Init version.

Gemfile

@@ -1,4 +1,4 @@
-source 'https://rubygems.org'
+source 'http://rubygems.org'
 
 gem 'rails', '3.2.2'
 
@@ -12,24 +12,34 @@ gem 'json'
 # Gems used only for assets and not required
 # in production environments by default.
 group :assets do
-  gem 'sass-rails',   '~> 3.2.3'
-  gem 'coffee-rails', '~> 3.2.1'
-
-  # See https://github.com/sstephenson/execjs#readme for more supported runtimes
-  # gem 'therubyracer'
-
-  gem 'uglifier', '>= 1.0.3'
+  gem 'sass-rails',   '~> 3.2.4'
+  gem 'coffee-rails', '~> 3.2.2'
+  gem 'uglifier', '>= 1.2.3'
 end
 
 gem 'jquery-rails'
 
+# Optional support for eco templates
+gem 'eco'
+
+gem "omniauth"  
+gem "omniauth-twitter"  
+gem "omniauth-facebook"  
+gem "omniauth-linkedin"  
+
+gem "twitter"
+gem "koala"
+gem "mail"
+
+gem "mime-types"
+
+gem 'delayed_job_active_record'
+gem "daemons"
+
 # To use ActiveModel has_secure_password
 # gem 'bcrypt-ruby', '~> 3.0.0'
 
-# To use Jbuilder templates for JSON
-# gem 'jbuilder'
-
-# Use unicorn as the app server
+# Use unicorn as the web server
 # gem 'unicorn'
 
 # Deploy with Capistrano
@@ -37,3 +47,4 @@ gem 'jquery-rails'
 
 # To use debugger
 # gem 'ruby-debug'
+

app/assets/javascripts/app/controllers/_application_controller.js.coffee

@@ -0,0 +1,698 @@
+class App.Controller extends Spine.Controller
+  
+  # add @title methode to set title
+  title: (name) ->
+    $('html head title').html( Config.product_name + ' - ' + name )
+
+  # add @notify methode to create notification
+  notify: (data) ->
+    Spine.trigger 'notify', data
+
+  # add @navupdate methode to update navigation
+  navupdate: (url) ->
+    Spine.trigger 'navupdate', url
+
+#  # extend delegateEvents to unbind and undelegate
+#  delegateEvents: ->
+#    
+#    # here unbind and undelegate while @el
+#    @el.unbind()
+#    @el.undelegate()
+#    
+#    for key, method of @events
+#      unless typeof(method) is 'function'
+#        method = @proxy(@[method])
+#
+#      match      = key.match(@eventSplitter)
+#      eventName  = match[1]
+#      selector   = match[2]
+#
+#      if selector is ''
+#        @el.bind(eventName, method)
+#      else
+#        @el.delegate(selector, eventName, method)
+
+  formGen: (data) ->
+    form = $('<form>')
+    fieldset = $('<fieldset>')
+    fieldset.appendTo(form)
+    autofocus = 1;
+    if data.autofocus isnt undefined
+      autofocus = data.autofocus
+
+    attributes = clone( data.model.configure_attributes || [] )
+    for attribute in attributes
+
+      if !attribute.readonly && ( !data.required || data.required && attribute[data.required] )
+  
+        # set autofocus
+        if autofocus is 1
+          attribute.autofocus = 'autofocus'
+          autofocus = 0
+          
+        # set required option
+        if !attribute.null
+          attribute.required = 'required'
+        else
+          attribute.required = ''
+
+        # set multible option
+        if attribute.multiple
+          attribute.multiple = 'multiple'
+        else
+          attribute.multiple = ''
+  
+        # set autocapitalize option
+        if attribute.autocapitalize is undefined || attribute.autocapitalize
+          attribute.autocapitalize = ''
+        else
+          attribute.autocapitalize = 'autocapitalize="off"'
+  
+        # set value
+        if data.params
+          if attribute.name of data.params
+            attribute.value = data.params[attribute.name]
+            
+        # set default value
+        else
+          if 'default' of attribute
+            @log 'default', attribute.default
+            attribute.value = attribute.default
+          else
+            attribute.value = ''
+        
+        # add item
+        item = $( @formGenItem(attribute, data.model.className) )
+        item.appendTo(fieldset)
+        
+        # if password, add confirm password item
+        if attribute.type is 'password'
+          
+          attribute.display = attribute.display + ' (confirm)'
+          attribute.name = attribute.name + '_confirm';
+  
+          item = $( @formGenItem(attribute, data.model.className) )
+          item.appendTo(fieldset)
+
+    # return form
+    return form.html()
+    
+  formGenItem: (attribute, classname) ->
+    
+    # create item id
+    attribute.id = classname + '_' + attribute.name        
+
+    # build options list based on config
+    selection = []
+    if attribute.options
+      if attribute.nulloption
+        attribute.options[''] = '-'
+      for key of attribute.options
+        selection.push {
+          name:  attribute.options[key],
+          value: key,
+        }
+
+    # build options list based on relation
+    attribute.options = selection || []
+    if attribute.relation && App[attribute.relation]
+      attribute.options = []
+      if attribute.nulloption
+        attribute.options[''] = '-'
+        attribute.options.push {
+          name:  '-',
+          value: '',
+        }
+
+      list = []
+      if attribute.filter && attribute.filter[attribute.name]
+        filter = attribute.filter[attribute.name]
+
+        # check all records
+        for record in App[attribute.relation].all()
+
+          # check all filter attributes
+          for key of filter
+
+            # check all filter values as array
+            for value in filter[key]
+              
+              # if it's matching, use it for selection
+              if record[key] is value
+                list.push record
+      else
+        list = App[attribute.relation].all()
+
+      list.forEach( (item) =>
+        if item.active
+          name = '???'
+          if item.name
+            name = item.name
+          else if item.firstname
+            name = item.firstname
+            if item.lastname
+              if name
+               name = name + ' '
+            name = name + item.lastname
+           
+          attribute.options.push {
+            name: name,
+            value: item.id,
+            note:  item.note,
+          }
+      )
+
+    # finde selected/checked item of list
+    if attribute.options
+      for record in attribute.options
+        if typeof attribute.value is 'string' || typeof attribute.value is 'number' || typeof attribute.value is 'boolean'
+          
+          # if name or value is matching
+          if record.value.toString() is attribute.value.toString() || record.name.toString() is attribute.value.toString()
+            record.selected = 'selected'
+            record.checked = 'checked'
+#          if record.name.toString() is attribute.value.toString()
+#            record.selected = 'selected'
+#            record.checked = 'checked'
+        if ( attribute.value && record.value && _.include(attribute.value, record.value) ) || ( attribute.value && record.name && _.include(attribute.value, record.name) )
+          record.selected = 'selected'
+          record.checked = 'checked'
+
+    # boolean
+    if attribute.tag is 'boolean'
+      
+      # build options list
+      attribute.options = [
+        { name: 'active', value: true } 
+        { name: 'inactive', value: false } 
+      ] || []
+
+      # finde selected item of list
+      for record in attribute.options
+        if record.value is attribute.value
+          record.selected = 'selected'
+          
+      # return item
+      item = App.view('generic/select')( attribute: attribute )
+
+    # select
+    else if attribute.tag is 'select'
+      item = App.view('generic/select')( attribute: attribute )
+
+    # checkbox
+    else if attribute.tag is 'checkbox'
+      item = App.view('generic/checkbox')( attribute: attribute )
+      
+    # radio
+    else if attribute.tag is 'radio'
+      item = App.view('generic/radio')( attribute: attribute )
+      
+    # textarea
+    else if attribute.tag is 'textarea'
+      item = App.view('generic/textarea')( attribute: attribute )
+      
+    # autocompletion
+    else if attribute.tag is 'autocompletion'
+      item = App.view('generic/autocompletion')( attribute: attribute )
+      
+      a = ->
+#        if attribute.relation && App[attribute.relation]
+#          @log '1312312333333333333', App[attribute.relation]
+#        @log '1231231231', '#' + attribute.id + '_autocompletion'
+        @local_attribute = '#' + attribute.id
+        @local_attribute_full = '#' + attribute.id + '_autocompletion'
+        @callback = attribute.callback
+
+        b = (event, key) =>
+#          @log 'zzzz', event, item, key, @local_attribute
+          $(@local_attribute).val(key)
+          if @callback
+            @callback( user_id: key )
+        ###
+        $(@local_attribute_full).tagsInput(
+          autocomplete_url: '/user_search',
+          height: '30px',
+          width: '530px',
+          auto: {
+            source: '/user_search',
+            minLength: 2,
+            select: ( event, ui ) =>
+              @log 'selected', event, ui
+              b(event, ui.item.id)
+          }
+        )
+        ###        
+        $(@local_attribute_full).autocomplete(
+          source: '/user_search',
+          minLength: 2,
+          select: ( event, ui ) =>
+            @log 'selected', event, ui
+            b(event, ui.item.id)
+        )
+
+      @delay(a, 800)
+
+    # input
+    else
+      item = App.view('generic/input')( attribute: attribute )
+
+    return App.view('generic/attribute')(
+      attribute: attribute,
+      item:      item,
+    )
+
+  # get all params of the form
+  formParam: (form, errors) ->
+    param = {}
+    
+    # find form based on sub elements
+    if $(form).children()[0]
+      form = $(form).children().parents('form')
+
+    # find form based on parents next <form>
+    else if $(form).parents('form')[0]
+      form = $(form).parents('form')
+        
+    # find form based on parents next <form>, not really good!
+    else if $(form).parents().find('form')[0]
+      form = $(form).parents().find('form')
+    else
+      @log 'ERROR, no form found!', form
+      
+    for key in form.serializeArray()
+      if param[key.name]
+        if typeof param[key.name] is 'string'
+          param[key.name] = [ param[key.name], key.value]
+        else
+          param[key.name].push key.value
+      else
+        param[key.name] = key.value
+
+    @log 'formParam', form, param
+    return param
+
+  formDisable: (form) ->
+    @log 'disable...', $(form.target).parent()
+    $(form.target).parent().find('[type="submit"]').attr('disabled', true)
+    $(form.target).parent().find('[type="reset"]').attr('disabled', true)
+
+  formEnable: (form) ->
+    @log 'enable...', $(form).parent()
+    $(form).parent().find('[type="submit"]').attr('disabled', false)
+    $(form).parent().find('[type="reset"]').attr('disabled', false)
+
+  table: (data) ->
+    overview = data.overview || data.model.configure_overview || []
+    attributes = data.attributes || data.model.configure_attributes || []
+
+    # define normal header
+    header = []
+    for row in overview
+      for attribute in attributes
+        if row is attribute.name
+          header.push(attribute.display)
+        else
+          rowWithoutId = row + '_id'
+          if rowWithoutId is attribute.name
+            header.push(attribute.display)
+
+    data_types = []
+    for row in overview
+      data_types.push {
+        name: row,
+        link: 1,
+      }
+
+    # extended table format
+    if data.overview_extended
+      header = []
+      for row in data.overview_extended
+        for attribute in attributes
+          if row.name is attribute.name
+            header.push(attribute.display)
+          else
+            rowWithoutId = row.name + '_id'
+            if rowWithoutId is attribute.name
+              header.push(attribute.display)
+
+      data_types = data.overview_extended
+
+    # generate content data
+    objects = clone( data.objects )
+    for object in objects
+      for row in data_types
+        
+        # check if data is a object
+        if typeof object[row.name] is 'object'
+          if !object[row.name]
+            object[row.name] = {
+              name: '-',
+            }
+            
+          # if no content exists, try firstname/lastname
+          if !object[row.name]['name']
+            if object[row.name]['firstname'] || object[row.name]['lastname']
+              object[row.name]['name'] = (object[row.name]['firstname'] || '') + ' ' + (object[row.name]['lastname'] || '')
+
+        # if it isnt a object, create one
+        else if typeof object[row.name] isnt 'object'
+          object[row.name] = {
+            name: object[row.name],
+          }
+
+        # fallback if it's something else
+        else
+          object[row.name] = {
+            name: '????',
+          }
+          
+        # execute callback on content
+        if row.callback
+          object[row.name]['name'] = row.callback(object[row.name]['name'])
+ 
+#    @log 'table', 'header', header, 'overview', data_types, 'objects', objects
+    table = App.view('generic/table')(
+      header:   header,
+      overview: data_types,
+      objects:  objects,
+      checkbox: data.checkbox,
+    )
+#    @log 'ttt', $(table).find('span')
+#    $(table).find('span').bind('click', ->
+#      console.log('----------click---------')
+#    )
+
+    # convert to jquery object
+    table = $(table)
+    
+    # enable checkbox bulk selection
+    if data.checkbox
+      table.delegate('[name="bulk_all"]', 'click', (e) ->
+        if $(e.target).attr('checked')
+          $(e.target).parents().find('[name="bulk"]').attr('checked', true);
+        else
+          $(e.target).parents().find('[name="bulk"]').attr('checked', false);       
+      )
+
+    return table
+
+  ticketTableAttributes: (attributes) =>
+    all_attributes = [
+      { name: 'number',                 link: true },
+      { name: 'title',                  link: true },
+      { name: 'customer',               class: 'user-data', data: { id: true } },
+      { name: 'ticket_state' },
+      { name: 'ticket_priority' },
+      { name: 'group' },
+      { name: 'owner',                  class: 'user-data', data: { id: true } },
+      { name: 'created_at',             callback: @humanTime },
+      { name: 'last_contact',           callback: @humanTime },
+      { name: 'last_contact_agent',     callback: @humanTime },
+      { name: 'last_contact_customer',  callback: @humanTime },
+      { name: 'first_response',         callback: @humanTime },
+      { name: 'close_time',             callback: @humanTime },
+    ]
+    shown_all_attributes = []
+    for all_attribute in all_attributes
+      for attribute in attributes
+        if all_attribute['name'] is attribute
+          shown_all_attributes.push all_attribute
+          break
+    return shown_all_attributes
+
+  validateForm: (data) ->
+
+    # remove all errors
+    $(data.form).parents().find('.error').removeClass('error')
+    $(data.form).parents().find('.help-inline').html('')
+
+    # show new errors
+    for key, msg of data.errors
+      $(data.form).parents().find('[name*="' + key + '"]').parents('div .control-group').addClass('error')      
+      $(data.form).parents().find('[name*="' + key + '"]').parent().find('.help-inline').html(msg);
+    
+    # set autofocus
+    $(data.form).parents().find('.error').find('input, textarea').first().focus()
+
+#    # enable form again
+#    if $(data.form).parents().find('.error').html()
+#      @formEnable(data.form)
+
+#  redirectToLogin: (data) ->
+#
+
+  # human readable file size
+  humanFileSize: (size) =>
+    if size > ( 1024 * 1024 )
+      size = Math.round( size / ( 1024 * 1024 ) ) + ' MBytes'
+    else if size > 1024
+      size = Math.round( size / 1024 ) + ' KBytes'
+    else
+      size = size + ' Bytes'
+    return size
+
+  # human readable time
+  humanTime: (time) =>
+    current = new Date()
+    created = new Date(time)
+    diff = (current - created) / 1000
+    if diff >= 86400
+      unit = Math.round( (diff / 86400) )
+      if unit > 1
+        return unit + ' days'
+      else
+        return unit + ' day'
+    if diff >= 3600
+      unit = Math.round( (diff / 3600) )
+      if unit > 1
+        return unit + ' hours'
+      else
+        return unit + ' hour'
+    if diff <= 3600
+      unit = Math.round( (diff / 60) )
+      if unit > 1
+        return unit + ' minutes'
+      else
+        return unit + ' minute'
+
+  userInfo: (data) =>
+    # start customer info controller
+    new App.UserInfo(
+      el:      data.el || $('#customer_info'),
+      user_id: data.user_id,
+    )
+
+  authenticate: ->
+    console.log 'authenticate', window.Session
+    return true if window.Session['id']
+
+    # redirect to login  
+    @navigate '#login'
+    return false
+
+  clone = (obj) ->
+    if not obj? or typeof obj isnt 'object'
+      return obj
+  
+    newInstance = new obj.constructor()
+  
+    for key of obj
+      newInstance[key] = clone obj[key]
+  
+    return newInstance
+
+  userPopups: (position = 'right') ->
+    # show user popup    
+    $('.user-data').popover(
+      delay: { show: 500, hide: 1200 },
+#      placement: 'bottom',
+      placement: position,
+      title: (e) =>
+        user_id = $(e).data('id')
+        user = App.User.find(user_id)
+        (user.firstname || '') + ' ' +  (user.lastname || '')
+      content: (e) =>
+        user_id = $(e).data('id')
+        user = App.User.find(user_id)
+
+        # get display data
+        data = []
+        for item in App.User.configure_attributes
+          if user[item.name]
+            if item.name isnt 'firstname'
+              if item.name isnt 'lastname'
+                if item.info #&& ( @user[item.name] || item.name isnt 'note' )
+                  data.push item
+
+        # insert data
+        App.view('user_info_small')(
+          user: user,
+          data: data,
+        )    
+    )
+
+  userTicketPopups: (data) ->
+    # get data
+    @tickets = {}
+    ajax = new App.Ajax
+    ajax.ajax(
+      type:  'GET',
+      url:   '/ticket_customer',
+      data:  {
+        customer_id: data.user_id,
+      }
+      processData: true,
+      success: (data, status, xhr) =>
+        @tickets = data.tickets
+    )
+
+    if !data.position
+      data.position = 'left'
+      
+    # show user popup    
+    $(data.selector).popover(
+      delay: { show: 500, hide: 5200 },
+      placement: data.position,
+      title: (e) =>
+        $(e).find('[title="*"]').val()
+        
+      content: (e) =>
+        type = $(e).filter('[data-type]').data('type')
+        data = @tickets[type] || []
+
+        for ticket in data
+          
+          # set human time
+          ticket.humanTime = @humanTime(ticket.created_at)
+
+        # insert data
+        App.view('user_ticket_info_small')(
+          tickets: data,
+        )    
+    )
+
+  loadCollection: (params) ->
+    
+    # users
+    if params.type == 'User'
+      for user of params.data
+        if user && !user.image
+          user.image = 'http://placehold.it/48x48'
+        App.User.refresh( params.data[user], options: { clear: true } )
+
+    # tickets
+    else if params.type == 'Ticket'
+      for ticket in params.data
+        # priority
+        ticket.ticket_priority = App.TicketPriority.find(ticket.ticket_priority_id)
+        
+        # state
+        ticket.ticket_state = App.TicketState.find(ticket.ticket_state_id)
+        
+        # group
+        ticket.group = App.Group.find(ticket.group_id)
+        
+        # customer
+        if ticket.customer_id and App.User.exists(ticket.customer_id)
+          user = App.User.find(ticket.customer_id)
+          ticket.customer = user
+          
+        # owner
+        if ticket.owner_id and App.User.exists(ticket.owner_id)
+          user = App.User.find(ticket.owner_id)
+          ticket.owner = user
+
+        # load collection
+        App.Ticket.refresh( ticket, options: { clear: true } )
+
+    # articles
+    else if params.type == 'TicketArticle'
+      for article in params.data
+        
+        # add user
+        article.created_by = App.User.find(article.created_by_id)
+        
+        # set human time
+        article.humanTime = @humanTime(article.created_at)
+  
+        # add possible actions
+        article.article_type = App.TicketArticleType.find( article.ticket_article_type_id )
+        article.article_sender = App.TicketArticleSender.find( article.ticket_article_sender_id )
+
+        App.TicketArticle.refresh( article, options: { clear: true } )
+
+    # history
+    else if params.type == 'History'
+      for histroy in params.data
+        
+        # add user
+        histroy.created_by = App.User.find(histroy.created_by_id)
+        
+        # set human time
+        histroy.humanTime = @humanTime(histroy.created_at)
+  
+        # add possible actions
+        if histroy.history_attribute_id
+          histroy.attribute = App.HistoryAttribute.find( histroy.history_attribute_id )
+        if histroy.history_type_id
+          histroy.type      = App.HistoryType.find( histroy.history_type_id )
+        if histroy.history_object_id
+          histroy.object    = App.HistoryObject.find( histroy.history_object_id )
+
+        App.History.refresh( histroy, options: { clear: true } )
+
+    # all the rest
+    else
+      for object in params.data
+        App[params.type].refresh( object, options: { clear: true } )
+
+
+class App.ControllerModal extends App.Controller
+  className: 'modal hide fade',
+  tag: 'div',
+
+  events:
+    'submit form': 'submit',
+    'click .submit': 'submit',
+    'click .cancel': 'modalHide',
+    'click .close': 'modalHide',
+
+  constructor: (options) ->
+
+    # do not use @el, because it's inserted by js
+    if options
+      delete options.el
+      
+      # callbacks
+#      @callback = {}
+#      if options.success
+#        @callback.success = options.success
+#      if options.error
+#        @callback.error = options.error
+   
+    super(options)
+
+  modalShow: (params) =>
+    @el.modal({
+      backdrop: true,
+      keyboard: true,
+      show: true
+    })
+    @el.bind('hidden', =>
+
+      # navigate back to home page
+      if @pageData && @pageData.home
+        @navigate @pageData.home
+
+      # navigate back
+      if params && params.navigateBack
+        window.history.back()
+      
+      # remove modal from dom
+      $('.modal').remove();
+    )
+
+  modalHide: (e) =>
+    if e
+      e.preventDefault()
+    @el.modal('hide')

app/assets/javascripts/app/controllers/_application_controller_generic.js.coffee

@@ -0,0 +1,230 @@
+$ = jQuery.sub()
+$.fn.item = (genericObject) ->
+  elementID   = $(@).data('id')
+  elementID or= $(@).parents('[data-id]').data('id')
+  genericObject.find(elementID)
+
+class App.ControllerGenericNew extends App.ControllerModal
+  constructor: (params) ->
+    super
+    @render()
+  
+  render: ->
+    @log 'ren new', @el
+    @html App.view('generic/admin/new')(
+      form: @formGen( model: @genericObject ),
+      head: 'New ' + @pageData.object
+    )
+    @modalShow()
+    
+  submit: (e) ->
+    @log 'submit'
+    e.preventDefault()
+    params = @formParam(e.target)
+    ###
+    for num in [1..199]
+      user = new User
+      params.login = 'login_c' + num
+      user.updateAttributes(params)
+    return false
+    ###
+    object = new @genericObject
+    object.load(params)
+    
+    # validate
+    errors = object.validate( form: true )
+    if errors
+      @log 'error new', errors
+      @validateForm( form: e.target, errors: errors )
+      return false
+
+    # save object
+    object.save(
+      success: =>
+        @modalHide()
+      error: =>
+        @log 'errors'
+        @modalHide()
+    )
+
+class App.ControllerGenericEdit extends App.ControllerModal
+  constructor: (params) ->
+    super
+    @log 'ControllerGenericEditWindow', params
+
+    # fetch item on demand
+    if @genericObject.exists(params.id)
+      @item = @genericObject.find(params.id)
+      @render()
+    else
+      @genericObject.bind 'refresh', =>
+        @log 'changed....'
+        @item = @genericObject.find(params.id)
+        @render()
+        @genericObject.unbind 'refresh'
+      @genericObject.fetch( id: params.id) 
+    
+  render: ->
+    @html App.view('generic/admin/edit')(
+      form: @formGen( model: @genericObject, params: @item ),
+      head: 'Edit ' + @pageData.object
+    )
+    @modalShow()
+
+  submit: (e) ->
+    e.preventDefault()
+    params = @formParam(e.target) 
+    @item.load(params)
+    
+    # validate
+    errors = @item.validate( form: true )
+    if errors
+      @log 'error new', errors
+      @validateForm( form: e.target, errors: errors )
+      return false
+
+    @log 'save....'
+    # save object
+    @item.save(
+      success: =>
+        @modalHide()
+      error: =>
+        @log 'errors'
+        @modalHide()
+    )
+
+class App.ControllerGenericIndex extends App.Controller
+  events:
+    'click [data-type=edit]':    'edit'
+    'click [data-type=destroy]': 'destroy'
+    'click [data-type=new]':     'new'
+
+  constructor: ->
+    super
+
+    # set controller to active
+    Config['ActiveController'] = @pageData.navupdate
+
+
+    # set title
+    @title @pageData.title
+
+    # set nav bar    
+    @navupdate @pageData.navupdate
+
+    # bind render after a change is done
+    @genericObject.bind 'refresh change', @render
+    @genericObject.bind 'ajaxError', (rec, msg) =>
+      @log 'ajax notice', msg.status
+      if msg.status is 401
+        @log 'ajax error', rec, msg, msg.status
+#        @navigate @pageData.navupdate
+#        alert('relogin')
+        @navigate 'login'
+    
+    # execute fetch, if needed
+    if !@genericObject.count() || true
+#    if !@genericObject.count()
+
+      # prerender without content    
+      @render()
+      
+      # fetch all
+      @genericObject.fetch()
+    else
+      @render()
+
+  render: =>
+    
+    return if Config['ActiveController'] isnt @pageData.navupdate
+    
+    objects = @genericObject.all()
+    
+    # remove ignored items from collection
+    if @ignoreObjectIDs
+      objects = _.filter(objects, (item) ->
+        return if item.id is 1
+        return item
+      )
+
+    @html App.view('generic/admin/index')(
+      head: @pageData.objects,
+      notes: @pageData.notes,
+      buttons: @pageData.buttons,
+      menus: @pageData.menus,
+    )
+
+    # append content table
+    table = @table(
+      model: @genericObject,
+      objects: objects,
+    )
+    @el.find('.table-overview').append(table)
+
+  edit: (e) =>
+    e.preventDefault()
+    item = $(e.target).item(@genericObject)
+    new App.ControllerGenericEdit(
+      id: item.id,
+      pageData: @pageData,
+      genericObject: @genericObject
+    )
+    
+  destroy: (e) ->
+    item = $(e.target).item(@genericObject)
+    item.destroy() if confirm('Sure?')
+    
+  new: (e) ->
+    e.preventDefault()
+    new App.ControllerGenericNew(
+      pageData:      @pageData,
+      genericObject: @genericObject
+    )
+
+class App.ControllerLevel2 extends App.Controller
+  events:
+    'click [data-toggle="tabnav"]': 'toggle',
+    
+  constructor: ->
+    super
+
+    return if !@authenticate()
+
+  render: ->
+    @log 'ttt', @target, @
+    # set title
+    @title @page.title
+    @navupdate @page.nav
+    
+    @html App.view('generic/admin_level2/index')(
+      page:     @page,
+      menus:    @menu,
+      type:     @type,
+      target:   @target,
+    )
+    for menu in @menu
+      @el.find('.nav-tab-content').append('<div class="tabbable" id="' + menu.target + '">' + menu.name + '</div>')
+      if menu.controller
+        params    = menu.params || {}
+        params.el = @el.find( '#' + menu.target )
+        new menu.controller( params )
+
+    @el.find('.tabbable').addClass('hide')
+    if @target
+      @el.find( '#' + @target ).removeClass('hide')
+    else
+      @el.find('.tabbable:first').removeClass('hide')
+
+    @el.find('[data-toggle="tabnav"]:first').addClass('active')
+
+    
+  toggle: (e) ->
+    return true if @toggleable is false
+    e.preventDefault()
+    target = $(e.target).data('target')
+    $(e.target).parents('ul').find('li').removeClass('active')
+    $(e.target).parents('li').addClass('active')
+    @el.find('.tabbable').addClass('hide')
+    @el.find('#' + target).removeClass('hide')
+#    window.scrollTo(0,0)
+    

app/assets/javascripts/app/controllers/_channel/chat.js.coffee

@@ -0,0 +1,18 @@
+$ = jQuery.sub()
+
+class App.ChannelChat extends App.Controller
+  events:
+    'click [data-toggle="tabnav"]': 'toggle',
+    
+  constructor: ->
+    super
+
+    # render page
+    @render()
+
+  render: ->
+    
+    @html App.view('channel/chat')(
+      head: 'some header'
+    )
+    

app/assets/javascripts/app/controllers/_channel/email.js.coffee

@@ -0,0 +1,18 @@
+$ = jQuery.sub()
+
+class App.ChannelEmail extends App.Controller
+  events:
+    'click [data-toggle="tabnav"]': 'toggle',
+    
+  constructor: ->
+    super
+
+    # render page
+    @render()
+
+  render: ->
+    
+    @html App.view('channel/email')(
+      head: 'some header'
+    )
+    

app/assets/javascripts/app/controllers/_channel/facebook.js.coffee

@@ -0,0 +1,18 @@
+$ = jQuery.sub()
+
+class App.ChannelFacebook extends App.Controller
+  events:
+    'click [data-toggle="tabnav"]': 'toggle',
+    
+  constructor: ->
+    super
+
+    # render page
+    @render()
+
+  render: ->
+    
+    @html App.view('channel/facebook')(
+      head: 'some header'
+    )
+    

app/assets/javascripts/app/controllers/_channel/twitter.js.coffee

@@ -0,0 +1,18 @@
+$ = jQuery.sub()
+
+class App.ChannelTwitter extends App.Controller
+  events:
+    'click [data-toggle="tabnav"]': 'toggle',
+    
+  constructor: ->
+    super
+
+    # render page
+    @render()
+
+  render: ->
+    
+    @html App.view('channel/twitter')(
+      head: 'some header'
+    )
+    

app/assets/javascripts/app/controllers/_channel/web.js.coffee

@@ -0,0 +1,18 @@
+$ = jQuery.sub()
+
+class App.ChannelWeb extends App.Controller
+  events:
+    'click [data-toggle="tabnav"]': 'toggle',
+    
+  constructor: ->
+    super
+
+    # render page
+    @render()
+
+  render: ->
+    
+    @html App.view('channel/web')(
+      head: 'some header'
+    )
+    

app/assets/javascripts/app/controllers/_dashboard/activity_stream.js.coffee

@@ -0,0 +1,61 @@
+$ = jQuery.sub()
+
+class App.DashboardActivityStream extends App.Controller
+  events:
+    'click [data-type=edit]': 'zoom'
+
+  constructor: ->
+    super
+#    @log 'aaaa', @el
+    
+    @items = []
+    
+    # get data
+    @ajax = new App.Ajax
+    @ajax.ajax(
+      type:  'GET',
+      url:   '/activity_stream',
+      data:  {
+        limit: 10,
+      }
+      processData: true,
+#      data: JSON.stringify( view: @view ),
+      success: (data, status, xhr) =>
+        @items = data.activity_stream
+
+        # load user collection
+        @loadCollection( type: 'User', data: data.users )
+
+        # load ticket collection
+        @loadCollection( type: 'Ticket', data: data.tickets )
+
+        @render()
+    )
+
+    
+  render: ->
+
+    # load user data
+    for item in @items
+      item.created_by = App.User.find(item.created_by_id)
+  
+    # load ticket data
+    for item in @items
+      item.ticket = App.Ticket.find(item.o_id)
+  
+    html = App.view('dashboard/activity_stream')(
+      head: 'Activity Stream',
+      items: @items
+    )
+    html = $(html)
+    
+    @html html
+
+    # start user popups
+    @userPopups('left')
+
+  zoom: (e) =>
+    e.preventDefault()
+    id = $(e.target).parents('[data-id]').data('id')
+    @log 'goto zoom!'
+    @navigate 'ticket/zoom/' + id

