 100%; + margin-left: auto; + margin-right: auto; +} +.thumbnail .caption { + padding: 9px; +} +.label { + padding: 1px 4px 2px; + font-size: 10.998px; + font-weight: bold; + line-height: 13px; + color: #ffffff; + vertical-align: middle; + white-space: nowrap; + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + background-color: #999999; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + border-radius: 3px; +} +.label:hover { + color: #ffffff; + text-decoration: none; +} +.label-important { + background-color: #b94a48; +} +.label-important:hover { + background-color: #953b39; +} +.label-warning { + background-color: #f89406; +} +.label-warning:hover { + background-color: #c67605; +} +.label-success { + background-color: #468847; +} +.label-success:hover { + background-color: #356635; +} +.label-info { + background-color: #3a87ad; +} +.label-info:hover { + background-color: #2d6987; +} +.label-inverse { + background-color: #333333; +} +.label-inverse:hover { + background-color: #1a1a1a; +} +.badge { + padding: 1px 9px 2px; + font-size: 12.025px; + font-weight: bold; + white-space: nowrap; + color: #ffffff; + background-color: #999999; + -webkit-border-radius: 9px; + -moz-border-radius: 9px; + border-radius: 9px; +} +.badge:hover { + color: #ffffff; + text-decoration: none; + cursor: pointer; +} +.badge-error { + background-color: #b94a48; +} +.badge-error:hover { + background-color: #953b39; +} +.badge-warning { + background-color: #f89406; +} +.badge-warning:hover { + background-color: #c67605; +} +.badge-success { + background-color: #468847; +} +.badge-success:hover { + background-color: #356635; +} +.badge-info { + background-color: #3a87ad; +} +.badge-info:hover { + background-color: #2d6987; +} +.badge-inverse { + background-color: #333333; +} +.badge-inverse:hover { + background-color: #1a1a1a; +} +@-webkit-keyframes progress-bar-stripes { + from { + background-position: 0 0; + } + to { + background-position: 40px 0; + } +} +@-moz-keyframes progress-bar-stripes { + from { + background-position: 0 0; + } + to { + background-position: 40px 0; + } +} +@-ms-keyframes progress-bar-stripes { + from { + background-position: 0 0; + } + to { + background-position: 40px 0; + } +} +@keyframes progress-bar-stripes { + from { + background-position: 0 0; + } + to { + background-position: 40px 0; + } +} +.progress { + overflow: hidden; + height: 18px; + margin-bottom: 18px; + background-color: #f7f7f7; + background-image: -moz-linear-gradient(top, #f5f5f5, #f9f9f9); + background-image: -ms-linear-gradient(top, #f5f5f5, #f9f9f9); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#f5f5f5), to(#f9f9f9)); + background-image: -webkit-linear-gradient(top, #f5f5f5, #f9f9f9); + background-image: -o-linear-gradient(top, #f5f5f5, #f9f9f9); + background-image: linear-gradient(top, #f5f5f5, #f9f9f9); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#f5f5f5', endColorstr='#f9f9f9', GradientType=0); + -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1); + -moz-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1); + box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1); + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; +} +.progress .bar { + width: 0%; + height: 18px; + color: #ffffff; + font-size: 12px; + text-align: center; + text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); + background-color: #0e90d2; + background-image: -moz-linear-gradient(top, #149bdf, #0480be); + background-image: -ms-linear-gradient(top, #149bdf, #0480be); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#149bdf), to(#0480be)); + background-image: -webkit-linear-gradient(top, #149bdf, #0480be); + background-image: -o-linear-gradient(top, #149bdf, #0480be); + background-image: linear-gradient(top, #149bdf, #0480be); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#149bdf', endColorstr='#0480be', GradientType=0); + -webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15); + -moz-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15); + box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15); + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + -ms-box-sizing: border-box; + box-sizing: border-box; + -webkit-transition: width 0.6s ease; + -moz-transition: width 0.6s ease; + -ms-transition: width 0.6s ease; + -o-transition: width 0.6s ease; + transition: width 0.6s ease; +} +.progress-striped .bar { + background-color: #149bdf; + background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent)); + background-image: -webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + -webkit-background-size: 40px 40px; + -moz-background-size: 40px 40px; + -o-background-size: 40px 40px; + background-size: 40px 40px; +} +.progress.active .bar { + -webkit-animation: progress-bar-stripes 2s linear infinite; + -moz-animation: progress-bar-stripes 2s linear infinite; + animation: progress-bar-stripes 2s linear infinite; +} +.progress-danger .bar { + background-color: #dd514c; + background-image: -moz-linear-gradient(top, #ee5f5b, #c43c35); + background-image: -ms-linear-gradient(top, #ee5f5b, #c43c35); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ee5f5b), to(#c43c35)); + background-image: -webkit-linear-gradient(top, #ee5f5b, #c43c35); + background-image: -o-linear-gradient(top, #ee5f5b, #c43c35); + background-image: linear-gradient(top, #ee5f5b, #c43c35); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ee5f5b', endColorstr='#c43c35', GradientType=0); +} +.progress-danger.progress-striped .bar { + background-color: #ee5f5b; + background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent)); + background-image: -webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); +} +.progress-success .bar { + background-color: #5eb95e; + background-image: -moz-linear-gradient(top, #62c462, #57a957); + background-image: -ms-linear-gradient(top, #62c462, #57a957); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#62c462), to(#57a957)); + background-image: -webkit-linear-gradient(top, #62c462, #57a957); + background-image: -o-linear-gradient(top, #62c462, #57a957); + background-image: linear-gradient(top, #62c462, #57a957); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#62c462', endColorstr='#57a957', GradientType=0); +} +.progress-success.progress-striped .bar { + background-color: #62c462; + background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent)); + background-image: -webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); +} +.progress-info .bar { + background-color: #4bb1cf; + background-image: -moz-linear-gradient(top, #5bc0de, #339bb9); + background-image: -ms-linear-gradient(top, #5bc0de, #339bb9); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#5bc0de), to(#339bb9)); + background-image: -webkit-linear-gradient(top, #5bc0de, #339bb9); + background-image: -o-linear-gradient(top, #5bc0de, #339bb9); + background-image: linear-gradient(top, #5bc0de, #339bb9); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#5bc0de', endColorstr='#339bb9', GradientType=0); +} +.progress-info.progress-striped .bar { + background-color: #5bc0de; + background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent)); + background-image: -webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); +} +.progress-warning .bar { + background-color: #faa732; + background-image: -moz-linear-gradient(top, #fbb450, #f89406); + background-image: -ms-linear-gradient(top, #fbb450, #f89406); + background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#fbb450), to(#f89406)); + background-image: -webkit-linear-gradient(top, #fbb450, #f89406); + background-image: -o-linear-gradient(top, #fbb450, #f89406); + background-image: linear-gradient(top, #fbb450, #f89406); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#fbb450', endColorstr='#f89406', GradientType=0); +} +.progress-warning.progress-striped .bar { + background-color: #fbb450; + background-image: -webkit-gradient(linear, 0 100%, 100% 0, color-stop(0.25, rgba(255, 255, 255, 0.15)), color-stop(0.25, transparent), color-stop(0.5, transparent), color-stop(0.5, rgba(255, 255, 255, 0.15)), color-stop(0.75, rgba(255, 255, 255, 0.15)), color-stop(0.75, transparent), to(transparent)); + background-image: -webkit-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -moz-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -ms-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(-45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); +} +.accordion { + margin-bottom: 18px; +} +.accordion-group { + margin-bottom: 2px; + border: 1px solid #e5e5e5; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; +} +.accordion-heading { + border-bottom: 0; +} +.accordion-heading .accordion-toggle { + display: block; + padding: 8px 15px; +} +.accordion-inner { + padding: 9px 15px; + border-top: 1px solid #e5e5e5; +} +.carousel { + position: relative; + margin-bottom: 18px; + line-height: 1; +} +.carousel-inner { + overflow: hidden; + width: 100%; + position: relative; +} +.carousel .item { + display: none; + position: relative; + -webkit-transition: 0.6s ease-in-out left; + -moz-transition: 0.6s ease-in-out left; + -ms-transition: 0.6s ease-in-out left; + -o-transition: 0.6s ease-in-out left; + transition: 0.6s ease-in-out left; +} +.carousel .item > img { + display: block; + line-height: 1; +} +.carousel .active, +.carousel .next, +.carousel .prev { + display: block; +} +.carousel .active { + left: 0; +} +.carousel .next, +.carousel .prev { + position: absolute; + top: 0; + width: 100%; +} +.carousel .next { + left: 100%; +} +.carousel .prev { + left: -100%; +} +.carousel .next.left, +.carousel .prev.right { + left: 0; +} +.carousel .active.left { + left: -100%; +} +.carousel .active.right { + left: 100%; +} +.carousel-control { + position: absolute; + top: 40%; + left: 15px; + width: 40px; + height: 40px; + margin-top: -20px; + font-size: 60px; + font-weight: 100; + line-height: 30px; + color: #ffffff; + text-align: center; + background: #222222; + border: 3px solid #ffffff; + -webkit-border-radius: 23px; + -moz-border-radius: 23px; + border-radius: 23px; + opacity: 0.5; + filter: alpha(opacity=50); +} +.carousel-control.right { + left: auto; + right: 15px; +} +.carousel-control:hover { + color: #ffffff; + text-decoration: none; + opacity: 0.9; + filter: alpha(opacity=90); +} +.carousel-caption { + position: absolute; + left: 0; + right: 0; + bottom: 0; + padding: 10px 15px 5px; + background: #333333; + background: rgba(0, 0, 0, 0.75); +} +.carousel-caption h4, +.carousel-caption p { + color: #ffffff; +} +.hero-unit { + padding: 60px; + margin-bottom: 30px; + background-color: #eeeeee; + -webkit-border-radius: 6px; + -moz-border-radius: 6px; + border-radius: 6px; +} +.hero-unit h1 { + margin-bottom: 0; + font-size: 60px; + line-height: 1; + color: inherit; + letter-spacing: -1px; +} +.hero-unit p { + font-size: 18px; + font-weight: 200; + line-height: 27px; + color: inherit; +} +.pull-right { + float: right; +} +.pull-left { + float: left; +} +.hide { + display: none; +} +.show { + display: block; +} +.invisible { + visibility: hidden; +} diff --git a/app/assets/stylesheets/fileuploader.css b/app/assets/stylesheets/fileuploader.css new file mode 100644 index 000000000..0e3f111a9 --- /dev/null +++ b/app/assets/stylesheets/fileuploader.css @@ -0,0 +1,31 @@ +.qq-uploader { position:relative; width: 100%;} + +.qq-upload-button { + display:block; /* or inline-block */ + width: 105px; padding: 7px 0; text-align:center; + background:#880000; border-bottom:1px solid #ddd;color:#fff; +} +.qq-upload-button-hover {background:#cc0000;} +.qq-upload-button-focus {outline:1px dotted black;} + +.qq-upload-drop-area { + position:absolute; top:0; left:0; width:100%; height:100%; min-height: 70px; z-index:2; + background:#FF9797; text-align:center; +} +.qq-upload-drop-area span { + display:block; position:absolute; top: 50%; width:100%; margin-top:-8px; font-size:16px; +} +.qq-upload-drop-area-active {background:#FF7171;} + +.qq-upload-list {margin:15px 35px; padding:0; list-style:disc;} +.qq-upload-list li { margin:0; padding:0; line-height:15px; font-size:12px;} +.qq-upload-file, .qq-upload-spinner, .qq-upload-size, .qq-upload-cancel, .qq-upload-failed-text { + margin-right: 7px; +} + +.qq-upload-file {} +.qq-upload-spinner {display:inline-block; background: url("loading.gif"); width:15px; height:15px; vertical-align:text-bottom;} +.qq-upload-size,.qq-upload-cancel {font-size:11px;} + +.qq-upload-failed-text {display:none;} +.qq-upload-fail .qq-upload-failed-text {display:inline;} \ No newline at end of file diff --git a/app/assets/stylesheets/jquery.tagsinput.css b/app/assets/stylesheets/jquery.tagsinput.css new file mode 100644 index 000000000..a8ab908ac --- /dev/null +++ b/app/assets/stylesheets/jquery.tagsinput.css @@ -0,0 +1,7 @@ +div.tagsinput { border:1px solid #CCC; background: #FFF; padding:5px; width:300px; height:100px; overflow-y: auto;} +div.tagsinput span.tag { border: 1px solid #a5d24a; -moz-border-radius:2px; -webkit-border-radius:2px; display: block; float: left; padding: 3px; text-decoration:none; background: #cde69c; color: #638421; margin-right: 5px; margin-bottom:5px;font-family: helvetica; font-size:13px;} +div.tagsinput span.tag a { font-weight: bold; color: #82ad2b; text-decoration:none; font-size: 11px; } +div.tagsinput input { width:380px; margin:0px; font-family: helvetica; font-size: 13px; border:1px solid transparent; padding:3px; background: transparent; color: #000; outline:0px; margin-right:5px; margin-bottom:5px; } +div.tagsinput div { display:block; float: left; } +.tags_clear { clear: both; width: 100%; height: 0px; } +.not_valid {background: #FBD8DB !important; color: #90111A !important;} diff --git a/app/assets/stylesheets/ui-lightness/jquery.ui.accordion.css b/app/assets/stylesheets/ui-lightness/jquery.ui.accordion.css new file mode 100755 index 000000000..e426c7622 --- /dev/null +++ b/app/assets/stylesheets/ui-lightness/jquery.ui.accordion.css @@ -0,0 +1,19 @@ +/* + * jQuery UI Accordion 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } diff --git a/app/assets/stylesheets/ui-lightness/jquery.ui.autocomplete.css b/app/assets/stylesheets/ui-lightness/jquery.ui.autocomplete.css new file mode 100755 index 000000000..4613938ae --- /dev/null +++ b/app/assets/stylesheets/ui-lightness/jquery.ui.autocomplete.css @@ -0,0 +1,53 @@ +/* + * jQuery UI Autocomplete 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.17 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} diff --git a/app/assets/stylesheets/ui-lightness/jquery.ui.base.css b/app/assets/stylesheets/ui-lightness/jquery.ui.base.css new file mode 100755 index 000000000..f52ee39b9 --- /dev/null +++ b/app/assets/stylesheets/ui-lightness/jquery.ui.base.css @@ -0,0 +1,11 @@ +@import url("jquery.ui.core.css"); +@import url("jquery.ui.resizable.css"); +@import url("jquery.ui.selectable.css"); +@import url("jquery.ui.accordion.css"); +@import url("jquery.ui.autocomplete.css"); +@import url("jquery.ui.button.css"); +@import url("jquery.ui.dialog.css"); +@import url("jquery.ui.slider.css"); +@import url("jquery.ui.tabs.css"); +@import url("jquery.ui.datepicker.css"); +@import url("jquery.ui.progressbar.css"); \ No newline at end of file diff --git a/app/assets/stylesheets/ui-lightness/jquery.ui.button.css b/app/assets/stylesheets/ui-lightness/jquery.ui.button.css new file mode 100755 index 000000000..a7565af80 --- /dev/null +++ b/app/assets/stylesheets/ui-lightness/jquery.ui.button.css @@ -0,0 +1,38 @@ +/* + * jQuery UI Button 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ diff --git a/app/assets/stylesheets/ui-lightness/jquery.ui.core.css b/app/assets/stylesheets/ui-lightness/jquery.ui.core.css new file mode 100755 index 000000000..bde176d27 --- /dev/null +++ b/app/assets/stylesheets/ui-lightness/jquery.ui.core.css @@ -0,0 +1,38 @@ +/* + * jQuery UI CSS Framework 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:before, .ui-helper-clearfix:after { content: ""; display: table; } +.ui-helper-clearfix:after { clear: both; } +.ui-helper-clearfix { zoom: 1; } +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } diff --git a/app/assets/stylesheets/ui-lightness/jquery.ui.datepicker.css b/app/assets/stylesheets/ui-lightness/jquery.ui.datepicker.css new file mode 100755 index 000000000..6cb5aefc3 --- /dev/null +++ b/app/assets/stylesheets/ui-lightness/jquery.ui.datepicker.css @@ -0,0 +1,68 @@ +/* + * jQuery UI Datepicker 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +} \ No newline at end of file diff --git a/app/assets/stylesheets/ui-lightness/jquery.ui.dialog.css b/app/assets/stylesheets/ui-lightness/jquery.ui.dialog.css new file mode 100755 index 000000000..a5914ff14 --- /dev/null +++ b/app/assets/stylesheets/ui-lightness/jquery.ui.dialog.css @@ -0,0 +1,21 @@ +/* + * jQuery UI Dialog 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } diff --git a/app/assets/stylesheets/ui-lightness/jquery.ui.progressbar.css b/app/assets/stylesheets/ui-lightness/jquery.ui.progressbar.css new file mode 100755 index 000000000..630fab390 --- /dev/null +++ b/app/assets/stylesheets/ui-lightness/jquery.ui.progressbar.css @@ -0,0 +1,11 @@ +/* + * jQuery UI Progressbar 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; overflow: hidden; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file diff --git a/app/assets/stylesheets/ui-lightness/jquery.ui.resizable.css b/app/assets/stylesheets/ui-lightness/jquery.ui.resizable.css new file mode 100755 index 000000000..582bcb315 --- /dev/null +++ b/app/assets/stylesheets/ui-lightness/jquery.ui.resizable.css @@ -0,0 +1,20 @@ +/* + * jQuery UI Resizable 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;} \ No newline at end of file diff --git a/app/assets/stylesheets/ui-lightness/jquery.ui.selectable.css b/app/assets/stylesheets/ui-lightness/jquery.ui.selectable.css new file mode 100755 index 000000000..b36b89881 --- /dev/null +++ b/app/assets/stylesheets/ui-lightness/jquery.ui.selectable.css @@ -0,0 +1,10 @@ +/* + * jQuery UI Selectable 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } diff --git a/app/assets/stylesheets/ui-lightness/jquery.ui.slider.css b/app/assets/stylesheets/ui-lightness/jquery.ui.slider.css new file mode 100755 index 000000000..4cc548103 --- /dev/null +++ b/app/assets/stylesheets/ui-lightness/jquery.ui.slider.css @@ -0,0 +1,24 @@ +/* + * jQuery UI Slider 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; } \ No newline at end of file diff --git a/app/assets/stylesheets/ui-lightness/jquery.ui.tabs.css b/app/assets/stylesheets/ui-lightness/jquery.ui.tabs.css new file mode 100755 index 000000000..fb827458e --- /dev/null +++ b/app/assets/stylesheets/ui-lightness/jquery.ui.tabs.css @@ -0,0 +1,18 @@ +/* + * jQuery UI Tabs 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } diff --git a/app/assets/stylesheets/ui-lightness/jquery.ui.theme.css b/app/assets/stylesheets/ui-lightness/jquery.ui.theme.css new file mode 100755 index 000000000..1c1ad2a19 --- /dev/null +++ b/app/assets/stylesheets/ui-lightness/jquery.ui.theme.css @@ -0,0 +1,249 @@ + + +/* + * jQuery UI CSS Framework 1.8.17 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; } +.ui-widget-content a { color: #333333; } +.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; } +.ui-widget-header a { color: #ffffff; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; } +.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } + +/* Overlays */ +.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); } +.