app/assets/javascripts/app/controllers/_dashboard/recent_viewed.js.coffee

@@ -0,0 +1,63 @@
+$ = jQuery.sub()
+
+class App.DashboardRecentViewed extends App.Controller
+  events:
+    'click [data-type=edit]': 'zoom'
+
+  constructor: ->
+    super
+#    @log 'aaaa', @el
+    
+    @items = []
+    
+    # get data
+    @ajax = new App.Ajax
+    @ajax.ajax(
+      type:  'GET',
+      url:   '/recent_viewed',
+      data:  {
+        limit: 5,
+      }
+      processData: true,
+#      data: JSON.stringify( view: @view ),
+      success: (data, status, xhr) =>
+        @items = data.recent_viewed
+
+        # load user collection
+        @loadCollection( type: 'User', data: data.users )
+
+        # load ticket collection
+        @loadCollection( type: 'Ticket', data: data.tickets )
+
+        @render()
+    )
+
+    
+  render: ->
+
+    # load user data
+    for item in @items
+#      @log 'load', item.created_by_id
+      item.created_by = App.User.find(item.created_by_id)
+  
+    # load ticket data
+    for item in @items
+#      @log 'load', item.o_id
+      item.ticket = App.Ticket.find(item.o_id)
+  
+    html = App.view('dashboard/recent_viewed')(
+      head: 'Recent Viewed',
+      items: @items
+    )
+    html = $(html)
+    
+    @html html
+
+    # start user popups
+    @userPopups('left')
+
+  zoom: (e) =>
+    e.preventDefault()
+    id = $(e.target).parents('[data-id]').data('id')
+    @log 'goto zoom!'
+    @navigate 'ticket/zoom/' + id

app/assets/javascripts/app/controllers/_dashboard/ticket.js.coffee

@@ -0,0 +1,235 @@
+$ = jQuery.sub()
+
+class App.DashboardTicket extends App.Controller
+  events:
+    'click [data-type=edit]':     'zoom'
+    'click [data-type=settings]': 'settings'
+    'click [data-type=page]':     'page'
+
+  constructor: ->
+    super
+    @tickets       = []
+    @tickets_count = 0
+    @start_page    = 1
+    @navupdate '#'
+
+    @fetch()
+
+  fetch: ->
+
+    # get data
+    @ajax = new App.Ajax
+    @ajax.ajax(
+      type:  'GET',
+      url:   '/ticket_overviews',
+      data:  {
+        view:       @view,
+        view_mode:  'd',
+        start_page: @start_page,
+      }
+      processData: true,
+#      data: JSON.stringify( view: @view ),
+      success: (data, status, xhr) =>
+
+        # get meta data
+        @overview = data.overview
+        App.Overview.refresh( @overview, options: { clear: true } )
+
+        App.Overview.unbind('local:rerender')
+        App.Overview.bind 'local:rerender', (record) =>
+          @log 'rerender...', record
+          @render()
+
+        App.Overview.unbind('local:refetch')
+        App.Overview.bind 'local:refetch', (record) =>
+          @log 'refetch...', record
+          @fetch()
+
+        # load user collection
+        @loadCollection( type: 'User', data: data.users )
+
+        # load ticket collection
+        @loadCollection( type: 'Ticket', data: data.tickets )
+
+        @tickets       = data.tickets
+        @tickets_count = data.tickets_count
+
+        @render()
+    )
+
+  render: ->
+    
+    pages_total =  parseInt( ( @tickets_count / @overview.view.d.per_page ) + 0.99999 ) || 1
+    html = App.view('dashboard/ticket')(
+      overview:    @overview,
+      pages_total: pages_total,
+      start_page:  @start_page,
+    )
+    html = $(html)
+    html.find('li').removeClass('active')
+    html.find("[data-id=\"#{@start_page}\"]").parents('li').addClass('active')
+
+
+    shown_all_attributes = @ticketTableAttributes( App.Overview.find(@overview.id).view.d.overview )
+    table = @table(
+      overview_extended: shown_all_attributes,
+      model:             App.Ticket,
+      objects:           @tickets,
+      checkbox:          false,
+    )
+
+    if _.isEmpty(@tickets)
+      table = ''
+#      table = '-none-'
+
+    # append content table
+    html.find('.table-overview').append(table)
+    @html html
+
+    # start user popups
+    @userPopups()
+
+  zoom: (e) =>
+    e.preventDefault()
+    id = $(e.target).parents('[data-id]').data('id')
+    @log 'goto zoom!'
+    @navigate 'ticket/zoom/' + id
+
+  settings: (e) =>
+    e.preventDefault()
+    new Settings(
+      overview: App.Overview.find(@overview.id)
+    )
+
+  page: (e) =>
+    e.preventDefault()
+    id = $(e.target).data('id')
+    @start_page = id
+    @fetch()
+
+class Settings extends App.ControllerModal
+  constructor: ->
+    super
+    @render()
+
+  render: ->
+
+    @html App.view('dashboard/ticket_settings')(
+      overview: @overview,
+    )
+    @configure_attributes_article = [
+#      { name: 'from',                     display: 'From',     tag: 'input',    type: 'text', limit: 100, null: false, class: 'span8',  },
+#      { name: 'to',                       display: 'To',          tag: 'input',    type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' },
+#      { name: 'ticket_article_type_id',   display: 'Type',        tag: 'select',   multiple: false, null: true, relation: 'TicketArticleType', default: '9', class: 'medium', item_class: 'keepleft' },
+#      { name: 'internal',                 display: 'Visability',  tag: 'radio',  default: false,  null: true, options: { true: 'internal', false: 'public' }, class: 'medium', item_class: 'keepleft' },
+      {
+        name:     'per_page',
+        display:  'Items per page',
+        tag:      'select',
+        multiple: false,
+        null:     false,
+        default: @overview.view.d.per_page,
+        options: {
+          5: 5,
+          10: 10,
+          15: 15,
+          20: 20,
+        },
+        class: 'medium',
+#        item_class: 'keepleft',
+      },
+      { 
+        name:    'attributes',
+        display: 'Attributes',
+        tag:     'checkbox',
+        default: @overview.view.d.overview,
+        null:    false,
+        options: {
+          number:                 'Number',
+          title:                  'Title',
+          customer:               'Customer',
+          ticket_state:           'State',
+          ticket_priority:        'Priority',
+          group:                  'Group',
+          owner:                  'Owner',
+          created_at:             'Alter',
+          last_contact:           'Last Contact',
+          last_contact_agent:     'Last Contact Agent',
+          last_contact_customer:  'Last Contact Customer',
+          first_response:         'First Response',
+          close_time:             'Close Time',
+        },
+        class:      'medium',
+#        item_class: 'keepleft',
+      },
+      { 
+        name:    'order_by',
+        display: 'Order',
+        tag:     'select',
+        default: @overview.order.by,
+        null:    false,
+        options: {
+          number:                 'Number',
+          title:                  'Title',
+          customer:               'Customer',
+          ticket_state:           'State',
+          ticket_priority:        'Priority',
+          group:                  'Group',
+          owner:                  'Owner',
+          created_at:             'Alter',
+          last_contact:           'Last Contact',
+          last_contact_agent:     'Last Contact Agent',
+          last_contact_customer:  'Last Contact Customer',
+          first_response:         'First Response',
+          close_time:             'Close Time',
+        },
+        class:      'medium',
+      },
+      { 
+        name:    'order_by_direction',
+        display: 'Direction',
+        tag:     'select',
+        default: @overview.order.direction,
+        null:    false,
+        options: {
+          ASC:   'up',
+          DESC:  'down',
+        },
+        class:      'medium',
+      },
+    ]
+    form = @formGen( model: { configure_attributes: @configure_attributes_article } )
+
+    @el.find('.setting').append(form)
+
+    @modalShow()
+
+  submit: (e) =>
+    e.preventDefault()
+    params = @formParam(e.target)
+    
+    # check if refetch is needed
+    @reload_needed = 0
+    if @overview.view['d']['per_page'] isnt params['per_page']
+      @overview.view['d']['per_page'] = params['per_page']
+      @reload_needed = 1
+
+    if @overview.order['by'] isnt params['order_by']
+      @overview.order['by'] = params['order_by']
+      @reload_needed = 1
+
+    if @overview.order['direction'] isnt params['order_by_direction']
+      @overview.order['direction'] = params['order_by_direction']
+      @reload_needed = 1
+
+    @overview.view['d']['overview'] = params['attributes']
+
+    @overview.save(
+      success: =>
+        if @reload_needed
+          @overview.trigger('local:refetch')
+        else
+          @overview.trigger('local:rerender')
+    )
+
+    @modalHide()

app/assets/javascripts/app/controllers/_settings/area.js.coffee

@@ -0,0 +1,70 @@
+$ = jQuery.sub()
+
+class App.SettingsArea extends App.Controller
+  constructor: ->
+    super
+
+    # check authentication
+    return if !@authenticate()
+
+    App.Setting.bind 'refresh change', @render
+    App.Setting.fetch()
+
+  render: =>
+    settings = App.Setting.all()
+    
+    html = $('<div></div>')
+    for setting in settings
+      if setting.area is @area
+        item = new App.SettingsAreaItem( setting: setting ) 
+        html.append( item.el )
+
+    @html html
+
+class App.SettingsAreaItem extends App.Controller
+  events:
+    'submit form': 'update',
+
+  constructor: ->
+    super
+    @render()
+
+  render: =>
+    # defaults
+    for item in @setting.options['form']
+      if typeof @setting.state.value is 'object'
+        item['default'] = @setting.state.value[item.name]
+      else
+        item['default'] = @setting.state.value
+
+    # form
+    @configure_attributes = @setting.options['form']
+    form = @formGen( model: { configure_attributes: @configure_attributes, className: '' }, autofocus: false )
+
+    # item
+    @html App.view('settings/item')(
+      setting: @setting,
+      form:    form,
+      )
+    
+  update: (e) =>
+    e.preventDefault()
+    params = @formParam(e.target)
+    @log 'submit', @setting, params, e.target
+    if typeof @setting.state.value is 'object'
+      state = {
+        value: params
+      }
+    else
+      state = {
+        value: params[@setting.name]
+      }
+
+    @setting['state'] = state
+    @setting.save(
+      success: =>
+
+        # login check
+        auth = new App.Auth
+        auth.loginCheck()
+    )

app/assets/javascripts/app/controllers/agent_ticket_create.js.coffee

@@ -0,0 +1,185 @@
+$ = jQuery.sub()
+
+class Index extends App.Controller
+  events:
+    'click .customer_new': 'user_new'
+    'submit form': 'submit',
+    'click .submit': 'submit',
+    'click .cancel': 'cancel',
+
+  constructor: ->
+    super
+
+    # check authentication
+    return if !@authenticate()
+    
+    # set title
+    @title 'New Ticket'
+#    @render()
+    @fetch()
+    @navupdate '#ticket_create'
+
+    @edit_form = undefined
+    
+  fetch: () ->
+    # get data
+    @ajax = new App.Ajax
+    @ajax.ajax(
+      type:  'GET',
+      url:   '/ticket_create',
+      data:  {
+#        view: @view
+      }
+      processData: true,
+      success: (data, status, xhr) =>
+        
+        # get edit form attributes
+        @edit_form = data.edit_form
+
+        # load user collection
+        @loadCollection( type: 'User', data: data.users )
+
+        # render page
+        @render()
+    )
+
+  render: ->
+    
+    configure_attributes = [
+      { name: 'customer_id',        display: 'From',     tag: 'autocompletion', type: 'text', limit: 100, null: false, relation: 'User', class: 'span7', autocapitalize: false, help: 'Select the customer of the Ticket or create one.', link: '<a href="" class="customer_new">&raquo;</a>', callback: @userInfo },
+      { name: 'group_id',           display: 'Group',    tag: 'select',   multiple: false, null: false, filter: @edit_form, nulloption: true, relation: 'Group', class: 'span7',  },
+      { name: 'owner_id',           display: 'Owner',    tag: 'select',   multiple: false, null: true, filter: @edit_form, nulloption: true, relation: 'User', class: 'span7',  },
+      { name: 'subject',            display: 'Subject',  tag: 'input',    type: 'text', limit: 100, null: false, class: 'span7',  },
+      { name: 'body',               display: 'Text',     tag: 'textarea', rows: 6,      limit: 100, null: false, class: 'span7',  },
+      { name: 'ticket_state_id',    display: 'State',    tag: 'select',   multiple: false, null: false, filter: @edit_form, relation: 'TicketState', default: 'new', class: 'medium' },
+      { name: 'ticket_priority_id', display: 'Priority', tag: 'select',   multiple: false, null: false, filter: @edit_form, relation: 'TicketPriority', default: '2 normal', class: 'medium' },
+    ]
+    @html App.view('agent_ticket_create')(
+      head: 'New Ticket',
+      form: @formGen( model: { configure_attributes: configure_attributes, className: 'create' } ),
+    )
+    
+#    @modalShow(
+#      navigateBack: true
+#    )
+
+  user_new: (e) =>
+    e.preventDefault()
+    new UserNew()
+
+  cancel: ->
+    @render()
+    
+  submit: (e) ->
+    e.preventDefault()
+        
+    # get params
+    params = @formParam(e.target)
+
+    # fillup params
+    if !params.title
+      params.title = params.subject
+
+    # create ticket
+    object = new App.Ticket
+    @log 'updateAttributes', params
+    object.load(params)
+    
+    # validate form
+    errors = object.validate()
+    
+    # show errors in form
+    if errors
+      @log 'error new', errors
+      @validateForm( form: e.target, errors: errors )
+      
+    # save ticket, create article
+    else 
+
+      # disable form
+      @formDisable(e)
+
+      object.save(
+        success: (r) =>
+          
+          # find sender_id
+          sender = App.TicketArticleSender.findByAttribute("name", "Customer")
+          type   = App.TicketArticleType.findByAttribute("name", "phone")
+
+          # create article
+          article = new App.TicketArticle
+          article.load(
+            from:                     'some guy',
+            to:                       'some group',
+            subject:                  params.subject,
+            body:                     params.body,
+            ticket_id:                r.id,
+            ticket_article_type_id:   type.id,
+            ticket_article_sender_id: sender.id,
+          )
+          article.save()
+#          console.log('params', params)
+
+          # notify UI
+          @notify
+            type: 'success',
+            msg: 'Ticket ' + r.number + ' created!'
+            
+          # create new create screen
+          @render()
+
+        error: =>
+          @log 'save failed!'
+      )
+
+
+class UserNew extends App.ControllerModal
+  constructor: ->
+    super
+    @render()
+
+  render: ->
+
+    @html App.view('agent_user_create')(
+      head: 'New User',
+      form: @formGen( model: App.User, required: 'quick' ),
+    )
+    @modalShow()
+    
+  submit: (e) ->
+    @log 'submit'
+    e.preventDefault()
+    params = @formParam(e.target)
+    
+    # if no login is given, use emails as fallback
+    if !params.login && params.email
+      params.login = params.email
+      
+    user = new App.User
+    
+    # find role_id
+    role = App.Role.findByAttribute("name", "Customer")
+    params.role_ids = role.id
+    @log 'updateAttributes', params
+    user.load(params)
+
+    errors = user.validate()
+    if errors
+      @log 'error new', errors
+      @validateForm( form: e.target, errors: errors )
+      return
+
+    # save user
+    user.save(
+      success: (r) =>
+        @modalHide()
+        $('#create_customer_id').val(r.id)
+        $('#create_customer_id_autocompletion').val(r.firstname)
+
+        # start customer info controller
+        @userInfo( user_id: r.id )
+      error: =>
+        @modalHide()
+    )
+
+Config.Routes['ticket_create'] = Index

app/assets/javascripts/app/controllers/agent_ticket_view.js.coffee

@@ -0,0 +1,399 @@
+$ = jQuery.sub()
+
+class Index extends App.Controller
+  events:
+    'click [data-type=edit]':      'zoom'
+    'click [data-type=settings]':  'settings'
+    'click [data-type=view-mode]': 'view_mode'
+    'click [data-type=page]':      'page'
+
+  constructor: ->
+    super
+
+    # check authentication
+    return if !@authenticate()
+
+    @log 'view:', @view
+    @view_mode = localStorage.getItem( "mode:#{@view}" ) || 's'
+
+    # set title
+    @title ''
+    @navupdate '#ticket_view'
+
+    @tickets       = []
+    @tickets_count = 0
+    @start_page    = 1
+    @meta          = {}
+    @bulk          = {}
+
+#    @render()
+    @fetch()
+
+  fetch: ->
+
+    # get data
+    @ajax = new App.Ajax
+    @ajax.ajax(
+      type:  'GET',
+      url:   '/ticket_overviews',
+      data:  {
+        view:       @view,
+        view_mode:  @view_mode,
+        start_page: @start_page,
+      }
+      processData: true,
+      success: (data, status, xhr) =>
+
+        # get meta data
+        @overview = data.overview
+        App.Overview.refresh( @overview, options: { clear: true } )
+
+        App.Overview.unbind('local:rerender')
+        App.Overview.bind 'local:rerender', (record) =>
+          @log 'rerender...', record
+          @render()
+
+        App.Overview.unbind('local:refetch')
+        App.Overview.bind 'local:refetch', (record) =>
+          @log 'refetch...', record
+          @fetch()
+
+        # set page title
+        @title @overview.meta.name
+
+        # load user collection
+        @loadCollection( type: 'User', data: data.users )
+
+        # load ticket collection
+        @loadCollection( type: 'Ticket', data: data.tickets )
+
+        # remember ticket order
+        @tickets = data.tickets
+
+        # remember ticket count
+        @tickets_count = data.tickets_count
+
+
+        # remeber bulk attributes
+        @bulk = data.bulk
+
+        # render page
+        @render()
+    )
+        
+    # refresh/load default collections
+#    for key, value of data.default_collections
+#      App[key].refresh( value, options: { clear: true } )
+
+  render: ->
+
+    pages_total =  parseInt( ( @tickets_count / @overview.view[@view_mode].per_page ) + 0.99999 ) || 1
+
+    # render init page
+    view_modes = [
+      {
+        name:  'S',
+        type:  's',
+        class: 'active' if @view_mode is 's',
+      },
+      {
+        name: 'M',
+        type: 'm',
+        class: 'active' if @view_mode is 'm',
+      }
+    ]
+    html = App.view('agent_ticket_view')(
+      overview:    @overview,
+      view_modes:  view_modes,
+      pages_total: pages_total,
+      start_page:  @start_page,
+      checkbox:    true,
+    )
+    html = $(html)
+#    html.find('li').removeClass('active')
+    html.find("[data-id=\"#{@start_page}\"]").parents('li').addClass('active')
+    @html html
+    
+    # create table/overview
+    table = ''
+    if @view_mode is 'm'
+      table = App.view('agent_ticket_view/detail')(
+        overview: @overview,
+        objects:  @tickets,
+        checkbox: true
+      )
+      table = $(table)
+      table.delegate('[name="bulk_all"]', 'click', (e) ->
+        if $(e.target).attr('checked')
+          $(e.target).parents().find('[name="bulk"]').attr('checked', true);
+        else
+          $(e.target).parents().find('[name="bulk"]').attr('checked', false);       
+      )
+    else
+      shown_all_attributes = @ticketTableAttributes( App.Overview.find(@overview.id).view.s.overview )
+      table = @table(
+        overview_extended: shown_all_attributes,
+        model:             App.Ticket,
+        objects:           @tickets,
+        checkbox:          true,
+      )
+    
+    # append content table
+    @el.find('.table-overview').append(table)
+    
+    # start user popups
+    @userPopups()
+    
+    # start bulk action observ
+    @el.find('.bulk-action').append( @bulk_form() )
+
+    # show/hide bulk action    
+    @el.find('.table-overview').delegate('[name="bulk"], [name="bulk_all"]', 'click', (e) =>
+      if @el.find('.table-overview').find('[name="bulk"]:checked').length == 0
+
+        # hide
+        @el.find('.bulk-action').addClass('hide')
+      else
+
+        # show
+        @el.find('.bulk-action').removeClass('hide')
+    )
+
+  page: (e) =>
+    e.preventDefault()
+    id = $(e.target).data('id')
+    @start_page = id
+    @fetch()
+
+  view_mode: (e) =>
+    e.preventDefault()
+    @start_page    = 1
+    id = $(e.target).data('mode')
+    @view_mode = id
+    localStorage.setItem( "mode:#{@view}", id )
+    @fetch()
+    @render()
+
+  bulk_form: =>
+    @configure_attributes_ticket = [
+      { name: 'ticket_state_id',    display: 'State',    tag: 'select',   multiple: false, null: true, relation: 'TicketState', nulloption: true, default: '', class: 'span2', item_class: 'keepleft' },
+      { name: 'ticket_priority_id', display: 'Priority', tag: 'select',   multiple: false, null: true, relation: 'TicketPriority', nulloption: true, default: '', class: 'span2', item_class: 'keepleft' },
+      { name: 'group_id',           display: 'Group',    tag: 'select',   multiple: false, null: true, relation: 'Group', nulloption: true, class: 'span2', item_class: 'keepleft'  },
+      { name: 'owner_id',           display: 'Owner',    tag: 'select',   multiple: false, null: true, relation: 'User', filter: @bulk, nulloption: true, class: 'span2', item_class: 'keepleft' },
+    ]
+    form_ticket = @formGen( model: { configure_attributes: @configure_attributes_ticket, className: 'create' } )
+    @configure_attributes_article = [
+#      { name: 'from',                     display: 'From',     tag: 'input',    type: 'text', limit: 100, null: false, class: 'span8',  },
+      { name: 'to',                       display: 'To',          tag: 'input',    type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' },
+      { name: 'cc',                       display: 'Cc',          tag: 'input',    type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' },
+      { name: 'subject',                  display: 'Subject',     tag: 'input',    type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' },
+      { name: 'in_reply_to',              display: 'In Reply to', tag: 'input',    type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' },
+      { name: 'body',                     display: 'Text',        tag: 'textarea', rows: 4,  limit: 100, null: true, class: 'span7',  },
+      { name: 'ticket_article_type_id',   display: 'Type',        tag: 'select',   multiple: false, null: true, relation: 'TicketArticleType', default: '9', class: 'medium', item_class: 'keepleft' },
+      { name: 'internal',                 display: 'Visability',  tag: 'radio',  default: false,  null: true, options: { true: 'internal', false: 'public' }, class: 'medium', item_class: 'keepleft' },
+#      { name: 'ticket_article_sender_id', display: 'Sender',   tag: 'select',   multiple: false, null: true, relation: 'TicketArticleSender', default: '', class: 'medium' },
+    ]
+    form_article = @formGen( model: { configure_attributes: @configure_attributes_article } )
+    
+    # render init page
+    html = App.view('agent_ticket_view/bulk')(
+      meta:        @overview.meta,
+      checkbox:    true
+      form_ticket: form_ticket,
+#      form_article: form_article,
+    )
+    html = $(html)
+#    html.delegate('.bulk-action-form', 'submit', (e) =>
+    html.bind('submit', (e) =>
+      e.preventDefault()
+      @bulk_submit(e)
+    )
+    return html
+
+  bulk_submit: (e) =>
+    @bulk_count = @el.find('.table-overview').find('[name="bulk"]:checked').length
+    @bulk_count_index = 0
+    @el.find('.table-overview').find('[name="bulk"]:checked').each( (index, element) =>
+      @log '@bulk_count_index', @bulk_count, @bulk_count_index
+      ticket_id = $(element).val()
+      ticket = App.Ticket.find(ticket_id)
+      params = @formParam(e.target)
+
+      # update ticket
+      ticket_update = {}
+      for item of params
+        if params[item] != ''
+          ticket_update[item] = params[item]
+
+#      @log 'update', params, ticket_update, ticket
+
+      ticket.load(ticket_update)
+      ticket.save(
+        success: (r) =>
+          @bulk_count_index++
+
+          # refresh view after all tickets are proceeded
+          if @bulk_count_index == @bulk_count
+
+            @tickets = []
+
+            # rebuild navbar with updated ticket count of overviews
+            Spine.trigger 'navupdate_remote'
+            
+            # fetch overview data again
+            @fetch()
+      )
+    )
+
+  zoom: (e) =>
+    e.preventDefault()
+    id = $(e.target).parents('[data-id]').data('id')
+    @navigate 'ticket/zoom/' + id
+
+  settings: (e) =>
+    e.preventDefault()
+    new Settings(
+      overview: App.Overview.find(@overview.id),
+      view_mode: @view_mode,
+    )
+
+class Settings extends App.ControllerModal
+  constructor: ->
+    super
+    @render()
+
+  render: ->
+
+    @html App.view('dashboard/ticket_settings')(
+      overview: @overview,
+    )
+    @configure_attributes_article = [
+#      { name: 'from',                     display: 'From',     tag: 'input',    type: 'text', limit: 100, null: false, class: 'span8',  },
+#      { name: 'to',                       display: 'To',          tag: 'input',    type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' },
+#      { name: 'ticket_article_type_id',   display: 'Type',        tag: 'select',   multiple: false, null: true, relation: 'TicketArticleType', default: '9', class: 'medium', item_class: 'keepleft' },
+#      { name: 'internal',                 display: 'Visability',  tag: 'radio',  default: false,  null: true, options: { true: 'internal', false: 'public' }, class: 'medium', item_class: 'keepleft' },
+      {
+        name:     'per_page',
+        display:  'Items per page',
+        tag:      'select',
+        multiple: false,
+        null:     false,
+        default: @overview.view[@view_mode].per_page,
+        options: {
+          15: 15,
+          20: 20,
+          25: 25,
+          30: 30,
+          35: 35,
+        },
+        class: 'medium',
+#        item_class: 'keepleft',
+      },
+      { 
+        name:    'attributes',
+        display: 'Attributes',
+        tag:     'checkbox',
+        default: @overview.view[@view_mode].overview,
+        null:    false,
+        options: {
+#          true:  'internal',
+#          false: 'public',
+          number:                 'Number',
+          title:                  'Title',
+          customer:               'Customer',
+          ticket_state:           'State',
+          ticket_priority:        'Priority',
+          group:                  'Group',
+          owner:                  'Owner',
+          created_at:             'Alter',
+          last_contact:           'Last Contact',
+          last_contact_agent:     'Last Contact Agent',
+          last_contact_customer:  'Last Contact Customer',
+          first_response:         'First Response',
+          close_time:             'Close Time',
+        },
+        class:      'medium',
+      },
+      { 
+        name:    'order_by',
+        display: 'Order',
+        tag:     'select',
+        default: @overview.order.by,
+        null:    false,
+        options: {
+          number:                 'Number',
+          title:                  'Title',
+          customer:               'Customer',
+          ticket_state:           'State',
+          ticket_priority:        'Priority',
+          group:                  'Group',
+          owner:                  'Owner',
+          created_at:             'Alter',
+          last_contact:           'Last Contact',
+          last_contact_agent:     'Last Contact Agent',
+          last_contact_customer:  'Last Contact Customer',
+          first_response:         'First Response',
+          close_time:             'Close Time',
+        },
+        class:      'medium',
+      },
+      { 
+        name:    'order_by_direction',
+        display: 'Direction',
+        tag:     'select',
+        default: @overview.order.direction,
+        null:    false,
+        options: {
+          ASC:   'up',
+          DESC:  'down',
+        },
+        class:      'medium',
+      },
+#      {
+#        name: 'condition',
+#        display: 'Conditions',
+#        tag: 'select',
+#        multiple: false,
+#        null: false,
+#        relation: 'TicketArticleType',
+#        default: '9',
+#        class: 'medium', 
+#        item_class: 'keepleft',
+#      },
+    ]
+    form = @formGen( model: { configure_attributes: @configure_attributes_article } )
+
+    @el.find('.setting').append(form)
+
+    @modalShow()
+
+  submit: (e) =>
+    e.preventDefault()
+    params = @formParam(e.target)
+
+    # check if refetch is needed
+    @reload_needed = 0
+    if @overview.view[@view_mode]['per_page'] isnt params['per_page']
+      @overview.view[@view_mode]['per_page'] = params['per_page']
+      @reload_needed = 1
+
+    if @overview.order['by'] isnt params['order_by']
+      @overview.order['by'] = params['order_by']
+      @reload_needed = 1
+
+    if @overview.order['direction'] isnt params['order_by_direction']
+      @overview.order['direction'] = params['order_by_direction']
+      @reload_needed = 1
+
+    @overview.view[@view_mode]['overview'] = params['attributes']
+
+    @overview.save(
+      success: =>
+        if @reload_needed
+          @overview.trigger('local:refetch')
+        else
+          @overview.trigger('local:rerender')
+    )
+    @modalHide()
+
+Config.Routes['ticket/view/:view'] = Index