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -khtml-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; } \ No newline at end of file diff --git a/app/assets/stylesheets/zzz.css b/app/assets/stylesheets/zzz.css new file mode 100644 index 000000000..ce7cee58e --- /dev/null +++ b/app/assets/stylesheets/zzz.css @@ -0,0 +1,96 @@ +body { + padding-top:60px; +} + +/* +#content > *:not(.active) { + display: none !important; +} +*/ + +[class^="icon-"], +[class*=" icon-"] { + background-image: url("../assets/glyphicons-halflings.png"); +} + +.edit { + min-height:30px; +} + +.edit:focus { + color: #000000; + outline: 0; +} + +.delete { + background:url("../assets/close.png") no-repeat; + text-indent: -9999em; + border: 0; + width: 40px; + height: 40px; + cursor:pointer; + float: right; + position: relative; + top: -15px; + left: 30px; + margin: 4px; + clear: right; +} + +/* +.dropdown-menu { + min-width: 220px; +} +*/ + +footer { +// margin-top: 17px; + padding-top: 17px; + border-top: 1px solid #EEE; +} + +.form-horizontal .controls { + margin-left: 150px; +} + +.search-query { + width: 160px; +} + +.keepleft { + float:left; +} + +.update-box { + margin-left: 10px; +} + +.article { + + padding-top: 4px; + padding-bottom: 4px; + margin-top: 5px; + margin-bottom: 5px; + + border: 1px solid #ffffff; + -webkit-border-radius: 4px; + -moz-border-radius: 4px; + border-radius: 4px; +} + +.article-message { + padding-left: 4px; +} + +.internal { + background-color: #f2dede; + border-color: #eed3d7; + border: 1px solid #fbeed5; +} + +.customer-info { + width:86%; + padding-top: 5px; + padding-left: 20px; + padding-right: 10px; +} diff --git a/app/controllers/application_controller.rb b/app/controllers/application_controller.rb index e8065d950..bb69464e5 100644 --- a/app/controllers/application_controller.rb +++ b/app/controllers/application_controller.rb @@ -1,3 +1,225 @@ class ApplicationController < ActionController::Base + include UserInfo protect_from_forgery + http_basic_authenticate_with :name => "test", :password => "ttt" + + helper_method :current_user, :authentication_check + + before_filter :set_user, :cors_preflight_check + after_filter :set_access_control_headers + + def user_data_full (user_id) + + # get user + user = User.find(user_id) + + # get linked accounts + user['accounts'] = {} + authorizations = user.authorizations() || [] + authorizations.each do | authorization | + user['accounts'][authorization.provider] = { + :uid => authorization[:uid], + :username => authorization[:username] + } + end + + # do not show password + user['password'] = '' + + # show linked topics and items + user['links'] = [] + ticket_state_list_open = Ticket::State.where( :ticket_state_type_id => Ticket::StateType.where(:name => ['new','open', 'pending remidner', 'pending action']) ) + ticket_state_list_closed = Ticket::State.where( :ticket_state_type_id => Ticket::StateType.where(:name => ['closed'] ) ) + + tickets_open = Ticket.where(:customer_id => user_id, :ticket_state_id => ticket_state_list_open).count() + tickets_closed = Ticket.where(:customer_id => user_id, :ticket_state_id => ticket_state_list_closed).count() + + topic = { + :title => 'Tickets', + :items => [ + { + :url => '', + :name => 'open (' + tickets_open.to_s + ')', + :title => 'Open Tickets', + :class => 'user-tickets', + :data => 'open' + }, + { + :url => '', + :name => 'closed (' + tickets_closed.to_s + ')', + :title => 'Closed Tickets', + :class => 'user-tickets', + :data => 'closed' + } + ] + } + user['links'].push topic + + # set roles + user['roles'] = user.roles.select('id, name').where(:active => true) + user['groups'] = user.groups.select('id, name').where(:active => true) + user['organization'] = user.organization + user['organizations'] = user.organizations.select('id, name').where(:active => true) + return user + end + + # For all responses in this controller, return the CORS access control headers. + def set_access_control_headers +# headers['Access-Control-Allow-Origin'] = 'http://localhost/' +# headers['Access-Control-Request-Method'] = '*' +# headers['Access-Control-Allow-Headers'] = 'X-Requested-With, X-Prototype-Version' + headers['Access-Control-Allow-Origin'] = 'http://localhost/' + headers['Access-Control-Allow-Methods'] = 'POST, GET, PUT, OPTIONS' + headers['Access-Control-Max-Age'] = "1728000" + headers['Access-Control-Allow-Headers'] = 'Content-Type, Depth, User-Agent, X-File-Size, X-Requested-With, If-Modified-Since, X-File-Name, Cache-Control' + headers['Access-Control-Allow-Credentials'] = 'true' + end + + # If this is a preflight OPTIONS request, then short-circuit the + # request, return only the necessary headers and return an empty + # text/plain. + + def cors_preflight_check + if request.method == :options + headers['Access-Control-Allow-Origin'] = '*' + headers['Access-Control-Allow-Methods'] = 'POST, GET, OPTIONS' + headers['Access-Control-Allow-Headers'] = 'X-Requested-With, X-Prototype-Version' + headers['Access-Control-Max-Age'] = '1728000' +# headers['Access-Control-Allow-Credentials'] = 'true' + render :text => '', :content_type => 'text/plain' + end + end + + + private + + # Finds the User with the ID stored in the session with the key + # :current_user_id This is a common way to handle user login in + # a Rails application; logging in sets the session value and + # logging out removes it. + def current_user + @_current_user ||= session[:user_id] && + User.find_by_id(session[:user_id]) + end + +# def authenticate +# unless current_user +# respond_to do |format| +# format.html { +# flash[:notice] = "You're not logged in!" +# store_location +# redirect_to :login +# } +# format.json { +# render :json => { :error => 'login required' }, :status => :unauthorized +# } +# end +# return false +# end +# end +# def store_location +# session[:return_to] = request.url +# end +# def redirect_back_or_default(default) +# redirect_to(session[:return_to] || default) +# session[:return_to] = nil +# end + def authentication_check + logger.debug 'authentication_check' + + # check http basic auth + if false + authenticate_with_http_basic do |user, password| + logger.debug 'http basic auth check' +# logger.debug session.inspect + logger.debug user + logger.debug password + userdata = User.where(:login => user).first +# logger.debug userdata.inspect + + message = '' + if !userdata + message = 'authentication failed, user' + else + if password != userdata.password + message = 'authentication failed, pw' + end + end + + # message = 'login required' + if message != '' + respond_to do |format| +# format.html { +# flash[:notice] = "You're not logged in!" +# store_location +# redirect_to :login +# } + format.json { + render :json => { :error => message }, :status => :unauthorized + } + end + end + return true +# return true +# request_http_basic_authentication + end + end + + logger.debug 'session check' + logger.debug session.inspect +# session[:user_id] = 2 + if !session[:user_id] +# = userdata.id + logger.debug '!session user_id' +# session[:name] = 'lol' + logger.debug session.inspect + message = 'no valid session, user_id' + respond_to do |format| +# format.html { +# flash[:notice] = "You're not logged in!" +# store_location +# redirect_to :login +# } + format.json { + render :json => { :error => message }, :status => :unauthorized + } + end + return true + end + + # check session auth +# logger.debug request.env.inspect +# return 1231 +# request_http_basic_authentication + + end + + # Sets the current user into a named Thread location so that it can be accessed + # by models and observers + def set_user + UserInfo.current_user_id = session[:user_id] + end + + def log_view (object) + history_type = History::Type.where( :name => 'viewed' ).first + if !history_type || !history_type.id + history_type = History::Type.create( + :name => 'viewed' + ) + end + history_object = History::Object.where( :name => object.class.name ).first + if !history_object || !history_object.id + history_object = History::Object.create( + :name => object.class.name + ) + end + + History.create( + :o_id => object.id, + :history_type_id => history_type.id, + :history_object_id => history_object.id, + :created_by_id => session[:user_id] + ) + end + end diff --git a/app/controllers/groups_controller.rb b/app/controllers/groups_controller.rb new file mode 100644 index 000000000..60d12764a --- /dev/null +++ b/app/controllers/groups_controller.rb @@ -0,0 +1,86 @@ +class GroupsController < ApplicationController + before_filter :authentication_check + + # GET /groups + # GET /groups.json + def index + @groups = Group.all + + respond_to do |format| + format.html # index.html.erb + format.json { render :json => @groups } + end + end + + # GET /groups/1 + # GET /groups/1.json + def show + @group = Group.find(params[:id]) + + respond_to do |format| + format.html # show.html.erb + format.json { render :json => @group } + end + end + + # GET /groups/new + # GET /groups/new.json + def new + @group = Group.new + + respond_to do |format| + format.html # new.html.erb + format.json { render :json => @group } + end + end + + # GET /groups/1/edit + def edit + @group = Group.find(params[:id]) + end + + # POST /groups + # POST /groups.json + def create + @group = Group.new(params[:group]) + @group.created_by_id = current_user.id + + respond_to do |format| + if @group.save + format.html { redirect_to @group, :notice => 'Group was successfully created.' } + format.json { render :json => @group, :status => :created } + else + format.html { render :action => "new" } + format.json { render :json => @group.errors, :status => :unprocessable_entity } + end + end + end + + # PUT /groups/1 + # PUT /groups/1.json + def update + @group = Group.find(params[:id]) + + respond_to do |format| + if @group.update_attributes(params[:group]) + format.html { redirect_to @group, :notice => 'Group was successfully updated.' } + format.json { render :json => @group, :status => :ok } + else + format.html { render :action => "edit" } + format.json { render :json => @group.errors, :status => :unprocessable_entity } + end + end + end + + # DELETE /groups/1 + # DELETE /groups/1.json + def destroy + @group = Group.find(params[:id]) + @group.destroy + + respond_to do |format| + format.html { redirect_to groups_url } + format.json { head :ok } + end + end +end diff --git a/app/controllers/init_controller.rb b/app/controllers/init_controller.rb new file mode 100644 index 000000000..836b73853 --- /dev/null +++ b/app/controllers/init_controller.rb @@ -0,0 +1,10 @@ +class InitController < ApplicationController + + # GET /init + def index + respond_to do |format| + format.html # index.html.erb + end + end + +end diff --git a/app/controllers/network_controller.rb b/app/controllers/network_controller.rb new file mode 100644 index 000000000..50f75f5a5 --- /dev/null +++ b/app/controllers/network_controller.rb @@ -0,0 +1,85 @@ +class NetworksController < ApplicationController + before_filter :authentication_check + + # GET /networks + # GET /networks.json + def index + @networks = Network.all + + respond_to do |format| + format.html # index.html.erb + format.json { render :json => @networks } + end + end + + # GET /networks/1 + # GET /networks/1.json + def show + @network = Network.find(params[:id]) + + respond_to do |format| + format.html # show.html.erb + format.json { render :json => @network } + end + end + + # GET /networks/new + # GET /networks/new.json + def new + @network = Network.new + + respond_to do |format| + format.html # new.html.erb + format.json { render :json => @network } + end + end + + # GET /networks/1/edit + def edit + @network = Network.find(params[:id]) + end + + # POST /networks + # POST /networks.json + def create + @network = Network.new(params[:network]) + + respond_to do |format| + if @network.save + format.html { redirect_to @network, :notice => 'Network was successfully created.' } + format.json { render :json => @network, :status => :created } + else + format.html { render :action => "new" } + format.json { render :json => @network.errors, :status => :unprocessable_entity } + end + end + end + + # PUT /networks/1 + # PUT /networks/1.json + def update + @network = Network.find(params[:id]) + + respond_to do |format| + if @network.update_attributes(params[:network]) + format.html { redirect_to @network, :notice => 'Network was successfully updated.' } + format.json { render :json => @network, :status => :ok } + else + format.html { render :action => "edit" } + format.json { render :json => @network.errors, :status => :unprocessable_entity } + end + end + end + + # DELETE /networks/1 + # DELETE /networks/1.json + def destroy + @network = Network.find(params[:id]) + @network.destroy + + respond_to do |format| + format.html { redirect_to networks_url } + format.json { head :ok } + end + end +end diff --git a/app/controllers/notes_controller.rb b/app/controllers/notes_controller.rb new file mode 100644 index 000000000..d54711546 --- /dev/null +++ b/app/controllers/notes_controller.rb @@ -0,0 +1,86 @@ +class NotesController < ApplicationController + before_filter :authentication_check + + # GET /notes + # GET /notes.json + def index + @notes = Note.find(:all, :order => "updated_at ASC") +# @notes = Note.all + + respond_to do |format| + format.html # index.html.erb + format.json { render :json => @notes } + end + end + + # GET /notes/1 + # GET /notes/1.json + def show + @note = Note.find(params[:id]) + + respond_to do |format| + format.html # show.html.erb + format.json { render :json => @note } + end + end + + # GET /notes/new + # GET /notes/new.json + def new + @note = Note.new + + respond_to do |format| + format.html # new.html.erb + format.json { render :json => @note } + end + end + + # GET /notes/1/edit + def edit + @note = Note.find(params[:id]) + end + + # POST /notes + # POST /notes.json + def create + @note = Note.new(params[:note]) + + respond_to do |format| + if @note.save + format.html { redirect_to @note, :notice => 'Note was successfully created.' } + format.json { render :json => @note, :status => :created } + else + format.html { render :action => "new" } + format.json { render :json => @note.errors, :status => :unprocessable_entity } + end + end + end + + # PUT /notes/1 + # PUT /notes/1.json + def update + @note = Note.find(params[:id]) + + respond_to do |format| + if @note.update_attributes(params[:note]) + format.html { redirect_to @note, :notice => 'Note was successfully updated.' } + format.json { render :json => @note, :status => :ok } + else + format.html { render :action => "edit" } + format.json { render :json => @note.errors, :status => :unprocessable_entity } + end + end + end + + # DELETE /notes/1 + # DELETE /notes/1.json + def destroy + @note = Note.find(params[:id]) + @note.destroy + + respond_to do |format| + format.html { redirect_to notes_url } + format.json { head :ok } + end + end +end diff --git a/app/controllers/organizations_controller.rb b/app/controllers/organizations_controller.rb new file mode 100644 index 000000000..9b7e77cd4 --- /dev/null +++ b/app/controllers/organizations_controller.rb @@ -0,0 +1,86 @@ +class OrganizationsController < ApplicationController + before_filter :authentication_check + + # GET /organizations + # GET /organizations.json + def index + @organizations = Organization.all + + respond_to do |format| + format.html # index.html.erb + format.json { render :json => @organizations } + end + end + + # GET /organizations/1 + # GET /organizations/1.json + def show + @organization = Organization.find(params[:id]) + + respond_to do |format| + format.html # show.html.erb + format.json { render :json => @organization } + end + end + + # GET /organizations/new + # GET /organizations/new.json + def new + @organization = Organization.new + + respond_to do |format| + format.html # new.html.erb + format.json { render :json => @organization } + end + end + + # GET /organizations/1/edit + def edit + @organization = Organization.find(params[:id]) + end + + # POST /organizations + # POST /organizations.json + def create + @organization = Organization.new(params[:organization]) + @organization.created_by_id = current_user.id + + respond_to do |format| + if @organization.save + format.html { redirect_to @organization, :notice => 'Organization was successfully created.' } + format.json { render :json => @organization, :status => :created } + else + format.html { render :action => "new" } + format.json { render :json => @organization.errors, :status => :unprocessable_entity } + end + end + end + + # PUT /organizations/1 + # PUT /organizations/1.json + def update + @organization = Organization.find(params[:id]) + + respond_to do |format| + if @organization.update_attributes(params[:organization]) + format.html { redirect_to @organization, :notice => 'Organization was successfully updated.' } + format.json { render :json => @organization, :status => :ok } + else + format.html { render :action => "edit" } + format.json { render :json => @organization.errors, :status => :unprocessable_entity } + end + end + end + + # DELETE /organizations/1 + # DELETE /organizations/1.json + def destroy + @organization = Organization.find(params[:id]) + @organization.destroy + + respond_to do |format| + format.html { redirect_to organizations_url } + format.json { head :ok } + end + end +end diff --git a/app/controllers/overviews_controller.rb b/app/controllers/overviews_controller.rb new file mode 100644 index 000000000..a1332aa55 --- /dev/null +++ b/app/controllers/overviews_controller.rb @@ -0,0 +1,77 @@ +class OverviewsController < ApplicationController + before_filter :authentication_check + + # GET /overviews + # GET /overviews.json + def index + @overviews = Overview.all + + respond_to do |format| + format.json { render :json => @overviews } + end + end + + # GET /overviews/1 + # GET /overviews/1.json + def show + @overview = Overview.find(params[:id]) + + respond_to do |format| + format.json { render :json => @overview } + end + end + + # GET /overviews/new + # GET /overviews/new.json + def new + @overview = Overview.new + + respond_to do |format| + format.json { render :json => @overview } + end + end + + # GET /overviews/1/edit + def edit + @overview = Overview.find(params[:id]) + end + + # POST /overviews + # POST /overviews.json + def create + @overview = Overview.new(params[:overview]) + + respond_to do |format| + if @overview.save + format.json { render :json => @overview, :status => :created } + else + format.json { render :json => @overview.errors, :status => :unprocessable_entity } + end + end + end + + # PUT /overviews/1 + # PUT /overviews/1.json + def update + @overview = Overview.find(params[:id]) + + respond_to do |format| + if @overview.update_attributes(params[:overview]) + format.json { render :json => @overview, :status => :ok } + else + format.json { render :json => @overview.errors, :status => :unprocessable_entity } + end + end + end + + # DELETE /overviews/1 + # DELETE /overviews/1.json + def destroy + @overview = Overview.find(params[:id]) + @overview.destroy + + respond_to do |format| + format.json { head :ok } + end + end +end diff --git a/app/controllers/roles_controller.rb b/app/controllers/roles_controller.rb new file mode 100644 index 000000000..0cc703238 --- /dev/null +++ b/app/controllers/roles_controller.rb @@ -0,0 +1,86 @@ +class RolesController < ApplicationController + before_filter :authentication_check + + # GET /roles + # GET /roles.json + def index + @roles = Role.all + + respond_to do |format| + format.html # index.html.erb + format.json { render :json => @roles } + end + end + + # GET /roles/1 + # GET /roles/1.json + def show + @role = Role.find(params[:id]) + + respond_to do |format| + format.html # show.html.erb + format.json { render :json => @role } + end + end + + # GET /roles/new + # GET /roles/new.json + def new + @role = Role.new + + respond_to do |format| + format.html # new.html.erb + format.json { render :json => @role } + end + end + + # GET /roles/1/edit + def edit + @role = Role.find(params[:id]) + end + + # POST /roles + # POST /roles.json + def create + @role = Role.new(params[:role]) + @role.created_by_id = current_user.id + + respond_to do |format| + if @role.save + format.html { redirect_to @role, :notice => 'Role was successfully created.' } + format.json { render :json => @role, :status => :created } + else + format.html { render :action => "new" } + format.json { render :json => @role.errors, :status => :unprocessable_entity } + end + end + end + + # PUT /roles/1 + # PUT /roles/1.json + def update + @role = Role.find(params[:id]) + + respond_to do |format| + if @role.update_attributes(params[:role]) + format.html { redirect_to @role, :notice => 'Role was successfully updated.' } + format.json { render :json => @role, :status => :ok } + else + format.html { render :action => "edit" } + format.json { render :json => @role.errors, :status => :unprocessable_entity } + end + end + end + + # DELETE /roles/1 + # DELETE /roles/1.json + def destroy + @role = Role.find(params[:id]) + @role.destroy + + respond_to do |format| + format.html { redirect_to roles_url } + format.json { head :ok } + end + end +end diff --git a/app/controllers/sessions_controller.rb b/app/controllers/sessions_controller.rb new file mode 100644 index 000000000..386ac55c2 --- /dev/null +++ b/app/controllers/sessions_controller.rb @@ -0,0 +1,144 @@ +class SessionsController < ApplicationController +# def create +# render :text => request.env['rack.auth'].inspect +# end + + # "Create" a login, aka "log the user in" + def create + logger.debug 'session create' + logger.debug params.inspect + logger.debug 'b auth' + user = User.authenticate(params[:username], params[:password]) + logger.debug 'a auth' +# user = User.authenticate('hansi', 'test') + + respond_to do |format| + if user + + # do not show password + user['password'] = '' + + user['roles'] = user.roles.select('id, name').where(:active => true) + user['groups'] = user.groups.select('id, name').where(:active => true) + user['organization'] = user.organization + user['organizations'] = user.organizations.select('id, name').where(:active => true) + + # auto population of default collections + default_collection = default_collections() + + session[:user_id] = user.id + format.json { render :json => { :session => user, :default_collections => default_collection }, :status => :created } + else + format.json { render :json => { :error => 'login failed' }, :status => :unprocessable_entity } + end + end + end + + def show + logger.debug 'session show' + logger.debug params.inspect +# user = User.authenticate('hansi', 'test') + + respond_to do |format| + if session[:user_id] + + # Save the user ID in the session so it can be used in + # subsequent requests + user = user_data_full( session[:user_id] ) + + # auto population of default collections + default_collection = default_collections() + + # config + config = {} + Setting.where( :frontend => true ).each { |setting| + config[setting.name] = setting.state[:value] + } + + #, :status => :created + format.json { + render :json => { + :session => user, + :default_collections => default_collection, + :config => config + } + } + else + format.json { render :json => { :error => 'no valid session' }, :status => :unprocessable_entity } + end + end + end + + # "Delete" a login, aka "log the user out" + def destroy + # Remove the user id from the session + @_current_user = session[:user_id] = nil + respond_to do |format| + format.json { render :json => { } } + end + end + + def create_omniauth +# auth = request.env['rack.auth'] + auth = request.env['omniauth.auth'] + + logger.info(auth.inspect) + if !auth + logger.info("AUTH IS NULL, SERVICE NOT LINKED TO ACCOUNT") +# logger.info() +# logger.info("PROVIDER: #{provider}, UID: #{uid}, EMAIL: #{email}") + end + logger.info(1111111) +# raise auth.to_yaml + unless @auth = Authorization.find_from_hash(auth) + # Create a new user or add an auth to existing user, depending on + # whether there is already a user signed in. + @auth = Authorization.create_from_hash(auth, current_user) + end +# logger.info(2222222) +# logger.info(@auth) +# logger.info(@auth.inspect) +# logger.info(@auth.user) + # Log the authorizing user in. +# self.current_user = @auth.user +# user = @auth.user +# logger.info(333333333) +# exit + session[:user_id] = @auth.user.id + + # redirect to app + redirect_to '/app#' + end + + private + def default_collections + + # auto population of default collections + default_collection = {} +# default_collection['User'] = User.all +# # get linked accounts +# default_collection['User'].each do |user| +# user['accounts'] = {} +# authorizations = user.authorizations() || [] +# authorizations.each do | authorization | +# user['accounts'][authorization.provider] = { +# :uid => authorization[:uid], +# :username => authorization[:username] +# } +# end +# end + default_collection['Role'] = Role.all + default_collection['Group'] = Group.all + default_collection['Organization'] = Organization.all + default_collection['TicketStateType'] = Ticket::StateType.all + default_collection['TicketState'] = Ticket::State.all + default_collection['TicketPriority'] = Ticket::Priority.all + default_collection['TicketArticleType'] = Ticket::Article::Type.all + default_collection['TicketArticleSender'] = Ticket::Article::Sender.all + default_collection['Forum'] = Forum.all + default_collection['ForumCategory'] = Forum::Category.all + default_collection['ForumCategoryType'] = Forum::Category::Type.all + default_collection['ForumPrivacy'] = Forum::Privacy.all + return default_collection + end +end \ No newline at end of file diff --git a/app/controllers/settings_controller.rb b/app/controllers/settings_controller.rb new file mode 100644 index 000000000..1554d0816 --- /dev/null +++ b/app/controllers/settings_controller.rb @@ -0,0 +1,77 @@ +class SettingsController < ApplicationController + before_filter :authentication_check + + # GET /settings + # GET /settings.json + def index + @settings = Setting.all + + respond_to do |format| + format.json { render :json => @settings } + end + end + + # GET /settings/1 + # GET /settings/1.json + def show + @setting = Setting.find(params[:id]) + + respond_to do |format| + format.json { render :json => @setting } + end + end + + # GET /settings/new + # GET /settings/new.json + def new + @setting = Setting.new + + respond_to do |format| + format.json { render :json => @setting } + end + end + + # GET /settings/1/edit + def edit + @setting = Setting.find(params[:id]) + end + + # POST /settings + # POST /settings.json + def create + @setting = Setting.new(params[:setting]) + + respond_to do |format| + if @setting.save + format.json { render :json => @setting, :status => :created } + else + format.json { render :json => @setting.errors, :status => :unprocessable_entity } + end + end + end + + # PUT /settings/1 + # PUT /settings/1.json + def update + @setting = Setting.find(params[:id]) + + respond_to do |format| + if @setting.update_attributes(params[:setting]) + format.json { render :json => @setting, :status => :ok } + else + format.json { render :json => @setting.errors, :status => :unprocessable_entity } + end + end + end + + # DELETE /settings/1 + # DELETE /settings/1.json + def destroy + @setting = Setting.find(params[:id]) + @setting.destroy + + respond_to do |format| + format.json { head :ok } + end + end +end diff --git a/app/controllers/ticket_articles_controller.rb b/app/controllers/ticket_articles_controller.rb new file mode 100644 index 000000000..16e7f4a51 --- /dev/null +++ b/app/controllers/ticket_articles_controller.rb @@ -0,0 +1,75 @@ +class TicketArticlesController < ApplicationController + before_filter :authentication_check + + # GET /articles + # GET /articles.json + def index + @articles = Ticket::Article.all + + respond_to do |format| + format.json { render :json => @articles } + end + end + + # GET /articles/1 + # GET /articles/1.json + def show + @article = Ticket::Article.find(params[:id]) + + respond_to do |format| + format.json { render :json => @article } + end + end + + # POST /articles + # POST /articles.json + def create + @article = Ticket::Article.new(params[:ticket_article]) + @article.created_by_id = current_user.id + + # find attachments in upload cache + @article['attachments'] = Store.list( + :object => 'UploadCache::TicketZoom::' + current_user.id.to_s, + :o_id => @article.ticket_id + ) + + respond_to do |format| + if @article.save + format.json { render :json => @article, :status => :created } + + # remove attachments from upload cache + Store.remove( + :object => 'UploadCache::TicketZoom::' + current_user.id.to_s, + :o_id => @article.ticket_id + ) + else + format.json { render :json => @article.errors, :status => :unprocessable_entity } + end + end + end + + # PUT /articles/1 + # PUT /articles/1.json + def update + @article = Ticket::Article.find(params[:id]) + + respond_to do |format| + if @article.update_attributes(params[:ticket_article]) + format.json { render :json => @article, :status => :ok } + else + format.json { render :json => @article.errors, :status => :unprocessable_entity } + end + end + end + + # DELETE /articles/1 + # DELETE /articles/1.json + def destroy + @article = Ticket::Article.find(params[:id]) + @article.destroy + + respond_to do |format| + format.json { head :ok } + end + end +end diff --git a/app/controllers/ticket_overviews_controller.rb b/app/controllers/ticket_overviews_controller.rb new file mode 100644 index 000000000..c3fd01d63 --- /dev/null +++ b/app/controllers/ticket_overviews_controller.rb @@ -0,0 +1,506 @@ +class TicketOverviewsController < ApplicationController + skip_before_filter :verify_authenticity_token + before_filter :authentication_check + + # GET /tickets + # GET /tickets.json + def show + + # build up attributes hash + overview_selected = nil + overviews = Overview.all + overviews.each { |overview| + + # replace 'current_user.id' with current_user.id + overview.condition.each { |item, value | + if value == 'current_user.id' + overview.condition[item] = current_user.id + end + } + + # remember selected view + if params[:view] && params[:view] == overview.meta[:url] + overview_selected = overview + end + } + + # sortby + # prio + # state + # group + # customer + + # order + # asc + # desc + + # groupby + # prio + # state + # group + # customer + +# all = attributes[:myopenassigned] +# all.merge( { :group_id => groups } ) + +# @tickets = Ticket.where(:group_id => groups, attributes[:myopenassigned] ).limit(params[:limit]) + # get only tickets with permissions + group_ids = Group.select( 'groups.id' ).joins(:users). + where( 'groups_users.user_id = ?', [current_user.id] ). + where( 'groups.active = ?', true ). + map( &:id ) + + # overview meta for navbar + if !overview_selected + + # loop each overview + result = [] + overviews.each { |overview| + + # get count + count = Ticket.where( :group_id => group_ids ).where( overview.condition ).count() + + # get meta info + all = overview.meta + + # push to result data + result.push all.merge( { :count => count } ) + } + + respond_to do |format| + format.json { render :json => result } + end + return + end + + # get tickets for overview + params[:start_page] ||= 1 + tickets = Ticket.where( :group_id => group_ids ). + where( overview_selected.condition ). + order( overview_selected[:order][:by].to_s + ' ' + overview_selected[:order][:direction].to_s ). + limit( overview_selected.view[ params[:view_mode].to_sym ][:per_page] ). + offset( overview_selected.view[ params[:view_mode].to_sym ][:per_page].to_i * ( params[:start_page].to_i - 1 ) ) + + tickets_count = Ticket.where( :group_id => group_ids ). + where( overview_selected.condition ). + count() + + # get related users + users = {} + tickets.each {|ticket| + if !users[ticket.owner_id] + users[ticket.owner_id] = user_data_full(ticket.owner_id) + end + if !users[ticket.customer_id] + users[ticket.customer_id] = user_data_full(ticket.customer_id) + end + if !users[ticket.created_by_id] + users[ticket.created_by_id] = user_data_full(ticket.created_by_id) + end + } + + # get data for bulk action + bulk_owners = Role.where( :name => ['Agent'] ).first.users.select(:id).where( :active => true ).uniq() + bulk_owner_ids = [] + bulk_owners.each { |user| + bulk_owner_ids.push user.id + if !users[user.id] + users[user.id] = user_data_full(user.id) + end + } + + # return result + respond_to do |format| + format.json { + render :json => { + :overview => overview_selected, + :tickets => tickets, + :tickets_count => tickets_count, + :users => users, + :bulk => { + :owner_id => { + :id => bulk_owner_ids, + } + }, + } + } + end + end + + + # GET /ticket_create + # GET /ticket_create/1.json + def ticket_create + + # get related users + users = {} + + ticket_group_ids = [] + Group.where( :active => true ).each { |group| + ticket_group_ids.push group.id + } + ticket_owner_ids = [] + Ticket.agents.each { |user| + ticket_owner_ids.push user.id + if !users[user.id] + users[user.id] = user_data_full(user.id) + end + } + + ticket_state_ids = [] + Ticket::State.where( :active => true ).each { |state| + ticket_state_ids.push state.id + } + ticket_priority_ids = [] + Ticket::Priority.where( :active => true ).each { |priority| + ticket_priority_ids.push priority.id + } + + # return result + respond_to do |format| + format.json { + render :json => { +# :ticket => ticket, +# :articles => articles, + :users => users, + :edit_form => { + :owner_id => { + :id => ticket_owner_ids + }, + :group_id => { + :id => ticket_group_ids + }, + :ticket_state_id => { + :id => ticket_state_ids + }, + :ticket_priority_id => { + :id => ticket_priority_ids + } + } + } + } + end + end + + # GET /ticket_full/1 + # GET /ticket_full/1.json + def ticket_full + ticket = Ticket.find(params[:id]) + + # get related users + users = {} + if !users[ticket.owner_id] + users[ticket.owner_id] = user_data_full(ticket.owner_id) + end + if !users[ticket.customer_id] + users[ticket.customer_id] = user_data_full(ticket.customer_id) + end + if !users[ticket.created_by_id] + users[ticket.created_by_id] = user_data_full(ticket.created_by_id) + end + + owner_ids = [] + ticket.agent_of_group.each { |user| + owner_ids.push user.id + if !users[user.id] + users[user.id] = user_data_full(user.id) + end + } + + # get related articles + ticket[:article_ids] = [] + articles = ticket.articles || [] + + # get related users + articles.each {|article| + + # load article ids + ticket[:article_ids].push article.id + + # add attachment list to article + article['attachments'] = Store.list( :object => 'Ticket::Article', :o_id => article.id ) + + # load users + if !users[article.created_by_id] + users[article.created_by_id] = user_data_full(article.created_by_id) + end + } + + # log object as viewed + log_view(ticket) + + # return result + respond_to do |format| + format.json { + render :json => { + :ticket => ticket, + :articles => articles, + :users => users, + :edit_form => { + :owner_id => { + :id => owner_ids + } + } + } + } + end + end + + # POST /ticket_attachment/new + def ticket_attachment_new +# puts '-------' +# puts params.inspect + + # store file + content_type = request.content_type + if content_type == 'application/octet-stream' + content_type = MIME::Types.type_for(params[:qqfile]).first.content_type + end + headers_store = { + 'Content-Type' => content_type + } + Store.add( + :object => 'UploadCache::' + params[:form] + '::' + current_user.id.to_s, + :o_id => params[:form_id], + :data => request.body.read, + :filename => params[:qqfile], + :preferences => headers_store + ) + + # return result + respond_to do |format| + format.json { + render :json => { + :success => true, + } + } + end + end + + # GET /ticket_attachment/1 + def ticket_attachment + + # permissin check + + # find file + file = Store.find(params[:id]) + send_data( + file.store_file.data, + :filename => file.filename, + :type => file.preferences['Mime-Type'] || file.preferences['Content-Type'], + :disposition => 'inline' + ) + end + + # GET /ticket_customer + # GET /tickets_customer + def ticket_customer + + # get closed/open states + ticket_state_list_open = Ticket::State.where( + :ticket_state_type_id => Ticket::StateType.where(:name => ['new','open', 'pending remidner', 'pending action']) + ) + ticket_state_list_closed = Ticket::State.where( + :ticket_state_type_id => Ticket::StateType.where(:name => ['closed'] ) + ) + + # get tickets + tickets_open = Ticket.where( + :customer_id => params[:customer_id], + :ticket_state_id => ticket_state_list_open + ).limit(15).order('created_at DESC') + + tickets_closed = Ticket.where( + :customer_id => params[:customer_id], + :ticket_state_id => ticket_state_list_closed + ).limit(15).order('created_at DESC') + +# tickets = Ticket.where(:customer_id => user_id).limit(15).order('created_at DESC') +# ticket_items = [] +# tickets.each do |ticket| +# style = '' +# ticket_state_type = ticket.ticket_state.ticket_state_type.name +# if ticket_state_type == 'closed' || ticket_state_type == 'merged' +# style = 'text-decoration: line-through' +# end +# item = { +# :url => '#ticket/zoom/' + ticket.id.to_s, +# :name => 'T:' + ticket.number.to_s, +# :title => ticket.title, +# :style => style +# } +# ticket_items.push item +# end +# if ticket_items[0] +# topic = { +# :title => 'Tickets', +# :items => ticket_items +# } +# user['links'].push topic +# end + + # return result + respond_to do |format| + format.json { + render :json => { + :tickets => { + :open => tickets_open, + :closed => tickets_closed + } +# :users => users, + } + } + end + end + + # GET /ticket_history/1 + # GET /tickets_history/1.json + def ticket_history + + # get ticket data + ticket = Ticket.find(params[:id]) + + # get history of ticket + history = History.history_list(['Ticket', 'Ticket::Article'], params[:id]) + + # get related users + users = {} + history.each do |item| + users[item.created_by_id] = user_data_full(item.created_by_id) +# item['history_attribute'] = item.history_attribute +# item['history_type'] = item.history_type + end + + # fetch meta relations + history_objects = History::Object.all() + history_types = History::Type.all() + history_attributes = History::Attribute.all() + + # return result + respond_to do |format| + format.json { + render :json => { + :ticket => ticket, + :users => users, + :history => history, + :history_objects => history_objects, + :history_types => history_types, + :history_attributes => history_attributes + } + } + end + end + + # GET /activity_stream + # GET /activity_stream.json + def activity_stream + activity_stream = History.activity_stream(current_user) + + # get related users + users = {} + tickets = [] + activity_stream.each {|item| + + # load article ids +# if item.history_object == 'Ticket' + tickets.push Ticket.find(item.o_id) +# end +# if item.history_object 'Ticket::Article' +# tickets.push Ticket::Article.find(item.o_id) +# end +# if item.history_object 'User' +# tickets.push User.find(item.o_id) +# end + + # load users + if !users[item.created_by_id] + users[item.created_by_id] = user_data_full(item.created_by_id) + end + } + + # return result + respond_to do |format| + format.json { + render :json => { + :activity_stream => activity_stream, + :tickets => tickets, + :users => users, + } + } + end + end + + # GET /recent_viewed + # GET /recent_viewed.json + def recent_viewed + recent_viewed = History.recent_viewed(current_user) + + # get related users + users = {} + tickets = [] + recent_viewed.each {|item| + + # load article ids +# if item.history_object == 'Ticket' + tickets.push Ticket.find(item.o_id) +# end +# if item.history_object 'Ticket::Article' +# tickets.push Ticket::Article.find(item.o_id) +# end +# if item.history_object 'User' +# tickets.push User.find(item.o_id) +# end + + # load users + if !users[item.created_by_id] + users[item.created_by_id] = user_data_full(item.created_by_id) + end + } + + # return result + respond_to do |format| + format.json { + render :json => { + :recent_viewed => recent_viewed, + :tickets => tickets, + :users => users, + } + } + end + end + + # GET /user_search + # GET /user_search.json + def user_search + + # get params + query = params[:term] + limit = params[:limit] || 18 + + # do query + user_all = User.find( + :all, + :limit => limit, + :conditions => ['firstname LIKE ? or lastname LIKE ? or email LIKE ?', "%#{query}%", "%#{query}%", "%#{query}%"], + :order => 'firstname' + ) + + # build result list + users = [] + user_all.each do |user| + realname = user.firstname.to_s + ' ' + user.lastname.to_s + if !user.email.empty? + realname = realname + ' <' + user.email.to_s + '>' + end + a = { :id => user.id, :label => realname, :value => realname } + users.push a + end + + # return result + respond_to do |format| + format.json { + render :json => users + } + end + end +end \ No newline at end of file diff --git a/app/controllers/ticket_priorities_controller.rb b/app/controllers/ticket_priorities_controller.rb new file mode 100644 index 000000000..c266ea650 --- /dev/null +++ b/app/controllers/ticket_priorities_controller.rb @@ -0,0 +1,62 @@ +class TicketPrioritiesController < ApplicationController + before_filter :authentication_check + + # GET /ticket_priorities + # GET /ticket_priorities.json + def index + @ticket_priorities = Ticket::Priority.all + + respond_to do |format| + format.json { render :json => @ticket_priorities } + end + end + + # GET /ticket_priorities/1 + # GET /ticket_priorities/1.json + def show + @ticket_priority = Ticket::Priority.find(params[:id]) + + respond_to do |format| + format.json { render :json => @ticket_priority } + end + end + + # POST /ticket_priorities + # POST /ticket_priorities.json + def create + @ticket_priority = Ticket::Priority.new(params[:ticket_priority]) + + respond_to do |format| + if @ticket_priority.save + format.json { render :json => @ticket_priority, :status => :created } + else + format.json { render :json => @ticket_priority.errors, :status => :unprocessable_entity } + end + end + end + + # PUT /ticket_priorities/1 + # PUT /ticket_priorities/1.json + def update + @ticket_priority = Ticket::Priority.find(params[:id]) + + respond_to do |format| + if @ticket_priority.update_attributes(params[:ticket_priority]) + format.json { render :json => @ticket_priority, :status => :ok } + else + format.json { render :json => @ticket_priority.errors, :status => :unprocessable_entity } + end + end + end + + # DELETE /ticket_priorities/1 + # DELETE /ticket_priorities/1.json + def destroy + @ticket_priority = Ticket::Priority.find(params[:id]) + @ticket_priority.destroy + + respond_to do |format| + format.json { head :ok } + end + end +end diff --git a/app/controllers/ticket_states_controller.rb b/app/controllers/ticket_states_controller.rb new file mode 100644 index 000000000..9bf7a01e4 --- /dev/null +++ b/app/controllers/ticket_states_controller.rb @@ -0,0 +1,62 @@ +class TicketStatesController < ApplicationController + before_filter :authentication_check + + # GET /ticket_states + # GET /ticket_states.json + def index + @ticket_states = Ticket::State.all + + respond_to do |format| + format.json { render :json => @ticket_states } + end + end + + # GET /ticket_states/1 + # GET /ticket_states/1.json + def show + @ticket_state = Ticket::State.find(params[:id]) + + respond_to do |format| + format.json { render :json => @ticket_state } + end + end + + # POST /ticket_states + # POST /ticket_states.json + def create + @ticket_state = Ticket::State.new(params[:ticket_state]) + + respond_to do |format| + if @ticket_state.save + format.json { render :json => @ticket_state, :status => :created } + else + format.json { render :json => @ticket_state.errors, :status => :unprocessable_entity } + end + end + end + + # PUT /ticket_states/1 + # PUT /ticket_states/1.json + def update + @ticket_state = Ticket::State.find(params[:id]) + + respond_to do |format| + if @ticket_state.update_attributes(params[:ticket_state]) + format.json { render :json => @ticket_state, :status => :ok } + else + format.json { render :json => @ticket_state.errors, :status => :unprocessable_entity } + end + end + end + + # DELETE /ticket_states/1 + # DELETE /ticket_states/1.json + def destroy + @ticket_state = Ticket::State.find(params[:id]) + @ticket_state.destroy + + respond_to do |format| + format.json { head :ok } + end + end +end diff --git a/app/controllers/tickets_controller.rb b/app/controllers/tickets_controller.rb new file mode 100644 index 000000000..52a523bb2 --- /dev/null +++ b/app/controllers/tickets_controller.rb @@ -0,0 +1,63 @@ +class TicketsController < ApplicationController + before_filter :authentication_check + + # GET /tickets + # GET /tickets.json + def index + @tickets = Ticket.all + + respond_to do |format| + format.json { render :json => @tickets } + end + end + + # GET /tickets/1 + # GET /tickets/1.json + def show + @ticket = Ticket.find(params[:id]) + + respond_to do |format| + format.json { render :json => @ticket } + end + end + + # POST /tickets + # POST /tickets.json + def create + @ticket = Ticket.new(params[:ticket]) + @ticket.created_by_id = current_user.id + + respond_to do |format| + if @ticket.save + format.json { render :json => @ticket, :status => :created } + else + format.json { render :json => @ticket.errors, :status => :unprocessable_entity } + end + end + end + + # PUT /tickets/1 + # PUT /tickets/1.json + def update + @ticket = Ticket.find(params[:id]) + + respond_to do |format| + if @ticket.update_attributes(params[:ticket]) + format.json { render :json => @ticket, :status => :ok } + else + format.json { render :json => @ticket.errors, :status => :unprocessable_entity } + end + end + end + + # DELETE /tickets/1 + # DELETE /tickets/1.json + def destroy + @ticket = Ticket.find(params[:id]) + @ticket.destroy + + respond_to do |format| + format.json { head :ok } + end + end +end diff --git a/app/controllers/users_controller.rb b/app/controllers/users_controller.rb new file mode 100644 index 000000000..eda3b0580 --- /dev/null +++ b/app/controllers/users_controller.rb @@ -0,0 +1,126 @@ +class UsersController < ApplicationController + before_filter :authentication_check, :except => [:create] + + # GET /users + # GET /users.json + def index + @users = User.all + + @users.each {|i| +# r = i.roles.select('id, name').where(:active => true) +# i['roles'] = r + role_ids = i.role_ids + group_ids = i.group_ids + organization_id = i.organization_id + i[:role_ids] = role_ids + i[:group_ids] = group_ids + i[:organization_id] = organization_id + } + + respond_to do |format| + format.html # index.html.erb + format.json { render :json => @users } + end + end + + # GET /users/1 + # GET /users/1.json + def show +# @user = User.find(params[:id]) + @user = user_data_full(params[:id]) + + respond_to do |format| + format.html # show.html.erb + format.json { render :json => @user } + end + end + + # GET /users/new + # GET /users/new.json + def new + @user = User.new + + respond_to do |format| + format.html # new.html.erb + format.json { render :json => @user } + end + end + + # GET /users/1/edit + def edit + @user = User.find(params[:id]) + end + + # POST /users + # POST /users.json + def create + @user = User.new(params[:user]) +# params[:user][:role_ids] = params[:role_ids] +# logger.debug params[:user].inspect + @user.created_by_id = (current_user && current_user.id) || 1 + respond_to do |format| + if @user.save + + # if it's a signup, add user to customer role + if @user.created_by_id == 1 + role_id = Role.where( :name => 'Customer' ).first.id + @user.role_ids = [role_id] + + # else do assignment as defined + else + if params[:role_ids] + @user.role_ids = params[:role_ids] + end + if params[:group_ids] + @user.group_ids = params[:group_ids] + end + end + + # send inviteation if needed + if params[:invite] +# logger.debug('IIIIIIIIIIIIIIIIIIIIIIIIIIIIII') +# exit '123' + end + format.html { redirect_to @user, :notice => 'User was successfully created.' } + format.json { render :json => @user, :status => :created } + else + format.html { render :action => "new" } + format.json { render :json => @user.errors, :status => :unprocessable_entity } + end + end + end + + # PUT /users/1 + # PUT /users/1.json + def update + @user = User.find(params[:id]) + + respond_to do |format| + if @user.update_attributes(params[:user]) + if params[:role_ids] + @user.role_ids = params[:role_ids] + end + if params[:group_ids] + @user.group_ids = params[:group_ids] + end + format.html { redirect_to @user, :notice => 'User was successfully updated.' } + format.json { render :json => @user, :status => :ok } + else + format.html { render :action => "edit" } + format.json { render :json => @user.errors, :status => :unprocessable_entity } + end + end + end + + # DELETE /users/1 + # DELETE /users/1.json + def destroy + @user = User.find(params[:id]) + @user.destroy + + respond_to do |format| + format.html { redirect_to users_url } + format.json { head :ok } + end + end +end diff --git a/app/helpers/notes_helper.rb b/app/helpers/notes_helper.rb new file mode 100644 index 000000000..8078f7303 --- /dev/null +++ b/app/helpers/notes_helper.rb @@ -0,0 +1,2 @@ +module NotesHelper +end diff --git a/app/helpers/posts_helper.rb b/app/helpers/posts_helper.rb new file mode 100644 index 000000000..a7b8cec89 --- /dev/null +++ b/app/helpers/posts_helper.rb @@ -0,0 +1,2 @@ +module PostsHelper +end diff --git a/app/models/account.rb b/app/models/account.rb new file mode 100644 index 000000000..4ee71d0c0 --- /dev/null +++ b/app/models/account.rb @@ -0,0 +1,14 @@ +module Account + class Outbound < ActiveRecord::Base + self.table_name = 'account_outbound' + end + + class Inbound < ActiveRecord::Base + self.table_name = 'account_inbound' + end + + class InboundFilter < ActiveRecord::Base + self.table_name = 'account_inbound_filter' + end + +end \ No newline at end of file diff --git a/app/models/authorization.rb b/app/models/authorization.rb new file mode 100644 index 000000000..a5b8b9747 --- /dev/null +++ b/app/models/authorization.rb @@ -0,0 +1,49 @@ +class Authorization < ActiveRecord::Base + belongs_to :user + validates_presence_of :user_id, :uid, :provider + validates_uniqueness_of :uid, :scope => :provider + + def self.find_from_hash(hash) + auth = Authorization.where( :provider => hash['provider'], :uid => hash['uid'] ) + if auth && auth.first then +# raise auth.first.to_yaml +# raise hash.to_yaml + + # update auth tokens + auth.first.update_attributes( + :token => hash['credentials']['token'], + :secret => hash['credentials']['secret'] + ) + + # update image if needed + if hash['info']['image'] + user = User.where( :id => auth.first.user_id ).first + user.update_attributes( + :image => hash['info']['image'] + ) + end + end + + return auth.first + end + + def self.create_from_hash(hash, user = nil) + if user then + user.update_attributes( + :username => hash['username'], + :image => hash['info']['image'] + ) + else + user = User.create_from_hash!(hash) + end + Authorization.create( + :user => user, + :uid => hash['uid'], + :username => hash['username'], + :provider => hash['provider'], + :token => hash['credentials']['token'], + :secret => hash['credentials']['secret'] + ) + end + +end \ No newline at end of file diff --git a/app/models/channel.rb b/app/models/channel.rb new file mode 100644 index 000000000..33fda6295 --- /dev/null +++ b/app/models/channel.rb @@ -0,0 +1,13 @@ +class Channel < ActiveRecord::Base + def self.fetch + Rails.application.config.channel.each { |channel| + begin + c = eval channel[:module] + '.new' + c.fetch(channel) + rescue Exception => e + puts "can't use " + channel[:module] + puts e.inspect + end + } + end +end \ No newline at end of file diff --git a/app/models/channel/facebook.rb b/app/models/channel/facebook.rb new file mode 100644 index 000000000..6d16ac9d0 --- /dev/null +++ b/app/models/channel/facebook.rb @@ -0,0 +1,29 @@ +#require 'rubygems' +#require 'twitter' + +class Channel::Facebook +# def fetch(:oauth_token, :oauth_token_secret) + def fetch + + + end + def send + + logger.debug('face!!!!!!!!!!!!!!') + graph_api = Koala::Facebook::API.new( + 'AAACqTciZAPsQBAHO9DbM333y2DcL5kccHyIObZB7WhaZBVUXUIeBNChkshvShCgiN6uwZC3r3l4cDvAZAPTArNIkemEraojzN1veNPZBADQAZDZD' + ) + graph_api.put_object( + 'id', + 'comments', + { + :message => self.body + } + ) +# client.direct_message_create( +# 'medenhofer', +# self.body, +# options = {} +# ) + end +end \ No newline at end of file diff --git a/app/models/channel/imap.rb b/app/models/channel/imap.rb new file mode 100644 index 000000000..2ffd92072 --- /dev/null +++ b/app/models/channel/imap.rb @@ -0,0 +1,201 @@ +require 'mail' +require 'net/imap' + +class Channel::IMAP + include UserInfo + +# def fetch(:oauth_token, :oauth_token_secret) + def fetch (account) + puts 'fetching imap' + + imap = Net::IMAP.new(account[:host], 993, true ) + imap.authenticate('LOGIN', account[:user], account[:pw]) + imap.select('INBOX') + imap.search(['ALL']).each do |message_id| + msg = imap.fetch(message_id,'RFC822')[0].attr['RFC822'] + puts '--------------------' +# puts msg.to_s + + mail = Mail.new( msg ) + from_email = Mail::Address.new( mail[:from].value ).address + from_display_name = Mail::Address.new( mail[:from].value ).display_name + + # use transaction + ActiveRecord::Base.transaction do + + user = User.where( :email => from_email ).first + if !user then + puts 'create user...' + roles = Role.where( :name => 'Customer' ) + user = User.create( + :login => from_email, + :firstname => from_display_name, + :lastname => '', + :email => from_email, + :password => '', + :active => true, + :roles => roles, + :created_by_id => 1 + ) + end + + # set current user + UserInfo.current_user_id = user.id + + def conv (charset, string) + if charset == 'US-ASCII' then + charset = 'LATIN1' + end + Iconv.conv("UTF8", charset, string) + end + + # get ticket# from subject + ticket = Ticket.number_check(mail[:subject].value) + + # set ticket state to open if not new + if ticket + ticket_state = Ticket::State.find( ticket.ticket_state_id ) + ticket_state_type = Ticket::StateType.find( ticket_state.ticket_state_type_id ) + if ticket_state_type.name != 'new' + ticket.ticket_state = Ticket::State.where( :name => 'open' ).first + ticket.save + end + end + + # create new ticket + if !ticket then + ticket = Ticket.create( + :group_id => Group.where( :name => account[:group] ).first.id, + :customer_id => user.id, + :title => conv(mail['subject'].charset || 'LATIN1', mail['subject'].to_s), + :ticket_state_id => Ticket::State.where(:name => 'new').first.id, + :ticket_priority_id => Ticket::Priority.where(:name => '2 normal').first.id, + :created_by_id => user.id + ) + end + + # import mail + plain_part = mail.multipart? ? (mail.text_part ? mail.text_part.body.decoded : nil) : mail.body.decoded + # html_part = message.html_part ? message.html_part.body.decoded : nil + article = Ticket::Article.create( + :created_by_id => user.id, + :ticket_id => ticket.id, + :ticket_article_type_id => Ticket::Article::Type.where(:name => 'email').first.id, + :ticket_article_sender_id => Ticket::Article::Sender.where(:name => 'Customer').first.id, + :body => conv(mail.body.charset || 'LATIN1', plain_part), + :from => mail['from'] ? conv(mail['from'].charset || 'LATIN1', mail['from'].to_s) : nil, + :to => mail['to'] ? conv(mail['to'].charset || 'LATIN1', mail['to'].to_s) : nil, + :cc => mail['cc'] ? conv(mail['cc'].charset || 'LATIN1', mail['cc'].to_s) : nil, + :subject => mail['subject'] ? conv(mail['subject'].charset || 'LATIN1', mail['subject'].to_s) : nil, + :message_id => mail['message_id'] ? mail['message_id'].to_s : nil, + :internal => false + ) + + # store mail plain + Store.add( + :object => 'Ticket::Article::Mail', + :o_id => article.id, + :data => msg, + :filename => 'plain.msg', + :preferences => {} + ) + + # store attachments + if mail.attachments + mail.attachments.each do |attachment| + + # get file preferences + headers = {} + attachment.header.fields.each do |f| + headers[f.name] = f.value + end + headers_store = {} + headers_store['Mime-Type'] = attachment.mime_type + if attachment.charset + headers_store['Charset'] = attachment.charset + end + ['Content-ID', 'Content-Type'].each do |item| + if headers[item] + headers_store[item] = headers[item] + end + end + + # store file + Store.add( + :object => 'Ticket::Article', + :o_id => article.id, + :data => attachment.body.decoded, + :filename => attachment.filename, + :preferences => headers_store + ) + end + end + + # delete email from server after article was created + if article + imap.store(message_id, "+FLAGS", [:Deleted]) + end + + end + + # execute ticket events + Ticket::Observer::Notification.transaction + end + imap.expunge() + imap.disconnect() + end + def send(attr, account, notification = false) + mail = Mail.new + + # set organization + organization = Setting.get('organization') + if organization then; + mail['organization'] = organization.to_s + end + + # notification + if notification + attr['X-Loop'] = 'yes' + attr['Precedence'] = 'bulk' + attr['Auto-Submitted'] = 'auto-generated' + end + + # set headers + attr.each do |key, v| + if key.to_s != 'attachments' && key.to_s != 'body' + mail[key.to_s] = v.to_s + end + end + + # add body + mail.text_part = Mail::Part.new do + body attr[:body] + end + + # add attachments + if attr[:attachments] + attr[:attachments].each do |attachment| + mail.attachments[attachment.filename] = { + :content_type => attachment.preferences['Content-Type'], + :mime_type => attachment.preferences['Mime-Type'], + :content => attachment.store_file.data + } + end + end + + #mail.delivery_method :sendmail + mail.delivery_method :smtp, { + :openssl_verify_mode => 'none', + :address => account[:host], + # :port => 587, + :port => 25, + :domain => account[:host], + :user_name => account[:user], + :password => account[:pw], + # :authentication => 'plain', + :enable_starttls_auto => true + } + mail.deliver + + end +end \ No newline at end of file diff --git a/app/models/channel/pop3.rb b/app/models/channel/pop3.rb new file mode 100644 index 000000000..74f26f209 --- /dev/null +++ b/app/models/channel/pop3.rb @@ -0,0 +1,20 @@ +#http://blog.ethanvizitei.com/2008/06/using-ruby-for-imap-with-gmail.html + + +pop = Net::POP3.new("pop.gmail.com", port) +pop.enable_ssl +pop.start('YourAccount', 'YourPassword') +if pop.mails.empty? + puts 'No mail.' +else + i = 0 + pop.each_mail do |m| + File.open("inbox/#{i}", 'w') do |f| + f.write m.pop + end + m.delete + i += 1 + end + puts "#{pop.mails.size} mails popped." +end +pop.finish diff --git a/app/models/channel/twitter2.rb b/app/models/channel/twitter2.rb new file mode 100644 index 000000000..d1e565c36 --- /dev/null +++ b/app/models/channel/twitter2.rb @@ -0,0 +1,245 @@ +#require 'rubygems' +require 'twitter' + +class Channel::Twitter2 + include UserInfo + +# def fetch(:oauth_token, :oauth_token_secret) + def fetch (account) + + puts 'fetching tweets' + @client = Twitter::Client.new( + :consumer_key => account[:consumer_key], + :consumer_secret => account[:consumer_secret], + :oauth_token => account[:oauth_token], + :oauth_token_secret => account[:oauth_token_secret] + ) + + # search results + if account[:search] + account[:search].each { |search| + tweets = @client.search( search[:item] ) + @article_type = 'twitter status' + fetch_loop(tweets, account, search[:group]) + } + end + + # mentions + if account[:mentions] + tweets = @client.mentions + @article_type = 'twitter status' + fetch_loop(tweets, account, account[:mentions][:group]) + end + + # direct messages + if account[:direct_messages] + tweets = @client.direct_messages + @article_type = 'twitter direct-message' + fetch_loop(tweets, account, account[:direct_messages][:group]) + end + end + + def fetch_loop(tweets, account, group) + + # find tweets + tweets.each do |tweet| + + # check if tweet is already imported + puts '------------------------------------------------------' + article = Ticket::Article.where( :message_id => tweet.id ).first + + # check if sender already exists + next if article + + # use transaction + ActiveRecord::Base.transaction do + puts 'import tweet' + fetch_import(tweet, account, group) + end + + # execute ticket events + Ticket::Observer::Notification.transaction + end + end + + def fetch_import(tweet, account, group) + + # do sender lockup if needed + sender = nil + + # status (full user data is included) + if tweet['user'] + sender = tweet['user'] + + # direct message (full user data is included) + elsif tweet['sender'] + sender = tweet['sender'] + + # search (no user data is included, do extra lookup) + elsif tweet['from_user_id'] + sender = @client.user(tweet.from_user_id) + end + + # check if parent exists + user = nil, ticket = nil, article = nil + if tweet['in_reply_to_status_id'] + puts 'import in_reply_tweet ' + tweet.in_reply_to_status_id.to_s + tweet_sub = @client.status(tweet.in_reply_to_status_id) +# puts tweet_sub.inspect + (user, ticket, article) = fetch_import(tweet_sub, account, group) + end + + # create stuff + user = fetch_user_create(tweet, sender) + if !ticket + ticket = fetch_ticket_create(user, tweet, sender, account, group) + end + article = fetch_article_create(user, ticket, tweet, sender) + return user, ticket, article + end + + def fetch_user_create(tweet, sender) + # create sender in db +# puts tweet.inspect +# user = User.where( :login => tweet.sender.screen_name ).first + auth = Authorization.where( :uid => sender.id, :provider => 'twitter' ).first +# user = undef + user = nil + if auth + puts 'user_id', auth.user_id + user = User.where( :id => auth.user_id ).first + end + if !user then + puts 'create user...' + roles = Role.where( :name => 'Customer' ) + user = User.create( + :login => sender.screen_name, + :firstname => sender.name, + :lastname => '', + :email => '', + :password => '', + :image => sender.profile_image_url, + :note => sender.description, + :active => true, + :roles => roles, + :created_by_id => 1 + ) + authentication = Authorization.create( + :uid => sender.id, + :username => sender.screen_name, + :user_id => user.id, + :provider => 'twitter' + ) + else + puts 'user exists'#, user.inspect + end + + # set current user + UserInfo.current_user_id = user.id + + return user + end + + def fetch_ticket_create(user, tweet, sender, account, group) + + puts '+++++++++++++++++++++++++++' + tweet.inspect + # check if ticket exists + if tweet['in_reply_to_status_id'] then + puts 'tweet.in_reply_to_status_id found: ' + tweet.in_reply_to_status_id + article = Ticket::Article.where( :message_id => tweet.in_reply_to_status_id ).first + if article + puts 'article with id found tweet.in_reply_to_status_id found: ' + tweet.in_reply_to_status_id + return article.ticket + end + end + + # find if record already exists + article = Ticket::Article.where( :message_id => tweet.id ).first + if article + return article.ticket + end + +# auth = Authorization.where( :uid => tweet.sender.id, :provider => 'twitter' ) + puts 'custimer_id', user.id, user.inspect + ticket = nil + if @article_type == 'twitter direct-message' + ticket = Ticket.where( :customer_id => user.id ).first + end + if !ticket then + ticket = Ticket.create( + :group_id => Group.where( :name => group ).first.id, + :customer_id => user.id, + :title => tweet.text[0,40], + :ticket_state_id => Ticket::State.where( :name => 'new' ).first.id, + :ticket_priority_id => Ticket::Priority.where( :name => '2 normal' ).first.id, + :created_by_id => user.id + ) + end + return ticket + end + + def fetch_article_create(user,ticket,tweet, sender) + + # find if record already exists + article = Ticket::Article.where( :message_id => tweet.id ).first + if article + return article + end + + # set ticket state to open if not new + if ticket.ticket_state.name != 'new' + ticket.ticket_state = Ticket::State.where( :name => 'open' ).first + ticket.save + end + + # import tweet + to = nil + if tweet['recipient'] + to = tweet.recipient.name + end + article = Ticket::Article.create( + :created_by_id => user.id, + :ticket_id => ticket.id, + :ticket_article_type_id => Ticket::Article::Type.where(:name => @article_type).first.id, + :ticket_article_sender_id => Ticket::Article::Sender.where(:name => 'Customer').first.id, + :body => tweet.text, + :from => sender.name, + :to => to, + :message_id => tweet.id, + :internal => false + ) + + end + + def send(atts, account) +# logger.debug('tweeeeettttt!!!!!!') + @client = Twitter::Client.new( + :consumer_key => account[:consumer_key], + :consumer_secret => account[:consumer_secret], + :oauth_token => account[:oauth_token], + :oauth_token_secret => account[:oauth_token_secret] + ) + puts 'to:' + atts[:to].to_s + if atts[:type] == 'twitter direct-message' then + dm = @client.direct_message_create( + atts[:to].to_s, + atts[:body].to_s, + options = {} + ) + puts dm.inspect + return dm + end + + if atts[:type] == 'twitter status' then + message = @client.update( + atts[:body].to_s, + options = { + :in_reply_to_status_id => atts[:in_reply_to] + } + ) + puts message.inspect + return message + end + + end +end \ No newline at end of file diff --git a/app/models/group.rb b/app/models/group.rb new file mode 100644 index 000000000..217c0d7e4 --- /dev/null +++ b/app/models/group.rb @@ -0,0 +1,3 @@ +class Group < ActiveRecord::Base + has_and_belongs_to_many :users +end diff --git a/app/models/history.rb b/app/models/history.rb new file mode 100644 index 000000000..9c52347d8 --- /dev/null +++ b/app/models/history.rb @@ -0,0 +1,84 @@ +class History < ActiveRecord::Base + self.table_name = 'histories' + belongs_to :history_type, :class_name => 'History::Type' + belongs_to :history_object, :class_name => 'History::Object' + belongs_to :history_attribute, :class_name => 'History::Attribute' +# before_validation :check_type, :check_object +# attr_writer :history_type, :history_object + +# def history_type(a) +# end + + def self.history_list(requested_object, requested_object_id) + history = History.where( :history_object_id => History::Object.where( :name => requested_object ) ). + where( :o_id => requested_object_id ). + where( :history_type_id => History::Type.where( :name => ['created', 'updated']) ). + order('created_at ASC, id ASC') + return history + end + + def self.activity_stream(user) +# g = Group.where( :active => true ).joins(:users).where( 'users.id' => user.id ) +# stream = History.select("distinct(histories.o_id), created_by_id, history_attribute_id, history_type_id, history_object_id, value_from, value_to"). + stream = History.select("distinct(histories.o_id), created_by_id, history_type_id, history_object_id"). + where( :history_object_id => History::Object.where( :name => 'Ticket').first.id ). + where( :history_type_id => History::Type.where( :name => ['created', 'updated']) ). + order('created_at DESC, id DESC'). + limit(10) + stream.each do |item| + item['history_object'] = item.history_object + item['history_type'] = item.history_type +# item['history_attribute'] = item.history_attribute + end + return stream + end + + def self.recent_viewed(user) +# g = Group.where( :active => true ).joins(:users).where( 'users.id' => user.id ) + stream = History.select("distinct(histories.o_id), created_by_id, history_attribute_id, history_type_id, history_object_id, value_from, value_to"). + where( :history_object_id => History::Object.where( :name => 'Ticket').first.id ). + where( :history_type_id => History::Type.where( :name => ['viewed']) ). + order('created_at DESC, id DESC'). + limit(10) + stream.each do |item| + item['history_object'] = item.history_object + item['history_type'] = item.history_type +# item['history_attribute'] = item.history_attribute + end + return stream + end + + private + def check_type + puts '--------------' + puts self.inspect + history_type = History::Type.where( :name => self.history_type ).first + if !history_type || !history_type.id + history_type = History::Type.create( + :name => self.history_type, + :active => true + ) + end + self.history_type_id = history_type.id + end + def check_object + history_object = History::Object.where( :name => self.history_object ).first + if !history_object || !history_object.id + history_object = History::Object.create( + :name => self.history_object, + :active => true + ) + end + self.history_object_id = history_object.id + end + + class Object < ActiveRecord::Base + end + + class Type < ActiveRecord::Base + end + + class Attribute < ActiveRecord::Base + end + +end diff --git a/app/models/history_observer.rb b/app/models/history_observer.rb new file mode 100644 index 000000000..e26520eaa --- /dev/null +++ b/app/models/history_observer.rb @@ -0,0 +1,178 @@ +class HistoryObserver < ActiveRecord::Observer + include UserInfo + observe :ticket, :user, 'ticket::_article' + + def after_create(record) + puts 'HISTORY OBSERVER CREATE !!!!' + record.class.name + puts record.inspect + + history_type = History::Type.where( :name => 'created' ).first + if !history_type || !history_type.id + history_type = History::Type.create( + :name => 'created' + ) + end + history_object = History::Object.where( :name => record.class.name ).first + if !history_object || !history_object.id + history_object = History::Object.create( + :name => record.class.name + ) + end + + History.create( + :o_id => record.id, + :history_type_id => history_type.id, + :history_object_id => history_object.id, + :created_by_id => current_user_id || record.created_by_id || 1 + ) +# :name => record.class.name, +# :type => 'create', +# :data => record + end + + def before_update(record) + puts 'before_update' + current = record.class.find(record.id) + + # do not send anything if nothing has changed + if current.attributes == record.attributes + return + end + + puts 'HISTORY OBSERVER UPDATE!!!!' + record.class.name + puts 'current' + puts current.inspect + puts 'record' + puts record.inspect + + diff = differences_from?