app/assets/javascripts/app/controllers/agent_ticket_zoom.js.coffee

@@ -0,0 +1,381 @@
+$ = jQuery.sub()
+
+class Index extends App.Controller
+  events:
+    'click .submit':                          'update',
+    'click [data-type=reply]':                'reply',
+    'click [data-type=reply-all]':            'replyall',
+    'click [data-type=public]':               'public_internal',
+    'click [data-type=internal]':             'public_internal',
+    'click [data-type=history]':              'history_view',
+    'change [name="ticket_article_type_id"]': 'form_update',
+
+  constructor: (params) ->
+    super
+    @log 'zoom', params
+
+    # check authentication
+    return if !@authenticate()
+
+    @navupdate '#'
+
+    @edit_form = undefined
+#    @render()
+    @ticket_id = params.ticket_id
+    @fetch(@ticket_id)
+
+  fetch: (ticket_id) ->
+    # get data
+    @ajax = new App.Ajax
+    @ajax.ajax(
+      type:  'GET',
+      url:   '/ticket_full/' + ticket_id,
+      data:  {
+        view: @view
+      }
+      processData: true,
+      success: (data, status, xhr) =>
+        # reset old indexes
+        @ticket = undefined
+        @articles = undefined
+        
+        # get edit form attributes
+        @edit_form = data.edit_form
+
+        # load user collection
+        @loadCollection( type: 'User', data: data.users )
+
+        # load ticket collection
+        @loadCollection( type: 'Ticket', data: [data.ticket] )
+
+        # load article collections
+        @loadCollection( type: 'TicketArticle', data: data.articles || [] )
+
+        # render page
+        @render()
+    )
+
+  render: =>
+
+    if !App.Ticket.exists(@ticket_id)
+      return
+
+    # get data
+    if !@ticket
+      @ticket = App.Ticket.find(@ticket_id)
+    if !@articles
+      @articles = []
+      for article_id in @ticket.article_ids
+        @articles.push App.TicketArticle.find(article_id)
+
+    # check attachments
+    for article in @articles
+      if article.attachments
+        for attachment in article.attachments
+          attachment.size = @humanFileSize(attachment.size)
+
+    # define actions
+    for article in @articles
+      actions = []
+      if article.internal is true
+        actions = [
+          {
+            name: 'set to public',
+            type: 'public',
+          }
+        ]
+      else
+        actions = [
+          {
+            name: 'set to internal',
+            type: 'internal',
+          }
+        ]      
+      if article.article_type.name is 'note'
+#        actions.push []
+      else
+        if article.article_sender.name is 'Customer'
+          actions.push {
+            name: 'reply',
+            type: 'reply',
+          }
+          actions.push {
+            name: 'reply all',
+            type: 'reply-all',
+          }
+      article.actions = actions
+
+    # set title
+    @title 'Ticket Zoom ' + @ticket.number
+    
+    @configure_attributes_ticket = [
+      { name: 'ticket_state_id',    display: 'State',    tag: 'select',   multiple: false, null: true, relation: 'TicketState', default: 'new', class: 'span2', item_class: 'keepleft' },
+      { name: 'ticket_priority_id', display: 'Priority', tag: 'select',   multiple: false, null: true, relation: 'TicketPriority', default: '2 normal', class: 'span2', item_class: 'keepleft' },
+      { name: 'group_id',           display: 'Group',    tag: 'select',   multiple: false, null: true, relation: 'Group', class: 'span2', item_class: 'keepleft'  },
+      { name: 'owner_id',           display: 'Owner',    tag: 'select',   multiple: false, null: true, relation: 'User', filter: @edit_form, nulloption: true, class: 'span2', item_class: 'keepleft' },
+    ]
+    form_ticket = @formGen( model: { configure_attributes: @configure_attributes_ticket, className: 'create' }, params: @ticket )
+    @configure_attributes_article = [
+#      { name: 'from',                     display: 'From',     tag: 'input',    type: 'text', limit: 100, null: false, class: 'span8',  },
+      { name: 'to',                       display: 'To',          tag: 'input',    type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' },
+      { name: 'cc',                       display: 'Cc',          tag: 'input',    type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' },
+      { name: 'subject',                  display: 'Subject',     tag: 'input',    type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' },
+      { name: 'in_reply_to',              display: 'In Reply to', tag: 'input',    type: 'text', limit: 100, null: true, class: 'span7', item_class: 'hide' },
+      { name: 'body',                     display: 'Text',        tag: 'textarea', rows: 5,  limit: 100, null: true, class: 'span7',  },
+      { name: 'ticket_article_type_id',   display: 'Type',        tag: 'select',   multiple: false, null: true, relation: 'TicketArticleType', default: '9', class: 'medium', item_class: 'keepleft' },
+      { name: 'internal',                 display: 'Visability',  tag: 'radio',  default: false,  null: true, options: { true: 'internal', false: 'public' }, class: 'medium', item_class: 'keepleft' },
+#      { name: 'ticket_article_sender_id', display: 'Sender',   tag: 'select',   multiple: false, null: true, relation: 'TicketArticleSender', default: '', class: 'medium' },
+    ]
+    form_article = @formGen( model: { configure_attributes: @configure_attributes_article } )
+      
+    @html App.view('agent_ticket_zoom')(
+      ticket:       @ticket,
+      articles:     @articles,
+      form_ticket:  form_ticket,
+      form_article: form_article,
+    )
+
+    @userPopups()
+    
+    # start customer info controller
+    new App.UserInfo(
+      el:      @el.find('#customer_info'),
+      user_id: @ticket.customer_id,
+      ticket:  @ticket,
+    )
+
+    @delay(@u, 200)
+    
+  u: =>
+    uploader = new qq.FileUploader(
+      element: document.getElementById('file-uploader'),
+      action: 'ticket_attachment_new',
+      params: {
+        form:    'TicketZoom',
+        form_id: @ticket.id,
+      },
+      debug: false
+    )
+
+  history_view: (e) ->
+    e.preventDefault()
+    new History( ticket_id: @ticket_id )
+
+  public_internal: (e) ->
+    e.preventDefault()
+    article_id = $(e.target).parents('[data-id]').data('id')
+    
+    # storage update
+    article = App.TicketArticle.find(article_id)
+    internal = true
+    if article.internal == true
+      internal = false
+  
+    article.updateAttributes(
+      internal: internal
+    )
+
+    # runtime update
+    for article in @articles
+      if article_id is article.id
+        article['internal'] = internal
+
+    @render()
+
+  form_update: (e) ->
+    ticket_article_type_id = $(e.target).find('option:selected').val()
+    @log 'eeee', e, ticket_article_type_id
+    article_type = App.TicketArticleType.find( ticket_article_type_id )
+    @form_update_execute(article_type)
+
+  form_update_execute: (article_type) =>
+    if article_type.name is 'twitter status'
+
+      # hide to
+      @el.find('[name="to"]').parents('.control-group').addClass('hide')
+      @el.find('[name="cc"]').parents('.control-group').addClass('hide')
+      @el.find('[name="subject"]').parents('.control-group').addClass('hide')
+
+    else if article_type.name is 'twitter direct-message'
+
+      # show
+      @el.find('[name="to"]').parents('.control-group').removeClass('hide')
+      @el.find('[name="cc"]').parents('.control-group').addClass('hide')
+      @el.find('[name="subject"]').parents('.control-group').addClass('hide')
+
+    else if article_type.name is 'note'
+
+      # hide to
+      @el.find('[name="to"]').parents('.control-group').addClass('hide')
+      @el.find('[name="cc"]').parents('.control-group').addClass('hide')
+      @el.find('[name="subject"]').parents('.control-group').addClass('hide')
+
+    else if article_type.name is 'email'
+
+      # show
+      @el.find('[name="to"]').parents('.control-group').removeClass('hide')
+      @el.find('[name="cc"]').parents('.control-group').removeClass('hide')
+#      @el.find('[name="subject"]').parents('.control-group').removeClass('hide')
+
+  reply: (e) =>
+    e.preventDefault()
+    article_id = $(e.target).parents('[data-id]').data('id')
+    article = App.TicketArticle.find( article_id )
+    article_type = App.TicketArticleType.find( article.ticket_article_type_id )
+    customer = App.User.find( article.created_by_id )
+
+    @log 'reply', e, article_type
+
+    # update form
+    @form_update_execute(article_type)
+
+    # preselect article type
+    @el.find('[name="ticket_article_type_id"]').find('option:selected').removeAttr('selected')
+    @el.find('[name="ticket_article_type_id"]').find('[value="' + article_type.id + '"]').attr('selected',true)
+
+    # empty form
+    @el.find('[name="to"]').val('')
+    @el.find('[name="cc"]').val('')
+    @el.find('[name="subject"]').val('')
+    @el.find('[name="in_reply_to"]').val('')
+    
+    if article.message_id
+      @el.find('[name="in_reply_to"]').val(article.message_id)
+
+    if article_type.name is 'twitter status'
+
+      # set to in body
+      to = customer.accounts['twitter'].username || customer.accounts['twitter'].uid
+      @log 'c', customer
+      @el.find('[name="body"]').val('@' + to)
+      
+    else if article_type.name is 'twitter direct-message'
+    
+      # show to
+      to = customer.accounts['twitter'].username || customer.accounts['twitter'].uid
+      @el.find('[name="to"]').val(to)
+    
+    else if article_type.name is 'email'
+      @el.find('[name="to"]').val(article.from)
+#    @log 'reply ', article, @el.find('[name="to"]')
+
+  update: (e) =>
+    e.preventDefault()
+    params = @formParam(e.target)
+    @log 'update', params, @ticket
+
+    # update ticket
+    ticket_update = {}
+    for item in @configure_attributes_ticket
+      ticket_update[item.name] = params[item.name]
+      
+    # check owner assignment
+    if !ticket_update['owner_id']
+      ticket_update['owner_id'] = 1
+
+    @ticket.load( ticket_update )
+    @log 'update ticket', ticket_update, @ticket
+    
+    # disable form
+    @formDisable(e)
+
+    @ticket.save(
+      success: (r) =>
+
+        # create article
+        if params['body']
+          article = new App.TicketArticle
+          params.from = window.Session['firstname'] + ' ' + window.Session['lastname'] 
+          params.ticket_id = @ticket.id
+          
+          # find sender_id
+          sender = App.TicketArticleSender.findByAttribute("name", "Agent")
+          params.ticket_article_sender_id = sender.id
+          @log 'updateAttributes', params, sender, sender.id
+          article.load(params)
+          article.save(
+            success: (r) =>
+              @fetch(@ticket.id)
+          )
+        else
+          @fetch(@ticket.id)
+    )
+    
+#    errors = article.validate()
+#    @log 'error new', errors
+#    @validateForm( form: e.target, errors: errors )
+    return false
+
+
+class History extends App.ControllerModal
+  constructor: ->
+    super
+    @fetch(@ticket_id)
+
+  fetch: (@ticket_id) ->
+    # get data
+    @ajax = new App.Ajax
+    @ajax.ajax(
+      type:  'GET',
+      url:   '/ticket_history/' + ticket_id,
+      data:  {
+#        view: @view
+      }
+#      processData: true,
+      success: (data, status, xhr) =>
+        # remember ticket
+        @ticket = data.ticket
+
+        # load user collection
+        @loadCollection( type: 'User', data: data.users )
+
+        # load ticket collection
+        @loadCollection( type: 'Ticket', data: [data.ticket] )
+
+        # load history_type collections
+        @loadCollection( type: 'HistoryType', data: data.history_types )
+
+        # load history_object collections
+        @loadCollection( type: 'HistoryObject', data: data.history_objects )
+
+        # load history_attributes collections
+        @loadCollection( type: 'HistoryAttribute', data: data.history_attributes )
+
+        # load history collections
+        App.History.deleteAll()
+        @loadCollection( type: 'History', data: data.history )
+
+        # render page
+        @render()
+    )
+
+  render: ->
+
+
+    # create table/overview
+    table = @table(
+      overview_extended: [
+        { name: 'type', },
+        { name: 'attribute', },
+        { name: 'value_from', },
+        { name: 'value_to', },
+        { name: 'created_by', class: 'user-data', data: { id: 1 } },
+        { name: 'created_at', callback: @humanTime },
+      ],
+      model: App.History,
+      objects: App.History.all(),
+    )
+
+
+    @html App.view('agent_ticket_history')(
+#      head: 'New User',
+#      form: @formGen( model: App.User, required: 'quick' ),
+    )
+    @el.find('.table_history').append(table)
+
+    @modalShow()
+    
+    @userPopups()
+
+Config.Routes['ticket/zoom/:ticket_id'] = Index
+Config.Routes['ticket/zoom/:ticket_id/:article_id'] = Index

app/assets/javascripts/app/controllers/channel.js.coffee

@@ -0,0 +1,26 @@
+$ = jQuery.sub()
+
+class Index extends App.ControllerLevel2
+  toggleable: true
+
+  menu: [
+    { name: 'Web',      'target': 'web',      controller: App.ChannelWeb },
+    { name: 'Mail',     'target': 'email',    controller: App.ChannelEmail },
+    { name: 'Chat',     'target': 'chat',     controller: App.ChannelChat },
+    { name: 'Twitter',  'target': 'twitter',  controller: App.ChannelTwitter },
+    { name: 'Facebook', 'target': 'facebook', controller: App.ChannelFacebook },
+  ] 
+  page: {
+    title:     'Channels',
+    sub_title: 'Management'
+    nav:       '#channels',
+  }
+
+  constructor: ->
+    super
+
+    # render page
+    @render()
+
+Config.Routes['channels'] = Index
+

app/assets/javascripts/app/controllers/dashboard.js.coffee

@@ -0,0 +1,60 @@
+$ = jQuery.sub()
+
+class Index extends App.Controller
+
+  constructor: ->
+    super
+    
+    # check authentication
+    return if !@authenticate()
+
+    # set title
+    @title 'Dashboard'
+    @navupdate '#/'
+
+    @plugins = {
+      main: {
+        my_assigned: {
+          controller: App.DashboardTicket,
+          params: {
+            view: 'my_assigned',
+          },
+        },
+        all_unassigned: {
+          controller: App.DashboardTicket,
+          params: {
+            view: 'all_unassigned',
+          },
+        },
+      },
+      side: {
+        activity_stream: {
+          controller: App.DashboardActivityStream,
+        },
+        recent_viewed: {
+          controller: App.DashboardRecentViewed,
+        }
+      }
+    }
+
+    # render page
+    @render()
+
+  render: ->
+    
+    @html App.view('dashboard')(
+      head: 'Dashboard'
+    )
+
+    for area, plugins of @plugins
+      for name, plugin of plugins
+        target = area + '_' + name
+        @el.find('.' + area + '-overviews').append('<div class="" id="' + target + '"></div>')
+        if plugin.controller
+          params = plugin.params || {}
+          params.el = @el.find( '#' + target )
+          new plugin.controller( params )
+
+
+Config.Routes[''] = Index
+Config.Routes['/'] = Index

app/assets/javascripts/app/controllers/getting_started.js.coffee

@@ -0,0 +1,74 @@
+$ = jQuery.sub()
+
+class Index extends App.Controller
+  className: 'container getstarted'
+
+  events:
+    'submit form': 'submit',
+    'click .submit': 'submit',
+
+  constructor: ->
+    super
+    
+    # check authentication
+    return if !@authenticate()
+    
+    # set title
+    @title 'Get Started'
+
+    @render()
+
+    @navupdate '#get_started'
+    
+  render: ->
+    @html App.view('getting_started')(
+      form: @formGen( model: App.User, required: 'invite_agent' ),
+    )
+
+  cancel: ->
+    @log 'cancel....'
+    @navigate 'login'
+
+  submit: (e) ->
+    @log 'submit'
+    e.preventDefault()
+    @params = @formParam(e.target)
+    
+    # if no login is given, use emails as fallback
+    if !@params.login && @params.email
+      @params.login = @params.email
+
+    # find agent role
+    role = App.Role.findByAttribute("name", "Agent")
+    @params.role_ids = role.id
+    
+    # set invite flag
+    @params.invite = true
+
+    @log 'updateAttributes', @params
+    user = new App.User
+    user.load(@params)
+
+    errors = user.validate()
+    if errors
+      @log 'error new', errors
+      @validateForm( form: e.target, errors: errors )
+      return false
+
+    # save user
+    user.save(
+      success: (r) =>
+        # send email
+        
+        # clear form
+        @render()
+#      error: =>
+#        @modalHide()
+    )
+
+Config.Routes['getting_started'] = Index
+
+#class App.GetStarted extends App.Router
+#  routes:
+#    'getting_started': Index
+#Config.Controller.push App.GetStarted;

app/assets/javascripts/app/controllers/groups.js.coffee

@@ -0,0 +1,37 @@
+$ = jQuery.sub()
+
+class Index extends App.Controller
+  constructor: ->
+    super
+
+    # check authentication
+    return if !@authenticate()
+
+    new App.ControllerGenericIndex(
+      el: @el,
+      id: @id,
+      genericObject: App.Group,
+      pageData: {
+        title: 'Groups',
+        home: 'groups',
+        object: 'Group',
+        objects: 'Groups',
+        navupdate: '#groups',
+        notes: [
+          'Groups are ...'
+        ],
+        buttons: [
+          { name: 'New Group', 'data-type': 'new', class: 'primary' },
+        ],
+      },
+    )
+
+
+Config.Routes['groups'] = Index
+
+#class App.Groups extends App.Router
+#  routes:
+#    'groups/new':      New
+#    'groups/:id/edit': Edit
+#    'groups':          Index
+#Config.Controller.push App.Groups

app/assets/javascripts/app/controllers/login.js.coffee

@@ -0,0 +1,97 @@
+$ = jQuery.sub()
+Note = App.Note
+
+$.fn.item = ->
+  elementID   = $(@).data('id')
+  elementID or= $(@).parents('[data-id]').data('id')
+  Note.find(elementID)
+
+class Index extends App.Controller
+  events:
+    'submit #login': 'login',
+    'click #register': 'register'
+    
+  constructor: ->
+    super
+    @title 'Sign in'
+    @render()
+    @navupdate '#login'
+
+  render: (data = {}) ->
+    @html App.view('login')(item: data)
+    if $(@el).find('[name="username"]').val()
+      $(@el).find('[name="username"]').focus()
+  
+  login: (e) ->
+    e.preventDefault()
+    e.stopPropagation();
+
+    @log 'submit', $(e.target)
+    @username = $(e.target).find('[name="username"]').val()
+    @password = $(e.target).find('[name="password"]').val()
+#    @log @username, @password 
+    
+    # session create with login/password
+    auth = new App.Auth
+    auth.login(
+      data: {
+        username: @username,
+        password: @password,
+      },
+      success: @success
+      error: @error,
+    )
+ 
+  success: (data, status, xhr) =>
+    @log 'login:success', data
+
+    # set avatar
+    if !data.session.image
+      data.session.image = 'http://placehold.it/48x48'
+
+    # update config
+    for key, value of data.config
+      window.Config[key] = value
+
+    # store user data
+    for key, value of data.session
+      window.Session[key] = value
+
+    # refresh default collections
+    for key, value of data.default_collections
+      App[key].refresh( value, options: { clear: true } )
+
+    Spine.trigger 'navrebuild', data.session
+
+    # add notify
+    Spine.trigger 'notify:removeall'
+    Spine.trigger 'notify', {
+      type: 'success',
+      msg: 'Login successfully! Have a nice day!', 
+    }
+    
+    # redirect to #
+    @navigate '#/'
+
+  error: (xhr, statusText, error) =>
+    console.log 'login:error'
+    
+    # add notify
+    Spine.trigger 'notify:removeall'
+    Spine.trigger 'notify', {
+      type: 'warning',
+      msg: 'Wrong Username and Password combination.', 
+    }
+    
+    # rerender login page
+    @render(
+      msg: 'Wrong Username and Password combination.', 
+      username: @username
+    )
+
+Config.Routes['login'] = Index
+
+#class App.Login extends App.Router
+#  routes:
+#    'login': Index
+#Config.Controller.push App.Login

app/assets/javascripts/app/controllers/logout.js.coffee

@@ -0,0 +1,30 @@
+$ = jQuery.sub()
+
+class Index extends Spine.Controller
+
+  constructor: ->
+    super
+
+    @signout()
+  
+  signout: ->
+    
+    # remove remote session
+    auth = new App.Auth
+    auth.logout()
+
+    # remoce local session
+    @log 'Session', window.Session
+    window.Session = {}
+    @log 'Session', window.Session
+    Spine.trigger 'navrebuild'
+    
+    # redirect to login 
+    @navigate 'login'
+
+Config.Routes['logout'] = Index
+
+#class App.Logout extends App.Router
+#  routes:
+#    'logout': Index
+#Config.Controller.push App.Logout

app/assets/javascripts/app/controllers/navigation.js.coffee

@@ -0,0 +1,169 @@
+$ = jQuery.sub()
+Note = App.Note
+
+$.fn.item = ->
+  elementID   = $(@).data('id')
+  elementID or= $(@).parents('[data-id]').data('id')
+  Note.find(elementID)
+
+class App.Navigation extends Spine.Controller
+  events:
+    'focusin [data-type=edit]':     'edit_in'
+
+  constructor: ->
+    super
+    @log 'nav...'
+    @render()
+    
+    Spine.bind 'navupdate', (data) =>
+      @update(arguments[0])
+    
+    Spine.bind 'navrebuild', (user) =>
+      @log 'navbarrebuild', user
+      @render(user)
+
+    Spine.bind 'navupdate_remote', (user) =>
+      @log 'navupdate_remote'
+      @sync
+    
+    # rerender if new overview data is there
+    @delay( @sync, 1800 )
+    
+  render: (user) ->
+#    @log 'nav render', Config.NavBar
+#    @log '111', _.keys(Config.NavBar)
+    navbar =  _.values(Config.NavBar)
+    
+    level1 = []
+    dropdown = {}
+
+    for item in navbar
+      if !item.parent
+        match = 0
+        if !window.Session['roles']
+          match = _.include(item.role, 'Anybody')
+        if window.Session['roles']
+          window.Session['roles'].forEach( (role) =>
+            if !match
+              match = _.include(item.role, role.name)
+          )
+          
+        if match
+          level1.push item
+            
+    for item in navbar
+      if item.parent && !dropdown[ item.parent ]
+        dropdown[ item.parent ] = []
+
+        # find all childs and order
+        for itemSub in navbar
+          if itemSub.parent is item.parent
+            match = 0
+            if !window.Session['roles']
+              match = _.include(itemSub.role, 'Anybody')
+            if window.Session['roles']
+              window.Session['roles'].forEach( (role) =>
+                if !match
+                  match = _.include(itemSub.role, role.name)
+              )
+              
+            if match
+              dropdown[ item.parent ].push itemSub
+
+        # find parent
+        for itemLevel1 in level1
+          if itemLevel1.target is item.parent
+            sub = @getOrder(dropdown[ item.parent ])
+            itemLevel1.child = sub
+            
+    nav = @getOrder(level1)
+    @html App.view('navigation')(
+      navbar: nav,
+      user: user,
+    )
+
+  getOrder: (data) ->
+    newlist = {}
+    for item in data
+      # check if same prio already exists
+      @addPrioCount newlist, item
+
+      newlist[ item['prio'] ] = item;
+
+    # get keys for sort order    
+    keys = _.keys(newlist)
+    inorder = keys.sort(@sortit)
+
+    # create new array with prio sort order
+    inordervalue = []
+    for num in inorder
+      inordervalue.push newlist[ num ]
+    return inordervalue
+  
+  sortit: (a,b) ->  
+    return(a-b)
+    
+  addPrioCount: (newlist, item) ->
+     if newlist[ item['prio'] ]
+        item['prio']++
+        if newlist[ item['prio'] ]
+          @addPrioCount newlist, item
+    
+  update: (url) =>
+    @el.find('li').removeClass('active')
+#    if url isnt '#'
+    @el.find("[href=\"#{url}\"]").parents('li').addClass('active')
+#      @el.find("[href*=\"#{url}\"]").parents('li').addClass('active')
+
+  sync: =>
+    
+    @ticket_overview()
+
+    # auto save
+    every = (ms, cb) -> setInterval cb, ms
+
+    # clear auto save
+    clearInterval(@intervalID) if @intervalID
+    
+    # request new data
+    @intervalID = every 40000, () =>
+      @ticket_overview()
+ 
+  # get data
+  ticket_overview: =>
+
+    # do no load and rerender if sub-menu is open
+    open = @el.find('.open').val()
+    if open isnt undefined
+      return
+    
+    # do no load and rerender if user is not logged in
+    if !window.Session['id']
+      return
+
+    @ajax = new App.Ajax
+    @ajax.ajax(
+      type:  'GET',
+      url:   '/ticket_overviews',
+      data:  {},
+      processData: true,
+      success: (data, status, xhr) =>
+
+        # remove old views
+        for key of Config.NavBar
+          if Config.NavBar[key].parent is '#ticket/view'
+            delete Config.NavBar[key]
+
+        # add new views
+        for item in data
+          Config.NavBar['TicketOverview' + item.url] = {
+            prio:   item.prio,
+            parent: '#ticket/view',
+            name:   item.name + ' (' + item.count + ')',
+            target: '#ticket/view/' + item.url,
+            role:   ['Agent'],
+          }
+
+        # rebuild navbar
+        Spine.trigger 'navrebuild', window.Session
+    )

app/assets/javascripts/app/controllers/network.js.coffee

@@ -0,0 +1,71 @@
+$ = jQuery.sub()
+Note = App.Note
+
+$.fn.item = ->
+  elementID   = $(@).data('id')
+  elementID or= $(@).parents('[data-id]').data('id')
+  Note.find(elementID)
+
+class Index extends App.Controller  
+  events:
+    'click [data-type=network-new]':              'network_new'
+    'click [data-type=network-edit]':             'network_edit'
+    'click [data-type=network-destroy]':          'network_destory'
+    'click [data-type=network-category-new]':     'network_category_new'
+    'click [data-type=network-category-edit]':    'network_category_edit'
+    'click [data-type=network-category-destroy]': 'network_category_destroy'
+
+  constructor: ->
+    super
+    
+    # set title
+    @title 'Network'
+    @render()
+    @navupdate '#network'
+    
+  render: ->
+    networks = App.Network.all()
+    network_categories = App.NetworkCategory.all()
+    for network in networks
+      @log 'f', network    for network in networks
+
+    for network_category in network_categories
+      @log 'fc', network_category
+      
+    @html App.view('network')(
+      networks: App.Network.all(),
+    )
+    
+  network_new: (e) ->
+    e.preventDefault()
+    new App.ControllerGenericNewWindow(
+      pageData: {
+        object: 'Network',
+      },
+      genericObject: App.Network,
+      success: =>
+        @render()
+    )
+        
+  network_edit: (e) ->
+    e.preventDefault()
+    @id = $(e.target).parents('[data-id]').data('id')
+    new App.ControllerGenericEditWindow(
+      id: @id,
+      pageData: {
+        object: 'Network',
+      },
+      genericObject: App.Network,
+      success: =>
+        @render()
+    )
+    
+  network_destory: (e) ->
+    e.preventDefault()
+    id = $(e.target).parents('[data-id]').data('id')
+    item = App.Network.find(id)
+    item.destroy() if confirm('Sure?')
+    @render()
+
+
+Config.Routes['network'] = Index

app/assets/javascripts/app/controllers/notify.js.coffee

@@ -0,0 +1,44 @@
+$ = jQuery.sub()
+#Post = App.Post
+
+class App.Notify extends Spine.Controller
+  events:
+    'click .alert': 'destroy'
+
+  className: 'container'
+
+  constructor: ->
+    super
+    
+    Spine.bind 'notify', (data) =>
+#      @log 'bind notify', data
+      @[data.type] data.msg
+
+    Spine.bind 'notify:removeall', =>
+      @log 'notify:removeall', @
+      @destroyAll()
+
+  info: (data) ->
+    @render( text: arguments[0], type: 'alert-info' )
+    
+  warning: (data) ->
+    @render( text: arguments[0], type: 'alert-warning' )
+    
+  error: (data) ->
+    @render( text: arguments[0], type: 'alert-error' )
+    
+  success: (data) ->
+    @render( text: arguments[0], type: 'alert-success' )
+    
+  render: (data) ->
+    notify = App.view('notify')(data: data)
+    @append( notify )
+#    notify.html('')
+
+  destroy: (e) ->
+    e.preventDefault()
+    $(e.target).parents('.alert').remove();
+
+  destroyAll: ->
+    $(@el).find('.alert').remove();
+

app/assets/javascripts/app/controllers/organizations.js.coffee

@@ -0,0 +1,65 @@
+$ = jQuery.sub()
+
+class Index extends App.Controller
+  constructor: ->
+    super
+    
+    # check authentication
+    return if !@authenticate()
+    
+    new App.ControllerGenericIndex(
+      el: @el,
+      id: @id,
+      genericObject: App.Organization,
+      pageData: {
+        title: 'Organizations',
+        home: 'organizations',
+        object: 'Organization',
+        objects: 'Organizations',
+        navupdate: '#organizations',
+        notes: [
+          'Organizations are for any person in the system. Agents (Owners, Resposbiles, ...) and Customers.'
+        ],
+        buttons: [
+          { name: 'New Organization', 'data-type': 'new', class: 'primary' },
+        ],
+      },
+    )
+
+#Config.Routes['organizations/new'] = New
+#Config.Routes['organizations/:id/edit'] = Edit
+Config.Routes['organizations'] = Index
+
+
+Config.NavBar['Admin'] = { prio: 10000, parent: '', name: 'Manage', target: '#admin', role: ['Admin'] }
+Config.NavBar['AdminUser'] = { prio: 1000, parent: '#admin', name: 'Users', target: '#users', role: ['Admin'] }
+Config.NavBar['AdminGroup'] = { prio: 1500, parent: '#admin', name: 'Groups', target: '#groups', role: ['Admin'] }
+Config.NavBar['AdminOrganization'] = { prio: 2000, parent: '#admin', name: 'Organizations', target: '#organizations', role: ['Admin'] }
+Config.NavBar['AdminChannels'] = { prio: 2500, parent: '#admin', name: 'Channels', target: '#channels', role: ['Admin'] }
+Config.NavBar['AdminTrigger'] = { prio: 3000, parent: '#admin', name: 'Trigger', target: '#trigger', role: ['Admin'] }
+Config.NavBar['AdminScheduler'] = { prio: 3500, parent: '#admin', name: 'Scheduler', target: '#scheduler', role: ['Admin'] }
+
+
+Config.NavBar['Note'] = { prio: 1500, parent: '', name: 'Notes', target: '#notes', role: ['Notes'] }
+#Config.NavBar['Post'] = { prio: 1600, parent: '', name: 'Posts', target: '#posts', role: ['Agent'] }
+
+Config.NavBar['Setting'] = { prio: 20000, parent: '', name: 'Settings', target: '#settings', role: ['Admin'] }
+Config.NavBar['SettingSystem']   = { prio: 1400, parent: '#settings', name: 'System', target: '#settings/system', role: ['Admin'] }
+Config.NavBar['SettingSecurity'] = { prio: 1500, parent: '#settings', name: 'Security', target: '#settings/security', role: ['Admin'] }
+Config.NavBar['SettingTicket']   = { prio: 1600, parent: '#settings', name: 'Ticket', target: '#settings/ticket', role: ['Admin'] }
+Config.NavBar['SettingObject']   = { prio: 1700, parent: '#settings', name: 'Objects', target: '#settings/objects', role: ['Admin'] }
+
+Config.NavBar['Packages']   = { prio: 1800, parent: '#settings', name: 'Packages', target: '#packages', role: ['Admin'] }
+
+
+Config.NavBar['TicketOverview'] = { prio: 1000, parent: '', name: 'Overviews', target: '#ticket/view', role: ['Agent'] }
+#Config.NavBar[''] = { prio: 1000, parent: '#ticket/view', name: 'My assigned Tickets (51)', target: '#ticket/view/my_assigned', role: ['Agent'] }
+#Config.NavBar[''] = { prio: 1000, parent: '#ticket/view', name: 'Unassigned Tickets (133)', target: '#ticket/view/all_unassigned', role: ['Agent'] }
+#Config.NavBar[''] = { prio: 1000, parent: '#ticket/view', name: 'Escalated Tickets (0)', target: '#ticket/view/all_escalated', role: ['Agent'] }
+#Config.NavBar[''] = { prio: 1000, parent: '#ticket/view', name: 'My Pending reached Tickets (2)', target: '#ticket/view/my_pending_reached', role: ['Agent'] }
+
+
+#Config.NavBar['Network'] = { prio: 1500, parent: '', name: 'Networking', target: '#network', role: ['Anybody', 'Customer', 'Agent'] }
+#Config.NavBar[''] = { prio: 1600, parent: '', name: 'anybody+agent', target: '#aa', role: ['Anybody', 'Agent'] }
+#Config.NavBar[''] = { prio: 1600, parent: '', name: 'Anybody', target: '#anybody', role: ['Anybody'] }
+Config.NavBar['CustomerTickets'] = { prio: 1600, parent: '', name: 'Tickets', target: '#customer_tickets', role: ['Customer'] }