(current, record) + puts 'DIFF' + puts diff.inspect + puts 'CURRENT O_ID' + puts current.id + puts 'CURRENT USER ID' + puts current_user_id + + history_type = History::Type.where( :name => 'updated' ).first + if !history_type || !history_type.id + history_type = History::Type.create( + :name => 'updated' + ) + end + history_object = History::Object.where( :name => record.class.name ).first + if !history_object || !history_object.id + history_object = History::Object.create( + :name => record.class.name + ) + end + + map = { + :group_id => { + :attribute => 'Group', + + :lookup_object => Group, + :lookup_name => 'name', + }, + :title => { + :attribute => 'Title', + }, + :number => { + :attribute => 'Number', + }, + :owner_id => { + :attribute => 'Owner', + + :lookup_object => User, + :lookup_name => ['firstname', 'lastname'], + }, + :ticket_state_id => { + :attribute => 'State', + + :lookup_object => Ticket::State, + :lookup_name => 'name', + }, + :ticket_priority_id => { + :attribute => 'Priority', + + :lookup_object => Ticket::Priority, + :lookup_name => 'name', + } + } + + diff.each do |key, value_ids| + puts "#{key} is #{value_ids}" + + # check if diff are ids, if yes do lookup + value = [] + if map[key.to_sym] && map[key.to_sym][:lookup_object] + value[0] = '' + value[1] = '' + if map[key.to_sym][:lookup_name].class == Array + map[key.to_sym][:lookup_name].each do |item| + if value[0] != '' + value[0] = value[0] + ' ' + end + value[0] = value[0] + map[key.to_sym][:lookup_object].find(value_ids[0])[item.to_sym].to_s + if value[1] != '' + value[1] = value[1] + ' ' + end + value[1] = value[1] + map[key.to_sym][:lookup_object].find(value_ids[1])[item.to_sym].to_s + end + else + value[0] = map[key.to_sym][:lookup_object].find(value_ids[0])[map[key.to_sym][:lookup_name]] + value[1] = map[key.to_sym][:lookup_object].find(value_ids[1])[map[key.to_sym][:lookup_name]] + end + + # if not, fill diff data to value, empty value_ids + else + value = value_ids + value_ids = [] + end + + attribute_name = '' + if map[key.to_sym] && map[key.to_sym][:attribute].to_s + attribute_name = map[key.to_sym][:attribute].to_s + else + attribute_name = key + end +puts 'LLLLLLLLLLLLLLLLLLLLLLLL' + attribute_name.to_s + attribute = History::Attribute.where( :name => attribute_name.to_s ).first + if !attribute || !attribute.object_id + attribute = History::Attribute.create( + :name => attribute_name + ) + end +# puts '9999999' +# puts current.object_id +# puts current.id + History.create( + :o_id => current.id, + :history_type_id => history_type.id, + :history_object_id => history_object.id, + :history_attribute_id => attribute.id, + :value_from => value[0], + :value_to => value[1], + :id_from => value_ids[0], + :id_to => value_ids[1], + :created_by_id => current_user_id || 1 || self['created_by_id'] || 1 + ) + + end + +# :name => record.class.name, +# :type => 'update', +# :data => record + end + + def differences_from?(one, other) +# puts '1111'+one.inspect +# puts '2222'+other.inspect + h = {} + one.attributes.each_pair do |key, value| + if one[key] != other[key] + h[key.to_sym] = [ one[key], other[key] ] + end + end + h + end +end \ No newline at end of file diff --git a/app/models/link.rb b/app/models/link.rb new file mode 100644 index 000000000..44ae62d40 --- /dev/null +++ b/app/models/link.rb @@ -0,0 +1,7 @@ +class Link < ActiveRecord::Base + class Object < ActiveRecord::Base + end + + class Type < ActiveRecord::Base + end +end diff --git a/app/models/network.rb b/app/models/network.rb new file mode 100644 index 000000000..3979f8012 --- /dev/null +++ b/app/models/network.rb @@ -0,0 +1,31 @@ +class Network < ActiveRecord::Base +# belongs_to :group +# belongs_to :ticket_state, :class_name => 'Ticket::State' +# belongs_to :ticket_priority, :class_name => 'Ticket::Priority' + + class Category < ActiveRecord::Base + self.table_name = 'network_categories' + + class Type < ActiveRecord::Base + end + + class Subscription < ActiveRecord::Base + end + end + + class Item < ActiveRecord::Base + class Comment < ActiveRecord::Base + end + + class Plus < ActiveRecord::Base + self.table_name = 'network_item_plus' + end + + class Subscription < ActiveRecord::Base + end + end + + class Privacy < ActiveRecord::Base + self.table_name = 'network_privacies' + end +end diff --git a/app/models/notification.rb b/app/models/notification.rb new file mode 100644 index 000000000..199a1961f --- /dev/null +++ b/app/models/notification.rb @@ -0,0 +1,2 @@ +class Notifications < ActiveRecord::Base +end diff --git a/app/models/organization.rb b/app/models/organization.rb new file mode 100644 index 000000000..b921d4f42 --- /dev/null +++ b/app/models/organization.rb @@ -0,0 +1,3 @@ +class Organization < ActiveRecord::Base + has_and_belongs_to_many :users +end diff --git a/app/models/overview.rb b/app/models/overview.rb new file mode 100644 index 000000000..0869d969d --- /dev/null +++ b/app/models/overview.rb @@ -0,0 +1,6 @@ +class Overview < ActiveRecord::Base + store :condition + store :order + store :meta + store :view +end \ No newline at end of file diff --git a/app/models/post.rb b/app/models/post.rb new file mode 100644 index 000000000..791dcb567 --- /dev/null +++ b/app/models/post.rb @@ -0,0 +1,2 @@ +class Post < ActiveRecord::Base +end diff --git a/app/models/role.rb b/app/models/role.rb new file mode 100644 index 000000000..33cd819ac --- /dev/null +++ b/app/models/role.rb @@ -0,0 +1,3 @@ +class Role < ActiveRecord::Base + has_and_belongs_to_many :users +end diff --git a/app/models/setting.rb b/app/models/setting.rb new file mode 100644 index 000000000..428a92a1b --- /dev/null +++ b/app/models/setting.rb @@ -0,0 +1,28 @@ +class Setting < ActiveRecord::Base + store :options + store :state + store :state_initial + before_create :set_initial + + @@config = nil + + def self.load + return @@config if @@config + config = {} + Setting.select('name, state').order(:id).each { |setting| + config[setting.name] = setting.state[:value] + } + @@config = config + return config + end + + def self.get(name) + self.load + return @@config[name] + end + + private + def set_initial + self.state_initial = self.state + end +end diff --git a/app/models/store.rb b/app/models/store.rb new file mode 100644 index 000000000..3ba09fe2e --- /dev/null +++ b/app/models/store.rb @@ -0,0 +1,85 @@ +require 'digest/md5' + +class Store < ActiveRecord::Base + store :preferences + belongs_to :store_object, :class_name => 'Store::Object' + belongs_to :store_file, :class_name => 'Store::File' + + def self.add(data) + data = data.stringify_keys + + # lookup store_object.id + store_object = Store::Object.where( :name => data['object'] ).first + if !store_object || !store_object.id + store_object = Store::Object.create( + :name => data['object'] + ) + end + data['store_object_id'] = store_object.id + + # check if record already exists +# store = Store.where( :store_object_id => store_object.id, :o_id => data['o_id'], ).first +# if store != nil +# return store +# end + + # check real store + md5 = Digest::MD5.hexdigest( data['data'] ) + data['size'] = data['data'].to_s.to_blob.bytesize + + file = Store::File.where( :md5 => md5 ).first + + # store attachment + if file == nil + file = Store::File.create( + :data => data['data'], + :md5 => md5 + ) + end + + data['store_file_id'] = file.id + data['created_by_id'] = 1 + + # not needed attributes + data.delete('data') + data.delete('object') + + # store meta data + store = Store.create(data) + + return store + end + + def self.list(data) + # search + stores = Store.where( :store_object_id => Store::Object.where( :name => data[:object] ) ). + where( :o_id => data[:o_id] ). + order('created_at ASC, id ASC') + return stores + end + + def self.remove(data) + # search + stores = Store.where( :store_object_id => Store::Object.where( :name => data[:object] ) ). + where( :o_id => data[:o_id] ). + order('created_at ASC, id ASC') + stores.each do |store| + store.destroy + end + return 1 + end + + + class Object < ActiveRecord::Base + end + + class File < ActiveRecord::Base + before_validation :add_md5 + + private + def add_md5 + self.md5 = Digest::MD5.hexdigest( self.data ) + end + end + +end diff --git a/app/models/ticket.rb b/app/models/ticket.rb new file mode 100644 index 000000000..f2e49b714 --- /dev/null +++ b/app/models/ticket.rb @@ -0,0 +1,254 @@ +class Ticket < ActiveRecord::Base + before_create :number_generate, :check_defaults + belongs_to :group + has_many :articles + belongs_to :ticket_state, :class_name => 'Ticket::State' + belongs_to :ticket_priority, :class_name => 'Ticket::Priority' + belongs_to :owner, :class_name => 'User' + belongs_to :customer, :class_name => 'User' + belongs_to :created_by, :class_name => 'User' + + @@number_adapter = nil + + def number_adapter + return @@number_adapter + end + + def number_adapter=(adapter_name) + return @@number_adapter if @@number_adapter + case adapter_name + when Symbol, String + require "ticket/number/#{adapter_name}" + @@number_adapter = Ticket::Number.const_get("#{adapter_name.to_s.capitalize}") + else + raise "Missing number_adapter #{adapter_name}" + end + end + + def self.number_check (string) + Ticket.new.number_adapter = Setting.get('ticket_number') + @@number_adapter.number_check_item(string) + end + + def agent_of_group + Group.find(self.group_id).users.where( :active => true ).joins(:roles).where( 'roles.name' => 'Agent', 'roles.active' => true ).uniq() + end + + def self.agents + User.where( :active => true ).joins(:roles).where( 'roles.name' => 'Agent', 'roles.active' => true ).uniq() + end + +# def self.agent +# Role.where( :name => ['Agent'], :active => true ).first.users.where( :active => true ).uniq() +# end + + def subject_build (subject) + + # clena subject + subject = self.subject_clean(subject) + + ticket_hook = Setting.get('ticket_hook') + ticket_hook_divider = Setting.get('ticket_hook_divider') + + # none position + if Setting.get('ticket_hook_position') == 'none' + return subject + end + + # right position + if Setting.get('ticket_hook_position') == 'right' + return subject + " [#{ticket_hook}#{ticket_hook_divider}#{self.number}] " + end + + # left position + return "[#{ticket_hook}#{ticket_hook_divider}#{self.number}] " + subject + end + + def subject_clean (subject) + ticket_hook = Setting.get('ticket_hook') + ticket_hook_divider = Setting.get('ticket_hook_divider') + ticket_subject_size = Setting.get('ticket_subject_size') + + # remove all possible ticket hook formats with [] + subject = subject.gsub /\[#{ticket_hook}: #{self.number}\](\s+?|)/, '' + subject = subject.gsub /\[#{ticket_hook}:#{self.number}\](\s+?|)/, '' + subject = subject.gsub /\[#{ticket_hook}#{ticket_hook_divider}#{self.number}\](\s+?|)/, '' + + # remove all possible ticket hook formats without [] + subject = subject.gsub /#{ticket_hook}: #{self.number}(\s+?|)/, '' + subject = subject.gsub /#{ticket_hook}:#{self.number}(\s+?|)/, '' + subject = subject.gsub /#{ticket_hook}#{ticket_hook_divider}#{self.number}(\s+?|)/, '' + + # remove leading "..:\s" and "..[\d+]:\s" e. g. "Re: " or "Re[5]: " + subject = subject.gsub /^(..(\[\d+\])?:\s)+/, '' + + # resize subject based on config + if subject.length > ticket_subject_size.to_i + subject = subject[ 0, ticket_subject_size.to_i ] + '[...]' + end + + return subject + end + + private + def number_generate + Ticket.new.number_adapter = Setting.get('ticket_number') + (1..15_000).each do |i| + number = @@number_adapter.number_generate_item() + ticket = Ticket.where( :number => number ).first + if ticket != nil + number = @@number_adapter.number_generate_item() + else + self.number = number + return number + end + end + end + def check_defaults + if !self.owner_id then + self.owner_id = 1 + end + end + + class Flag < ActiveRecord::Base + end + + class Priority < ActiveRecord::Base + self.table_name = 'ticket_priorities' + end + + class StateType < ActiveRecord::Base + end + + class State < ActiveRecord::Base + belongs_to :ticket_state_type, :class_name => 'Ticket::StateType' + end + + class Article < ActiveRecord::Base + before_create :fillup + after_create :attachment_check, :communicate + belongs_to :ticket + belongs_to :ticket_article_type, :class_name => 'Ticket::Article::Type' + belongs_to :ticket_article_sender, :class_name => 'Ticket::Article::Sender' + belongs_to :created_by, :class_name => 'User' + + private + def fillup + + # if sender is customer, do not change anything + sender = Ticket::Article::Sender.where( :id => self.ticket_article_sender_id ).first + return if sender == nil || sender['name'] == 'Customer' + + type = Ticket::Article::Type.where( :id => self.ticket_article_type_id ).first + ticket = Ticket.find(self.ticket_id) + + # set email attributes + if type['name'] == 'email' + + # set subject if empty + if !self.subject || self.subject == '' + self.subject = ticket.title + end + + # clean subject + self.subject = ticket.subject_clean(self.subject) + + # generate message id + fqdn = Setting.get('fqdn') + self.message_id = '<' + DateTime.current.to_s(:number) + '.' + self.ticket_id.to_s + '.' + rand(999999).to_s() + '@' + fqdn + '>' + + # set sender + self.from = Rails.application.config.email_sender + end + end + def attachment_check + + # do nothing if no attachment exists + return 1 if self['attachments'] == nil + + # store attachments + article_store = [] + self.attachments.each do |attachment| + article_store.push Store.add( + :object => 'Ticket::Article', + :o_id => self.id, + :data => attachment.store_file.data, + :filename => attachment.filename, + :preferences => attachment.preferences + ) + end + self.attachments = article_store + end + + def communicate + # if sender is customer, do not communication + sender = Ticket::Article::Sender.where( :id => self.ticket_article_sender_id ).first + return 1 if sender == nil || sender['name'] == 'Customer' + + type = Ticket::Article::Type.where( :id => self.ticket_article_type_id ).first + ticket = Ticket.find(self.ticket_id) + + # if sender is agent or system + + # create tweet + if type['name'] == 'twitter direct-message' || type['name'] == 'twitter status' + a = Channel::Twitter2.new + message = a.send( + { + :type => type['name'], + :to => self.to, + :body => self.body, + :in_reply_to => self.in_reply_to + }, + Rails.application.config.channel_twitter + ) + self.message_id = message.id + self.save + end + + # post facebook comment + if type['name'] == 'facebook' + a = Channel::Facebook.new + a.send( + { + :from => 'me@znuny.com', + :to => 'medenhofer', + :body => self.body + } + ) + end + + # send email + if type['name'] == 'email' + + # build subject + subject = ticket.subject_build(self.subject) + + # send email + a = Channel::IMAP.new + message = a.send( + { + :message_id => self.message_id, + :in_reply_to => self.in_reply_to, + :from => self.from, + :to => self.to, + :subject => subject, + :body => self.body, + :attachments => self.attachments + }, + Rails.application.config.channel_email + ) + end + end + + class Flag < ActiveRecord::Base + end + + class Sender < ActiveRecord::Base + end + + class Type < ActiveRecord::Base + end + end + +end diff --git a/app/models/ticket/number/date.rb b/app/models/ticket/number/date.rb new file mode 100644 index 000000000..eebfaf100 --- /dev/null +++ b/app/models/ticket/number/date.rb @@ -0,0 +1,88 @@ +module Ticket::Number::Date + extend self + + def number_generate_item + + # get config + config = Setting.get('ticket_number_date') + + t = Time.now + date = t.strftime("%Y-%m-%d") + + # read counter + file_name = config[:file] || '/tmp/counter.log' + contents = "" + begin + file = File.open(file_name) + file.each {|line| + contents << line + } + file.close + rescue + contents = '0' + end + + # increase counter + counter, date_file = contents.to_s.split(';') + + if date_file == date + counter = counter.to_i + 1 + else + counter = 1 + end + contents = counter.to_s + ';' + date + + # write counter + file = File.open(file_name, 'w') + file.write(contents) + file.close + + system_id = Setting.get('system_id') || '' + number = t.strftime("%Y%m%d") + system_id.to_s + sprintf( "%04d", counter) + + # calculate a checksum + # The algorithm to calculate the checksum is derived from the one + # Deutsche Bundesbahn (german railway company) uses for calculation + # of the check digit of their vehikel numbering. + # The checksum is calculated by alternately multiplying the digits + # with 1 and 2 and adding the resulsts from left to right of the + # vehikel number. The modulus to 10 of this sum is substracted from + # 10. See: http://www.pruefziffernberechnung.de/F/Fahrzeugnummer.shtml + # (german) + if config[:checksum] + chksum = 0 + mult = 1 + (1..number.length).each do |i| + digit = number.to_s[i, 1] + chksum = chksum + ( mult * digit.to_i ) + mult += 1; + if mult == 3 + mult = 1; + end + end + chksum %= 10 + chksum = 10 - chksum + if chksum == 10 + chksum = 1 + end + number += chksum.to_s + end + return number + end + def number_check_item (string) + + # get config + system_id = Setting.get('system_id') || '' + ticket_hook = Setting.get('ticket_hook') + ticket_hook_divider = Setting.get('ticket_hook_divider') || '' + ticket = nil + + # probe format + if string =~ /#{ticket_hook}#{ticket_hook_divider}(#{system_id}\d{2,50})/i then + ticket = Ticket.where( :number => $1 ).first + elsif string =~ /#{ticket_hook}\s{0,2}(#{system_id}\d{2,50})/i then + ticket = Ticket.where( :number => $1 ).first + end + return ticket + end +end \ No newline at end of file diff --git a/app/models/ticket/number/increment.rb b/app/models/ticket/number/increment.rb new file mode 100644 index 000000000..2c563ec8b --- /dev/null +++ b/app/models/ticket/number/increment.rb @@ -0,0 +1,91 @@ +module Ticket::Number::Increment + extend self + + def number_generate_item + + # get config + config = Setting.get('ticket_number_increment') + + # read counter + min_digs = config[:min_size] || 4; + file_name = config[:file] || '/tmp/counter.log' + contents = "" + begin + file = File.open( file_name ) + file.each {|line| + contents << line + } + file.close + rescue + contents = '0' + end + + # increase counter + counter, date_file = contents.to_s.split(';') + counter = counter.to_i + 1 + contents = counter.to_s + ';' + + # write counter + file = File.open( file_name, 'w' ) + file.write(contents) + file.close + + # fill up number counter + if config[:checksum] + min_digs = min_digs.to_i - 1 + end + fillup = Setting.get('system_id') || '1' + ( 1..100 ).each do |i| + if ( fillup.length.to_i + counter.to_s.length.to_i ) < min_digs.to_i + fillup = fillup + '0' + end + end + number = fillup.to_s + counter.to_s + + # calculate a checksum + # The algorithm to calculate the checksum is derived from the one + # Deutsche Bundesbahn (german railway company) uses for calculation + # of the check digit of their vehikel numbering. + # The checksum is calculated by alternately multiplying the digits + # with 1 and 2 and adding the resulsts from left to right of the + # vehikel number. The modulus to 10 of this sum is substracted from + # 10. See: http://www.pruefziffernberechnung.de/F/Fahrzeugnummer.shtml + # (german) + if config[:checksum] + chksum = 0 + mult = 1 + (1..number.length).each do |i| + digit = number.to_s[i, 1] + chksum = chksum + ( mult * digit.to_i ) + mult += 1; + if mult == 3 + mult = 1; + end + end + chksum %= 10 + chksum = 10 - chksum + if chksum == 10 + chksum = 1 + end + number += chksum.to_s + end + return number + end + + def number_check_item (string) + + # get config + system_id = Setting.get('system_id') || '' + ticket_hook = Setting.get('ticket_hook') + ticket_hook_divider = Setting.get('ticket_hook_divider') || '' + ticket = nil + + # probe format + if string =~ /#{ticket_hook}#{ticket_hook_divider}(#{system_id}\d{2,50})/i then + ticket = Ticket.where( :number => $1 ).first + elsif string =~ /#{ticket_hook}\s{0,2}(#{system_id}\d{2,50})/i then + ticket = Ticket.where( :number => $1 ).first + end + return ticket + end +end \ No newline at end of file diff --git a/app/models/ticket/observer/close_time.rb b/app/models/ticket/observer/close_time.rb new file mode 100644 index 000000000..e243e5c04 --- /dev/null +++ b/app/models/ticket/observer/close_time.rb @@ -0,0 +1,21 @@ +class Ticket::Observer::CloseTime < ActiveRecord::Observer + observe 'ticket' + + def after_update(record) +# puts 'check close time' + + # check if close_time is already set + return true if record.close_time + + # check if ticket is closed now + ticket_state = Ticket::State.find( record.ticket_state_id ) + ticket_state_type = Ticket::StateType.find( ticket_state.ticket_state_type_id ) + return true if ticket_state_type.name != 'closed' + + # set close_time + record.close_time = Time.now + + # save ticket + record.save + end +end \ No newline at end of file diff --git a/app/models/ticket/observer/first_response.rb b/app/models/ticket/observer/first_response.rb new file mode 100644 index 000000000..a8badaee7 --- /dev/null +++ b/app/models/ticket/observer/first_response.rb @@ -0,0 +1,25 @@ +class Ticket::Observer::FirstResponse < ActiveRecord::Observer + observe 'ticket::_article' + + def after_create(record) +# puts 'check first response' + + # if article in internal + return true if record.internal + + # if sender is not agent + return true if record.ticket_article_sender.name != 'Agent' + + # if article is a message to customer + return true if !record.ticket_article_type.communication + + # check if first_response is already set + return true if record.ticket.first_response + + # set first_response + record.ticket.first_response = Time.now + + # save ticket + record.ticket.save + end +end \ No newline at end of file diff --git a/app/models/ticket/observer/last_contact.rb b/app/models/ticket/observer/last_contact.rb new file mode 100644 index 000000000..45d657938 --- /dev/null +++ b/app/models/ticket/observer/last_contact.rb @@ -0,0 +1,43 @@ +class Ticket::Observer::LastContact < ActiveRecord::Observer + observe 'ticket::_article' + + def after_create(record) +# puts 'check last contact' + + # if article in internal + return true if record.internal + + # if article is a message to customer + return true if !record.ticket_article_type.communication + + # if sender is not customer + if record.ticket_article_sender.name == 'Customer' + + # check if last communication is done by agent, else do not set last_contact_customer + if record.ticket.last_contact_customer == nil || + record.ticket.last_contact_agent == nil || + record.ticket.last_contact_agent > record.ticket.last_contact_customer + record.ticket.last_contact_customer = Time.now + + # set last_contact + record.ticket.last_contact = Time.now + + # save ticket + record.ticket.save + end + end + + # if sender is not agent + if record.ticket_article_sender.name == 'Agent' + + # set last_contact_agent + record.ticket.last_contact_agent = Time.now + + # set last_contact + record.ticket.last_contact = Time.now + + # save ticket + record.ticket.save + end + end +end \ No newline at end of file diff --git a/app/models/ticket/observer/notification.rb b/app/models/ticket/observer/notification.rb new file mode 100644 index 000000000..2316a83a8 --- /dev/null +++ b/app/models/ticket/observer/notification.rb @@ -0,0 +1,264 @@ +class String + def message_quote + quote = self.split("\n") + body_quote = '' + quote.each do |line| + body_quote = body_quote + '> ' + line + "\n" + end + body_quote + end + def word_wrap(*args) + options = args.extract_options! + unless args.blank? + options[:line_width] = args[0] || 80 + end + options.reverse_merge!(:line_width => 80) + + lines = self + lines.split("\n").collect do |line| + line.length > options[:line_width] ? line.gsub(/(.{1,#{options[:line_width]}})(\s+|$)/, "\\1\n").strip : line + end * "\n" + end + +end + +class Ticket::Observer::Notification < ActiveRecord::Observer + observe :ticket, 'ticket::_article' + + @@event_buffer = [] + + def self.transaction + +# puts '@@event_buffer' +# puts @@event_buffer.inspect + @@event_buffer.each { |event| + if event[:name] == 'Ticket' && event[:type] == 'create' + ticket = Ticket.find( event[:id] ) + + # send new ticket notification to agents + puts 'send new ticket notify to agent' + send_notify( + { + :event => event, + :recipient => 'to_work_on', # group|owner|to_work_on|customer + :subject => 'New Ticket (#{ticket.title})', + :body => 'New Ticket (#{ticket.title}) in Group #{ticket.group.name} + +From: #{ticket.articles[-1].from} + + +#{ticket.articles[-1].body} + + +#{config.http_type}://#{config.fqdn}/ticket/zoom/#{ticket.id}/#{ticket.articles[-1].id} +' + }, + ticket, + nil + ) + + # send new ticket notification to customers + puts 'send new ticket notify to customer' + send_notify( + { + :event => event, + :recipient => 'customer', # group|owner|to_work_on|customer + :subject => 'New Ticket has been created! (#{ticket.title})', + :body => 'Thanks for your email. A new ticket has been created. + +You wrote: + +#{ticket.articles[-1].body} + + +Your email will be answered by a human ASAP + +Have fun with Zammad! :-) + +Your Zammad Team +' + }, + ticket, + nil + ) + end + + # send follow up notification + if event[:name] == 'Ticket::Article' && event[:type] == 'create' + article = Ticket::Article.find( event[:id] ) + ticket = article.ticket + + # only send article notifications after init article is created (handled by ticket create event) + next if ticket.articles.count >= 1 + + puts 'send new ticket::article notify' + + if article.ticket_article_sender.name == 'Customer' + send_notify( + { + :event => event, + :recipient => 'to_work_on', # group|owner|to_work_on|customer + :subject => 'Follow Up (#{ticket.title})', + :body => 'Follow Up (#{ticket.title}) in Group #{ticket.group.name} + +From: #{ticket.articles[-1].from} + + +#{ticket.articles[-1].body} + + +#{config.http_type}://#{config.fqdn}/ticket/zoom/#{ticket.id}/#{ticket.articles[-1].id} +' + }, + ticket, + article + ) + end + + # send new note notification to owner + # if agent == created.id + if article.ticket_article_sender.name == 'Agent' && article.created_by_id != article.ticket.owner_id + send_notify( + { + :event => event, + :recipient => 'owner', # group|owner|to_work_on + :subject => 'Update (#{ticket.title})', + :body => 'Update (#{ticket.title}) in Group #{ticket.group.name} + +From: #{ticket.articles[-1].from} + + +#{ticket.articles[-1].body} + + +#{config.http_type}://#{config.fqdn}/ticket/zoom/#{ticket.id}/#{ticket.articles[-1].id} +' + }, + ticket, + article + ) + end + end + } + + # reset buffer + @@event_buffer = [] + end + + def self.send_notify(data, ticket, article) + + # find recipients + recipients = [] + + # group of agents to work on + if data[:recipient] == 'group' + recipients = ticket.agent_of_group() + + # owner + elsif data[:recipient] == 'owner' + if ticket.owner_id != 1 + recipients.push ticket.owner + end + + # customer + elsif data[:recipient] == 'customer' + if ticket.customer_id != 1 + recipients.push ticket.customer + end + + # owner or group of agents to work on + elsif data[:recipient] == 'to_work_on' + if ticket.owner_id != 1 + recipients.push ticket.owner + else + recipients = ticket.agent_of_group() + end + end + + # prepare subject & body + [:subject, :body].each { |key| + data[key.to_sym].gsub!( /\#\{(.+?)\}/ ) { |s| + + # use quoted text + callback = $1 + callback.gsub!( /.body$/ ) { |item| + item = item + '.word_wrap( :line_width => 80 ).message_quote.chomp' + } + + # use config params + callback.gsub!( /^config.(.+?)$/ ) { |item| + name = $1 + item = "Setting.get('#{$1}')" + } + + # replace value + s = eval callback + } + } + + # rebuild subject + data[:subject] = ticket.subject_build( data[:subject] ) + + # send notifications + sender = Setting.get('notification_sender') + recipients.each do |user| + next if !user.email || user.email == '' + a = Channel::IMAP.new + subject = data[:subject] + body = data[:body] + message = a.send( + { + # :in_reply_to => self.in_reply_to, + :from => sender, + :to => user.email, + :subject => subject, + :body => body, + }, + Rails.application.config.channel_email, + true + ) + end + end + + def after_create(record) +# puts 'CREATED!!!!' +# puts record.inspect + e = { + :name => record.class.name, + :type => 'create', + :data => record, + :id => record.id, + } + @@event_buffer.push e + end + + def before_update(record) + puts 'before_update' + current = record.class.find(record.id) + + # do not send anything if nothing has changed + return if current.attributes == record.attributes + +# puts 'UPDATE!!!!!!!!' +# puts 'current' +# puts current.inspect +# puts 'record' +# puts record.inspect + + e = { + :name => record.class.name, + :type => 'update', + :data => record, + :id => record.id, + } + @@event_buffer.push e + end + + def after_update(record) +# puts 'after_update' +# puts record.inspect +# puts '-----' +# puts @a.inspect +# AuditTrail.new(record, "UPDATED") + end +end \ No newline at end of file diff --git a/app/models/time_accounting.rb b/app/models/time_accounting.rb new file mode 100644 index 000000000..6c0b8c27d --- /dev/null +++ b/app/models/time_accounting.rb @@ -0,0 +1,2 @@ +class TimeAccounting < ActiveRecord::Base +end diff --git a/app/models/trigger.rb b/app/models/trigger.rb new file mode 100644 index 000000000..9172928c9 --- /dev/null +++ b/app/models/trigger.rb @@ -0,0 +1,2 @@ +class Triggers < ActiveRecord::Base +end diff --git a/app/models/user.rb b/app/models/user.rb new file mode 100644 index 000000000..9a2f92d06 --- /dev/null +++ b/app/models/user.rb @@ -0,0 +1,73 @@ +class User < ActiveRecord::Base + before_create :check_name, :check_email, :check_image + has_and_belongs_to_many :groups + has_and_belongs_to_many :roles + has_and_belongs_to_many :organizations + belongs_to :organization, :class_name => 'Organization' + has_many :authorizations + + def self.authenticate(username, password) + user = User.where( :login => username, :active => true ).first + return nil if user.nil? + logger.debug 'auth' + logger.debug username + logger.debug user.login + logger.debug password + logger.debug user.password + logger.debug user.inspect +# return user + return user if user.password == password + return + end + + def self.create_from_hash!(hash) +# logger.debug(hash.inspect) +# raise hash.to_yaml +# exit + url = '' + if hash['info']['urls'] then + url = hash['info']['urls']['Website'] || hash['info']['urls']['Twitter'] || '' + end +# logger.debug(hash['info'].inspect) +# raise url.to_yaml +# exit +# logger.debug('aaaaaaaa') + roles = Role.where( :name => 'Customer' ) + create( + :login => hash['info']['nickname'] || hash['uid'], + :firstname => hash['info']['name'], + :email => hash['info']['email'], + :image => hash['info']['image'], +# :url => url.to_s, + :note => hash['info']['description'], + :source => hash['provider'], + :roles => roles, + :created_by_id => 1 + ) + + end + + + private + def check_name + if self.firstname && (!self.lastname || self.lastname == '') then + name = self.firstname.split(' ', 2) + self.firstname = name[0] + self.lastname = name[1] + end + end + def check_email + if self.email then + self.email = self.email.downcase + end + end + def check_image + require 'digest/md5' + if !self.image || self.image == '' then + if self.email then + hash = Digest::MD5.hexdigest(self.email) + self.image = "http://www.gravatar.com/avatar/#{hash}?s=48" + end + end + end +end diff --git a/app/views/init/index.html.erb b/app/views/init/index.html.erb new file mode 100644 index 000000000..9635a051b --- /dev/null +++ b/app/views/init/index.html.erb @@ -0,0 +1,20 @@ + +
    + +
    +
    +
    + +
    +
    + +

    Back to top

    +

    Designed and built with all the love in the world @xxx

    +
    +
    + + \ No newline at end of file diff --git a/app/views/layouts/application.html.erb b/app/views/layouts/application.html.erb index f0bc29964..ec8432c08 100644 --- a/app/views/layouts/application.html.erb +++ b/app/views/layouts/application.html.erb @@ -1,8 +1,8 @@ - Zammad - <%= stylesheet_link_tag "application", :media => "all" %> + ... + <%= stylesheet_link_tag "application" %> <%= javascript_include_tag "application" %> <%= csrf_meta_tags %> diff --git a/config/initializers/session_store.rb b/config/initializers/session_store.rb index 655191a30..64ed9fe58 100644 --- a/config/initializers/session_store.rb +++ b/config/initializers/session_store.rb @@ -1,8 +1,8 @@ # Be sure to restart your server when you modify this file. -Zammad::Application.config.session_store :cookie_store, :key => '_zammad_session' +#Zammad::Application.config.session_store :cookie_store, :key => '_zammad_session' # Use the database for sessions instead of the cookie-based default, # which shouldn't be used to store highly confidential information # (create the session table with "rails generate session_migration") -# Zammad::Application.config.session_store :active_record_store +Zammad::Application.config.session_store :active_record_store diff --git a/config/routes.rb b/config/routes.rb index 9099c4f90..745aec42d 100644 --- a/config/routes.rb +++ b/config/routes.rb @@ -1,4 +1,51 @@ Zammad::Application.routes.draw do + + # app init + match '/init', :to => 'init#index' + match '/app', :to => 'init#index' + + # omniauth + match '/auth/:provider/callback', :to => 'sessions#create_omniauth' + + # base objects + resources :settings, :only => [:create, :show, :index, :update] + resources :users, :only => [:create, :show, :index, :update] + resources :groups, :only => [:create, :show, :index, :update] + resources :roles, :only => [:create, :show, :index, :update] + resources :organizations, :only => [:create, :show, :index, :update] + + # overviews + resources :overviews + + # notes + resources :notes + + # tickets + resources :ticket_articles, :only => [:create, :show, :index, :update] + resources :ticket_priorities, :only => [:create, :show, :index, :update] + resources :ticket_states, :only => [:create, :show, :index, :update] + resources :tickets, :only => [:create, :show, :index, :update] + match '/ticket_full/:id', :to => 'ticket_overviews#ticket_full' + match '/ticket_attachment/:id', :to => 'ticket_overviews#ticket_attachment' + match '/ticket_attachment_new', :to => 'ticket_overviews#ticket_attachment_new' + match '/ticket_history/:id', :to => 'ticket_overviews#ticket_history' + match '/ticket_customer', :to => 'ticket_overviews#ticket_customer' + match '/ticket_overviews', :to => 'ticket_overviews#show' + match '/activity_stream', :to => 'ticket_overviews#activity_stream' + match '/recent_viewed', :to => 'ticket_overviews#recent_viewed' + match '/ticket_create', :to => 'ticket_overviews#ticket_create' + match '/user_search', :to => 'ticket_overviews#user_search' + + # networks + resources :networks, :only => [:create, :show, :index, :update, :destroy] + + # sessions + resources :sessions, :only => [:create, :destroy, :show] + match '/signin', :to => 'sessions#create' + match '/signshow', :to => 'sessions#show' + match '/signout', :to => 'sessions#destroy' + + # The priority is based upon order of creation: # first created -> highest priority. diff --git a/db/migrate/20120101000001_create_base.rb b/db/migrate/20120101000001_create_base.rb new file mode 100644 index 000000000..d524228fc --- /dev/null +++ b/db/migrate/20120101000001_create_base.rb @@ -0,0 +1,102 @@ +class CreateBase < ActiveRecord::Migration + def up + + create_table :sessions do |t| + t.string :session_id, :null => false + t.text :data + t.timestamps + end + add_index :sessions, :session_id + add_index :sessions, :updated_at + + create_table :users do |t| + t.references :organization, :null => true + t.column :login, :string, :limit => 100, :null => false + t.column :firstname, :string, :limit => 100, :null => true + t.column :lastname, :string, :limit => 100, :null => true + t.column :email, :string, :limit => 140, :null => true + t.column :image, :string, :limit => 200, :null => true + t.column :web, :string, :limit => 100, :null => true + t.column :password, :string, :limit => 100, :null => true + t.column :phone, :string, :limit => 100, :null => true + t.column :fax, :string, :limit => 100, :null => true + t.column :mobile, :string, :limit => 100, :null => true + t.column :street, :string, :limit => 120, :null => true + t.column :zip, :string, :limit => 100, :null => true + t.column :city, :string, :limit => 100, :null => true + t.column :country, :string, :limit => 100, :null => true + t.column :verified, :boolean, :null => false, :default => false + t.column :active, :boolean, :null => false, :default => true + t.column :note, :string, :limit => 250, :null => true + t.column :source, :string, :limit => 200, :null => true + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :users, [:login], :unique => true + add_index :users, [:email] +# add_index :users, [:email], :unique => true + add_index :users, [:phone] + add_index :users, [:fax] + add_index :users, [:mobile] + add_index :users, [:source] + add_index :users, [:created_by_id] + + create_table :groups do |t| + t.column :name, :string, :limit => 100, :null => false + t.column :active, :boolean, :null => false, :default => true + t.column :note, :string, :limit => 250, :null => true + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :groups, [:name], :unique => true + + create_table :roles do |t| + t.column :name, :string, :limit => 100, :null => false + t.column :active, :boolean, :null => false, :default => true + t.column :note, :string, :limit => 250, :null => true + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :roles, [:name], :unique => true + + create_table :organizations do |t| + t.column :name, :string, :limit => 100, :null => false + t.column :shared, :boolean, :null => false, :default => true + t.column :active, :boolean, :null => false, :default => true + t.column :note, :string, :limit => 250, :null => true + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :organizations, [:name], :unique => true + + create_table :roles_users, :id => false do |t| + t.integer :user_id + t.integer :role_id + end + + create_table :groups_users, :id => false do |t| + t.integer :user_id + t.integer :group_id + end + + create_table :organizations_users, :id => false do |t| + t.integer :user_id + t.integer :organization_id + end + + create_table :authorizations do |t| + t.string :provider, :limit => 250, :null => false + t.string :uid, :limit => 250, :null => false + t.string :token, :limit => 250, :null => true + t.string :secret, :limit => 250, :null => true + t.string :username, :limit => 250, :null => true + t.references :user, :null => false + t.timestamps + end + add_index :authorizations, [:uid, :provider] + add_index :authorizations, [:user_id] + add_index :authorizations, [:username] + + end +end + diff --git a/db/migrate/20120101000010_create_ticket.rb b/db/migrate/20120101000010_create_ticket.rb new file mode 100644 index 000000000..df565bc3e --- /dev/null +++ b/db/migrate/20120101000010_create_ticket.rb @@ -0,0 +1,252 @@ +class CreateTicket < ActiveRecord::Migration + def up + create_table :ticket_state_types do |t| + t.column :name, :string, :limit => 250, :null => false + t.column :note, :string, :limit => 250, :null => true + t.timestamps + end + add_index :ticket_state_types, [:name], :unique => true + + create_table :ticket_states do |t| + t.references :ticket_state_type, :null => false + t.column :name, :string, :limit => 250, :null => false + t.column :note, :string, :limit => 250, :null => true + t.column :active, :boolean, :null => false, :default => true + t.timestamps + end + add_index :ticket_states, [:name], :unique => true + + create_table :ticket_priorities do |t| + t.column :name, :string, :limit => 250, :null => false + t.column :note, :string, :limit => 250, :null => true + t.column :active, :boolean, :null => false, :default => true + t.timestamps + end + add_index :ticket_priorities, [:name], :unique => true + + create_table :tickets do |t| + t.references :group, :null => false + t.references :ticket_priority, :null => false + t.references :ticket_state, :null => false + t.column :number, :string, :limit => 60, :null => false + t.column :title, :string, :limit => 250, :null => false + t.column :owner_id, :integer, :null => false + t.column :customer_id, :integer, :null => false + t.column :note, :string, :limit => 250, :null => true + t.column :first_response, :timestamp, :null => true + t.column :last_contact, :timestamp, :null => true + t.column :last_contact_agent, :timestamp, :null => true + t.column :last_contact_customer, :timestamp, :null => true + t.column :close_time, :timestamp, :null => true + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :tickets, [:ticket_state_id] + add_index :tickets, [:ticket_priority_id] + add_index :tickets, [:group_id] + add_index :tickets, [:owner_id] + add_index :tickets, [:customer_id] + add_index :tickets, [:number], :unique => true + add_index :tickets, [:title] + add_index :tickets, [:created_at] + add_index :tickets, [:first_response] + add_index :tickets, [:last_contact] + add_index :tickets, [:last_contact_agent] + add_index :tickets, [:last_contact_customer] + add_index :tickets, [:close_time] + add_index :tickets, [:created_by_id] + + create_table :ticket_flags do |t| + t.references :tickets, :null => false + t.column :key, :string, :limit => 50, :null => false + t.column :value, :string, :limit => 50, :null => true + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :ticket_flags, [:tickets_id, :created_by_id] + add_index :ticket_flags, [:tickets_id, :key] + add_index :ticket_flags, [:tickets_id] + add_index :ticket_flags, [:created_by_id] + + create_table :ticket_time_accounting do |t| + t.references :tickets, :null => false + t.references :ticket_articles, :null => true + t.column :time_unit, :decimal, :precision => 6, :scale => 2, :null => false + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :ticket_time_accounting, [:tickets_id] + add_index :ticket_time_accounting, [:ticket_articles_id] + add_index :ticket_time_accounting, [:created_by_id] + + create_table :ticket_article_types do |t| + t.column :name, :string, :limit => 250, :null => false + t.column :note, :string, :limit => 250, :null => true + t.column :communication, :boolean, :null => false + t.column :active, :boolean, :null => false, :default => true + t.timestamps + end + add_index :ticket_article_types, [:name], :unique => true + + create_table :ticket_article_senders do |t| + t.column :name, :string, :limit => 250, :null => false + t.column :note, :string, :limit => 250, :null => true + t.timestamps + end + add_index :ticket_article_senders, [:name], :unique => true + + create_table :ticket_articles do |t| + t.references :ticket, :null => false + t.references :ticket_article_type, :null => false + t.references :ticket_article_sender, :null => false + t.column :from, :string, :limit => 3800, :null => true + t.column :to, :string, :limit => 3800, :null => true + t.column :cc, :string, :limit => 3800, :null => true + t.column :subject, :string, :limit => 3800, :null => true + t.column :message_id, :string, :limit => 3800, :null => true + t.column :message_id_md5, :string, :limit => 32, :null => true + t.column :in_reply_to, :string, :limit => 3800, :null => true + t.column :references, :string, :limit => 3800, :null => true + t.column :body, :string, :limit => 1800000, :null => true + t.column :internal, :boolean, :null => false, :default => false + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :ticket_articles, [:ticket_id] + add_index :ticket_articles, [:message_id_md5] + add_index :ticket_articles, [:message_id_md5, :ticket_article_type_id], :name => 'index_ticket_articles_message_id_md5_type_id' + add_index :ticket_articles, [:created_by_id] + add_index :ticket_articles, [:internal] + add_index :ticket_articles, [:ticket_article_type_id] + add_index :ticket_articles, [:ticket_article_sender_id] + + create_table :ticket_article_flags do |t| + t.references :ticket_articles, :null => false + t.column :key, :string, :limit => 50, :null => false + t.column :value, :string, :limit => 50, :null => true + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :ticket_article_flags, [:ticket_articles_id, :created_by_id], :name => 'index_ticket_article_flags_on_articles_id_and_created_by_id' + add_index :ticket_article_flags, [:ticket_articles_id, :key] + add_index :ticket_article_flags, [:ticket_articles_id] + add_index :ticket_article_flags, [:created_by_id] + + create_table :overviews do |t| + t.references :user, :null => true + t.column :name, :string, :limit => 250, :null => false + t.column :meta, :string, :limit => 1000, :null => false + t.column :condition, :string, :limit => 2500, :null => false + t.column :order, :string, :limit => 2500, :null => false + t.column :view, :string, :limit => 1000, :null => false + t.timestamps + end + add_index :overviews, [:user_id] + add_index :overviews, [:name] + + create_table :overviews_groups, :id => false do |t| + t.integer :overview_id + t.integer :group_id + end + add_index :overviews_groups, [:overview_id] + add_index :overviews_groups, [:group_id] + + create_table :account_inbounds do |t| + t.references :group, :null => true + t.column :login, :string, :limit => 250, :null => false + t.column :password, :string, :limit => 250, :null => false + t.column :host, :string, :limit => 250, :null => false + t.column :account_type, :string, :limit => 20, :null => false + t.column :trusted, :boolean, :null => false, :default => false + t.column :active, :boolean, :null => false, :default => true + t.column :note, :string, :limit => 250, :null => true + t.timestamps + end + + create_table :account_outbounds do |t| + t.column :realname, :string, :limit => 250, :null => false + t.column :address, :string, :limit => 250, :null => false + t.column :account_type, :string, :limit => 20, :null => false + t.column :login, :string, :limit => 250, :null => true + t.column :password, :string, :limit => 250, :null => true + t.column :host, :string, :limit => 250, :null => true + t.column :active, :boolean, :null => false, :default => true + t.column :note, :string, :limit => 250, :null => true + t.timestamps + end + + create_table :account_inbound_filters do |t| + t.column :name, :string, :limit => 250, :null => false + t.column :key, :string, :limit => 250, :null => false + t.column :value, :string, :limit => 250, :null => false + end + add_index :account_inbound_filters, [:name] + + create_table :triggers do |t| + t.column :name, :string, :limit => 250, :null => false + t.column :key, :string, :limit => 250, :null => false + t.column :value, :string, :limit => 250, :null => false + end + add_index :triggers, [:name] + add_index :triggers, [:key] + add_index :triggers, [:value] + + create_table :notifications do |t| + t.references :account_outbounds, :null => false + t.column :subject, :string, :limit => 250, :null => false + t.column :body, :string, :limit => 8000, :null => false + t.column :content_type, :string, :limit => 250, :null => false + t.column :active, :boolean, :null => false, :default => true + t.column :note, :string, :limit => 250, :null => true + t.timestamps + end + + create_table :link_types do |t| + t.column :name, :string, :limit => 250, :null => false + t.column :note, :string, :limit => 250, :null => true + t.column :active, :boolean, :null => false, :default => true + t.timestamps + end + add_index :link_types, [:name], :unique => true + + create_table :link_objects do |t| + t.column :name, :string, :limit => 250, :null => false + t.column :note, :string, :limit => 250, :null => true + t.column :active, :boolean, :null => false, :default => true + t.timestamps + end + add_index :link_objects, [:name], :unique => true + + create_table :links do |t| + t.references :link_types, :null => false + t.column :source_object_id, :integer, :null => false + t.column :source_key, :string, :limit => 50, :null => false + t.column :target_object_id, :integer, :null => false + t.column :target_key, :string, :limit => 50, :null => false + t.timestamps + end + add_index :links, [:source_object_id, :source_key, :target_object_id, :target_key, :link_types_id], :unique => true, :name => 'links_uniq_total' + end + + def self.down + drop_table :notifications + drop_table :triggers + drop_table :links + drop_table :link_types + drop_table :link_objects + drop_table :overviews + drop_table :ticket_time_accounting + drop_table :ticket_article_flags + drop_table :ticket_articles + drop_table :ticket_article_types + drop_table :ticket_article_senders + drop_table :ticket_flags + drop_table :tickets + drop_table :ticket_priorities + drop_table :ticket_states + drop_table :ticket_state_types + drop_table :account_inbounds + drop_table :account_inbound_filters + drop_table :account_outbounds + end +end diff --git a/db/migrate/20120101000020_create_network.rb b/db/migrate/20120101000020_create_network.rb new file mode 100644 index 000000000..6f8b1b2b4 --- /dev/null +++ b/db/migrate/20120101000020_create_network.rb @@ -0,0 +1,98 @@ +class CreateNetwork < ActiveRecord::Migration + def up + create_table :networks do |t| + t.column :name, :string, :limit => 100, :null => false + t.column :note, :string, :limit => 250, :null => true + t.column :active, :boolean, :null => false, :default => true + t.timestamps + end + add_index :networks, [:name], :unique => true + + create_table :network_category_types do |t| + t.column :name, :string, :limit => 100, :null => false + t.column :note, :string, :limit => 250, :null => true + t.column :active, :boolean, :null => false, :default => true + t.timestamps + end + add_index :network_category_types, [:name], :unique => true + + create_table :network_privacies do |t| + t.column :name, :string, :limit => 100, :null => false + t.column :key, :string, :limit => 250, :null => false + t.timestamps + end + add_index :network_privacies, [:name], :unique => true + + create_table :network_categories do |t| + t.references :network_category_type, :null => false + t.references :network_privacy, :null => false + t.references :network, :null => false + t.column :name, :string, :limit => 200, :null => false + t.column :note, :string, :limit => 250, :null => true + t.column :allow_comments, :boolean, :null => false, :default => true + t.column :active, :boolean, :null => false, :default => true + t.timestamps + end + add_index :network_categories, [:network_id] + + create_table :network_categories_moderator_users, :id => false do |t| + t.integer :user_id + t.integer :network_category_id + end + + create_table :network_items do |t| + t.references :network_category, :null => false + t.column :title, :string, :limit => 200, :null => false + t.column :body, :string, :limit => 25000, :null => false + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :network_items, [:network_category_id] + + create_table :network_item_comments do |t| + t.references :network_item, :null => false + t.column :body, :string, :limit => 25000, :null => false + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :network_item_comments, [:network_item_id] + + + create_table :network_item_plus do |t| + t.references :network_item, :null => false + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :network_item_plus, [:network_item_id, :created_by_id], :unique => true + + create_table :network_category_subscriptions do |t| + t.references :network_categories, :null => false + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :network_category_subscriptions, [:network_categories_id, :created_by_id], :unique => true, :name => 'index_network_category_subscriptions_on_network_categories_i_and_c' + + + create_table :network_item_subscriptions do |t| + t.references :network_item, :null => false + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :network_item_subscriptions, [:network_item_id, :created_by_id], :unique => true, :name => 'index_network_item_subscriptions_on_item_id_and_created_by_id' + + + end + + def down + drop_table :network_item_subscriptions + drop_table :network_category_subscriptions + drop_table :network_categories_moderator_users + drop_table :network_item_plus + drop_table :network_item_comments + drop_table :network_items + drop_table :network_categories + drop_table :network_privacies + drop_table :network_category_types + drop_table :networks + end +end diff --git a/db/migrate/20120101000030_create_storage.rb b/db/migrate/20120101000030_create_storage.rb new file mode 100644 index 000000000..218b915f6 --- /dev/null +++ b/db/migrate/20120101000030_create_storage.rb @@ -0,0 +1,36 @@ +class CreateStorage < ActiveRecord::Migration + def up + create_table :stores do |t| + t.references :store_object, :null => false + t.references :store_file, :null => false + t.column :o_id, :integer, :null => false + t.column :preferences, :string, :limit => 2500, :null => true + t.column :size, :string, :limit => 50, :null => true + t.column :filename, :string, :limit => 250, :null => false + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :stores, [:store_object_id, :o_id] + + create_table :store_objects do |t| + t.column :name, :string, :limit => 250, :null => false + t.column :note, :string, :limit => 250, :null => true + t.timestamps + end + add_index :store_objects, [:name], :unique => true + + create_table :store_files do |t| + t.column :data, :binary + t.column :md5, :string, :limit => 60, :null => false + t.timestamps + end + add_index :store_files, [:md5], :unique => true + + end + + def down + drop_table :stores + drop_table :store_objects + drop_table :store_files + end +end diff --git a/db/migrate/20120101000040_create_delayed_jobs.rb b/db/migrate/20120101000040_create_delayed_jobs.rb new file mode 100644 index 000000000..e7841608c --- /dev/null +++ b/db/migrate/20120101000040_create_delayed_jobs.rb @@ -0,0 +1,22 @@ +class CreateDelayedJobs < ActiveRecord::Migration + def self.up + create_table :delayed_jobs, :force => true do |table| + table.integer :priority, :default => 0 # Allows some jobs to jump to the front of the queue + table.integer :attempts, :default => 0 # Provides for retries, but still fail eventually. + table.text :handler # YAML-encoded string of the object that will do work + table.text :last_error # reason for last failure (See Note below) + table.datetime :run_at # When to run. Could be Time.zone.now for immediately, or sometime in the future. + table.datetime :locked_at # Set when a client is working on this object + table.datetime :failed_at # Set when all retries have failed (actually, by default, the record is deleted instead) + table.string :locked_by # Who is working on this object (if locked) + table.string :queue # The name of the queue this job is in + table.timestamps + end + + add_index :delayed_jobs, [:priority, :run_at], :name => 'delayed_jobs_priority' + end + + def self.down + drop_table :delayed_jobs + end +end diff --git a/db/migrate/20120101000050_create_history.rb b/db/migrate/20120101000050_create_history.rb new file mode 100644 index 000000000..6e96b7727 --- /dev/null +++ b/db/migrate/20120101000050_create_history.rb @@ -0,0 +1,45 @@ +class CreateHistory < ActiveRecord::Migration + def up + + create_table :histories do |t| + t.references :history_type, :null => false + t.references :history_object, :null => false + t.references :history_attribute, :null => true + t.column :o_id, :integer, :null => false + t.column :id_to, :integer, :null => true + t.column :id_from, :integer, :null => true + t.column :value_from, :string, :limit => 250, :null => true + t.column :value_to, :string, :limit => 250, :null => true + t.column :created_by_id, :integer, :null => false + t.timestamps + end + add_index :histories, [:o_id] + add_index :histories, [:created_by_id] + + create_table :history_types do |t| + t.column :name, :string, :limit => 250, :null => false + t.timestamps + end + add_index :history_types, [:name], :unique => true + + create_table :history_objects do |t| + t.column :name, :string, :limit => 250, :null => false + t.column :note, :string, :limit => 250, :null => true + t.timestamps + end + add_index :history_objects, [:name], :unique => true + + create_table :history_attributes do |t| + t.column :name, :string, :limit => 250, :null => false + t.timestamps + end + add_index :history_attributes, [:name], :unique => true + end + + def down + drop_table :histories + drop_table :history_attributes + drop_table :history_objects + drop_table :history_types + end +end diff --git a/db/migrate/20120101000060_create_setting.rb b/db/migrate/20120101000060_create_setting.rb new file mode 100644 index 000000000..313e64b12 --- /dev/null +++ b/db/migrate/20120101000060_create_setting.rb @@ -0,0 +1,22 @@ +class CreateSetting < ActiveRecord::Migration + def up + create_table :settings do |t| + t.column :title, :string, :limit => 200, :null => false + t.column :name, :string, :limit => 200, :null => false + t.column :area, :string, :limit => 100, :null => false + t.column :description, :string, :limit => 2000, :null => false + t.column :options, :string, :limit => 2000, :null => true + t.column :state, :string, :limit => 2000, :null => true + t.column :state_initial, :string, :limit => 2000, :null => true + t.column :frontend, :boolean, :null => false + t.timestamps + end + add_index :settings, [:name], :unique => true + add_index :settings, [:area] + add_index :settings, [:frontend] + end + + def down + drop_table :settings + end +end diff --git a/db/seeds.rb b/db/seeds.rb index d34dfa024..dfc5244f2 100644 --- a/db/seeds.rb +++ b/db/seeds.rb @@ -5,3 +5,1157 @@ # # cities = City.create([{ :name => 'Chicago' }, { :name => 'Copenhagen' }]) # Mayor.create(:name => 'Emanuel', :city => cities.first) +Setting.create( + :title => 'Product Name', + :name => 'product_name', + :area => 'System::Base', + :description => 'Defines the name of the application, shown in the web interface, tabs and title bar of the web browser.', + :options => { + :form => [ + { + :display => '', + :null => false, + :name => 'product_name', + :tag => 'input', + }, + ], + }, + :state => { + :value => 'Zammad', + }, + :frontend => true +) + +Setting.create( + :title => 'Organization', + :name => 'organization', + :area => 'System::Base', + :description => 'Will also be included in emails as an X-Header.', + :options => { + :form => [ + { + :display => '', + :null => false, + :name => 'organization', + :tag => 'input', + }, + ], + }, + :state => { + :value => 'Example Inc.', + }, + :frontend => true +) + +Setting.create( + :title => 'SystemID', + :name => 'system_id', + :area => 'System::Base', + :description => 'Defines the system identifier. Every ticket number contains this ID. This ensures that only tickets which belong to your system will be processed as follow-ups (useful when communicating between two instances of Zammad).', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'system_id', + :tag => 'select', + :options => { + '10' => '10', + '11' => '11', + '12' => '12', + '13' => '13', + }, + }, + ], + }, + :state => { + :value => '10', + }, + :frontend => true +) +Setting.create( + :title => 'Fully Qualified Domain Name', + :name => 'fqdn', + :area => 'System::Base', + :description => 'Defines the fully qualified domain name of the system. This setting is used as a variable, #{setting.fqdn} which is found in all forms of messaging used by the application, to build links to the tickets within your system.', + :options => { + :form => [ + { + :display => '', + :null => false, + :name => 'fqdn', + :tag => 'input', + }, + ], + }, + :state => { + :value => 'zammad.example.com', + }, + :frontend => true +) +Setting.create( + :title => 'http type', + :name => 'http_type', + :area => 'System::Base', + :description => 'Defines the type of protocol, used by ther web server, to serve the application. If https protocol will be used instead of plain http, it must be specified it here. Since this has no affect on the web server\'s settings or behavior, it will not change the method of access to the application and, if it is wrong, it will not prevent you from logging into the application. This setting is used as a variable, #{setting.http_type} which is found in all forms of messaging used by the application, to build links to the tickets within your system.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'storage', + :tag => 'select', + :options => { + 'https' => 'https', + 'http' => 'http', + }, + }, + ], + }, + :state => { + :value => 'http', + }, + :frontend => true +) + + + +Setting.create( + :title => 'Storage Mechanism', + :name => 'storage', + :area => 'System::Storage', + :description => '"Database" stores all attachments in the database (not recommended for storing big). "Filesystem" stores the data on the filesystem; this is faster but the webserver should run under the Zammad user. You can switch between the modules even on a system that is already in production without any loss of data.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'storage', + :tag => 'select', + :options => { + 'DB' => 'Database', + 'FS' => 'Filesystem', + }, + }, + ], + }, + :state => { + :value => 'DB', + }, + :frontend => false +) + + +Setting.create( + :title => 'New User Accouts', + :name => 'user_create_account', + :area => 'Security::Authentication', + :description => 'Enables users to create their own account via web interface.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'user_create_account', + :tag => 'select', + :options => { + 1 => 'yes', + 0 => 'no', + }, + }, + ], + }, + :state => { + :value => 1, + }, + :frontend => true +) +Setting.create( + :title => 'Lost Password', + :name => 'user_lost_password', + :area => 'Security::Authentication', + :description => 'Activates lost password feature for agents, in the agent interface.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'user_lost_password', + :tag => 'select', + :options => { + 1 => 'yes', + 0 => 'no', + }, + }, + ], + }, + :state => { + :value => 1, + }, + :frontend => true +) +Setting.create( + :title => 'Switch to User', + :name => 'switch_to_user', + :area => 'Security::Authentication', + :description => 'Allows the administrators to login as other users, via the users administration panel.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'switch_to_user', + :tag => 'select', + :options => { + 1 => 'yes', + 0 => 'no', + }, + }, + ], + }, + :state => { + :value => 0, + }, + :frontend => true +) +Setting.create( + :title => 'Autentication via Database', + :name => 'auth_db', + :area => 'Security::Authentication', + :description => 'Enables user authentication via database.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'auth_db', + :tag => 'select', + :options => { + 1 => 'yes', + 0 => 'no', + }, + }, + ], + }, + :state => { + :value => 1, + }, + :frontend => true +) +Setting.create( + :title => 'Autentication via Twitter', + :name => 'auth_twitter', + :area => 'Security::Authentication', + :description => 'Enables user authentication via twitter.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'auth_twitter', + :tag => 'select', + :options => { + 1 => 'yes', + 0 => 'no', + }, + }, + ], + }, + :state => { + :value => 1, + }, + :frontend => true +) +Setting.create( + :title => 'Autentication via Facebook', + :name => 'auth_facebook', + :area => 'Security::Authentication', + :description => 'Enables user authentication via Facebook.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'auth_facebook', + :tag => 'select', + :options => { + 1 => 'yes', + 0 => 'no', + }, + }, + ], + }, + :state => { + :value => 1, + }, + :frontend => true +) +Setting.create( + :title => 'Autentication via LinkedIn', + :name => 'auth_linkedin', + :area => 'Security::Authentication', + :description => 'Enables user authentication via LinkedIn.