app/assets/javascripts/app/controllers/profile.js.coffee

@@ -0,0 +1,32 @@
+$ = jQuery.sub()
+Note = App.Note
+
+$.fn.item = ->
+  elementID   = $(@).data('id')
+  elementID or= $(@).parents('[data-id]').data('id')
+  Note.find(elementID)
+
+class Index extends App.Controller
+  events:
+    'focusin [data-type=edit]':     'edit_in'
+
+  constructor: ->
+    super
+    
+    # set title
+    @title 'Profile'
+
+    @render()
+    
+    @navupdate '#profile'
+
+    
+  render: ->
+    @html App.view('profile')()
+
+Config.Routes['profile'] = Index
+
+#class App.Profile extends App.Router
+#  routes:
+#    'profile': Index
+#Config.Controller.push App.Profile

app/assets/javascripts/app/controllers/scheduler.js.coffee

@@ -0,0 +1,23 @@
+$ = jQuery.sub()
+
+class Index extends App.Controller
+  constructor: ->
+    super
+
+    # check authentication
+    return if !@authenticate()
+
+    # set title
+    @title 'Scheduler'
+    @navupdate '#scheduler'
+
+    # render page
+    @render()
+
+  render: ->
+    
+    @html App.view('scheduler')(
+      head: 'some header'
+    )
+Config.Routes['scheduler'] = Index
+

app/assets/javascripts/app/controllers/settings.js.coffee

@@ -0,0 +1,55 @@
+$ = jQuery.sub()
+
+class Index extends App.ControllerLevel2
+  toggleable: false
+  toggleable: true
+
+  constructor: ->
+    super
+
+    # system
+    if @type is 'system'
+      @menu = [
+        { name: 'Base',     'target': 'base',      controller: App.SettingsArea, params: { area: 'System::Base' } },
+    #    { name: 'Language', 'target': 'language',  controller: App.SettingsSystem, params: { area: 'System::Language' } },
+    #    { name: 'Log',      'target': 'log',       controller: App.SettingsSystem, params: { area: 'System::Log' } },
+        { name: 'Storage',  'target': 'storage',   controller: App.SettingsArea, params: { area: 'System::Storage' } },
+      ]
+      @page = {
+        title:     'System',
+        sub_title: 'Settings'
+        nav:       '#settings/system',
+      }
+
+    # security
+    if @type is 'security'
+      @menu = [
+        { name: 'Authentication', 'target': 'auth',      controller: App.SettingsArea, params: { area: 'Security::Authentication' } },
+        { name: 'Password',       'target': 'password',  controller: App.SettingsArea, params: { area: 'Security::Password' } },
+#        { name: 'Session',        'target': 'session',   controller: '' },
+      ] 
+      @page = {
+        title:     'Security',
+        sub_title: 'Settings'
+        nav:       '#settings/security',
+      }
+
+    # ticket
+    if @type is 'ticket'
+      @menu = [
+        { name: 'Base',           'target': 'base',          controller: App.SettingsArea, params: { area: 'Ticket::Base' } },
+        { name: 'Number',         'target': 'number',        controller: App.SettingsArea, params: { area: 'Ticket::Number' } },
+        { name: 'Sender Format',  'target': 'sender-format', controller: App.SettingsArea, params: { area: 'Ticket::SenderFormat' } },
+      ] 
+      @page = {
+        title:     'Ticket',
+        sub_title: 'Settings'
+        nav:       '#settings/ticket',
+      }
+
+    # render page
+    @render()
+
+Config.Routes['settings/:type/:target'] = Index
+Config.Routes['settings/:type'] = Index
+

app/assets/javascripts/app/controllers/signup.js.coffee

@@ -0,0 +1,121 @@
+$ = jQuery.sub()
+User = App.User
+
+class Index extends App.Controller
+  className: 'container signup'
+  
+  events:
+    'submit form': 'submit',
+    'click .submit': 'submit',
+    'click .cancel': 'cancel',
+
+  constructor: ->
+    super
+    
+    # set title
+    @title 'Sign up'
+
+    @render()
+    
+    @navupdate '#signup'
+
+    
+  render: ->
+    
+    # set password as required
+    for item in User.configure_attributes
+      if item.name is 'password'
+        item.null = false
+
+    @html App.view('signup')(
+      form: @formGen( model: User, required: 'signup' ),
+    )
+
+  cancel: ->
+    @log 'cancel....'
+    @navigate 'login'
+
+  submit: (e) ->
+    @log 'submit'
+    e.preventDefault()
+    @params = @formParam(e.target)
+    ###
+    for num in [1..199]
+      user = new User
+      params.login = 'login_c' + num
+      user.updateAttributes(params)
+    return false
+    ###
+    
+    # if no login is given, use emails as fallback
+    if !@params.login && @params.email
+      @params.login = @params.email
+      
+#    role = App.Role.findByAttribute("name", "Customer")
+#    @params.role_ids = role.id
+#    @params.role_ids = 3
+    @params.role_ids = []
+    @log 'updateAttributes', @params
+    user = new User
+    user.load(@params)
+
+    errors = user.validate()
+    if errors
+      @log 'error new', errors
+      @validateForm( form: e.target, errors: errors )
+      return false
+
+    # save user
+    user.save(
+      success: (r) =>
+        auth = new App.Auth
+        auth.login(
+          data: {
+            username: @params.login,
+            password: @params.password,
+          },
+          success: @success
+          error: @error,
+        )
+#      error: =>
+#        @modalHide()
+    )
+  
+  success: (data, status, xhr) =>
+    @log 'login:success', data
+
+    # login check
+    auth = new App.Auth
+    auth.loginCheck()
+
+    # add notify
+    Spine.trigger 'notify:removeall'
+    @notify
+      type: 'success',
+      msg: 'Thanks for joining. Email sent to "' + @params.email + '". Please verify your email address.'
+    
+    # redirect to #
+    @navigate '#'
+
+  error: (xhr, statusText, error) =>
+    console.log 'login:error'
+    
+    # add notify
+    Spine.trigger 'notify:removeall'
+    Spine.trigger 'notify', {
+      type: 'warning',
+      msg: 'Wrong Username and Password combination.', 
+    }
+    
+    # rerender login page
+    @render(
+      msg: 'Wrong Username and Password combination.', 
+      username: @username
+    )
+
+Config.Routes['signup'] = Index
+
+#class App.SignUp extends App.Router
+#  routes:
+#    'signup': Index
+#Config.Controller.push App.SignUp

app/assets/javascripts/app/controllers/trigger.js.coffee

@@ -0,0 +1,34 @@
+$ = jQuery.sub()
+
+class Index extends App.Controller
+  constructor: ->
+    super
+
+    # check authentication
+    return if !@authenticate()
+
+    # set title
+    @title 'Triggers'
+    @navupdate '#trigger'
+
+    # render page
+    @render()
+
+  render: ->
+    
+    @html App.view('trigger')(
+      head: 'some header'
+    )
+Config.Routes['trigger'] = Index
+
+#class App.Triggers extends App.Router
+#  routes:
+#    'triggers/web':      New
+#    'triggers/email':    New
+#    'triggers/twitter':  New
+#    'triggers/facebook': New
+#    'triggers/new':      New
+#    'triggers/:id/edit': Edit
+#    'triggers':          Index
+#
+#Config.Controller.push App.Triggers

app/assets/javascripts/app/controllers/user_info.js.coffee

@@ -0,0 +1,68 @@
+$ = jQuery.sub()
+
+class App.UserInfo extends App.Controller
+  events:
+    'focusout [data-type=edit]': 'update',
+
+  constructor: ->
+    super
+
+    # fetch item on demand
+    fetch_needed = 1
+    if App.User.exists(@user_id)
+      @user = App.User.find(@user_id)
+      @log 'exists', @user
+      fetch_needed = 0
+      @render()
+
+    if fetch_needed
+      @reload(@user_id)
+
+  reload: (user_id) =>
+      App.User.bind 'refresh', =>
+        @log 'loading....', user_id
+        @user = App.User.find(user_id)
+        @render()
+        App.User.unbind 'refresh'
+      App.User.fetch( id: user_id )
+    
+  render: ->
+
+    # define links to linked accounts
+    if @user['accounts']
+      for account of @user['accounts']
+        if account == 'twitter'
+          @user['accounts'][account]['link'] = 'http://twitter.com/' + @user['accounts'][account]['username']
+        if account == 'facebook'
+          @user['accounts'][account]['link'] = 'https://www.facebook.com/profile.php?id=' + @user['accounts'][account]['uid']
+
+    # set default image url
+    if !@user.image
+      @user.image = 'http://placehold.it/48x48'
+
+    # get display data
+    data = []
+    for item in App.User.configure_attributes
+      if item.name isnt 'firstname'
+        if item.name isnt 'lastname'
+          if item.info #&& ( @user[item.name] || item.name isnt 'note' )
+            data.push item
+
+    # insert data
+    @html App.view('user_info')(
+      user: @user,
+      data: data,
+    )
+    
+    @userTicketPopups(
+      selector: '.user-tickets',
+      user_id:  @user.id,
+    )
+
+  update: (e) =>
+    
+    # update changes
+    note = $(e.target).parent().find('[data-type=edit]').val()
+    if @user.note isnt note
+      @user.updateAttributes( note: note )
+      @log 'update', e, note, @user

app/assets/javascripts/app/controllers/users.js.coffee

@@ -0,0 +1,39 @@
+$ = jQuery.sub()
+
+class Index extends App.Controller
+  constructor: ->
+    super
+
+    # check authentication
+    return if !@authenticate()
+
+    new App.ControllerGenericIndex(
+      el: @el,
+      id: @id,
+      genericObject: App.User,
+      ignoreObjectIDs: [1], 
+      pageData: {
+        title: 'Users',
+        home: 'users',
+        object: 'User',
+        objects: 'Users',
+        navupdate: '#users',
+        notes: [
+          'Users are for any person in the system. Agents (Owners, Resposbiles, ...) and Customers.'
+        ],
+        buttons: [
+#          { name: 'List', 'data-type': '', class: 'active' },
+          { name: 'New User', 'data-type': 'new', class: 'primary' },
+        ],
+      }
+    )
+
+Config.Routes['users'] = Index
+
+#class App.Users extends App.Router
+#  routes:
+#    'users/new':      New
+#    'users/:id/edit': Edit
+#    'users':          Index
+#
+#Config.Controller.push App.Users

app/assets/javascripts/app/index.js.coffee

@@ -0,0 +1,195 @@
+#s#= require json2
+#= require jquery
+
+#= require ./lib/spine/spine.coffee
+#= require ./lib/spine/ajax.coffee
+#= require ./lib/spine/route.coffee
+#not_userd= require ./lib/spine/manager.coffee
+
+#= require ./lib/bootstrap-dropdown.js
+#= require ./lib/bootstrap-tooltip.js
+#= require ./lib/bootstrap-popover.js
+#= require ./lib/bootstrap-modal.js
+#= require ./lib/bootstrap-tab.js
+
+#= require ./lib/underscore.coffee
+#= require ./lib/ba-linkify.js
+#= require ./lib/ui/jquery.ui.core.js
+#= require ./lib/ui/jquery.ui.widget.js
+#= require ./lib/ui/jquery.ui.position.js
+#= require ./lib/ui/jquery.ui.autocomplete.js
+#not_used= require_tree ./lib/uis
+#not_used= require ./lib/jquery.autocomplete.js
+#= require ./lib/jquery.tagsinput.js
+#= require ./lib/fileuploader.js
+
+#not_used= require_tree ./lib
+#= require_self
+#= require_tree ./models
+#= require_tree ./controllers
+#= require_tree ./views
+
+class App extends Spine.Controller
+  @view: (name) ->
+    JST["app/views/#{name}"]
+
+###
+class App.Config extends Spine.Module
+  constructor: ->
+    super
+    @config = {}
+    
+  set: (key, value) =>
+    @config[key] = value
+    
+  get: (key) =>
+    @config[key]
+    
+  append: (key, value) =>
+    if !@config[key]
+      @config[key] = []
+      
+    @config[key].push = value
+
+
+Config2 = new App.Config
+Config2.set( 'a', 123)
+console.log '1112222', Config2.get( 'a')
+###
+
+class App.Ajax
+  defaults:
+    contentType: 'application/json'
+    dataType: 'json'
+    processData: false
+    headers: {'X-Requested-With': 'XMLHttpRequest'}
+    cache: false
+
+  ajax: (params, defaults) ->
+    $.ajax($.extend({}, @defaults, defaults, params))
+
+class App.Auth extends App.Ajax
+  constructor: ->
+    console.log 'auth'
+
+  login: (params) ->
+    console.log 'login(...)', params
+    @ajax(
+#      params,
+      type:   'POST',
+      url:     '/signin',
+      data:    JSON.stringify(params.data),
+      success: params.success,
+      error:   params.error,
+    )
+
+  loginCheck: ->
+    console.log 'loginCheck(...)'
+    @ajax(
+      async: false,
+      type:  'GET',
+      url:   '/signshow',
+      success: (data, status, xhr) =>
+        console.log 'logincheck:success', data
+
+        # set avatar
+        if !data.session.image
+          data.session.image = 'http://placehold.it/48x48'
+
+        # update config
+        for key, value of data.config
+          window.Config[key] = value
+
+        # store user data
+        for key, value of data.session
+          window.Session[key] = value
+    
+        # refresh/load default collections
+        for key, value of data.default_collections
+          App[key].refresh( value, options: { clear: true } )
+
+        # rebuild navbar with new navbar items
+        Spine.trigger 'navrebuild', data.session
+    
+        # rebuild navbar with updated ticket count of overviews
+        Spine.trigger 'navupdate_remote'
+
+
+      error: (xhr, statusText, error) =>
+        console.log 'loginCheck:error'#, error, statusText, xhr.statusCode
+       
+        # empty session
+        window.Session = {}
+
+    )
+
+  logout: ->
+    console.log 'logout(...)'
+    @ajax(
+      type: 'DELETE',
+      url:  '/signout',
+    )
+
+class App.Run extends Spine.Controller
+  constructor: ->
+    super
+    @log 'RUN app'#, @
+    @el = $('#app')
+
+    # start navigation controller
+    new App.Navigation( el: @el.find('#navigation') );
+
+    # check if session already exists/try to get session data from server
+    auth = new App.Auth
+    auth.loginCheck()
+
+    # start notify controller
+    new App.Notify( el: @el.find('#notify') );
+    
+    # start content
+    new App.Content( el: @el.find('#content') );
+
+
+#class App.Content extends Spine.Stack
+class App.Content extends Spine.Controller
+  className: 'container'
+
+  constructor: ->
+#    @controllers = {}
+#    @routes = {}
+#    @default = '/'
+#    for route, controller of Config.Routes
+##      @log 'route,controller', route, controller
+#      @controllers[route] = controller
+#      @routes[route] = route
+
+    super
+    @log 'RUN content'#, @
+
+    for route, callback of Config.Routes
+#      @log 'route,controller', route#, controller
+      do (route, callback) =>
+        @route(route, (params) ->
+#          @log 'routing...', route
+          Config['ActiveController'] = route
+          
+          # unbind in controller area
+          @el.unbind()
+          @el.undelegate()
+ 
+          params.el = @el
+          params.auth = @auth
+          new callback( params )
+
+          # scroll to top
+#          window.scrollTo(0,0)
+        )
+
+#    for name, object of Config.Controller
+##      @log 'new', object, @el
+#      new object( el: @el, auth: @auth )
+
+    Spine.Route.setup()    
+
+window.App = App
+

app/assets/javascripts/app/lib/ba-linkify.js

@@ -0,0 +1,179 @@
+/*!
+ * linkify - v0.3 - 6/27/2009
+ * http://benalman.com/code/test/js-linkify/
+ * 
+ * Copyright (c) 2009 "Cowboy" Ben Alman
+ * Licensed under the MIT license
+ * http://benalman.com/about/license/
+ * 
+ * Some regexps adapted from http://userscripts.org/scripts/review/7122
+ */
+
+// Turn text into linkified html.
+// 
+// var html = linkify( text, options );
+// 
+// options:
+// 
+//  callback (Function) - default: undefined - if defined, this will be called
+//    for each link- or non-link-chunk with two arguments, text and href. If the
+//    chunk is non-link, href will be omitted.
+// 
+//  punct_regexp (RegExp | Boolean) - a RegExp that can be used to trim trailing
+//    punctuation from links, instead of the default.
+// 
+// This is a work in progress, please let me know if (and how) it fails!
+
+window.linkify = (function(){
+  var
+    SCHEME = "[a-z\\d.-]+://",
+    IPV4 = "(?:(?:[0-9]|[1-9]\\d|1\\d{2}|2[0-4]\\d|25[0-5])\\.){3}(?:[0-9]|[1-9]\\d|1\\d{2}|2[0-4]\\d|25[0-5])",
+    HOSTNAME = "(?:(?:[^\\s!@#$%^&*()_=+[\\]{}\\\\|;:'\",.<>/?]+)\\.)+",
+    TLD = "(?:ac|ad|aero|ae|af|ag|ai|al|am|an|ao|aq|arpa|ar|asia|as|at|au|aw|ax|az|ba|bb|bd|be|bf|bg|bh|biz|bi|bj|bm|bn|bo|br|bs|bt|bv|bw|by|bz|cat|ca|cc|cd|cf|cg|ch|ci|ck|cl|cm|cn|coop|com|co|cr|cu|cv|cx|cy|cz|de|dj|dk|dm|do|dz|ec|edu|ee|eg|er|es|et|eu|fi|fj|fk|fm|fo|fr|ga|gb|gd|ge|gf|gg|gh|gi|gl|gm|gn|gov|gp|gq|gr|gs|gt|gu|gw|gy|hk|hm|hn|hr|ht|hu|id|ie|il|im|info|int|in|io|iq|ir|is|it|je|jm|jobs|jo|jp|ke|kg|kh|ki|km|kn|kp|kr|kw|ky|kz|la|lb|lc|li|lk|lr|ls|lt|lu|lv|ly|ma|mc|md|me|mg|mh|mil|mk|ml|mm|mn|mobi|mo|mp|mq|mr|ms|mt|museum|mu|mv|mw|mx|my|mz|name|na|nc|net|ne|nf|ng|ni|nl|no|np|nr|nu|nz|om|org|pa|pe|pf|pg|ph|pk|pl|pm|pn|pro|pr|ps|pt|pw|py|qa|re|ro|rs|ru|rw|sa|sb|sc|sd|se|sg|sh|si|sj|sk|sl|sm|sn|so|sr|st|su|sv|sy|sz|tc|td|tel|tf|tg|th|tj|tk|tl|tm|tn|to|tp|travel|tr|tt|tv|tw|tz|ua|ug|uk|um|us|uy|uz|va|vc|ve|vg|vi|vn|vu|wf|ws|xn--0zwm56d|xn--11b5bs3a9aj6g|xn--80akhbyknj4f|xn--9t4b11yi5a|xn--deba0ad|xn--g6w251d|xn--hgbk6aj7f53bba|xn--hlcj6aya9esc7a|xn--jxalpdlp|xn--kgbechtv|xn--zckzah|ye|yt|yu|za|zm|zw)",
+    HOST_OR_IP = "(?:" + HOSTNAME + TLD + "|" + IPV4 + ")",
+    PATH = "(?:[;/][^#?<>\\s]*)?",
+    QUERY_FRAG = "(?:\\?[^#<>\\s]*)?(?:#[^<>\\s]*)?",
+    URI1 = "\\b" + SCHEME + "[^<>\\s]+",
+    URI2 = "\\b" + HOST_OR_IP + PATH + QUERY_FRAG + "(?!\\w)",
+    
+    MAILTO = "mailto:",
+    EMAIL = "(?:" + MAILTO + ")?[a-z0-9!#$%&'*+/=?^_`{|}~-]+(?:\\.[a-z0-9!#$%&'*+/=?^_`{|}~-]+)*@" + HOST_OR_IP + QUERY_FRAG + "(?!\\w)",
+    
+    URI_RE = new RegExp( "(?:" + URI1 + "|" + URI2 + "|" + EMAIL + ")", "ig" ),
+    SCHEME_RE = new RegExp( "^" + SCHEME, "i" ),
+    
+    quotes = {
+      "'": "`",
+      '>': '<',
+      ')': '(',
+      ']': '[',
+      '}': '{',
+      '»': '«',
+      '›': '‹'
+    },
+    
+    default_options = {
+      callback: function( text, href ) {
+//        return href ? '<a href="' + href + '" title="' + href + '">' + text + '<\/a>' : text;
+        return href ? '<a href="' + href + '" title="' + href + '" target="_blank">' + text + '<\/a>' : text;
+      },
+      punct_regexp: /(?:[!?.,:;'"]|(?:&|&amp;)(?:lt|gt|quot|apos|raquo|laquo|rsaquo|lsaquo);)$/
+    };
+  
+  return function( txt, options ) {
+    options = options || {};
+    
+    // me
+    txt = txt 
+      .replace(/&/g, '&amp;')
+      .replace(/"/g, '&quot;')
+      .replace(/'/g, '&#39;')
+      .replace(/</g, '&lt;')
+      .replace(/>/g, '&gt;');
+    // me
+    // Temp variables.
+    var arr,
+      i,
+      link,
+      href,
+      
+      // Output HTML.
+      html = '',
+      
+      // Store text / link parts, in order, for re-combination.
+      parts = [],
+      
+      // Used for keeping track of indices in the text.
+      idx_prev,
+      idx_last,
+      idx,
+      link_last,
+      
+      // Used for trimming trailing punctuation and quotes from links.
+      matches_begin,
+      matches_end,
+      quote_begin,
+      quote_end;
+    
+    // Initialize options.
+    for ( i in default_options ) {
+      if ( options[ i ] === undefined ) {
+        options[ i ] = default_options[ i ];
+      }
+    }
+    
+    // Find links.
+    while ( arr = URI_RE.exec( txt ) ) {
+      
+      link = arr[0];
+      idx_last = URI_RE.lastIndex;
+      idx = idx_last - link.length;
+      
+      // Not a link if preceded by certain characters.
+      if ( /[\/:]/.test( txt.charAt( idx - 1 ) ) ) {
+        continue;
+      }
+      
+      // Trim trailing punctuation.
+      do {
+        // If no changes are made, we don't want to loop forever!
+        link_last = link;
+        
+        quote_end = link.substr( -1 )
+        quote_begin = quotes[ quote_end ];
+        
+        // Ending quote character?
+        if ( quote_begin ) {
+          matches_begin = link.match( new RegExp( '\\' + quote_begin + '(?!$)', 'g' ) );
+          matches_end = link.match( new RegExp( '\\' + quote_end, 'g' ) );
+          
+          // If quotes are unbalanced, remove trailing quote character.
+          if ( ( matches_begin ? matches_begin.length : 0 ) < ( matches_end ? matches_end.length : 0 ) ) {
+            link = link.substr( 0, link.length - 1 );
+            idx_last--;
+          }
+        }
+        
+        // Ending non-quote punctuation character?
+        if ( options.punct_regexp ) {
+          link = link.replace( options.punct_regexp, function(a){
+            idx_last -= a.length;
+            return '';
+          });
+        }
+      } while ( link.length && link !== link_last );
+      
+      href = link;
+      
+      // Add appropriate protocol to naked links.
+      if ( !SCHEME_RE.test( href ) ) {
+        href = ( href.indexOf( '@' ) !== -1 ? ( !href.indexOf( MAILTO ) ? '' : MAILTO )
+          : !href.indexOf( 'irc.' ) ? 'irc://'
+          : !href.indexOf( 'ftp.' ) ? 'ftp://'
+          : 'http://' )
+          + href;
+      }
+      
+      // Push preceding non-link text onto the array.
+      if ( idx_prev != idx ) {
+        parts.push([ txt.slice( idx_prev, idx ) ]);
+        idx_prev = idx_last;
+      }
+      
+      // Push massaged link onto the array
+      parts.push([ link, href ]);
+    };
+    
+    // Push remaining non-link text onto the array.
+    parts.push([ txt.substr( idx_prev ) ]);
+    
+    // Process the array items.
+    for ( i = 0; i < parts.length; i++ ) {
+      html += options.callback.apply( window, parts[i] );
+    }
+    
+    // In case of catastrophic failure, return the original text;
+    return html || txt;
+  };
+  
+})();

app/assets/javascripts/app/lib/bootstrap-dropdown.js

@@ -0,0 +1,92 @@
+/* ============================================================
+ * bootstrap-dropdown.js v2.0.0
+ * http://twitter.github.com/bootstrap/javascript.html#dropdowns
+ * ============================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ============================================================ */
+
+
+!function( $ ){
+
+  "use strict"
+
+ /* DROPDOWN CLASS DEFINITION
+  * ========================= */
+
+  var toggle = '[data-toggle="dropdown"]'
+    , Dropdown = function ( element ) {
+        var $el = $(element).on('click.dropdown.data-api', this.toggle)
+        $('html').on('click.dropdown.data-api', function () {
+          $el.parent().removeClass('open')
+        })
+      }
+
+  Dropdown.prototype = {
+
+    constructor: Dropdown
+
+  , toggle: function ( e ) {
+      var $this = $(this)
+        , selector = $this.attr('data-target')
+        , $parent
+        , isActive
+
+      if (!selector) {
+        selector = $this.attr('href')
+        selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
+      }
+
+      $parent = $(selector)
+      $parent.length || ($parent = $this.parent())
+
+      isActive = $parent.hasClass('open')
+
+      clearMenus()
+      !isActive && $parent.toggleClass('open')
+
+      return false
+    }
+
+  }
+
+  function clearMenus() {
+    $(toggle).parent().removeClass('open')
+  }
+
+
+  /* DROPDOWN PLUGIN DEFINITION
+   * ========================== */
+
+  $.fn.dropdown = function ( option ) {
+    return this.each(function () {
+      var $this = $(this)
+        , data = $this.data('dropdown')
+      if (!data) $this.data('dropdown', (data = new Dropdown(this)))
+      if (typeof option == 'string') data[option].call($this)
+    })
+  }
+
+  $.fn.dropdown.Constructor = Dropdown
+
+
+  /* APPLY TO STANDARD DROPDOWN ELEMENTS
+   * =================================== */
+
+  $(function () {
+    $('html').on('click.dropdown.data-api', clearMenus)
+    $('body').on('click.dropdown.data-api', toggle, Dropdown.prototype.toggle)
+  })
+
+}( window.jQuery )

app/assets/javascripts/app/lib/bootstrap-modal.js

@@ -0,0 +1,209 @@
+/* =========================================================
+ * bootstrap-modal.js v2.0.0
+ * http://twitter.github.com/bootstrap/javascript.html#modals
+ * =========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ========================================================= */
+
+
+!function( $ ){
+
+  "use strict"
+
+ /* MODAL CLASS DEFINITION
+  * ====================== */
+
+  var Modal = function ( content, options ) {
+    this.options = $.extend({}, $.fn.modal.defaults, options)
+    this.$element = $(content)
+      .delegate('[data-dismiss="modal"]', 'click.dismiss.modal', $.proxy(this.hide, this))
+  }
+
+  Modal.prototype = {
+
+      constructor: Modal
+
+    , toggle: function () {
+        return this[!this.isShown ? 'show' : 'hide']()
+      }
+
+    , show: function () {
+        var that = this
+
+        if (this.isShown) return
+
+        $('body').addClass('modal-open')
+
+        this.isShown = true
+        this.$element.trigger('show')
+
+        escape.call(this)
+        backdrop.call(this, function () {
+          var transition = $.support.transition && that.$element.hasClass('fade')
+
+          !that.$element.parent().length && that.$element.appendTo(document.body) //don't move modals dom position
+
+          that.$element
+            .show()
+
+          if (transition) {
+            that.$element[0].offsetWidth // force reflow
+          }
+
+          that.$element.addClass('in')
+
+          transition ?
+            that.$element.one($.support.transition.end, function () { that.$element.trigger('shown') }) :
+            that.$element.trigger('shown')
+
+        })
+      }
+
+    , hide: function ( e ) {
+        e && e.preventDefault()
+
+        if (!this.isShown) return
+
+        var that = this
+        this.isShown = false
+
+        $('body').removeClass('modal-open')
+
+        escape.call(this)
+
+        this.$element
+          .trigger('hide')
+          .removeClass('in')
+
+        $.support.transition && this.$element.hasClass('fade') ?
+          hideWithTransition.call(this) :
+          hideModal.call(this)
+      }
+
+  }
+
+
+ /* MODAL PRIVATE METHODS
+  * ===================== */
+
+  function hideWithTransition() {
+    var that = this
+      , timeout = setTimeout(function () {
+          that.$element.off($.support.transition.end)
+          hideModal.call(that)
+        }, 500)
+
+    this.$element.one($.support.transition.end, function () {
+      clearTimeout(timeout)
+      hideModal.call(that)
+    })
+  }
+
+  function hideModal( that ) {
+    this.$element
+      .hide()
+      .trigger('hidden')
+
+    backdrop.call(this)
+  }
+
+  function backdrop( callback ) {
+    var that = this
+      , animate = this.$element.hasClass('fade') ? 'fade' : ''
+
+    if (this.isShown && this.options.backdrop) {
+      var doAnimate = $.support.transition && animate
+
+      this.$backdrop = $('<div class="modal-backdrop ' + animate + '" />')
+        .appendTo(document.body)
+
+      if (this.options.backdrop != 'static') {
+        this.$backdrop.click($.proxy(this.hide, this))
+      }
+
+      if (doAnimate) this.$backdrop[0].offsetWidth // force reflow
+
+      this.$backdrop.addClass('in')
+
+      doAnimate ?
+        this.$backdrop.one($.support.transition.end, callback) :
+        callback()
+
+    } else if (!this.isShown && this.$backdrop) {
+      this.$backdrop.removeClass('in')
+
+      $.support.transition && this.$element.hasClass('fade')?
+        this.$backdrop.one($.support.transition.end, $.proxy(removeBackdrop, this)) :
+        removeBackdrop.call(this)
+
+    } else if (callback) {
+      callback()
+    }
+  }
+
+  function removeBackdrop() {
+    this.$backdrop.remove()
+    this.$backdrop = null
+  }
+
+  function escape() {
+    var that = this
+    if (this.isShown && this.options.keyboard) {
+      $(document).on('keyup.dismiss.modal', function ( e ) {
+        e.which == 27 && that.hide()
+      })
+    } else if (!this.isShown) {
+      $(document).off('keyup.dismiss.modal')
+    }
+  }
+
+
+ /* MODAL PLUGIN DEFINITION
+  * ======================= */
+
+  $.fn.modal = function ( option ) {
+    return this.each(function () {
+      var $this = $(this)
+        , data = $this.data('modal')
+        , options = typeof option == 'object' && option
+      if (!data) $this.data('modal', (data = new Modal(this, options)))
+      if (typeof option == 'string') data[option]()
+      else data.show()
+    })
+  }
+
+  $.fn.modal.defaults = {
+      backdrop: true
+    , keyboard: true
+  }
+
+  $.fn.modal.Constructor = Modal
+
+
+ /* MODAL DATA-API
+  * ============== */
+
+  $(function () {
+    $('body').on('click.modal.data-api', '[data-toggle="modal"]', function ( e ) {
+      var $this = $(this), href
+        , $target = $($this.attr('data-target') || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7
+        , option = $target.data('modal') ? 'toggle' : $.extend({}, $target.data(), $this.data())
+
+      e.preventDefault()
+      $target.modal(option)
+    })
+  })
+
+}( window.jQuery )