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'auth_linkedin', + :tag => 'select', + :options => { + 1 => 'yes', + 0 => 'no', + }, + }, + ], + }, + :state => { + :value => 1, + }, + :frontend => true +) +Setting.create( + :title => 'Minimal size', + :name => 'password_min_size', + :area => 'Security::Password', + :description => 'Password need to have at least minimal size of characters.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'password_min_size', + :tag => 'select', + :options => { + 4 => 4, + 5 => 5, + 6 => 6, + 7 => 7, + 8 => 8, + 9 => 9, + 10 => 10, + 11 => 11, + 12 => 12, + }, + }, + ], + }, + :state => { + :value => 6, + }, + :frontend => true +) +Setting.create( + :title => '2 lower and 2 upper characters', + :name => 'password_min_2_lower_2_upper_characters', + :area => 'Security::Password', + :description => 'Password need to contain 2 lower and 2 upper characters.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'password_min_2_lower_2_upper_characters', + :tag => 'select', + :options => { + 1 => 'yes', + 0 => 'no', + }, + }, + ], + }, + :state => { + :value => 0, + }, + :frontend => true +) +Setting.create( + :title => 'Digit required', + :name => 'password_need_digit', + :area => 'Security::Password', + :description => 'Password need to have at least one digit.', + :options => { + :form => [ + { + :display => 'Needed', + :null => true, + :name => 'password_need_digit', + :tag => 'select', + :options => { + 1 => 'yes', + 0 => 'no', + }, + }, + ], + }, + :state => { + :value => 0, + }, + :frontend => true +) +Setting.create( + :title => 'Maximal failed logins', + :name => 'password_max_login_failed', + :area => 'Security::Password', + :description => 'Maximal faild logins after account is inactive.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'password_max_login_failed', + :tag => 'select', + :options => { + 4 => 4, + 5 => 5, + 6 => 6, + 7 => 7, + 8 => 8, + 9 => 9, + 10 => 10, + 11 => 11, + 12 => 12, + }, + }, + ], + }, + :state => { + :value => 6, + }, + :frontend => true +) + +Setting.create( + :title => 'Ticket Hook', + :name => 'ticket_hook', + :area => 'Ticket::Base', + :description => 'The identifier for a ticket, e.g. Ticket#, Call#, MyTicket#. The default is Ticket#.', + :options => { + :form => [ + { + :display => '', + :null => false, + :name => 'ticket_hook', + :tag => 'input', + }, + ], + }, + :state => { + :value => 'Ticket#', + }, + :frontend => true +) +Setting.create( + :title => 'Ticket Hook Divider', + :name => 'ticket_hook_divider', + :area => 'Ticket::Base::Shadow', + :description => 'The divider between TicketHook and ticket number. E.g \': \'.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'ticket_hook_divider', + :tag => 'input', + }, + ], + }, + :state => { + :value => '', + }, + :frontend => false +) +Setting.create( + :title => 'Ticket Hook Position', + :name => 'ticket_hook_position', + :area => 'Ticket::Base', + :description => 'The format of the subject. "Left" means "[Ticket#12345] Some Subject", "Right" means "Some Subject [Ticket#12345]", "None" means "Some Subject" and no ticket number. In the last case you should enable PostmasterFollowupSearchInRaw or PostmasterFollowUpSearchInReferences to recognize followups based on email headers and/or body.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'ticket_hook_position', + :tag => 'select', + :options => { + 'left' => 'Left', + 'right' => 'Right', + 'none' => 'None', + }, + }, + ], + }, + :state => { + :value => 'right', + }, + :frontend => false +) +Setting.create( + :title => 'Ticket Subject Size', + :name => 'ticket_subject_size', + :area => 'Ticket::Base', + :description => 'Max size of the subjects in an email reply.', + :options => { + :form => [ + { + :display => '', + :null => false, + :name => 'ticket_subject_size', + :tag => 'input', + }, + ], + }, + :state => { + :value => '50', + }, + :frontend => false +) +Setting.create( + :title => 'Ticket Subject Reply', + :name => 'ticket_subject_re', + :area => 'Ticket::Base', + :description => 'The text at the beginning of the subject in an email reply, e.g. RE, AW, or AS.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'ticket_subject_re', + :tag => 'input', + }, + ], + }, + :state => { + :value => 'RE', + }, + :frontend => false +) +#Setting.create( +# :title => 'Ticket Subject Forward', +# :name => 'ticket_subject_fw', +# :area => 'Ticket::Base', +# :description => 'The text at the beginning of the subject when an email is forwarded, e.g. FW, Fwd, or WG.', +# :state => { +# :value => 'FW', +# }, +# :frontend => false +#) + +Setting.create( + :title => 'Ticket Number Format', + :name => 'ticket_number', + :area => 'Ticket::Number', + :description => 'Selects the ticket number generator module. "Increment" increments the ticket + number, the SystemID and the counter are used with SystemID.Counter format (e.g. 1010138, 1010139). + With "Date" the ticket numbers will be generated by the current date, the SystemID and the counter. + The format looks like Year.Month.Day.SystemID.counter (e.g. 201206231010138, 201206231010139). + With param "Checksum => true" the counter will be appended as checksum to the string. The format + looks like SystemID.Counter.CheckSum (e. g. 10101384, 10101392) or Year.Month.Day.SystemID.Counter.CheckSum (e.g. 2012070110101520, 2012070110101535).', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'ticket_number', + :tag => 'select', + :options => { + 'Increment' => 'Increment', + 'Date' => 'Date', + }, + }, + ], + }, + :state => { + :value => 'Increment', + }, + :frontend => false +) +Setting.create( + :title => 'Ticket Number Increment', + :name => 'ticket_number_increment', + :area => 'Ticket::Number', + :description => '-', + :options => { + :form => [ + { + :display => 'Checksum', + :null => true, + :name => 'checksum', + :tag => 'select', + :options => { + true => 'yes', + false => 'no', + }, + }, + { + :display => 'Min. size of number', + :null => true, + :name => 'min_size', + :tag => 'select', + :options => { + 1 => 1, + 2 => 2, + 3 => 3, + 4 => 4, + 5 => 5, + 6 => 6, + 7 => 7, + 8 => 8, + 9 => 9, + 10 => 10, + 11 => 11, + 12 => 12, + 13 => 13, + 14 => 14, + 15 => 15, + 16 => 16, + 17 => 17, + 18 => 18, + 19 => 19, + 20 => 20, + }, + }, + { + :display => 'Logfile', + :null => false, + :name => 'file', + :tag => 'input', + }, + ], + }, + :state => { + :value => { + :checksum => false, + :file => '/tmp/counter.log', + :min_size => 4, + }, + }, + :frontend => false +) +Setting.create( + :title => 'Ticket Number Increment Date', + :name => 'ticket_number_date', + :area => 'Ticket::Number', + :description => '-', + :options => { + :form => [ + { + :display => 'Checksum', + :null => true, + :name => 'checksum', + :tag => 'select', + :options => { + true => 'yes', + false => 'no', + }, + }, + { + :display => 'Logfile', + :null => false, + :name => 'file', + :tag => 'input', + }, + ], + }, + :state => { + :value => { + :checksum => false, + :file => '/tmp/counter.log', + } + }, + :frontend => false +) + +Setting.create( + :title => 'Sender Format', + :name => 'ticket_define_email_from', + :area => 'Ticket::SenderFormat', + :description => 'Defines how the From field from the emails (sent from answers and email tickets) should look like.', + :options => { + :form => [ + { + :display => '', + :null => true, + :name => 'ticket_define_email_from', + :tag => 'select', + :options => { + :SystemAddressName => 'System Address Display Name', + :AgentNameSystemAddressName => 'Agent Name + FromSeparator + System Address Display Name', + }, + }, + ], + }, + :state => { + :value => 'SystemAddressName', + }, + :frontend => false +) + +Setting.create( + :title => 'Sender Format Seperator', + :name => 'ticket_define_email_from_seperator', + :area => 'Ticket::SenderFormat', + :description => 'Defines the separator between the agents real name and the given queue email address.', + :options => { + :form => [ + { + :display => '', + :null => false, + :name => 'ticket_define_email_from_seperator', + :tag => 'input', + }, + ], + }, + :state => { + :value => 'via', + }, + :frontend => false +) + +Setting.create( + :title => 'Notification Sender', + :name => 'notification_sender', + :area => 'Ticket::Notification', + :description => 'Defines the sender of email notifications.', + :options => { + :form => [ + { + :display => '', + :null => false, + :name => 'notification_sender', + :tag => 'input', + }, + ], + }, + :state => { + :value => 'Notify ', + }, + :frontend => false +) + +Role.create( + :id => 1, + :name => 'Admin', + :note => 'To configure your system.', + :created_by_id => 1 +) +Role.create( + :id => 2, + :name => 'Agent', + :note => 'To work on Tickets.', + :created_by_id => 1 +) +Role.create( + :id => 3, + :name => 'Customer', + :note => 'People who create Tickets ask for help.', + :created_by_id => 1 +) + +Group.create( + :id => 1, + :name => 'Users', + :note => 'Standard Group/Pool for Tickets.', + :created_by_id => 1 +) +Group.create( + :id => 2, + :name => 'Twitter', + :note => 'All Tweets.', + :created_by_id => 1 +) + +roles = Role.where( :name => 'Customer' ) +organizations = Organization.find( :all ) +groups = Group.find( :all ) + +user = User.create( + :login => '-', + :firstname => '-', + :lastname => '', + :email => '', + :password => 'root', + :active => false, + :roles => roles, + :groups => groups, + :organizations => organizations, + :created_by_id => 1 +) + +Link::Type.create( :name => 'normal' ) +Link::Object.create( :name => 'Ticket' ) +Link::Object.create( :name => 'Announcement' ) +Link::Object.create( :name => 'Question/Answer' ) +Link::Object.create( :name => 'Idea' ) +Link::Object.create( :name => 'Bug' ) + +Ticket::StateType.create( :name => 'new' ) +Ticket::StateType.create( :name => 'open' ) +Ticket::StateType.create( :name => 'pending reminder' ) +Ticket::StateType.create( :name => 'pending action' ) +Ticket::StateType.create( :name => 'closed' ) + +Ticket::State.create( :name => 'new', :ticket_state_type_id => Ticket::StateType.where(:name => 'new').first.id ) +Ticket::State.create( :name => 'open', :ticket_state_type_id => Ticket::StateType.where(:name => 'open').first.id ) +Ticket::State.create( :name => 'pending', :ticket_state_type_id => Ticket::StateType.where(:name => 'pending reminder').first.id ) +Ticket::State.create( :name => 'closed', :ticket_state_type_id => Ticket::StateType.where(:name => 'closed').first.id ) + +Ticket::Priority.create( :name => '1 low' ) +Ticket::Priority.create( :name => '2 normal' ) +Ticket::Priority.create( :name => '3 high' ) + +Ticket::Article::Type.create( :name => 'email', :communication => true ) +Ticket::Article::Type.create( :name => 'sms', :communication => true ) +Ticket::Article::Type.create( :name => 'chat', :communication => true ) +Ticket::Article::Type.create( :name => 'fax', :communication => true ) +Ticket::Article::Type.create( :name => 'phone', :communication => true ) +Ticket::Article::Type.create( :name => 'twitter status', :communication => true ) +Ticket::Article::Type.create( :name => 'twitter direct-message', :communication => true ) +Ticket::Article::Type.create( :name => 'facebook', :communication => true ) +Ticket::Article::Type.create( :name => 'note', :communication => false ) + +Ticket::Article::Sender.create( :name => 'Agent' ) +Ticket::Article::Sender.create( :name => 'Customer' ) +Ticket::Article::Sender.create( :name => 'System' ) + +for i in (1..10) + next + ticket = Ticket.create( +# :number => '1314' + i.to_s, + :group_id => Group.where(:name => 'Users' ).first.id, + :customer_id => User.where(:login => '-').first.id, + :title => 'printer isn\'t working...', + :ticket_state_id => Ticket::State.where(:name => 'new').first.id, + :ticket_priority_id => Ticket::Priority.where(:name => '2 normal').first.id, + :created_by_id => User.where(:login => '-').first.id + ) + Ticket::Article.create( + :created_by_id => User.where(:login => '-').first.id, + :ticket_id => ticket.id, + :ticket_article_type_id => Ticket::Article::Type.where(:name => 'email').first.id, + :ticket_article_sender_id => Ticket::Article::Sender.where(:name => 'Agent').first.id, + :body => 'Lorem ipsum dolor sit amet, consectetur adipisici elit, sed eiusmod tempor incidunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquid ex ea commodi consequat. Quis aute iure reprehenderit in voluptate velit esse cillum dolore eu fugiat nulla pariatur. Excepteur sint obcaecat cupiditat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum. Lorem ipsum dolor sit amet, consectetur adipisici elit, sed eiusmod tempor incidunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquid ex ea commodi consequat. Quis aute iure reprehenderit in voluptate velit esse cillum dolore eu fugiat nulla pariatur. Excepteur sint obcaecat cupiditat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum.', + :from => 'Some Agent ', + :internal => false + ) + Ticket::Article.create( + :created_by_id => User.where(:login => '-').first.id, + :ticket_id => ticket.id, + :ticket_article_type_id => Ticket::Article::Type.where(:name => 'email').first.id, + :ticket_article_sender_id => Ticket::Article::Sender.where(:name => 'Customer').first.id, + :body => 'Nam liber tempor cum soluta nobis eleifend option congue nihil imperdiet doming id quod mazim placerat facer possim assum. Lorem ipsum dolor sit amet, consectetuer adipiscing elit, sed diam nonummy nibh euismod tincidunt ut laoreet dolore magna aliquam erat volutpat. Ut wisi enim ad minim veniam, quis nostrud exerci tation ullamcorper suscipit lobortis nisl ut aliquip ex ea commodo consequat. Nam liber tempor cum soluta nobis eleifend option congue nihil imperdiet doming id quod mazim placerat facer possim assum. Lorem ipsum dolor sit amet, consectetuer adipiscing elit, sed diam nonummy nibh euismod tincidunt ut laoreet dolore magna aliquam erat volutpat. Ut wisi enim ad minim veniam, quis nostrud exerci tation ullamcorper suscipit lobortis nisl ut aliquip ex ea commodo consequat.', + :from => 'Some Customer ', + :internal => false + ) +end + +#Ticket.create( +# :number => '1315', +# :group_id => Group.where(:name => 'Users' ).first.id, +# :customer_id => User.where(:login => '-').first.id, +# :title => 'iphone isn\'t working...', +# :ticket_state_id => Ticket::State.where(:name => 'new').first.id, +# :ticket_priority_id => Ticket::Priority.where(:name => '2 normal').first.id, +# :created_by_id => User.where(:login => '-').first.id +#) + +#Ticket.create( +# :number => '1316', +# :group_id => Group.where(:name => 'Users' ).first.id, +# :customer_id => User.where(:login => '-').first.id, +# :title => 'android isn\'t working...', +# :ticket_state_id => Ticket::State.where(:name => 'new').first.id, +# :ticket_priority_id => Ticket::Priority.where(:name => '2 normal').first.id, +# :created_by_id => User.where(:login => '-').first.id +#) + +Overview.create( + :name => 'my_assigned', + :condition => { + :ticket_state_id => [ 1,2,3 ], + :owner_id => 'current_user.id', + }, + :order => { + :by => 'created_at', + :direction => 'ASC', + }, + :meta => { + :url => 'my_assigned', + :name => 'My assigned Tickets', + :prio => 1000, + }, + :view => { + :d => { + :overview => [ + 'title', 'customer', 'ticket_state', 'group', 'created_at' + ], + :per_page => 5, + }, + :s => { + :overview => [ + 'number', 'title', 'customer', 'ticket_state', 'ticket_priority', 'group', 'created_at' + ], + :per_page => 30, + }, + :m => { + :overview => [ + 'number', 'title', 'customer', 'ticket_state', 'ticket_priority', 'group', 'created_at' + ], + :per_page => 20, + }, + :view_mode_default => 's', + } +) + +Overview.create( + :name => 'all_unassigned', + :condition => { + :ticket_state_id => [1,2,3], + :owner_id => 1, + }, + :order => { + :by => 'created_at', + :direction => 'ASC', + }, + :meta => { + :url => 'all_unassigned', + :name => 'Unassigned Tickets', + :prio => 1001, + }, + :view => { + :d => { + :overview => [ + 'title', 'customer', 'ticket_state', 'group', 'created_at' + ], + :per_page => 5, + }, + :s => { + :overview => [ + 'number', 'title', 'customer', 'ticket_state', 'ticket_priority', 'group', 'created_at' + ], + :per_page => 30, + }, + :m => { + :overview => [ + 'number', 'title', 'customer', 'ticket_state', 'ticket_priority', 'group', 'created_at' + ], + :per_page => 20, + }, + :view_mode_default => 's', + } +) + +Overview.create( + :name => 'all_escalated', + :condition => { + :ticket_state_id => [1,2,3], + }, + :order => { + :by => 'created_at', + :direction => 'ASC', + }, + :meta => { + :url => 'all_escalated', + :name => 'Escalated Tickets', + :prio => 1002, + }, + :view => { + :d => { + :overview => [ + 'title', 'customer', 'ticket_state', 'group', 'owner', 'created_at' + ], + :per_page => 5, + }, + :s => { + :overview => [ + 'number', 'title', 'customer', 'ticket_state', 'ticket_priority', 'group', 'owner', 'created_at' + ], + :per_page => 30, + }, + :m => { + :overview => [ + 'number', 'title', 'customer', 'ticket_state', 'ticket_priority', 'group', 'owner', 'created_at' + ], + :per_page => 20, + }, + :view_mode_default => 's', + } +) + +Overview.create( + :name => 'my_pending_reached', + :condition => { + :ticket_state_id => [3], + :owner_id => 'current_user.id', + }, + :order => { + :by => 'created_at', + :direction => 'ASC', + }, + :meta => { + :url => 'my_pending_reached', + :name => 'My pending reached Tickets', + :prio => 1003, + }, + :view => { + :d => { + :overview => [ + 'title', 'customer', 'ticket_state', 'group', 'created_at' + ], + :per_page => 5, + }, + :s => { + :overview => [ + 'number', 'title', 'customer', 'ticket_state', 'ticket_priority', 'group', 'created_at' + ], + :per_page => 30, + }, + :m => { + :overview => [ + 'number', 'title', 'customer', 'ticket_state', 'ticket_priority', 'group', 'created_at' + ], + :per_page => 20, + }, + :view_mode_default => 's', + } +) + +Overview.create( + :name => 'all', + :condition => { +# :ticket_state_id => [3], +# :owner_id => current_user.id, + }, + :order => { + :by => 'created_at', + :direction => 'ASC', + }, + :meta => { + :url => 'all', + :name => 'All Tickets', + :prio => 9003, + }, + :view => { + :s => { + :overview => [ + 'title', 'customer', 'ticket_state', 'group', 'created_at' + ], + :per_page => 5, + }, + :s => { + :overview => [ + 'number', 'title', 'customer', 'ticket_state', 'ticket_priority', 'group', 'created_at' + ], + :per_page => 30, + }, + :m => { + :overview => [ + 'number', 'title', 'customer', 'ticket_state', 'ticket_priority', 'group', 'created_at' + ], + :per_page => 20, + }, + :view_mode_default => 's', + } +) + +network = Network.create( + :name => 'base' +) + +Network::Category::Type.create( + :name => 'Announcement' +) +Network::Category::Type.create( + :name => 'Idea' +) +Network::Category::Type.create( + :name => 'Question' +) +Network::Category::Type.create( + :name => 'Bug Report' +) + +Network::Privacy.create( + :name => 'logged in', + :key => 'loggedIn' +) +Network::Privacy.create( + :name => 'logged in and moderator', + :key => 'loggedInModerator' +) +Network::Category.create( + :name => 'Announcements', + :network_id => network.id, + :allow_comments => true, + :network_category_type_id => Network::Category::Type.where(:name => 'Announcement').first.id, + :network_privacy_id => Network::Privacy.where(:name => 'logged in and moderator').first.id, + :allow_comments => true +) +Network::Category.create( + :name => 'Questions', + :network_id => network.id, + :allow_comments => true, + :network_category_type_id => Network::Category::Type.where(:name => 'Question').first.id, + :network_privacy_id => Network::Privacy.where(:name => 'logged in').first.id +# :network_categories_moderator_user_ids => User.where(:login => '-').first.id +) +Network::Category.create( + :name => 'Ideas', + :network_id => network.id, + :allow_comments => true, + :network_category_type_id => Network::Category::Type.where(:name => 'Idea').first.id, + :network_privacy_id => Network::Privacy.where(:name => 'logged in').first.id, + :allow_comments => true +) +Network::Category.create( + :name => 'Bug Reports', + :network_id => network.id, + :allow_comments => true, + :network_category_type_id => Network::Category::Type.where(:name => 'Bug Report').first.id, + :network_privacy_id => Network::Privacy.where(:name => 'logged in').first.id, + :allow_comments => true +) +item = Network::Item.create( + :title => 'Example Announcement', + :body => 'Some announcement....', + :network_category_id => Network::Category.where(:name => 'Announcements').first.id, + :created_by_id => User.where(:login => '-').first.id +) +Network::Item::Comment.create( + :network_item_id => item.id, + :body => 'Some comment....', + :created_by_id => User.where(:login => '-').first.id +) +item = Network::Item.create( + :title => 'Example Question?', + :body => 'Some questions....', + :network_category_id => Network::Category.where(:name => 'Questions').first.id, + :created_by_id => User.where(:login => '-').first.id +) +Network::Item::Comment.create( + :network_item_id => item.id, + :body => 'Some comment....', + :created_by_id => User.where(:login => '-').first.id +) +item = Network::Item.create( + :title => 'Example Idea', + :body => 'Some idea....', + :network_category_id => Network::Category.where(:name => 'Ideas').first.id, + :created_by_id => User.where(:login => '-').first.id +) +Network::Item::Comment.create( + :network_item_id => item.id, + :body => 'Some comment....', + :created_by_id => User.where(:login => '-').first.id +) +item = Network::Item.create( + :title => 'Example Bug Report', + :body => 'Some bug....', + :network_category_id => Network::Category.where(:name => 'Bug Reports').first.id, + :created_by_id => User.where(:login => '-').first.id +) +Network::Item::Comment.create( + :network_item_id => item.id, + :body => 'Some comment....', + :created_by_id => User.where(:login => '-').first.id +)