app/assets/javascripts/app/lib/bootstrap-popover.js

@@ -0,0 +1,96 @@
+/* ===========================================================
+ * bootstrap-popover.js v2.0.0
+ * http://twitter.github.com/bootstrap/javascript.html#popovers
+ * ===========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * =========================================================== */
+
+
+!function( $ ) {
+
+ "use strict"
+
+  var Popover = function ( element, options ) {
+    this.init('popover', element, options)
+  }
+
+  /* NOTE: POPOVER EXTENDS BOOTSTRAP-TOOLTIP.js
+     ========================================== */
+
+  Popover.prototype = $.extend({}, $.fn.tooltip.Constructor.prototype, {
+
+    constructor: Popover
+
+  , setContent: function () {
+      var $tip = this.tip()
+        , title = this.getTitle()
+        , content = this.getContent()
+
+      $tip.find('.popover-title')[ $.type(title) == 'object' ? 'append' : 'html' ](title)
+      $tip.find('.popover-content > *')[ $.type(content) == 'object' ? 'append' : 'html' ](content)
+
+      $tip.removeClass('fade top bottom left right in')
+    }
+
+  , hasContent: function () {
+      return this.getTitle() || this.getContent()
+    }
+
+  , getContent: function () {
+      var content
+        , $e = this.$element
+        , o = this.options
+
+      content = $e.attr('data-content')
+        || (typeof o.content == 'function' ? o.content($e[0]) :  o.content)
+//        || (typeof o.content == 'function' ? o.content.call($e[0]) :  o.content)
+
+      content = content.toString().replace(/(^\s*|\s*$)/, "")
+
+      return content
+    }
+
+  , tip: function() {
+      if (!this.$tip) {
+        this.$tip = $(this.options.template)
+      }
+      return this.$tip
+    }
+
+  })
+
+
+ /* POPOVER PLUGIN DEFINITION
+  * ======================= */
+
+  $.fn.popover = function ( option ) {
+    return this.each(function () {
+      var $this = $(this)
+        , data = $this.data('popover')
+        , options = typeof option == 'object' && option
+      if (!data) $this.data('popover', (data = new Popover(this, options)))
+      if (typeof option == 'string') data[option]()
+    })
+  }
+
+  $.fn.popover.Constructor = Popover
+
+  $.fn.popover.defaults = $.extend({} , $.fn.tooltip.defaults, {
+    placement: 'right'
+  , content: ''
+  , template: '<div class="popover"><div class="arrow"></div><div class="popover-inner"><h3 class="popover-title"></h3><div class="popover-content"><p></p></div></div></div>'
+  })
+
+}( window.jQuery )

app/assets/javascripts/app/lib/bootstrap-tab.js

@@ -0,0 +1,130 @@
+/* ========================================================
+ * bootstrap-tab.js v2.0.0
+ * http://twitter.github.com/bootstrap/javascript.html#tabs
+ * ========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ======================================================== */
+
+
+!function( $ ){
+
+  "use strict"
+
+ /* TAB CLASS DEFINITION
+  * ==================== */
+
+  var Tab = function ( element ) {
+    this.element = $(element)
+  }
+
+  Tab.prototype = {
+
+    constructor: Tab
+
+  , show: function () {
+      var $this = this.element
+        , $ul = $this.closest('ul:not(.dropdown-menu)')
+        , selector = $this.attr('data-target')
+        , previous
+        , $target
+
+      if (!selector) {
+        selector = $this.attr('href')
+        selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7
+      }
+
+      if ( $this.parent('li').hasClass('active') ) return
+
+      previous = $ul.find('.active a').last()[0]
+
+      $this.trigger({
+        type: 'show'
+      , relatedTarget: previous
+      })
+
+      $target = $(selector)
+
+      this.activate($this.parent('li'), $ul)
+      this.activate($target, $target.parent(), function () {
+        $this.trigger({
+          type: 'shown'
+        , relatedTarget: previous
+        })
+      })
+    }
+
+  , activate: function ( element, container, callback) {
+      var $active = container.find('> .active')
+        , transition = callback
+            && $.support.transition
+            && $active.hasClass('fade')
+
+      function next() {
+        $active
+          .removeClass('active')
+          .find('> .dropdown-menu > .active')
+          .removeClass('active')
+
+        element.addClass('active')
+
+        if (transition) {
+          element[0].offsetWidth // reflow for transition
+          element.addClass('in')
+        } else {
+          element.removeClass('fade')
+        }
+
+        if ( element.parent('.dropdown-menu') ) {
+          element.closest('li.dropdown').addClass('active')
+        }
+
+        callback && callback()
+      }
+
+      transition ?
+        $active.one($.support.transition.end, next) :
+        next()
+
+      $active.removeClass('in')
+    }
+  }
+
+
+ /* TAB PLUGIN DEFINITION
+  * ===================== */
+
+  $.fn.tab = function ( option ) {
+    return this.each(function () {
+      var $this = $(this)
+        , data = $this.data('tab')
+      if (!data) $this.data('tab', (data = new Tab(this)))
+      if (typeof option == 'string') data[option]()
+    })
+  }
+
+  $.fn.tab.Constructor = Tab
+
+
+ /* TAB DATA-API
+  * ============ */
+
+  $(function () {
+    $('body').on('click.tab.data-api', '[data-toggle="tab"], [data-toggle="pill"]', function (e) {
+      e.preventDefault()
+      $(this).tab('show')
+    })
+  })
+
+}( window.jQuery )

app/assets/javascripts/app/lib/bootstrap-tooltip.js

@@ -0,0 +1,271 @@
+/* ===========================================================
+ * bootstrap-tooltip.js v2.0.0
+ * http://twitter.github.com/bootstrap/javascript.html#tooltips
+ * Inspired by the original jQuery.tipsy by Jason Frame
+ * ===========================================================
+ * Copyright 2012 Twitter, Inc.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ * ========================================================== */
+
+!function( $ ) {
+
+  "use strict"
+
+ /* TOOLTIP PUBLIC CLASS DEFINITION
+  * =============================== */
+
+  var Tooltip = function ( element, options ) {
+    this.init('tooltip', element, options)
+  }
+
+  Tooltip.prototype = {
+
+    constructor: Tooltip
+
+  , init: function ( type, element, options ) {
+      var eventIn
+        , eventOut
+
+      this.type = type
+      this.$element = $(element)
+      this.options = this.getOptions(options)
+      this.enabled = true
+
+      if (this.options.trigger != 'manual') {
+        eventIn  = this.options.trigger == 'hover' ? 'mouseenter' : 'focus'
+        eventOut = this.options.trigger == 'hover' ? 'mouseleave' : 'blur'
+        this.$element.on(eventIn, this.options.selector, $.proxy(this.enter, this))
+        this.$element.on(eventOut, this.options.selector, $.proxy(this.leave, this))
+      }
+
+      this.options.selector ?
+        (this._options = $.extend({}, this.options, { trigger: 'manual', selector: '' })) :
+        this.fixTitle()
+    }
+
+  , getOptions: function ( options ) {
+      options = $.extend({}, $.fn[this.type].defaults, options, this.$element.data())
+
+      if (options.delay && typeof options.delay == 'number') {
+        options.delay = {
+          show: options.delay
+        , hide: options.delay
+        }
+      }
+
+      return options
+    }
+
+  , enter: function ( e ) {
+      var self = $(e.currentTarget)[this.type](this._options).data(this.type)
+
+      if (!self.options.delay || !self.options.delay.show) {
+        self.show()
+      } else {
+        self.hoverState = 'in'
+        setTimeout(function() {
+          if (self.hoverState == 'in') {
+            self.show()
+          }
+        }, self.options.delay.show)
+      }
+    }
+
+  , leave: function ( e ) {
+      var self = $(e.currentTarget)[this.type](this._options).data(this.type)
+
+      if (!self.options.delay || !self.options.delay.hide) {
+        self.hide()
+      } else {
+        self.hoverState = 'out'
+        setTimeout(function() {
+          if (self.hoverState == 'out') {
+            self.hide()
+          }
+        }, self.options.delay.hide)
+      }
+    }
+
+  , show: function () {
+      var $tip
+        , inside
+        , pos
+        , actualWidth
+        , actualHeight
+        , placement
+        , tp
+
+      if (this.hasContent() && this.enabled) {
+        $tip = this.tip()
+        this.setContent()
+
+        if (this.options.animation) {
+          $tip.addClass('fade')
+        }
+
+        placement = typeof this.options.placement == 'function' ?
+          this.options.placement.call(this, $tip[0], this.$element[0]) :
+          this.options.placement
+
+        inside = /in/.test(placement)
+
+        $tip
+          .remove()
+          .css({ top: 0, left: 0, display: 'block' })
+          .appendTo(inside ? this.$element : document.body)
+
+        pos = this.getPosition(inside)
+
+        actualWidth = $tip[0].offsetWidth
+        actualHeight = $tip[0].offsetHeight
+
+        switch (inside ? placement.split(' ')[1] : placement) {
+          case 'bottom':
+            tp = {top: pos.top + pos.height, left: pos.left + pos.width / 2 - actualWidth / 2}
+            break
+          case 'top':
+            tp = {top: pos.top - actualHeight, left: pos.left + pos.width / 2 - actualWidth / 2}
+            break
+          case 'left':
+            tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left - actualWidth}
+            break
+          case 'right':
+            tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left + pos.width}
+            break
+        }
+
+        $tip
+          .css(tp)
+          .addClass(placement)
+          .addClass('in')
+      }
+    }
+
+  , setContent: function () {
+      var $tip = this.tip()
+      $tip.find('.tooltip-inner').html(this.getTitle())
+      $tip.removeClass('fade in top bottom left right')
+    }
+
+  , hide: function () {
+      var that = this
+        , $tip = this.tip()
+
+      $tip.removeClass('in')
+
+      function removeWithAnimation() {
+        var timeout = setTimeout(function () {
+          $tip.off($.support.transition.end).remove()
+        }, 500)
+
+        $tip.one($.support.transition.end, function () {
+          clearTimeout(timeout)
+          $tip.remove()
+        })
+      }
+
+      $.support.transition && this.$tip.hasClass('fade') ?
+        removeWithAnimation() :
+        $tip.remove()
+    }
+
+  , fixTitle: function () {
+      var $e = this.$element
+      if ($e.attr('title') || typeof($e.attr('data-original-title')) != 'string') {
+        $e.attr('data-original-title', $e.attr('title') || '').removeAttr('title')
+      }
+    }
+
+  , hasContent: function () {
+      return this.getTitle()
+    }
+
+  , getPosition: function (inside) {
+      return $.extend({}, (inside ? {top: 0, left: 0} : this.$element.offset()), {
+        width: this.$element[0].offsetWidth
+      , height: this.$element[0].offsetHeight
+      })
+    }
+
+  , getTitle: function () {
+      var title
+        , $e = this.$element
+        , o = this.options
+
+      title = $e.attr('data-original-title')
+        || (typeof o.title == 'function' ? o.title($e[0]) :  o.title)
+//        || (typeof o.title == 'function' ? o.title.call($e[0]) :  o.title)
+
+      title = title.toString().replace(/(^\s*|\s*$)/, "")
+
+      return title
+    }
+
+  , tip: function () {
+      return this.$tip = this.$tip || $(this.options.template)
+    }
+
+  , validate: function () {
+      if (!this.$element[0].parentNode) {
+        this.hide()
+        this.$element = null
+        this.options = null
+      }
+    }
+
+  , enable: function () {
+      this.enabled = true
+    }
+
+  , disable: function () {
+      this.enabled = false
+    }
+
+  , toggleEnabled: function () {
+      this.enabled = !this.enabled
+    }
+
+  , toggle: function () {
+      this[this.tip().hasClass('in') ? 'hide' : 'show']()
+    }
+
+  }
+
+
+ /* TOOLTIP PLUGIN DEFINITION
+  * ========================= */
+
+  $.fn.tooltip = function ( option ) {
+    return this.each(function () {
+      var $this = $(this)
+        , data = $this.data('tooltip')
+        , options = typeof option == 'object' && option
+      if (!data) $this.data('tooltip', (data = new Tooltip(this, options)))
+      if (typeof option == 'string') data[option]()
+    })
+  }
+
+  $.fn.tooltip.Constructor = Tooltip
+
+  $.fn.tooltip.defaults = {
+    animation: true
+  , delay: 0
+  , selector: false
+  , placement: 'top'
+  , trigger: 'hover'
+  , title: ''
+  , template: '<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>'
+  }
+
+}( window.jQuery )

app/assets/javascripts/app/lib/jquery.tagsinput.js

@@ -0,0 +1,353 @@
+/*
+
+	jQuery Tags Input Plugin 1.3.3
+	
+	Copyright (c) 2011 XOXCO, Inc
+	
+	Documentation for this plugin lives here:
+	http://xoxco.com/clickable/jquery-tags-input
+	
+	Licensed under the MIT license:
+	http://www.opensource.org/licenses/mit-license.php
+
+	ben@xoxco.com
+
+*/
+
+(function($) {
+
+	var delimiter = new Array();
+	var tags_callbacks = new Array();
+	$.fn.doAutosize = function(o){
+	    var minWidth = $(this).data('minwidth'),
+	        maxWidth = $(this).data('maxwidth'),
+	        val = '',
+	        input = $(this),
+	        testSubject = $('#'+$(this).data('tester_id'));
+	
+	    if (val === (val = input.val())) {return;}
+	
+	    // Enter new content into testSubject
+	    var escaped = val.replace(/&/g, '&amp;').replace(/\s/g,' ').replace(/</g, '&lt;').replace(/>/g, '&gt;');
+	    testSubject.html(escaped);
+	    // Calculate new width + whether to change
+	    var testerWidth = testSubject.width(),
+	        newWidth = (testerWidth + o.comfortZone) >= minWidth ? testerWidth + o.comfortZone : minWidth,
+	        currentWidth = input.width(),
+	        isValidWidthChange = (newWidth < currentWidth && newWidth >= minWidth)
+	                             || (newWidth > minWidth && newWidth < maxWidth);
+	
+	    // Animate width
+	    if (isValidWidthChange) {
+	        input.width(newWidth);
+	    }
+
+
+  };
+  $.fn.resetAutosize = function(options){
+    // alert(JSON.stringify(options));
+    var minWidth =  $(this).data('minwidth') || options.minInputWidth || $(this).width(),
+        maxWidth = $(this).data('maxwidth') || options.maxInputWidth || ($(this).closest('.tagsinput').width() - options.inputPadding),
+        val = '',
+        input = $(this),
+        testSubject = $('<tester/>').css({
+            position: 'absolute',
+            top: -9999,
+            left: -9999,
+            width: 'auto',
+            fontSize: input.css('fontSize'),
+            fontFamily: input.css('fontFamily'),
+            fontWeight: input.css('fontWeight'),
+            letterSpacing: input.css('letterSpacing'),
+            whiteSpace: 'nowrap'
+        }),
+        testerId = $(this).attr('id')+'_autosize_tester';
+    if(! $('#'+testerId).length > 0){
+      testSubject.attr('id', testerId);
+      testSubject.appendTo('body');
+    }
+
+    input.data('minwidth', minWidth);
+    input.data('maxwidth', maxWidth);
+    input.data('tester_id', testerId);
+    input.css('width', minWidth);
+  };
+  
+	$.fn.addTag = function(value,options) {
+			options = jQuery.extend({focus:false,callback:true},options);
+			this.each(function() { 
+				var id = $(this).attr('id');
+
+				var tagslist = $(this).val().split(delimiter[id]);
+				if (tagslist[0] == '') { 
+					tagslist = new Array();
+				}
+
+				value = jQuery.trim(value);
+		
+				if (options.unique) {
+					var skipTag = $(tagslist).tagExist(value);
+					if(skipTag == true) {
+					    //Marks fake input as not_valid to let styling it
+    				    $('#'+id+'_tag').addClass('not_valid');
+    				}
+				} else {
+					var skipTag = false; 
+				}
+				
+				if (value !='' && skipTag != true) { 
+                    $('<span>').addClass('tag').append(
+                        $('<span>').text(value).append('&nbsp;&nbsp;'),
+                        $('<a>', {
+                            href  : '#',
+                            title : 'Removing tag',
+                            text  : 'x'
+                        }).click(function () {
+                            return $('#' + id).removeTag(escape(value));
+                        })
+                    ).insertBefore('#' + id + '_addTag');
+
+					tagslist.push(value);
+				
+					$('#'+id+'_tag').val('');
+					if (options.focus) {
+						$('#'+id+'_tag').focus();
+					} else {		
+						$('#'+id+'_tag').blur();
+					}
+					
+					$.fn.tagsInput.updateTagsField(this,tagslist);
+					
+					if (options.callback && tags_callbacks[id] && tags_callbacks[id]['onAddTag']) {
+						var f = tags_callbacks[id]['onAddTag'];
+						f.call(this, value);
+					}
+					if(tags_callbacks[id] && tags_callbacks[id]['onChange'])
+					{
+						var i = tagslist.length;
+						var f = tags_callbacks[id]['onChange'];
+						f.call(this, $(this), tagslist[i-1]);
+					}					
+				}
+		
+			});		
+			
+			return false;
+		};
+		
+	$.fn.removeTag = function(value) { 
+			value = unescape(value);
+			this.each(function() { 
+				var id = $(this).attr('id');
+	
+				var old = $(this).val().split(delimiter[id]);
+					
+				$('#'+id+'_tagsinput .tag').remove();
+				str = '';
+				for (i=0; i< old.length; i++) { 
+					if (old[i]!=value) { 
+						str = str + delimiter[id] +old[i];
+					}
+				}
+				
+				$.fn.tagsInput.importTags(this,str);
+
+				if (tags_callbacks[id] && tags_callbacks[id]['onRemoveTag']) {
+					var f = tags_callbacks[id]['onRemoveTag'];
+					f.call(this, value);
+				}
+			});
+					
+			return false;
+		};
+	
+	$.fn.tagExist = function(val) {
+		return (jQuery.inArray(val, $(this)) >= 0); //true when tag exists, false when not
+	};
+	
+	// clear all existing tags and import new ones from a string
+	$.fn.importTags = function(str) {
+                id = $(this).attr('id');
+		$('#'+id+'_tagsinput .tag').remove();
+		$.fn.tagsInput.importTags(this,str);
+	}
+		
+	$.fn.tagsInput = function(options) { 
+    var settings = jQuery.extend({
+      interactive:true,
+      defaultText:'add a tag',
+      minChars:0,
+      width:'300px',
+      height:'100px',
+      autocomplete: {selectFirst: false },
+      'hide':true,
+      'delimiter':',',
+      'unique':true,
+      removeWithBackspace:true,
+      placeholderColor:'#666666',
+      autosize: true,
+      comfortZone: 20,
+      inputPadding: 6*2
+    },options);
+
+		this.each(function() { 
+			if (settings.hide) { 
+				$(this).hide();				
+			}
+				
+			var id = $(this).attr('id')
+			
+			var data = jQuery.extend({
+				pid:id,
+				real_input: '#'+id,
+				holder: '#'+id+'_tagsinput',
+				input_wrapper: '#'+id+'_addTag',
+				fake_input: '#'+id+'_tag'
+			},settings);
+	
+			delimiter[id] = data.delimiter;
+			
+			if (settings.onAddTag || settings.onRemoveTag || settings.onChange) {
+				tags_callbacks[id] = new Array();
+				tags_callbacks[id]['onAddTag'] = settings.onAddTag;
+				tags_callbacks[id]['onRemoveTag'] = settings.onRemoveTag;
+				tags_callbacks[id]['onChange'] = settings.onChange;
+			}
+	
+			var markup = '<div id="'+id+'_tagsinput" class="tagsinput"><div id="'+id+'_addTag">';
+			
+			if (settings.interactive) {
+				markup = markup + '<input id="'+id+'_tag" value="" data-default="'+settings.defaultText+'" />';
+			}
+			
+			markup = markup + '</div><div class="tags_clear"></div></div>';
+			
+			$(markup).insertAfter(this);
+
+			$(data.holder).css('width',settings.width);
+			$(data.holder).css('height',settings.height);
+	
+			if ($(data.real_input).val()!='') { 
+				$.fn.tagsInput.importTags($(data.real_input),$(data.real_input).val());
+			}		
+			if (settings.interactive) { 
+				$(data.fake_input).val($(data.fake_input).attr('data-default'));
+				$(data.fake_input).css('color',settings.placeholderColor);
+		        $(data.fake_input).resetAutosize(settings);
+		
+				$(data.holder).bind('click',data,function(event) {
+					$(event.data.fake_input).focus();
+				});
+			
+				$(data.fake_input).bind('focus',data,function(event) {
+					if ($(event.data.fake_input).val()==$(event.data.fake_input).attr('data-default')) { 
+						$(event.data.fake_input).val('');
+					}
+					$(event.data.fake_input).css('color','#000000');		
+				});
+						
+				if (settings.autocomplete_url != undefined) {
+          // 2012-02-23 me
+//          autocomplete_options = {source: settings.autocomplete_url};
+          autocomplete_options = settings.auto;
+          // 2012-02-23 me
+					for (attrname in settings.autocomplete) { 
+						autocomplete_options[attrname] = settings.autocomplete[attrname]; 
+					}
+				
+					if (jQuery.Autocompleter !== undefined) {
+						$(data.fake_input).autocomplete(settings.autocomplete_url, settings.autocomplete);
+						$(data.fake_input).bind('result',data,function(event,data,formatted) {
+							if (data) {
+								$('#'+id).addTag(data[0] + "",{focus:true,unique:(settings.unique)});
+							}
+					  	});
+					} else if (jQuery.ui.autocomplete !== undefined) {
+						$(data.fake_input).autocomplete(autocomplete_options);
+						$(data.fake_input).bind('autocompleteselect',data,function(event,ui) {
+							$(event.data.real_input).addTag(ui.item.value,{focus:true,unique:(settings.unique)});
+							return false;
+						});
+					}
+				
+					
+				} else {
+						// if a user tabs out of the field, create a new tag
+						// this is only available if autocomplete is not used.
+						$(data.fake_input).bind('blur',data,function(event) { 
+							var d = $(this).attr('data-default');
+							if ($(event.data.fake_input).val()!='' && $(event.data.fake_input).val()!=d) { 
+								if( (event.data.minChars <= $(event.data.fake_input).val().length) && (!event.data.maxChars || (event.data.maxChars >= $(event.data.fake_input).val().length)) )
+									$(event.data.real_input).addTag($(event.data.fake_input).val(),{focus:true,unique:(settings.unique)});
+							} else {
+								$(event.data.fake_input).val($(event.data.fake_input).attr('data-default'));
+								$(event.data.fake_input).css('color',settings.placeholderColor);
+							}
+							return false;
+						});
+				
+				}
+				// if user types a comma, create a new tag
+				$(data.fake_input).bind('keypress',data,function(event) {
+					if (event.which==event.data.delimiter.charCodeAt(0) || event.which==13 ) {
+					    event.preventDefault();
+						if( (event.data.minChars <= $(event.data.fake_input).val().length) && (!event.data.maxChars || (event.data.maxChars >= $(event.data.fake_input).val().length)) )
+							$(event.data.real_input).addTag($(event.data.fake_input).val(),{focus:true,unique:(settings.unique)});
+					  	$(event.data.fake_input).resetAutosize(settings);
+						return false;
+					} else if (event.data.autosize) {
+			            $(event.data.fake_input).doAutosize(settings);
+            
+          			}
+				});
+				//Delete last tag on backspace
+				data.removeWithBackspace && $(data.fake_input).bind('keydown', function(event)
+				{
+					if(event.keyCode == 8 && $(this).val() == '')
+					{
+						 event.preventDefault();
+						 var last_tag = $(this).closest('.tagsinput').find('.tag:last').text();
+						 var id = $(this).attr('id').replace(/_tag$/, '');
+						 last_tag = last_tag.replace(/[\s]+x$/, '');
+						 $('#' + id).removeTag(escape(last_tag));
+						 $(this).trigger('focus');
+					}
+				});
+				$(data.fake_input).blur();
+				
+				//Removes the not_valid class when user changes the value of the fake input
+				if(data.unique) {
+				    $(data.fake_input).keydown(function(event){
+				        if(event.keyCode == 8 || String.fromCharCode(event.which).match(/\w+|[áéíóúÁÉÍÓÚñÑ,/]+/)) {
+				            $(this).removeClass('not_valid');
+				        }
+				    });
+				}
+			} // if settings.interactive
+			return false;
+		});
+			
+		return this;
+	
+	};
+	
+	$.fn.tagsInput.updateTagsField = function(obj,tagslist) { 
+		var id = $(obj).attr('id');
+		$(obj).val(tagslist.join(delimiter[id]));
+	};
+	
+	$.fn.tagsInput.importTags = function(obj,val) {			
+		$(obj).val('');
+		var id = $(obj).attr('id');
+		var tags = val.split(delimiter[id]);
+		for (i=0; i<tags.length; i++) { 
+			$(obj).addTag(tags[i],{focus:false,callback:false});
+		}
+		if(tags_callbacks[id] && tags_callbacks[id]['onChange'])
+		{
+			var f = tags_callbacks[id]['onChange'];
+			f.call(obj, obj, tags[i]);
+		}
+	};
+
+})(jQuery);

app/assets/javascripts/app/lib/spine/ajax.coffee

@@ -0,0 +1,206 @@
+Spine ?= require('spine')
+$      = Spine.$
+Model  = Spine.Model
+
+Ajax =
+  getURL: (object) ->
+    object and object.url?() or object.url
+
+  enabled:  true
+  pending:  false
+  requests: []
+
+  disable: (callback) ->
+    if @enabled    
+      @enabled = false
+      do callback
+      @enabled = true
+    else
+      do callback
+    
+  requestNext: ->
+    next = @requests.shift()
+    if next
+      @request(next)
+    else
+      @pending = false
+
+  request: (callback) ->
+    (do callback).complete(=> do @requestNext)
+      
+  queue: (callback) ->
+    return unless @enabled
+    if @pending
+      @requests.push(callback)
+    else
+      @pending = true
+      @request(callback)    
+    callback
+    
+class Base
+  defaults:
+    contentType: 'application/json'
+    dataType: 'json'
+    processData: false
+    headers: {'X-Requested-With': 'XMLHttpRequest'}
+  
+  ajax: (params, defaults) ->
+    $.ajax($.extend({}, @defaults, defaults, params))
+    
+  queue: (callback) ->
+    Ajax.queue(callback)
+
+class Collection extends Base
+  constructor: (@model) -> 
+    
+  find: (id, params) ->
+    record = new @model(id: id)
+    @ajax(
+      params,
+      type: 'GET',
+      url:  Ajax.getURL(record)
+    ).success(@recordsResponse)
+     .error(@errorResponse)
+    
+  all: (params) ->
+    @ajax(
+      params,
+      type: 'GET',
+      url:  Ajax.getURL(@model)
+    ).success(@recordsResponse)
+     .error(@errorResponse)
+    
+  fetch: (params = {}, options = {}) ->
+    if id = params.id
+      delete params.id
+      @find(id, params).success (record) =>
+        @model.refresh(record, options)
+    else
+      @all(params).success (records) =>
+        @model.refresh(records, options)
+
+  # Private
+
+  recordsResponse: (data, status, xhr) =>
+    @model.trigger('ajaxSuccess', null, status, xhr)
+
+  errorResponse: (xhr, statusText, error) =>
+    @model.trigger('ajaxError', null, xhr, statusText, error)
+
+class Singleton extends Base
+  constructor: (@record) ->
+    @model = @record.constructor
+  
+  reload: (params, options) ->
+    @queue =>
+      @ajax(
+        params,
+        type: 'GET'
+        url:  Ajax.getURL(@record)
+      ).success(@recordResponse(options))
+       .error(@errorResponse(options))
+  
+  create: (params, options) ->
+    @queue =>
+      @ajax(
+        params,
+        type: 'POST'
+        data: JSON.stringify(@record)
+        url:  Ajax.getURL(@model)
+      ).success(@recordResponse(options))
+       .error(@errorResponse(options))
+
+  update: (params, options) ->
+    @queue =>
+      @ajax(
+        params,
+        type: 'PUT'
+        data: JSON.stringify(@record)
+        url:  Ajax.getURL(@record)
+      ).success(@recordResponse(options))
+       .error(@errorResponse(options))
+  
+  destroy: (params, options) ->
+    @queue =>
+      @ajax(
+        params,
+        type: 'DELETE'
+        url:  Ajax.getURL(@record)
+      ).success(@recordResponse(options))
+       .error(@errorResponse(options))
+
+  # Private
+
+  recordResponse: (options = {}) =>
+    (data, status, xhr) =>
+      if Spine.isBlank(data)
+        data = false
+      else
+        data = @model.fromJSON(data)
+    
+      Ajax.disable =>
+        if data
+          # ID change, need to do some shifting
+          if data.id and @record.id isnt data.id
+            @record.changeID(data.id)
+
+          # Update with latest data
+          @record.updateAttributes(data.attributes())
+        
+      @record.trigger('ajaxSuccess', data, status, xhr)
+      # 2012-02-23 me
+#      options.success?.apply(@record)
+      options.success?(@record)
+      
+  errorResponse: (options = {}) =>
+    (xhr, statusText, error) =>
+      @record.trigger('ajaxError', xhr, statusText, error)
+      options.error?.apply(@record)
+
+# Ajax endpoint
+Model.host = ''
+
+Include =
+  ajax: -> new Singleton(this)
+
+  url: (args...) ->
+    url = Ajax.getURL(@constructor)
+    url += '/' unless url.charAt(url.length - 1) is '/'
+    url += encodeURIComponent(@id)
+    args.unshift(url)
+    args.join('/')
+    
+Extend = 
+  ajax: -> new Collection(this)
+
+  url: (args...) ->
+    args.unshift(@className.toLowerCase() + 's')
+    args.unshift(Model.host)
+    args.join('/')
+      
+Model.Ajax =
+  extended: ->
+    @fetch @ajaxFetch
+    @change @ajaxChange
+    
+    @extend Extend
+    @include Include
+
+  # Private
+
+  ajaxFetch: ->
+    @ajax().fetch(arguments...)
+    
+  ajaxChange: (record, type, options = {}) ->
+    return if options.ajax is false
+    record.ajax()[type](options.ajax, options)
+    
+Model.Ajax.Methods = 
+  extended: ->
+    @extend Extend
+    @include Include
+    
+# Globals
+Ajax.defaults   = Base::defaults
+Spine.Ajax      = Ajax
+module?.exports = Ajax

app/assets/javascripts/app/lib/spine/list.coffee

@@ -0,0 +1,42 @@
+Spine ?= require('spine')
+$      = Spine.$
+
+class Spine.List extends Spine.Controller
+  events:
+    'click .item': 'click'
+    
+  selectFirst: false
+    
+  constructor: ->
+    super
+    @bind 'change', @change
+    
+  template: -> arguments[0]
+  
+  change: (item) =>
+    @current = item
+
+    unless @current
+      @children().removeClass('active')
+      return
+    
+    @children().removeClass('active')
+    @children().forItem(@current).addClass('active')
+  
+  render: (items) ->
+    @items = items if items
+    @html @template(@items)
+    @change @current
+    if @selectFirst
+      unless @children('.active').length
+        @children(':first').click()
+        
+  children: (sel) ->
+    @el.children(sel)
+    
+  click: (e) ->
+    item = $(e.currentTarget).item()
+    @trigger('change', item)
+    true
+    
+module?.exports = Spine.List

app/assets/javascripts/app/lib/spine/local.coffee

@@ -0,0 +1,16 @@
+Spine ?= require('spine')
+
+Spine.Model.Local =
+  extended: ->
+    @change @saveLocal
+    @fetch @loadLocal
+    
+  saveLocal: ->
+    result = JSON.stringify(@)
+    localStorage[@className] = result
+
+  loadLocal: ->
+    result = localStorage[@className]
+    @refresh(result or [], clear: true)
+    
+module?.exports = Spine.Model.Local

app/assets/javascripts/app/lib/spine/manager.coffee

@@ -0,0 +1,85 @@
+Spine ?= require('spine')
+$      = Spine.$
+
+class Spine.Manager extends Spine.Module
+  @include Spine.Events
+  
+  constructor: ->
+    @controllers = []
+    @bind 'change', @change
+    @add(arguments...)
+    
+  add: (controllers...) ->
+    @addOne(cont) for cont in controllers
+    
+  addOne: (controller) ->    
+    controller.bind 'active', (args...) =>
+      @trigger('change', controller, args...)
+    controller.bind 'release', =>
+      @controllers.splice(@controllers.indexOf(controller), 1)
+
+    @controllers.push(controller)
+      
+  deactivate: ->
+    @trigger('change', false, arguments...)
+    
+  # Private
+    
+  change: (current, args...) ->
+    for cont in @controllers
+      if cont is current
+        cont.activate(args...)
+      else
+        cont.deactivate(args...)
+
+Spine.Controller.include
+  active: (args...) ->
+    if typeof args[0] is 'function'
+      @bind('active', args[0])
+    else
+      args.unshift('active')
+      @trigger(args...)
+    @
+  
+  isActive: ->
+    @el.hasClass('active')
+  
+  activate: ->
+    @el.addClass('active')
+    @
+  
+  deactivate: ->
+    @el.removeClass('active')
+    @
+    
+class Spine.Stack extends Spine.Controller
+  controllers: {}
+  routes: {}
+
+  className: 'spine stack'
+
+  constructor: ->
+    super
+
+    @manager = new Spine.Manager
+    
+    @manager.bind 'change', (controller, args...) =>
+      @active(args...) if controller
+    
+    for key, value of @controllers
+      @[key] = new value(stack: @)
+      @add(@[key])
+
+    for key, value of @routes
+      do (key, value) =>
+        callback = value if typeof value is 'function'
+        callback or= => @[value].active(arguments...)
+        @route(key, callback)
+        
+    @[@default].active() if @default
+
+  add: (controller) ->
+    @manager.add(controller)
+    @append(controller)
+    
+module?.exports = Spine.Manager

app/assets/javascripts/app/lib/spine/relation.coffee

@@ -0,0 +1,144 @@
+Spine   ?= require('spine')
+isArray = Spine.isArray
+require ?= ((value) -> eval(value))
+
+class Collection extends Spine.Module
+  constructor: (options = {}) ->
+    for key, value of options
+      @[key] = value
+        
+  all: ->
+    @model.select (rec) => @associated(rec)
+    
+  first: ->
+    @all()[0]
+    
+  last: ->
+    values = @all()
+    values[values.length - 1]
+    
+  find: (id) ->
+    records = @select (rec) =>
+      rec.id + '' is id + ''
+    throw('Unknown record') unless records[0]
+    records[0]
+    
+  findAllByAttribute: (name, value) ->
+    @model.select (rec) =>
+      rec[name] is value
+    
+  findByAttribute: (name, value) ->
+    @findAllByAttribute(name, value)[0]
+      
+  select: (cb) ->
+    @model.select (rec) =>
+      @associated(rec) and cb(rec)
+    
+  refresh: (values) ->
+    delete @model.records[record.id] for record in @all()
+    records = @model.fromJSON(values)
+
+    records = [records] unless isArray(records)
+
+    for record in records
+      record.newRecord = false
+      record[@fkey] = @record.id
+      @model.records[record.id] = record
+
+    @model.trigger('refresh', records)
+    
+  create: (record) ->
+    record[@fkey] = @record.id
+    @model.create(record)
+    
+  # Private
+  
+  associated: (record) ->
+    record[@fkey] is @record.id
+    
+class Instance extends Spine.Module
+  constructor: (options = {}) ->
+    for key, value of options
+      @[key] = value
+    
+  exists: ->
+    @record[@fkey] and @model.exists(@record[@fkey])
+    
+  update: (value) ->
+    unless value instanceof @model
+      value = new @model(value)
+    value.save() if value.isNew()
+    @record[@fkey] = value and value.id
+    
+class Singleton extends Spine.Module
+  constructor: (options = {}) ->
+    for key, value of options
+      @[key] = value
+
+  find: ->
+    @record.id and @model.findByAttribute(@fkey, @record.id)
+
+  update: (value) ->
+    unless value instanceof @model
+      value = @model.fromJSON(value)
+    
+    value[@fkey] = @record.id
+    value.save()
+
+singularize = (str) ->
+  str.replace(/s$/, '')
+  
+underscore = (str) ->
+  str.replace(/::/g, '/')
+     .replace(/([A-Z]+)([A-Z][a-z])/g, '$1_$2')
+     .replace(/([a-z\d])([A-Z])/g, '$1_$2')
+     .replace(/-/g, '_')
+     .toLowerCase()
+
+Spine.Model.extend 
+  hasMany: (name, model, fkey) -> 
+    fkey ?= "#{underscore(this.className)}_id"
+    
+    association = (record) -> 
+      model = require(model) if typeof model is 'string'
+      
+      new Collection(
+        name: name, model: model, 
+        record: record, fkey: fkey
+      )
+    
+    @::[name] = (value) ->
+      association(@).refresh(value) if value?
+      association(@)
+  
+  belongsTo: (name, model, fkey) ->
+    fkey ?= "#{singularize(name)}_id"
+    
+    association = (record) ->
+      model = require(model) if typeof model is 'string'
+      
+      new Instance(
+        name: name, model: model, 
+        record: record, fkey: fkey
+      )
+          
+    @::[name] = (value) ->
+      association(@).update(value) if value?
+      association(@).exists()
+
+    @attributes.push(fkey)
+    
+  hasOne: (name, model, fkey) -> 
+    fkey ?= "#{underscore(@className)}_id"
+    
+    association = (record) ->
+      model = require(model) if typeof model is 'string'
+      
+      new Singleton(
+        name: name, model: model, 
+        record: record, fkey: fkey
+      )
+      
+    @::[name] = (value) ->
+      association(@).update(value) if value?
+      association(@).find()

app/assets/javascripts/app/lib/spine/route.coffee

@@ -0,0 +1,147 @@
+Spine ?= require('spine')
+$      = Spine.$
+
+hashStrip    = /^#*/
+namedParam   = /:([\w\d]+)/g
+splatParam   = /\*([\w\d]+)/g
+escapeRegExp = /[-[\]{}()+?.,\\^$|#\s]/g
+
+class Spine.Route extends Spine.Module
+  @extend Spine.Events
+  
+  @historySupport: window.history?.pushState?
+  
+  @routes: []
+        
+  @options:
+    trigger: true
+    history: false
+    shim: false
+        
+  @add: (path, callback) ->
+    if (typeof path is 'object' and path not instanceof RegExp)
+      @add(key, value) for key, value of path
+    else
+      @routes.push(new @(path, callback))
+    
+  @setup: (options = {}) ->
+    @options = $.extend({}, @options, options)
+      
+    if (@options.history)
+      @history = @historySupport && @options.history
+      
+    return if @options.shim
+        
+    if @history 
+      $(window).bind('popstate', @change)
+    else
+      $(window).bind('hashchange', @change)
+    @change() 
+    
+  @unbind: ->
+    if @history
+      $(window).unbind('popstate', @change)
+    else
+      $(window).unbind('hashchange', @change)
+    
+  @navigate: (args...) ->
+    options = {}
+    
+    lastArg = args[args.length - 1]
+    if typeof lastArg is 'object'
+      options = args.pop()
+    else if typeof lastArg is 'boolean'
+      options.trigger = args.pop()
+    
+    options = $.extend({}, @options, options)
+    
+    path = args.join('/')
+    return if @path is path
+    @path = path
+
+    @trigger('navigate', @path)
+
+    @matchRoute(@path, options) if options.trigger
+
+    return if options.shim
+    
+    if @history
+      history.pushState(
+        {}, 
+        document.title, 
+        @path
+      )
+    else
+      window.location.hash = @path
+    
+  # Private
+  
+  @getPath: -> 
+    path = window.location.pathname
+    if path.substr(0,1) isnt '/' 
+      path = '/' + path
+    path
+  
+  @getHash: -> window.location.hash
+  
+  @getFragment: -> @getHash().replace(hashStrip, '')
+  
+  @getHost: ->
+    (document.location + '').replace(@getPath() + @getHash(), '')
+    
+  @change: ->
+# change me 2012-02-15
+#    path = if @getFragment() isnt '' then @getFragment() else @getPath()
+    path = if @getFragment() isnt 'workaround' then @getFragment() else @getPath()
+    return if path is @path
+    @path = path
+    @matchRoute(@path)
+  
+  @matchRoute: (path, options) ->
+    for route in @routes
+      if route.match(path, options)
+        @trigger('change', route, path)
+        return route
+
+  constructor: (@path, @callback) ->
+    @names = []
+
+    if typeof path is 'string'
+      namedParam.lastIndex = 0
+      while (match = namedParam.exec(path)) != null
+        @names.push(match[1])
+        
+      path = path.replace(escapeRegExp, '\\$&')
+                 .replace(namedParam, '([^\/]*)')
+                 .replace(splatParam, '(.*?)')
+                 
+      @route = new RegExp('^' + path + '$')
+    else
+      @route = path
+
+  match: (path, options = {}) ->
+    match = @route.exec(path)
+    return false unless match
+    options.match = match
+    params = match.slice(1)
+    
+    if @names.length
+      for param, i in params
+        options[@names[i]] = param
+        
+    @callback.call(null, options) isnt false
+
+# Coffee-script bug
+Spine.Route.change = Spine.Route.proxy(Spine.Route.change)
+
+Spine.Controller.include
+  route: (path, callback) ->
+    Spine.Route.add(path, @proxy(callback))
+  
+  routes: (routes) ->
+    @route(key, value) for key, value of routes
+
+  navigate: ->
+    Spine.Route.navigate.apply(Spine.Route, arguments)
+  
+module?.exports = Spine.Route

app/assets/javascripts/app/lib/spine/spine.coffee

@@ -0,0 +1,528 @@
+Events =
+  bind: (ev, callback) ->
+    evs   = ev.split(' ')
+    calls = @hasOwnProperty('_callbacks') and @_callbacks or= {}
+
+    for name in evs
+      calls[name] or= []
+      calls[name].push(callback)
+    this
+
+  one: (ev, callback) ->
+    @bind ev, ->
+      @unbind(ev, arguments.callee)
+      callback.apply(@, arguments)
+
+  trigger: (args...) ->
+    ev = args.shift()
+
+    list = @hasOwnProperty('_callbacks') and @_callbacks?[ev]
+    return unless list
+
+    for callback in list
+      if callback.apply(@, args) is false
+        break
+    true
+
+  unbind: (ev, callback) ->
+    unless ev
+      @_callbacks = {}
+      return this
+
+    list = @_callbacks?[ev]
+    return this unless list
+
+    unless callback
+      delete @_callbacks[ev]
+      return this
+
+    for cb, i in list when cb is callback
+      list = list.slice()
+      list.splice(i, 1)
+      @_callbacks[ev] = list
+      break
+    this
+
+Log =
+  trace: true
+
+  logPrefix: '(App)'
+
+  log: (args...) ->
+    return unless @trace
+    if @logPrefix then args.unshift(@logPrefix)
+    console?.log?(args...)
+    this
+
+moduleKeywords = ['included', 'extended']
+
+class Module
+  @include: (obj) ->
+    throw('include(obj) requires obj') unless obj
+    for key, value of obj when key not in moduleKeywords
+      @::[key] = value
+    obj.included?.apply(@)
+    this
+
+  @extend: (obj) ->
+    throw('extend(obj) requires obj') unless obj
+    for key, value of obj when key not in moduleKeywords
+      @[key] = value
+    obj.extended?.apply(@)
+    this
+
+  @proxy: (func) ->
+    => func.apply(@, arguments)
+
+  proxy: (func) ->
+    => func.apply(@, arguments)
+
+  constructor: ->
+    @init?(arguments...)
+
+class Model extends Module
+  @extend Events
+
+  @records: {}
+  @crecords: {}
+  @attributes: []
+
+  @configure: (name, attributes...) ->
+    @className  = name
+    @records    = {}
+    @crecords   = {}
+    @attributes = attributes if attributes.length
+    @attributes and= makeArray(@attributes)
+    @attributes or=  []
+    @unbind()
+    this
+
+  @toString: -> "#{@className}(#{@attributes.join(", ")})"
+
+  @find: (id) ->
+    record = @records[id]
+    if !record and ("#{id}").match(/c-\d+/)
+      return @findCID(id)
+    throw('Unknown record'+id+@className) unless record
+    record.clone()
+
+  @findCID: (cid) ->
+    record = @crecords[cid]
+    throw('Unknown record') unless record
+    record.clone()
+
+  @exists: (id) ->
+    try
+      return @find(id)
+    catch e
+      return false
+
+  @refresh: (values, options = {}) ->
+    if options.clear
+      @records  = {}
+      @crecords = {}
+
+    records = @fromJSON(values)
+    records = [records] unless isArray(records)
+
+    for record in records
+      record.id           or= record.cid
+      @records[record.id]   = record
+      @crecords[record.cid] = record
+
+    @trigger('refresh', not options.clear and @cloneArray(records))
+    this
+
+  @select: (callback) ->
+    result = (record for id, record of @records when callback(record))
+    @cloneArray(result)
+
+  @findByAttribute: (name, value) ->
+    for id, record of @records
+      if record[name] is value
+        return record.clone()
+    null
+
+  @findAllByAttribute: (name, value) ->
+    @select (item) ->
+      item[name] is value
+
+  @each: (callback) ->
+    for key, value of @records
+      callback(value.clone())
+
+  @all: ->
+    @cloneArray(@recordsValues())
+
+  @first: ->
+    record = @recordsValues()[0]
+    record?.clone()
+
+  @last: ->
+    values = @recordsValues()
+    record = values[values.length - 1]
+    record?.clone()
+
+  @count: ->
+    @recordsValues().length
+
+  @deleteAll: ->
+    for key, value of @records
+      delete @records[key]
+
+  @destroyAll: ->
+    for key, value of @records
+      @records[key].destroy()
+
+  @update: (id, atts, options) ->
+    @find(id).updateAttributes(atts, options)
+
+  @create: (atts, options) ->
+    record = new @(atts)
+    record.save(options)
+
+  @destroy: (id, options) ->
+    @find(id).destroy(options)
+
+  @change: (callbackOrParams) ->
+    if typeof callbackOrParams is 'function'
+      @bind('change', callbackOrParams)
+    else
+      @trigger('change', callbackOrParams)
+
+  @fetch: (callbackOrParams) ->
+    if typeof callbackOrParams is 'function'
+      @bind('fetch', callbackOrParams)
+    else
+      @trigger('fetch', callbackOrParams)
+
+  @toJSON: ->
+    @recordsValues()
+
+  @fromJSON: (objects) ->
+    return unless objects
+    if typeof objects is 'string'
+      objects = JSON.parse(objects)
+    if isArray(objects)
+      (new @(value) for value in objects)
+    else
+      new @(objects)
+
+  @fromForm: ->
+    (new this).fromForm(arguments...)
+
+  # Private
+
+  @recordsValues: ->
+    result = []
+    for key, value of @records
+      result.push(value)
+    result
+
+  @cloneArray: (array) ->
+    (value.clone() for value in array)
+
+  @idCounter: 0
+
+  @uid: ->
+    @idCounter++
+
+  # Instance
+
+  constructor: (atts) ->
+    super
+    @load atts if atts
+    @cid or= 'c-' + @constructor.uid()
+
+  isNew: ->
+    not @exists()
+
+  isValid: ->
+    not @validate()
+
+  validate: ->
+
+  load: (atts) ->
+    for key, value of atts
+      if typeof @[key] is 'function'
+        @[key](value)
+      else
+        @[key] = value
+    this
+
+  attributes: ->
+    result = {}
+    for key in @constructor.attributes when key of this
+      if typeof @[key] is 'function'
+        result[key] = @[key]()
+      else
+        result[key] = @[key]
+    result.id = @id if @id
+    result
+
+  eql: (rec) ->
+    !!(rec and rec.constructor is @constructor and
+        ((rec.id and rec.id is @id) or rec.cid is @cid))
+
+  save: (options = {}) ->
+    unless options.validate is false
+      error = @validate()
+      if error
+        @trigger('error', error)
+        return false
+
+    @trigger('beforeSave', options)
+    record = if @isNew() then @create(options) else @update(options)
+    @trigger('save', options)
+    record
+
+  updateAttribute: (name, value) ->
+    @[name] = value
+    @save()
+
+  updateAttributes: (atts, options) ->
+    @load(atts)
+    @save(options)
+
+  changeID: (id) ->
+    records = @constructor.records
+    records[id] = records[@id]
+    delete records[@id]
+    @id = id
+    @save()
+
+  destroy: (options = {}) ->
+    @trigger('beforeDestroy', options)
+    delete @constructor.records[@id]
+    delete @constructor.crecords[@cid]
+    @destroyed = true
+    @trigger('destroy', options)
+    @trigger('change', 'destroy', options)
+    @unbind()
+    this
+
+  dup: (newRecord) ->
+    result = new @constructor(@attributes())
+    if newRecord is false
+      result.cid = @cid
+    else
+      delete result.id
+    result
+
+  clone: ->
+    Object.create(@)
+
+  reload: ->
+    return this if @isNew()
+    original = @constructor.find(@id)
+    @load(original.attributes())
+    original
+
+  toJSON: ->
+    @attributes()
+
+  toString: ->
+    "<#{@constructor.className} (#{JSON.stringify(@)})>"
+
+  fromForm: (form) ->
+    result = {}
+    for key in $(form).serializeArray()
+      result[key.name] = key.value
+    @load(result)
+
+  exists: ->
+    @id && @id of @constructor.records
+
+  # Private
+
+  update: (options) ->
+    @trigger('beforeUpdate', options)
+    records = @constructor.records
+    records[@id].load @attributes()
+    clone = records[@id].clone()
+    clone.trigger('update', options)
+    clone.trigger('change', 'update', options)
+    clone
+
+  create: (options) ->
+    @trigger('beforeCreate', options)
+    @id          = @cid unless @id
+
+    record       = @dup(false)
+    @constructor.records[@id]   = record
+    @constructor.crecords[@cid] = record
+
+    clone        = record.clone()
+    clone.trigger('create', options)
+    clone.trigger('change', 'create', options)
+    clone
+
+  bind: (events, callback) ->
+    @constructor.bind events, binder = (record) =>
+      if record && @eql(record)
+        callback.apply(@, arguments)
+    @constructor.bind 'unbind', unbinder = (record) =>
+      if record && @eql(record)
+        @constructor.unbind(events, binder)
+        @constructor.unbind('unbind', unbinder)
+    binder
+
+  one: (events, callback) ->
+    binder = @bind events, =>
+      @constructor.unbind(events, binder)
+      callback.apply(@)
+
+  trigger: (args...) ->
+    args.splice(1, 0, @)
+    @constructor.trigger(args...)
+
+  unbind: ->
+    @trigger('unbind')
+
+class Controller extends Module
+  @include Events
+  @include Log
+
+  eventSplitter: /^(\S+)\s*(.*)$/
+  tag: 'div'
+
+  constructor: (options) ->
+    @options = options
+
+    for key, value of @options
+      @[key] = value
+
+    @el = document.createElement(@tag) unless @el
+    @el = $(@el)
+
+    @el.addClass(@className) if @className
+    @el.attr(@attributes) if @attributes
+
+    @release -> @el.remove()
+
+    @events = @constructor.events unless @events
+    @elements = @constructor.elements unless @elements
+
+    @delegateEvents() if @events
+    @refreshElements() if @elements
+
+    super
+
+  release: (callback) =>
+    if typeof callback is 'function'
+      @bind 'release', callback
+    else
+      @trigger 'release'
+
+  $: (selector) -> $(selector, @el)
+
+  delegateEvents: ->
+    for key, method of @events
+      unless typeof(method) is 'function'
+        method = @proxy(@[method])
+
+      match      = key.match(@eventSplitter)
+      eventName  = match[1]
+      selector   = match[2]
+
+      if selector is ''
+        @el.bind(eventName, method)
+      else
+        @el.delegate(selector, eventName, method)
+
+  refreshElements: ->
+    for key, value of @elements
+      @[value] = @$(key)
+
+  delay: (func, timeout) ->
+    setTimeout(@proxy(func), timeout || 0)
+
+  html: (element) ->
+    @el.html(element.el or element)
+    @refreshElements()
+    @el
+
+  append: (elements...) ->
+    elements = (e.el or e for e in elements)
+    @el.append(elements...)
+    @refreshElements()
+    @el
+
+  appendTo: (element) ->
+    @el.appendTo(element.el or element)
+    @refreshElements()
+    @el
+
+  prepend: (elements...) ->
+    elements = (e.el or e for e in elements)
+    @el.prepend(elements...)
+    @refreshElements()
+    @el
+
+  replace: (element) ->
+    [previous, @el] = [@el, $(element.el or element)]
+    previous.replaceWith(@el)
+    @delegateEvents()
+    @refreshElements()
+    @el
+
+# Utilities & Shims
+
+$ = window?.jQuery or window?.Zepto or (element) -> element
+
+unless typeof Object.create is 'function'
+  Object.create = (o) ->
+    Func = ->
+    Func.prototype = o
+    new Func()
+
+isArray = (value) ->
+  Object::toString.call(value) is '[object Array]'
+
+isBlank = (value) ->
+  return true unless value
+  return false for key of value
+  true
+
+makeArray = (args) ->
+  Array.prototype.slice.call(args, 0)
+
+# Globals
+
+Spine = @Spine   = {}
+module?.exports  = Spine
+
+Spine.version    = '1.0.6'
+Spine.isArray    = isArray
+Spine.isBlank    = isBlank
+Spine.$          = $
+Spine.Events     = Events
+Spine.Log        = Log
+Spine.Module     = Module
+Spine.Controller = Controller
+Spine.Model      = Model
+
+# Global events
+
+Module.extend.call(Spine, Events)
+
+# JavaScript compatability
+
+Module.create = Module.sub =
+  Controller.create = Controller.sub =
+    Model.sub = (instances, statics) ->
+      class result extends this
+      result.include(instances) if instances
+      result.extend(statics) if statics
+      result.unbind?()
+      result
+
+Model.setup = (name, attributes = []) ->
+  class Instance extends this
+  Instance.configure(name, attributes...)
+  Instance
+
+Module.init = Controller.init = Model.init = (a1, a2, a3, a4, a5) ->
+  new this(a1, a2, a3, a4, a5)
+
+Spine.Class = Module

app/assets/javascripts/app/lib/spine/tabs.coffee

@@ -0,0 +1,36 @@
+Spine ?= require('spine')
+$      = Spine.$
+
+class Spine.Tabs extends Spine.Controller
+  events: 
+    'click [data-name]': 'click'
+    
+  constructor: ->
+    super
+    @bind 'change', @change
+
+  change: (name) => 
+    return unless name
+    @current = name
+    @children().removeClass('active')
+    @children("[data-name=#{@current}]").addClass('active')
+  
+  render: ->
+    @change @current
+    unless @children('.active').length or @current
+      @children(':first').click()
+
+  children: (sel) ->
+    @el.children(sel)
+
+  click: (e) ->
+    name = $(e.currentTarget).attr('data-name')
+    @trigger('change', name)
+
+  connect: (tabName, controller) ->
+    @bind 'change', (name) ->
+      controller.active() if name is tabName
+    controller.bind 'active', =>
+      @change tabName
+      
+module?.exports = Spine.Tabs

app/assets/javascripts/app/lib/spine/tmpl.coffee

@@ -0,0 +1,15 @@
+# jQuery.tmpl.js utilities
+
+$ = jQuery ? require("jqueryify")
+
+$.fn.item = ->
+  item = $(@)
+  item = item.data("item") or item.tmplItem?().data
+  item?.reload?()
+  item
+
+$.fn.forItem = (item) ->
+  @filter ->
+    compare = $(@).item()
+    return item.eql?(compare) or item is compare
+

app/assets/javascripts/app/lib/ui/jquery.ui.accordion.js

@@ -0,0 +1,611 @@
+/*
+ * jQuery UI Accordion 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget( "ui.accordion", {
+	options: {
+		active: 0,
+		animated: "slide",
+		autoHeight: true,
+		clearStyle: false,
+		collapsible: false,
+		event: "click",
+		fillSpace: false,
+		header: "> li > :first-child,> :not(li):even",
+		icons: {
+			header: "ui-icon-triangle-1-e",
+			headerSelected: "ui-icon-triangle-1-s"
+		},
+		navigation: false,
+		navigationFilter: function() {
+			return this.href.toLowerCase() === location.href.toLowerCase();
+		}
+	},
+
+	_create: function() {
+		var self = this,
+			options = self.options;
+
+		self.running = 0;
+
+		self.element
+			.addClass( "ui-accordion ui-widget ui-helper-reset" )
+			// in lack of child-selectors in CSS
+			// we need to mark top-LIs in a UL-accordion for some IE-fix
+			.children( "li" )
+				.addClass( "ui-accordion-li-fix" );
+
+		self.headers = self.element.find( options.header )
+			.addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" )
+			.bind( "mouseenter.accordion", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).addClass( "ui-state-hover" );
+			})
+			.bind( "mouseleave.accordion", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).removeClass( "ui-state-hover" );
+			})
+			.bind( "focus.accordion", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).addClass( "ui-state-focus" );
+			})
+			.bind( "blur.accordion", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).removeClass( "ui-state-focus" );
+			});
+
+		self.headers.next()
+			.addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" );
+
+		if ( options.navigation ) {
+			var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 );
+			if ( current.length ) {
+				var header = current.closest( ".ui-accordion-header" );
+				if ( header.length ) {
+					// anchor within header
+					self.active = header;
+				} else {
+					// anchor within content
+					self.active = current.closest( ".ui-accordion-content" ).prev();
+				}
+			}
+		}
+
+		self.active = self._findActive( self.active || options.active )
+			.addClass( "ui-state-default ui-state-active" )
+			.toggleClass( "ui-corner-all" )
+			.toggleClass( "ui-corner-top" );
+		self.active.next().addClass( "ui-accordion-content-active" );
+
+		self._createIcons();
+		self.resize();
+		
+		// ARIA
+		self.element.attr( "role", "tablist" );
+
+		self.headers
+			.attr( "role", "tab" )
+			.bind( "keydown.accordion", function( event ) {
+				return self._keydown( event );
+			})
+			.next()
+				.attr( "role", "tabpanel" );
+
+		self.headers
+			.not( self.active || "" )
+			.attr({
+				"aria-expanded": "false",
+				"aria-selected": "false",
+				tabIndex: -1
+			})
+			.next()
+				.hide();
+
+		// make sure at least one header is in the tab order
+		if ( !self.active.length ) {
+			self.headers.eq( 0 ).attr( "tabIndex", 0 );
+		} else {
+			self.active
+				.attr({
+					"aria-expanded": "true",
+					"aria-selected": "true",
+					tabIndex: 0
+				});
+		}
+
+		// only need links in tab order for Safari
+		if ( !$.browser.safari ) {
+			self.headers.find( "a" ).attr( "tabIndex", -1 );
+		}
+
+		if ( options.event ) {
+			self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) {
+				self._clickHandler.call( self, event, this );
+				event.preventDefault();
+			});
+		}
+	},
+
+	_createIcons: function() {
+		var options = this.options;
+		if ( options.icons ) {
+			$( "<span></span>" )
+				.addClass( "ui-icon " + options.icons.header )
+				.prependTo( this.headers );
+			this.active.children( ".ui-icon" )
+				.toggleClass(options.icons.header)
+				.toggleClass(options.icons.headerSelected);
+			this.element.addClass( "ui-accordion-icons" );
+		}
+	},
+
+	_destroyIcons: function() {
+		this.headers.children( ".ui-icon" ).remove();
+		this.element.removeClass( "ui-accordion-icons" );
+	},
+
+	destroy: function() {
+		var options = this.options;
+
+		this.element
+			.removeClass( "ui-accordion ui-widget ui-helper-reset" )
+			.removeAttr( "role" );
+
+		this.headers
+			.unbind( ".accordion" )
+			.removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" )
+			.removeAttr( "role" )
+			.removeAttr( "aria-expanded" )
+			.removeAttr( "aria-selected" )
+			.removeAttr( "tabIndex" );
+
+		this.headers.find( "a" ).removeAttr( "tabIndex" );
+		this._destroyIcons();
+		var contents = this.headers.next()
+			.css( "display", "" )
+			.removeAttr( "role" )
+			.removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" );
+		if ( options.autoHeight || options.fillHeight ) {
+			contents.css( "height", "" );
+		}
+
+		return $.Widget.prototype.destroy.call( this );
+	},
+
+	_setOption: function( key, value ) {
+		$.Widget.prototype._setOption.apply( this, arguments );
+			
+		if ( key == "active" ) {
+			this.activate( value );
+		}
+		if ( key == "icons" ) {
+			this._destroyIcons();
+			if ( value ) {
+				this._createIcons();
+			}
+		}
+		// #5332 - opacity doesn't cascade to positioned elements in IE
+		// so we need to add the disabled class to the headers and panels
+		if ( key == "disabled" ) {
+			this.headers.add(this.headers.next())
+				[ value ? "addClass" : "removeClass" ](
+					"ui-accordion-disabled ui-state-disabled" );
+		}
+	},
+
+	_keydown: function( event ) {
+		if ( this.options.disabled || event.altKey || event.ctrlKey ) {
+			return;
+		}
+
+		var keyCode = $.ui.keyCode,
+			length = this.headers.length,
+			currentIndex = this.headers.index( event.target ),
+			toFocus = false;
+
+		switch ( event.keyCode ) {
+			case keyCode.RIGHT:
+			case keyCode.DOWN:
+				toFocus = this.headers[ ( currentIndex + 1 ) % length ];
+				break;
+			case keyCode.LEFT:
+			case keyCode.UP:
+				toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
+				break;
+			case keyCode.SPACE:
+			case keyCode.ENTER:
+				this._clickHandler( { target: event.target }, event.target );
+				event.preventDefault();
+		}
+
+		if ( toFocus ) {
+			$( event.target ).attr( "tabIndex", -1 );
+			$( toFocus ).attr( "tabIndex", 0 );
+			toFocus.focus();
+			return false;
+		}
+
+		return true;
+	},
+
+	resize: function() {
+		var options = this.options,
+			maxHeight;
+
+		if ( options.fillSpace ) {
+			if ( $.browser.msie ) {
+				var defOverflow = this.element.parent().css( "overflow" );
+				this.element.parent().css( "overflow", "hidden");
+			}
+			maxHeight = this.element.parent().height();
+			if ($.browser.msie) {
+				this.element.parent().css( "overflow", defOverflow );
+			}
+
+			this.headers.each(function() {
+				maxHeight -= $( this ).outerHeight( true );
+			});
+
+			this.headers.next()
+				.each(function() {
+					$( this ).height( Math.max( 0, maxHeight -
+						$( this ).innerHeight() + $( this ).height() ) );
+				})
+				.css( "overflow", "auto" );
+		} else if ( options.autoHeight ) {
+			maxHeight = 0;
+			this.headers.next()
+				.each(function() {
+					maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
+				})
+				.height( maxHeight );
+		}
+
+		return this;
+	},
+
+	activate: function( index ) {
+		// TODO this gets called on init, changing the option without an explicit call for that
+		this.options.active = index;
+		// call clickHandler with custom event
+		var active = this._findActive( index )[ 0 ];
+		this._clickHandler( { target: active }, active );
+
+		return this;
+	},
+
+	_findActive: function( selector ) {
+		return selector
+			? typeof selector === "number"
+				? this.headers.filter( ":eq(" + selector + ")" )
+				: this.headers.not( this.headers.not( selector ) )
+			: selector === false
+				? $( [] )
+				: this.headers.filter( ":eq(0)" );
+	},
+
+	// TODO isn't event.target enough? why the separate target argument?
+	_clickHandler: function( event, target ) {
+		var options = this.options;
+		if ( options.disabled ) {
+			return;
+		}
+
+		// called only when using activate(false) to close all parts programmatically
+		if ( !event.target ) {
+			if ( !options.collapsible ) {
+				return;
+			}
+			this.active
+				.removeClass( "ui-state-active ui-corner-top" )
+				.addClass( "ui-state-default ui-corner-all" )
+				.children( ".ui-icon" )
+					.removeClass( options.icons.headerSelected )
+					.addClass( options.icons.header );
+			this.active.next().addClass( "ui-accordion-content-active" );
+			var toHide = this.active.next(),
+				data = {
+					options: options,
+					newHeader: $( [] ),
+					oldHeader: options.active,
+					newContent: $( [] ),
+					oldContent: toHide
+				},
+				toShow = ( this.active = $( [] ) );
+			this._toggle( toShow, toHide, data );
+			return;
+		}
+
+		// get the click target
+		var clicked = $( event.currentTarget || target ),
+			clickedIsActive = clicked[0] === this.active[0];
+
+		// TODO the option is changed, is that correct?
+		// TODO if it is correct, shouldn't that happen after determining that the click is valid?
+		options.active = options.collapsible && clickedIsActive ?
+			false :
+			this.headers.index( clicked );
+
+		// if animations are still active, or the active header is the target, ignore click
+		if ( this.running || ( !options.collapsible && clickedIsActive ) ) {
+			return;
+		}
+
+		// find elements to show and hide
+		var active = this.active,
+			toShow = clicked.next(),
+			toHide = this.active.next(),
+			data = {
+				options: options,
+				newHeader: clickedIsActive && options.collapsible ? $([]) : clicked,
+				oldHeader: this.active,
+				newContent: clickedIsActive && options.collapsible ? $([]) : toShow,
+				oldContent: toHide
+			},
+			down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+
+		// when the call to ._toggle() comes after the class changes
+		// it causes a very odd bug in IE 8 (see #6720)
+		this.active = clickedIsActive ? $([]) : clicked;
+		this._toggle( toShow, toHide, data, clickedIsActive, down );
+
+		// switch classes
+		active
+			.removeClass( "ui-state-active ui-corner-top" )
+			.addClass( "ui-state-default ui-corner-all" )
+			.children( ".ui-icon" )
+				.removeClass( options.icons.headerSelected )
+				.addClass( options.icons.header );
+		if ( !clickedIsActive ) {
+			clicked
+				.removeClass( "ui-state-default ui-corner-all" )
+				.addClass( "ui-state-active ui-corner-top" )
+				.children( ".ui-icon" )
+					.removeClass( options.icons.header )
+					.addClass( options.icons.headerSelected );
+			clicked
+				.next()
+				.addClass( "ui-accordion-content-active" );
+		}
+
+		return;
+	},
+
+	_toggle: function( toShow, toHide, data, clickedIsActive, down ) {
+		var self = this,
+			options = self.options;
+
+		self.toShow = toShow;
+		self.toHide = toHide;
+		self.data = data;
+
+		var complete = function() {
+			if ( !self ) {
+				return;
+			}
+			return self._completed.apply( self, arguments );
+		};
+
+		// trigger changestart event
+		self._trigger( "changestart", null, self.data );
+
+		// count elements to animate
+		self.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+
+		if ( options.animated ) {
+			var animOptions = {};
+
+			if ( options.collapsible && clickedIsActive ) {
+				animOptions = {
+					toShow: $( [] ),
+					toHide: toHide,
+					complete: complete,
+					down: down,
+					autoHeight: options.autoHeight || options.fillSpace
+				};
+			} else {
+				animOptions = {
+					toShow: toShow,
+					toHide: toHide,
+					complete: complete,
+					down: down,
+					autoHeight: options.autoHeight || options.fillSpace
+				};
+			}
+
+			if ( !options.proxied ) {
+				options.proxied = options.animated;
+			}
+
+			if ( !options.proxiedDuration ) {
+				options.proxiedDuration = options.duration;
+			}
+
+			options.animated = $.isFunction( options.proxied ) ?
+				options.proxied( animOptions ) :
+				options.proxied;
+
+			options.duration = $.isFunction( options.proxiedDuration ) ?
+				options.proxiedDuration( animOptions ) :
+				options.proxiedDuration;
+
+			var animations = $.ui.accordion.animations,
+				duration = options.duration,
+				easing = options.animated;
+
+			if ( easing && !animations[ easing ] && !$.easing[ easing ] ) {
+				easing = "slide";
+			}
+			if ( !animations[ easing ] ) {
+				animations[ easing ] = function( options ) {
+					this.slide( options, {
+						easing: easing,
+						duration: duration || 700
+					});
+				};
+			}
+
+			animations[ easing ]( animOptions );
+		} else {
+			if ( options.collapsible && clickedIsActive ) {
+				toShow.toggle();
+			} else {
+				toHide.hide();
+				toShow.show();
+			}
+
+			complete( true );
+		}
+
+		// TODO assert that the blur and focus triggers are really necessary, remove otherwise
+		toHide.prev()
+			.attr({
+				"aria-expanded": "false",
+				"aria-selected": "false",
+				tabIndex: -1
+			})
+			.blur();
+		toShow.prev()
+			.attr({
+				"aria-expanded": "true",
+				"aria-selected": "true",
+				tabIndex: 0
+			})
+			.focus();
+	},
+
+	_completed: function( cancel ) {
+		this.running = cancel ? 0 : --this.running;
+		if ( this.running ) {
+			return;
+		}
+
+		if ( this.options.clearStyle ) {
+			this.toShow.add( this.toHide ).css({
+				height: "",
+				overflow: ""
+			});
+		}
+
+		// other classes are removed before the animation; this one needs to stay until completed
+		this.toHide.removeClass( "ui-accordion-content-active" );
+		// Work around for rendering bug in IE (#5421)
+		if ( this.toHide.length ) {
+			this.toHide.parent()[0].className = this.toHide.parent()[0].className;
+		}
+
+		this._trigger( "change", null, this.data );
+	}
+});
+
+$.extend( $.ui.accordion, {
+	version: "1.8.17",
+	animations: {
+		slide: function( options, additions ) {
+			options = $.extend({
+				easing: "swing",
+				duration: 300
+			}, options, additions );
+			if ( !options.toHide.size() ) {
+				options.toShow.animate({
+					height: "show",
+					paddingTop: "show",
+					paddingBottom: "show"
+				}, options );
+				return;
+			}
+			if ( !options.toShow.size() ) {
+				options.toHide.animate({
+					height: "hide",
+					paddingTop: "hide",
+					paddingBottom: "hide"
+				}, options );
+				return;
+			}
+			var overflow = options.toShow.css( "overflow" ),
+				percentDone = 0,
+				showProps = {},
+				hideProps = {},
+				fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
+				originalWidth;
+			// fix width before calculating height of hidden element
+			var s = options.toShow;
+			originalWidth = s[0].style.width;
+			s.width( s.parent().width()
+				- parseFloat( s.css( "paddingLeft" ) )
+				- parseFloat( s.css( "paddingRight" ) )
+				- ( parseFloat( s.css( "borderLeftWidth" ) ) || 0 )
+				- ( parseFloat( s.css( "borderRightWidth" ) ) || 0 ) );
+
+			$.each( fxAttrs, function( i, prop ) {
+				hideProps[ prop ] = "hide";
+
+				var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ );
+				showProps[ prop ] = {
+					value: parts[ 1 ],
+					unit: parts[ 2 ] || "px"
+				};
+			});
+			options.toShow.css({ height: 0, overflow: "hidden" }).show();
+			options.toHide
+				.filter( ":hidden" )
+					.each( options.complete )
+				.end()
+				.filter( ":visible" )
+				.animate( hideProps, {
+				step: function( now, settings ) {
+					// only calculate the percent when animating height
+					// IE gets very inconsistent results when animating elements
+					// with small values, which is common for padding
+					if ( settings.prop == "height" ) {
+						percentDone = ( settings.end - settings.start === 0 ) ? 0 :
+							( settings.now - settings.start ) / ( settings.end - settings.start );
+					}
+
+					options.toShow[ 0 ].style[ settings.prop ] =
+						( percentDone * showProps[ settings.prop ].value )
+						+ showProps[ settings.prop ].unit;
+				},
+				duration: options.duration,
+				easing: options.easing,
+				complete: function() {
+					if ( !options.autoHeight ) {
+						options.toShow.css( "height", "" );
+					}
+					options.toShow.css({
+						width: originalWidth,
+						overflow: overflow
+					});
+					options.complete();
+				}
+			});
+		},
+		bounceslide: function( options ) {
+			this.slide( options, {
+				easing: options.down ? "easeOutBounce" : "swing",
+				duration: options.down ? 1000 : 200
+			});
+		}
+	}
+});
+
+})( jQuery );

app/assets/javascripts/app/lib/ui/jquery.ui.autocomplete.js

@@ -0,0 +1,622 @@
+/*
+ * jQuery UI Autocomplete 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.position.js
+ */
+(function( $, undefined ) {
+
+// used to prevent race conditions with remote data sources
+var requestIndex = 0;
+
+$.widget( "ui.autocomplete", {
+	options: {
+		appendTo: "body",
+		autoFocus: false,
+		delay: 300,
+		minLength: 1,
+		position: {
+			my: "left top",
+			at: "left bottom",
+			collision: "none"
+		},
+		source: null
+	},
+
+	pending: 0,
+
+	_create: function() {
+		var self = this,
+			doc = this.element[ 0 ].ownerDocument,
+			suppressKeyPress;
+
+		this.element
+			.addClass( "ui-autocomplete-input" )
+			.attr( "autocomplete", "off" )
+			// TODO verify these actually work as intended
+			.attr({
+				role: "textbox",
+				"aria-autocomplete": "list",
+				"aria-haspopup": "true"
+			})
+			.bind( "keydown.autocomplete", function( event ) {
+				if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) {
+					return;
+				}
+
+				suppressKeyPress = false;
+				var keyCode = $.ui.keyCode;
+				switch( event.keyCode ) {
+				case keyCode.PAGE_UP:
+					self._move( "previousPage", event );
+					break;
+				case keyCode.PAGE_DOWN:
+					self._move( "nextPage", event );
+					break;
+				case keyCode.UP:
+					self._move( "previous", event );
+					// prevent moving cursor to beginning of text field in some browsers
+					event.preventDefault();
+					break;
+				case keyCode.DOWN:
+					self._move( "next", event );
+					// prevent moving cursor to end of text field in some browsers
+					event.preventDefault();
+					break;
+				case keyCode.ENTER:
+				case keyCode.NUMPAD_ENTER:
+					// when menu is open and has focus
+					if ( self.menu.active ) {
+						// #6055 - Opera still allows the keypress to occur
+						// which causes forms to submit
+						suppressKeyPress = true;
+						event.preventDefault();
+					}
+					//passthrough - ENTER and TAB both select the current element
+				case keyCode.TAB:
+					if ( !self.menu.active ) {
+						return;
+					}
+					self.menu.select( event );
+					break;
+				case keyCode.ESCAPE:
+					self.element.val( self.term );
+					self.close( event );
+					break;
+				default:
+					// keypress is triggered before the input value is changed
+					clearTimeout( self.searching );
+					self.searching = setTimeout(function() {
+						// only search if the value has changed
+						if ( self.term != self.element.val() ) {
+							self.selectedItem = null;
+							self.search( null, event );
+						}
+					}, self.options.delay );
+					break;
+				}
+			})
+			.bind( "keypress.autocomplete", function( event ) {
+				if ( suppressKeyPress ) {
+					suppressKeyPress = false;
+					event.preventDefault();
+				}
+			})
+			.bind( "focus.autocomplete", function() {
+				if ( self.options.disabled ) {
+					return;
+				}
+
+				self.selectedItem = null;
+				self.previous = self.element.val();
+			})
+			.bind( "blur.autocomplete", function( event ) {
+				if ( self.options.disabled ) {
+					return;
+				}
+
+				clearTimeout( self.searching );
+				// clicks on the menu (or a button to trigger a search) will cause a blur event
+				self.closing = setTimeout(function() {
+					self.close( event );
+					self._change( event );
+				}, 150 );
+			});
+		this._initSource();
+		this.response = function() {
+			return self._response.apply( self, arguments );
+		};
+		this.menu = $( "<ul></ul>" )
+			.addClass( "ui-autocomplete" )
+			.appendTo( $( this.options.appendTo || "body", doc )[0] )
+			// prevent the close-on-blur in case of a "slow" click on the menu (long mousedown)
+			.mousedown(function( event ) {
+				// clicking on the scrollbar causes focus to shift to the body
+				// but we can't detect a mouseup or a click immediately afterward
+				// so we have to track the next mousedown and close the menu if
+				// the user clicks somewhere outside of the autocomplete
+				var menuElement = self.menu.element[ 0 ];
+				if ( !$( event.target ).closest( ".ui-menu-item" ).length ) {
+					setTimeout(function() {
+						$( document ).one( 'mousedown', function( event ) {
+							if ( event.target !== self.element[ 0 ] &&
+								event.target !== menuElement &&
+								!$.ui.contains( menuElement, event.target ) ) {
+								self.close();
+							}
+						});
+					}, 1 );
+				}
+
+				// use another timeout to make sure the blur-event-handler on the input was already triggered
+				setTimeout(function() {
+					clearTimeout( self.closing );
+				}, 13);
+			})
+			.menu({
+				focus: function( event, ui ) {
+					var item = ui.item.data( "item.autocomplete" );
+					if ( false !== self._trigger( "focus", event, { item: item } ) ) {
+						// use value to match what will end up in the input, if it was a key event
+						if ( /^key/.test(event.originalEvent.type) ) {
+							self.element.val( item.value );
+						}
+					}
+				},
+				selected: function( event, ui ) {
+					var item = ui.item.data( "item.autocomplete" ),
+						previous = self.previous;
+
+					// only trigger when focus was lost (click on menu)
+					if ( self.element[0] !== doc.activeElement ) {
+						self.element.focus();
+						self.previous = previous;
+						// #6109 - IE triggers two focus events and the second
+						// is asynchronous, so we need to reset the previous
+						// term synchronously and asynchronously :-(
+						setTimeout(function() {
+							self.previous = previous;
+							self.selectedItem = item;
+						}, 1);
+					}
+
+					if ( false !== self._trigger( "select", event, { item: item } ) ) {
+						self.element.val( item.value );
+					}
+					// reset the term after the select event
+					// this allows custom select handling to work properly
+					self.term = self.element.val();
+
+					self.close( event );
+					self.selectedItem = item;
+				},
+				blur: function( event, ui ) {
+					// don't set the value of the text field if it's already correct
+					// this prevents moving the cursor unnecessarily
+					if ( self.menu.element.is(":visible") &&
+						( self.element.val() !== self.term ) ) {
+						self.element.val( self.term );
+					}
+				}
+			})
+			.zIndex( this.element.zIndex() + 1 )
+			// workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+			.css({ top: 0, left: 0 })
+			.hide()
+			.data( "menu" );
+		if ( $.fn.bgiframe ) {
+			 this.menu.element.bgiframe();
+		}
+		// turning off autocomplete prevents the browser from remembering the
+		// value when navigating through history, so we re-enable autocomplete
+		// if the page is unloaded before the widget is destroyed. #7790
+		self.beforeunloadHandler = function() {
+			self.element.removeAttr( "autocomplete" );
+		};
+		$( window ).bind( "beforeunload", self.beforeunloadHandler );
+	},
+
+	destroy: function() {
+		this.element
+			.removeClass( "ui-autocomplete-input" )
+			.removeAttr( "autocomplete" )
+			.removeAttr( "role" )
+			.removeAttr( "aria-autocomplete" )
+			.removeAttr( "aria-haspopup" );
+		this.menu.element.remove();
+		$( window ).unbind( "beforeunload", this.beforeunloadHandler );
+		$.Widget.prototype.destroy.call( this );
+	},
+
+	_setOption: function( key, value ) {
+		$.Widget.prototype._setOption.apply( this, arguments );
+		if ( key === "source" ) {
+			this._initSource();
+		}
+		if ( key === "appendTo" ) {
+			this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] )
+		}
+		if ( key === "disabled" && value && this.xhr ) {
+			this.xhr.abort();
+		}
+	},
+
+	_initSource: function() {
+		var self = this,
+			array,
+			url;
+		if ( $.isArray(this.options.source) ) {
+			array = this.options.source;
+			this.source = function( request, response ) {
+				response( $.ui.autocomplete.filter(array, request.term) );
+			};
+		} else if ( typeof this.options.source === "string" ) {
+			url = this.options.source;
+			this.source = function( request, response ) {
+				if ( self.xhr ) {
+					self.xhr.abort();
+				}
+				self.xhr = $.ajax({
+					url: url,
+					data: request,
+					dataType: "json",
+					autocompleteRequest: ++requestIndex,
+					success: function( data, status ) {
+						if ( this.autocompleteRequest === requestIndex ) {
+							response( data );
+						}
+					},
+					error: function() {
+						if ( this.autocompleteRequest === requestIndex ) {
+							response( [] );
+						}
+					}
+				});
+			};
+		} else {
+			this.source = this.options.source;
+		}
+	},
+
+	search: function( value, event ) {
+		value = value != null ? value : this.element.val();
+
+		// always save the actual value, not the one passed as an argument
+		this.term = this.element.val();
+
+		if ( value.length < this.options.minLength ) {
+			return this.close( event );
+		}
+
+		clearTimeout( this.closing );
+		if ( this._trigger( "search", event ) === false ) {
+			return;
+		}
+
+		return this._search( value );
+	},
+
+	_search: function( value ) {
+		this.pending++;
+		this.element.addClass( "ui-autocomplete-loading" );
+
+		this.source( { term: value }, this.response );
+	},
+
+	_response: function( content ) {
+		if ( !this.options.disabled && content && content.length ) {
+			content = this._normalize( content );
+			this._suggest( content );
+			this._trigger( "open" );
+		} else {
+			this.close();
+		}
+		this.pending--;
+		if ( !this.pending ) {
+			this.element.removeClass( "ui-autocomplete-loading" );
+		}
+	},
+
+	close: function( event ) {
+		clearTimeout( this.closing );
+		if ( this.menu.element.is(":visible") ) {
+			this.menu.element.hide();
+			this.menu.deactivate();
+			this._trigger( "close", event );
+		}
+	},
+	
+	_change: function( event ) {
+		if ( this.previous !== this.element.val() ) {
+			this._trigger( "change", event, { item: this.selectedItem } );
+		}
+	},
+
+	_normalize: function( items ) {
+		// assume all items have the right format when the first item is complete
+		if ( items.length && items[0].label && items[0].value ) {
+			return items;
+		}
+		return $.map( items, function(item) {
+			if ( typeof item === "string" ) {
+				return {
+					label: item,
+					value: item
+				};
+			}
+			return $.extend({
+				label: item.label || item.value,
+				value: item.value || item.label
+			}, item );
+		});
+	},
+
+	_suggest: function( items ) {
+		var ul = this.menu.element
+			.empty()
+			.zIndex( this.element.zIndex() + 1 );
+		this._renderMenu( ul, items );
+		// TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
+		this.menu.deactivate();
+		this.menu.refresh();
+
+		// size and position menu
+		ul.show();
+		this._resizeMenu();
+		ul.position( $.extend({
+			of: this.element
+		}, this.options.position ));
+
+		if ( this.options.autoFocus ) {
+			this.menu.next( new $.Event("mouseover") );
+		}
+	},
+
+	_resizeMenu: function() {
+		var ul = this.menu.element;
+		ul.outerWidth( Math.max(
+			// Firefox wraps long text (possibly a rounding bug)
+			// so we add 1px to avoid the wrapping (#7513)
+			ul.width( "" ).outerWidth() + 1,
+			this.element.outerWidth()
+		) );
+	},
+
+	_renderMenu: function( ul, items ) {
+		var self = this;
+		$.each( items, function( index, item ) {
+			self._renderItem( ul, item );
+		});
+	},
+
+	_renderItem: function( ul, item) {
+		return $( "<li></li>" )
+			.data( "item.autocomplete", item )
+			.append( $( "<a></a>" ).text( item.label ) )
+			.appendTo( ul );
+	},
+
+	_move: function( direction, event ) {
+		if ( !this.menu.element.is(":visible") ) {
+			this.search( null, event );
+			return;
+		}
+		if ( this.menu.first() && /^previous/.test(direction) ||
+				this.menu.last() && /^next/.test(direction) ) {
+			this.element.val( this.term );
+			this.menu.deactivate();
+			return;
+		}
+		this.menu[ direction ]( event );
+	},
+
+	widget: function() {
+		return this.menu.element;
+	}
+});
+
+$.extend( $.ui.autocomplete, {
+	escapeRegex: function( value ) {
+		return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
+	},
+	filter: function(array, term) {
+		var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
+		return $.grep( array, function(value) {
+			return matcher.test( value.label || value.value || value );
+		});
+	}
+});
+
+}( jQuery ));
+
+/*
+ * jQuery UI Menu (not officially released)
+ * 
+ * This widget isn't yet finished and the API is subject to change. We plan to finish
+ * it for the next release. You're welcome to give it a try anyway and give us feedback,
+ * as long as you're okay with migrating your code later on. We can help with that, too.
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *  jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.menu", {
+	_create: function() {
+		var self = this;
+		this.element
+			.addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
+			.attr({
+				role: "listbox",
+				"aria-activedescendant": "ui-active-menuitem"
+			})
+			.click(function( event ) {
+				if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) {
+					return;
+				}
+				// temporary
+				event.preventDefault();
+				self.select( event );
+			});
+		this.refresh();
+	},
+	
+	refresh: function() {
+		var self = this;
+
+		// don't refresh list items that are already adapted
+		var items = this.element.children("li:not(.ui-menu-item):has(a)")
+			.addClass("ui-menu-item")
+			.attr("role", "menuitem");
+		
+		items.children("a")
+			.addClass("ui-corner-all")
+			.attr("tabindex", -1)
+			// mouseenter doesn't work with event delegation
+			.mouseenter(function( event ) {
+				self.activate( event, $(this).parent() );
+			})
+			.mouseleave(function() {
+				self.deactivate();
+			});
+	},
+
+	activate: function( event, item ) {
+		this.deactivate();
+		if (this.hasScroll()) {
+			var offset = item.offset().top - this.element.offset().top,
+				scroll = this.element.scrollTop(),
+				elementHeight = this.element.height();
+			if (offset < 0) {
+				this.element.scrollTop( scroll + offset);
+			} else if (offset >= elementHeight) {
+				this.element.scrollTop( scroll + offset - elementHeight + item.height());
+			}
+		}
+		this.active = item.eq(0)
+			.children("a")
+				.addClass("ui-state-hover")
+				.attr("id", "ui-active-menuitem")
+			.end();
+		this._trigger("focus", event, { item: item });
+	},
+
+	deactivate: function() {
+		if (!this.active) { return; }
+
+		this.active.children("a")
+			.removeClass("ui-state-hover")
+			.removeAttr("id");
+		this._trigger("blur");
+		this.active = null;
+	},
+
+	next: function(event) {
+		this.move("next", ".ui-menu-item:first", event);
+	},
+
+	previous: function(event) {
+		this.move("prev", ".ui-menu-item:last", event);
+	},
+
+	first: function() {
+		return this.active && !this.active.prevAll(".ui-menu-item").length;
+	},
+
+	last: function() {
+		return this.active && !this.active.nextAll(".ui-menu-item").length;
+	},
+
+	move: function(direction, edge, event) {
+		if (!this.active) {
+			this.activate(event, this.element.children(edge));
+			return;
+		}
+		var next = this.active[direction + "All"](".ui-menu-item").eq(0);
+		if (next.length) {
+			this.activate(event, next);
+		} else {
+			this.activate(event, this.element.children(edge));
+		}
+	},
+
+	// TODO merge with previousPage
+	nextPage: function(event) {
+		if (this.hasScroll()) {
+			// TODO merge with no-scroll-else
+			if (!this.active || this.last()) {
+				this.activate(event, this.element.children(".ui-menu-item:first"));
+				return;
+			}
+			var base = this.active.offset().top,
+				height = this.element.height(),
+				result = this.element.children(".ui-menu-item").filter(function() {
+					var close = $(this).offset().top - base - height + $(this).height();
+					// TODO improve approximation
+					return close < 10 && close > -10;
+				});
+
+			// TODO try to catch this earlier when scrollTop indicates the last page anyway
+			if (!result.length) {
+				result = this.element.children(".ui-menu-item:last");
+			}
+			this.activate(event, result);
+		} else {
+			this.activate(event, this.element.children(".ui-menu-item")
+				.filter(!this.active || this.last() ? ":first" : ":last"));
+		}
+	},
+
+	// TODO merge with nextPage
+	previousPage: function(event) {
+		if (this.hasScroll()) {
+			// TODO merge with no-scroll-else
+			if (!this.active || this.first()) {
+				this.activate(event, this.element.children(".ui-menu-item:last"));
+				return;
+			}
+
+			var base = this.active.offset().top,
+				height = this.element.height();
+				result = this.element.children(".ui-menu-item").filter(function() {
+					var close = $(this).offset().top - base + height - $(this).height();
+					// TODO improve approximation
+					return close < 10 && close > -10;
+				});
+
+			// TODO try to catch this earlier when scrollTop indicates the last page anyway
+			if (!result.length) {
+				result = this.element.children(".ui-menu-item:first");
+			}
+			this.activate(event, result);
+		} else {
+			this.activate(event, this.element.children(".ui-menu-item")
+				.filter(!this.active || this.first() ? ":last" : ":first"));
+		}
+	},
+
+	hasScroll: function() {
+		return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight");
+	},
+
+	select: function( event ) {
+		this._trigger("selected", event, { item: this.active });
+	}
+});
+
+}(jQuery));

app/assets/javascripts/app/lib/ui/jquery.ui.button.js

@@ -0,0 +1,416 @@
+/*
+ * jQuery UI Button 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var lastActive, startXPos, startYPos, clickDragged,
+	baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
+	stateClasses = "ui-state-hover ui-state-active ",
+	typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only",
+	formResetHandler = function() {
+		var buttons = $( this ).find( ":ui-button" );
+		setTimeout(function() {
+			buttons.button( "refresh" );
+		}, 1 );
+	},
+	radioGroup = function( radio ) {
+		var name = radio.name,
+			form = radio.form,
+			radios = $( [] );
+		if ( name ) {
+			if ( form ) {
+				radios = $( form ).find( "[name='" + name + "']" );
+			} else {
+				radios = $( "[name='" + name + "']", radio.ownerDocument )
+					.filter(function() {
+						return !this.form;
+					});
+			}
+		}
+		return radios;
+	};
+
+$.widget( "ui.button", {
+	options: {
+		disabled: null,
+		text: true,
+		label: null,
+		icons: {
+			primary: null,
+			secondary: null
+		}
+	},
+	_create: function() {
+		this.element.closest( "form" )
+			.unbind( "reset.button" )
+			.bind( "reset.button", formResetHandler );
+
+		if ( typeof this.options.disabled !== "boolean" ) {
+			this.options.disabled = this.element.propAttr( "disabled" );
+		}
+
+		this._determineButtonType();
+		this.hasTitle = !!this.buttonElement.attr( "title" );
+
+		var self = this,
+			options = this.options,
+			toggleButton = this.type === "checkbox" || this.type === "radio",
+			hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
+			focusClass = "ui-state-focus";
+
+		if ( options.label === null ) {
+			options.label = this.buttonElement.html();
+		}
+
+		if ( this.element.is( ":disabled" ) ) {
+			options.disabled = true;
+		}
+
+		this.buttonElement
+			.addClass( baseClasses )
+			.attr( "role", "button" )
+			.bind( "mouseenter.button", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).addClass( "ui-state-hover" );
+				if ( this === lastActive ) {
+					$( this ).addClass( "ui-state-active" );
+				}
+			})
+			.bind( "mouseleave.button", function() {
+				if ( options.disabled ) {
+					return;
+				}
+				$( this ).removeClass( hoverClass );
+			})
+			.bind( "click.button", function( event ) {
+				if ( options.disabled ) {
+					event.preventDefault();
+					event.stopImmediatePropagation();
+				}
+			});
+
+		this.element
+			.bind( "focus.button", function() {
+				// no need to check disabled, focus won't be triggered anyway
+				self.buttonElement.addClass( focusClass );
+			})
+			.bind( "blur.button", function() {
+				self.buttonElement.removeClass( focusClass );
+			});
+
+		if ( toggleButton ) {
+			this.element.bind( "change.button", function() {
+				if ( clickDragged ) {
+					return;
+				}
+				self.refresh();
+			});
+			// if mouse moves between mousedown and mouseup (drag) set clickDragged flag
+			// prevents issue where button state changes but checkbox/radio checked state
+			// does not in Firefox (see ticket #6970)
+			this.buttonElement
+				.bind( "mousedown.button", function( event ) {
+					if ( options.disabled ) {
+						return;
+					}
+					clickDragged = false;
+					startXPos = event.pageX;
+					startYPos = event.pageY;
+				})
+				.bind( "mouseup.button", function( event ) {
+					if ( options.disabled ) {
+						return;
+					}
+					if ( startXPos !== event.pageX || startYPos !== event.pageY ) {
+						clickDragged = true;
+					}
+			});
+		}
+
+		if ( this.type === "checkbox" ) {
+			this.buttonElement.bind( "click.button", function() {
+				if ( options.disabled || clickDragged ) {
+					return false;
+				}
+				$( this ).toggleClass( "ui-state-active" );
+				self.buttonElement.attr( "aria-pressed", self.element[0].checked );
+			});
+		} else if ( this.type === "radio" ) {
+			this.buttonElement.bind( "click.button", function() {
+				if ( options.disabled || clickDragged ) {
+					return false;
+				}
+				$( this ).addClass( "ui-state-active" );
+				self.buttonElement.attr( "aria-pressed", "true" );
+
+				var radio = self.element[ 0 ];
+				radioGroup( radio )
+					.not( radio )
+					.map(function() {
+						return $( this ).button( "widget" )[ 0 ];
+					})
+					.removeClass( "ui-state-active" )
+					.attr( "aria-pressed", "false" );
+			});
+		} else {
+			this.buttonElement
+				.bind( "mousedown.button", function() {
+					if ( options.disabled ) {
+						return false;
+					}
+					$( this ).addClass( "ui-state-active" );
+					lastActive = this;
+					$( document ).one( "mouseup", function() {
+						lastActive = null;
+					});
+				})
+				.bind( "mouseup.button", function() {
+					if ( options.disabled ) {
+						return false;
+					}
+					$( this ).removeClass( "ui-state-active" );
+				})
+				.bind( "keydown.button", function(event) {
+					if ( options.disabled ) {
+						return false;
+					}
+					if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
+						$( this ).addClass( "ui-state-active" );
+					}
+				})
+				.bind( "keyup.button", function() {
+					$( this ).removeClass( "ui-state-active" );
+				});
+
+			if ( this.buttonElement.is("a") ) {
+				this.buttonElement.keyup(function(event) {
+					if ( event.keyCode === $.ui.keyCode.SPACE ) {
+						// TODO pass through original event correctly (just as 2nd argument doesn't work)
+						$( this ).click();
+					}
+				});
+			}
+		}
+
+		// TODO: pull out $.Widget's handling for the disabled option into
+		// $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
+		// be overridden by individual plugins
+		this._setOption( "disabled", options.disabled );
+		this._resetButton();
+	},
+
+	_determineButtonType: function() {
+
+		if ( this.element.is(":checkbox") ) {
+			this.type = "checkbox";
+		} else if ( this.element.is(":radio") ) {
+			this.type = "radio";
+		} else if ( this.element.is("input") ) {
+			this.type = "input";
+		} else {
+			this.type = "button";
+		}
+
+		if ( this.type === "checkbox" || this.type === "radio" ) {
+			// we don't search against the document in case the element
+			// is disconnected from the DOM
+			var ancestor = this.element.parents().filter(":last"),
+				labelSelector = "label[for='" + this.element.attr("id") + "']";
+			this.buttonElement = ancestor.find( labelSelector );
+			if ( !this.buttonElement.length ) {
+				ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
+				this.buttonElement = ancestor.filter( labelSelector );
+				if ( !this.buttonElement.length ) {
+					this.buttonElement = ancestor.find( labelSelector );
+				}
+			}
+			this.element.addClass( "ui-helper-hidden-accessible" );
+
+			var checked = this.element.is( ":checked" );
+			if ( checked ) {
+				this.buttonElement.addClass( "ui-state-active" );
+			}
+			this.buttonElement.attr( "aria-pressed", checked );
+		} else {
+			this.buttonElement = this.element;
+		}
+	},
+
+	widget: function() {
+		return this.buttonElement;
+	},
+
+	destroy: function() {
+		this.element
+			.removeClass( "ui-helper-hidden-accessible" );
+		this.buttonElement
+			.removeClass( baseClasses + " " + stateClasses + " " + typeClasses )
+			.removeAttr( "role" )
+			.removeAttr( "aria-pressed" )
+			.html( this.buttonElement.find(".ui-button-text").html() );
+
+		if ( !this.hasTitle ) {
+			this.buttonElement.removeAttr( "title" );
+		}
+
+		$.Widget.prototype.destroy.call( this );
+	},
+
+	_setOption: function( key, value ) {
+		$.Widget.prototype._setOption.apply( this, arguments );
+		if ( key === "disabled" ) {
+			if ( value ) {
+				this.element.propAttr( "disabled", true );
+			} else {
+				this.element.propAttr( "disabled", false );
+			}
+			return;
+		}
+		this._resetButton();
+	},
+
+	refresh: function() {
+		var isDisabled = this.element.is( ":disabled" );
+		if ( isDisabled !== this.options.disabled ) {
+			this._setOption( "disabled", isDisabled );
+		}
+		if ( this.type === "radio" ) {
+			radioGroup( this.element[0] ).each(function() {
+				if ( $( this ).is( ":checked" ) ) {
+					$( this ).button( "widget" )
+						.addClass( "ui-state-active" )
+						.attr( "aria-pressed", "true" );
+				} else {
+					$( this ).button( "widget" )
+						.removeClass( "ui-state-active" )
+						.attr( "aria-pressed", "false" );
+				}
+			});
+		} else if ( this.type === "checkbox" ) {
+			if ( this.element.is( ":checked" ) ) {
+				this.buttonElement
+					.addClass( "ui-state-active" )
+					.attr( "aria-pressed", "true" );
+			} else {
+				this.buttonElement
+					.removeClass( "ui-state-active" )
+					.attr( "aria-pressed", "false" );
+			}
+		}
+	},
+
+	_resetButton: function() {
+		if ( this.type === "input" ) {
+			if ( this.options.label ) {
+				this.element.val( this.options.label );
+			}
+			return;
+		}
+		var buttonElement = this.buttonElement.removeClass( typeClasses ),
+			buttonText = $( "<span></span>", this.element[0].ownerDocument )
+				.addClass( "ui-button-text" )
+				.html( this.options.label )
+				.appendTo( buttonElement.empty() )
+				.text(),
+			icons = this.options.icons,
+			multipleIcons = icons.primary && icons.secondary,
+			buttonClasses = [];  
+
+		if ( icons.primary || icons.secondary ) {
+			if ( this.options.text ) {
+				buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) );
+			}
+
+			if ( icons.primary ) {
+				buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
+			}
+
+			if ( icons.secondary ) {
+				buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
+			}
+
+			if ( !this.options.text ) {
+				buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" );
+
+				if ( !this.hasTitle ) {
+					buttonElement.attr( "title", buttonText );
+				}
+			}
+		} else {
+			buttonClasses.push( "ui-button-text-only" );
+		}
+		buttonElement.addClass( buttonClasses.join( " " ) );
+	}
+});
+
+$.widget( "ui.buttonset", {
+	options: {
+		items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)"
+	},
+
+	_create: function() {
+		this.element.addClass( "ui-buttonset" );
+	},
+	
+	_init: function() {
+		this.refresh();
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "disabled" ) {
+			this.buttons.button( "option", key, value );
+		}
+
+		$.Widget.prototype._setOption.apply( this, arguments );
+	},
+	
+	refresh: function() {
+		var rtl = this.element.css( "direction" ) === "rtl";
+		
+		this.buttons = this.element.find( this.options.items )
+			.filter( ":ui-button" )
+				.button( "refresh" )
+			.end()
+			.not( ":ui-button" )
+				.button()
+			.end()
+			.map(function() {
+				return $( this ).button( "widget" )[ 0 ];
+			})
+				.removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
+				.filter( ":first" )
+					.addClass( rtl ? "ui-corner-right" : "ui-corner-left" )
+				.end()
+				.filter( ":last" )
+					.addClass( rtl ? "ui-corner-left" : "ui-corner-right" )
+				.end()
+			.end();
+	},
+
+	destroy: function() {
+		this.element.removeClass( "ui-buttonset" );
+		this.buttons
+			.map(function() {
+				return $( this ).button( "widget" )[ 0 ];
+			})
+				.removeClass( "ui-corner-left ui-corner-right" )
+			.end()
+			.button( "destroy" );
+
+		$.Widget.prototype.destroy.call( this );
+	}
+});
+
+}( jQuery ) );

app/assets/javascripts/app/lib/ui/jquery.ui.core.js

@@ -0,0 +1,314 @@
+/*!
+ * jQuery UI 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function( $, undefined ) {
+
+// prevent duplicate loading
+// this is only a problem because we proxy existing functions
+// and we don't want to double proxy them
+$.ui = $.ui || {};
+if ( $.ui.version ) {
+	return;
+}
+
+$.extend( $.ui, {
+	version: "1.8.17",
+
+	keyCode: {
+		ALT: 18,
+		BACKSPACE: 8,
+		CAPS_LOCK: 20,
+		COMMA: 188,
+		COMMAND: 91,
+		COMMAND_LEFT: 91, // COMMAND
+		COMMAND_RIGHT: 93,
+		CONTROL: 17,
+		DELETE: 46,
+		DOWN: 40,
+		END: 35,
+		ENTER: 13,
+		ESCAPE: 27,
+		HOME: 36,
+		INSERT: 45,
+		LEFT: 37,
+		MENU: 93, // COMMAND_RIGHT
+		NUMPAD_ADD: 107,
+		NUMPAD_DECIMAL: 110,
+		NUMPAD_DIVIDE: 111,
+		NUMPAD_ENTER: 108,
+		NUMPAD_MULTIPLY: 106,
+		NUMPAD_SUBTRACT: 109,
+		PAGE_DOWN: 34,
+		PAGE_UP: 33,
+		PERIOD: 190,
+		RIGHT: 39,
+		SHIFT: 16,
+		SPACE: 32,
+		TAB: 9,
+		UP: 38,
+		WINDOWS: 91 // COMMAND
+	}
+});
+
+// plugins
+$.fn.extend({
+	propAttr: $.fn.prop || $.fn.attr,
+
+	_focus: $.fn.focus,
+	focus: function( delay, fn ) {
+		return typeof delay === "number" ?
+			this.each(function() {
+				var elem = this;
+				setTimeout(function() {
+					$( elem ).focus();
+					if ( fn ) {
+						fn.call( elem );
+					}
+				}, delay );
+			}) :
+			this._focus.apply( this, arguments );
+	},
+
+	scrollParent: function() {
+		var scrollParent;
+		if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+			scrollParent = this.parents().filter(function() {
+				return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+			}).eq(0);
+		} else {
+			scrollParent = this.parents().filter(function() {
+				return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+			}).eq(0);
+		}
+
+		return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+	},
+
+	zIndex: function( zIndex ) {
+		if ( zIndex !== undefined ) {
+			return this.css( "zIndex", zIndex );
+		}
+
+		if ( this.length ) {
+			var elem = $( this[ 0 ] ), position, value;
+			while ( elem.length && elem[ 0 ] !== document ) {
+				// Ignore z-index if position is set to a value where z-index is ignored by the browser
+				// This makes behavior of this function consistent across browsers
+				// WebKit always returns auto if the element is positioned
+				position = elem.css( "position" );
+				if ( position === "absolute" || position === "relative" || position === "fixed" ) {
+					// IE returns 0 when zIndex is not specified
+					// other browsers return a string
+					// we ignore the case of nested elements with an explicit value of 0
+					// <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+					value = parseInt( elem.css( "zIndex" ), 10 );
+					if ( !isNaN( value ) && value !== 0 ) {
+						return value;
+					}
+				}
+				elem = elem.parent();
+			}
+		}
+
+		return 0;
+	},
+
+	disableSelection: function() {
+		return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
+			".ui-disableSelection", function( event ) {
+				event.preventDefault();
+			});
+	},
+
+	enableSelection: function() {
+		return this.unbind( ".ui-disableSelection" );
+	}
+});
+
+$.each( [ "Width", "Height" ], function( i, name ) {
+	var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
+		type = name.toLowerCase(),
+		orig = {
+			innerWidth: $.fn.innerWidth,
+			innerHeight: $.fn.innerHeight,
+			outerWidth: $.fn.outerWidth,
+			outerHeight: $.fn.outerHeight
+		};
+
+	function reduce( elem, size, border, margin ) {
+		$.each( side, function() {
+			size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0;
+			if ( border ) {
+				size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0;
+			}
+			if ( margin ) {
+				size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0;
+			}
+		});
+		return size;
+	}
+
+	$.fn[ "inner" + name ] = function( size ) {
+		if ( size === undefined ) {
+			return orig[ "inner" + name ].call( this );
+		}
+
+		return this.each(function() {
+			$( this ).css( type, reduce( this, size ) + "px" );
+		});
+	};
+
+	$.fn[ "outer" + name] = function( size, margin ) {
+		if ( typeof size !== "number" ) {
+			return orig[ "outer" + name ].call( this, size );
+		}
+
+		return this.each(function() {
+			$( this).css( type, reduce( this, size, true, margin ) + "px" );
+		});
+	};
+});
+
+// selectors
+function focusable( element, isTabIndexNotNaN ) {
+	var nodeName = element.nodeName.toLowerCase();
+	if ( "area" === nodeName ) {
+		var map = element.parentNode,
+			mapName = map.name,
+			img;
+		if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
+			return false;
+		}
+		img = $( "img[usemap=#" + mapName + "]" )[0];
+		return !!img && visible( img );
+	}
+	return ( /input|select|textarea|button|object/.test( nodeName )
+		? !element.disabled
+		: "a" == nodeName
+			? element.href || isTabIndexNotNaN
+			: isTabIndexNotNaN)
+		// the element and all of its ancestors must be visible
+		&& visible( element );
+}
+
+function visible( element ) {
+	return !$( element ).parents().andSelf().filter(function() {
+		return $.curCSS( this, "visibility" ) === "hidden" ||
+			$.expr.filters.hidden( this );
+	}).length;
+}
+
+$.extend( $.expr[ ":" ], {
+	data: function( elem, i, match ) {
+		return !!$.data( elem, match[ 3 ] );
+	},
+
+	focusable: function( element ) {
+		return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) );
+	},
+
+	tabbable: function( element ) {
+		var tabIndex = $.attr( element, "tabindex" ),
+			isTabIndexNaN = isNaN( tabIndex );
+		return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN );
+	}
+});
+
+// support
+$(function() {
+	var body = document.body,
+		div = body.appendChild( div = document.createElement( "div" ) );
+
+	$.extend( div.style, {
+		minHeight: "100px",
+		height: "auto",
+		padding: 0,
+		borderWidth: 0
+	});
+
+	$.support.minHeight = div.offsetHeight === 100;
+	$.support.selectstart = "onselectstart" in div;
+
+	// set display to none to avoid a layout bug in IE
+	// http://dev.jquery.com/ticket/4014
+	body.removeChild( div ).style.display = "none";
+});
+
+
+
+
+
+// deprecated
+$.extend( $.ui, {
+	// $.ui.plugin is deprecated.  Use the proxy pattern instead.
+	plugin: {
+		add: function( module, option, set ) {
+			var proto = $.ui[ module ].prototype;
+			for ( var i in set ) {
+				proto.plugins[ i ] = proto.plugins[ i ] || [];
+				proto.plugins[ i ].push( [ option, set[ i ] ] );
+			}
+		},
+		call: function( instance, name, args ) {
+			var set = instance.plugins[ name ];
+			if ( !set || !instance.element[ 0 ].parentNode ) {
+				return;
+			}
+	
+			for ( var i = 0; i < set.length; i++ ) {
+				if ( instance.options[ set[ i ][ 0 ] ] ) {
+					set[ i ][ 1 ].apply( instance.element, args );
+				}
+			}
+		}
+	},
+	
+	// will be deprecated when we switch to jQuery 1.4 - use jQuery.contains()
+	contains: function( a, b ) {
+		return document.compareDocumentPosition ?
+			a.compareDocumentPosition( b ) & 16 :
+			a !== b && a.contains( b );
+	},
+	
+	// only used by resizable
+	hasScroll: function( el, a ) {
+	
+		//If overflow is hidden, the element might have extra content, but the user wants to hide it
+		if ( $( el ).css( "overflow" ) === "hidden") {
+			return false;
+		}
+	
+		var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
+			has = false;
+	
+		if ( el[ scroll ] > 0 ) {
+			return true;
+		}
+	
+		// TODO: determine which cases actually cause this to happen
+		// if the element doesn't have the scroll set, see if it's possible to
+		// set the scroll
+		el[ scroll ] = 1;
+		has = ( el[ scroll ] > 0 );
+		el[ scroll ] = 0;
+		return has;
+	},
+	
+	// these are odd functions, fix the API or move into individual plugins
+	isOverAxis: function( x, reference, size ) {
+		//Determines when x coordinate is over "b" element axis
+		return ( x > reference ) && ( x < ( reference + size ) );
+	},
+	isOver: function( y, x, top, left, height, width ) {
+		//Determines when x, y coordinates is over "b" element
+		return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width );
+	}
+});
+
+})( jQuery );

app/assets/javascripts/app/lib/ui/jquery.ui.dialog.js

@@ -0,0 +1,878 @@
+/*
+ * jQuery UI Dialog 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *  jquery.ui.button.js
+ *	jquery.ui.draggable.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.position.js
+ *	jquery.ui.resizable.js
+ */
+(function( $, undefined ) {
+
+var uiDialogClasses =
+		'ui-dialog ' +
+		'ui-widget ' +
+		'ui-widget-content ' +
+		'ui-corner-all ',
+	sizeRelatedOptions = {
+		buttons: true,
+		height: true,
+		maxHeight: true,
+		maxWidth: true,
+		minHeight: true,
+		minWidth: true,
+		width: true
+	},
+	resizableRelatedOptions = {
+		maxHeight: true,
+		maxWidth: true,
+		minHeight: true,
+		minWidth: true
+	},
+	// support for jQuery 1.3.2 - handle common attrFn methods for dialog
+	attrFn = $.attrFn || {
+		val: true,
+		css: true,
+		html: true,
+		text: true,
+		data: true,
+		width: true,
+		height: true,
+		offset: true,
+		click: true
+	};
+
+$.widget("ui.dialog", {
+	options: {
+		autoOpen: true,
+		buttons: {},
+		closeOnEscape: true,
+		closeText: 'close',
+		dialogClass: '',
+		draggable: true,
+		hide: null,
+		height: 'auto',
+		maxHeight: false,
+		maxWidth: false,
+		minHeight: 150,
+		minWidth: 150,
+		modal: false,
+		position: {
+			my: 'center',
+			at: 'center',
+			collision: 'fit',
+			// ensure that the titlebar is never outside the document
+			using: function(pos) {
+				var topOffset = $(this).css(pos).offset().top;
+				if (topOffset < 0) {
+					$(this).css('top', pos.top - topOffset);
+				}
+			}
+		},
+		resizable: true,
+		show: null,
+		stack: true,
+		title: '',
+		width: 300,
+		zIndex: 1000
+	},
+
+	_create: function() {
+		this.originalTitle = this.element.attr('title');
+		// #5742 - .attr() might return a DOMElement
+		if ( typeof this.originalTitle !== "string" ) {
+			this.originalTitle = "";
+		}
+
+		this.options.title = this.options.title || this.originalTitle;
+		var self = this,
+			options = self.options,
+
+			title = options.title || '&#160;',
+			titleId = $.ui.dialog.getTitleId(self.element),
+
+			uiDialog = (self.uiDialog = $('<div></div>'))
+				.appendTo(document.body)
+				.hide()
+				.addClass(uiDialogClasses + options.dialogClass)
+				.css({
+					zIndex: options.zIndex
+				})
+				// setting tabIndex makes the div focusable
+				// setting outline to 0 prevents a border on focus in Mozilla
+				.attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+					if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
+						event.keyCode === $.ui.keyCode.ESCAPE) {
+						
+						self.close(event);
+						event.preventDefault();
+					}
+				})
+				.attr({
+					role: 'dialog',
+					'aria-labelledby': titleId
+				})
+				.mousedown(function(event) {
+					self.moveToTop(false, event);
+				}),
+
+			uiDialogContent = self.element
+				.show()
+				.removeAttr('title')
+				.addClass(
+					'ui-dialog-content ' +
+					'ui-widget-content')
+				.appendTo(uiDialog),
+
+			uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
+				.addClass(
+					'ui-dialog-titlebar ' +
+					'ui-widget-header ' +
+					'ui-corner-all ' +
+					'ui-helper-clearfix'
+				)
+				.prependTo(uiDialog),
+
+			uiDialogTitlebarClose = $('<a href="#"></a>')
+				.addClass(
+					'ui-dialog-titlebar-close ' +
+					'ui-corner-all'
+				)
+				.attr('role', 'button')
+				.hover(
+					function() {
+						uiDialogTitlebarClose.addClass('ui-state-hover');
+					},
+					function() {
+						uiDialogTitlebarClose.removeClass('ui-state-hover');
+					}
+				)
+				.focus(function() {
+					uiDialogTitlebarClose.addClass('ui-state-focus');
+				})
+				.blur(function() {
+					uiDialogTitlebarClose.removeClass('ui-state-focus');
+				})
+				.click(function(event) {
+					self.close(event);
+					return false;
+				})
+				.appendTo(uiDialogTitlebar),
+
+			uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
+				.addClass(
+					'ui-icon ' +
+					'ui-icon-closethick'
+				)
+				.text(options.closeText)
+				.appendTo(uiDialogTitlebarClose),
+
+			uiDialogTitle = $('<span></span>')
+				.addClass('ui-dialog-title')
+				.attr('id', titleId)
+				.html(title)
+				.prependTo(uiDialogTitlebar);
+
+		//handling of deprecated beforeclose (vs beforeClose) option
+		//Ticket #4669 http://dev.jqueryui.com/ticket/4669
+		//TODO: remove in 1.9pre
+		if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
+			options.beforeClose = options.beforeclose;
+		}
+
+		uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+		if (options.draggable && $.fn.draggable) {
+			self._makeDraggable();
+		}
+		if (options.resizable && $.fn.resizable) {
+			self._makeResizable();
+		}
+
+		self._createButtons(options.buttons);
+		self._isOpen = false;
+
+		if ($.fn.bgiframe) {
+			uiDialog.bgiframe();
+		}
+	},
+
+	_init: function() {
+		if ( this.options.autoOpen ) {
+			this.open();
+		}
+	},
+
+	destroy: function() {
+		var self = this;
+		
+		if (self.overlay) {
+			self.overlay.destroy();
+		}
+		self.uiDialog.hide();
+		self.element
+			.unbind('.dialog')
+			.removeData('dialog')
+			.removeClass('ui-dialog-content ui-widget-content')
+			.hide().appendTo('body');
+		self.uiDialog.remove();
+
+		if (self.originalTitle) {
+			self.element.attr('title', self.originalTitle);
+		}
+
+		return self;
+	},
+
+	widget: function() {
+		return this.uiDialog;
+	},
+
+	close: function(event) {
+		var self = this,
+			maxZ, thisZ;
+		
+		if (false === self._trigger('beforeClose', event)) {
+			return;
+		}
+
+		if (self.overlay) {
+			self.overlay.destroy();
+		}
+		self.uiDialog.unbind('keypress.ui-dialog');
+
+		self._isOpen = false;
+
+		if (self.options.hide) {
+			self.uiDialog.hide(self.options.hide, function() {
+				self._trigger('close', event);
+			});
+		} else {
+			self.uiDialog.hide();
+			self._trigger('close', event);
+		}
+
+		$.ui.dialog.overlay.resize();
+
+		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+		if (self.options.modal) {
+			maxZ = 0;
+			$('.ui-dialog').each(function() {
+				if (this !== self.uiDialog[0]) {
+					thisZ = $(this).css('z-index');
+					if(!isNaN(thisZ)) {
+						maxZ = Math.max(maxZ, thisZ);
+					}
+				}
+			});
+			$.ui.dialog.maxZ = maxZ;
+		}
+
+		return self;
+	},
+
+	isOpen: function() {
+		return this._isOpen;
+	},
+
+	// the force parameter allows us to move modal dialogs to their correct
+	// position on open
+	moveToTop: function(force, event) {
+		var self = this,
+			options = self.options,
+			saveScroll;
+
+		if ((options.modal && !force) ||
+			(!options.stack && !options.modal)) {
+			return self._trigger('focus', event);
+		}
+
+		if (options.zIndex > $.ui.dialog.maxZ) {
+			$.ui.dialog.maxZ = options.zIndex;
+		}
+		if (self.overlay) {
+			$.ui.dialog.maxZ += 1;
+			self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
+		}
+
+		//Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+		//  http://ui.jquery.com/bugs/ticket/3193
+		saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() };
+		$.ui.dialog.maxZ += 1;
+		self.uiDialog.css('z-index', $.ui.dialog.maxZ);
+		self.element.attr(saveScroll);
+		self._trigger('focus', event);
+
+		return self;
+	},
+
+	open: function() {
+		if (this._isOpen) { return; }
+
+		var self = this,
+			options = self.options,
+			uiDialog = self.uiDialog;
+
+		self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
+		self._size();
+		self._position(options.position);
+		uiDialog.show(options.show);
+		self.moveToTop(true);
+
+		// prevent tabbing out of modal dialogs
+		if ( options.modal ) {
+			uiDialog.bind( "keydown.ui-dialog", function( event ) {
+				if ( event.keyCode !== $.ui.keyCode.TAB ) {
+					return;
+				}
+
+				var tabbables = $(':tabbable', this),
+					first = tabbables.filter(':first'),
+					last  = tabbables.filter(':last');
+
+				if (event.target === last[0] && !event.shiftKey) {
+					first.focus(1);
+					return false;
+				} else if (event.target === first[0] && event.shiftKey) {
+					last.focus(1);
+					return false;
+				}
+			});
+		}
+
+		// set focus to the first tabbable element in the content area or the first button
+		// if there are no tabbable elements, set focus on the dialog itself
+		$(self.element.find(':tabbable').get().concat(
+			uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat(
+				uiDialog.get()))).eq(0).focus();
+
+		self._isOpen = true;
+		self._trigger('open');
+
+		return self;
+	},
+
+	_createButtons: function(buttons) {
+		var self = this,
+			hasButtons = false,
+			uiDialogButtonPane = $('<div></div>')
+				.addClass(
+					'ui-dialog-buttonpane ' +
+					'ui-widget-content ' +
+					'ui-helper-clearfix'
+				),
+			uiButtonSet = $( "<div></div>" )
+				.addClass( "ui-dialog-buttonset" )
+				.appendTo( uiDialogButtonPane );
+
+		// if we already have a button pane, remove it
+		self.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+		if (typeof buttons === 'object' && buttons !== null) {
+			$.each(buttons, function() {
+				return !(hasButtons = true);
+			});
+		}
+		if (hasButtons) {
+			$.each(buttons, function(name, props) {
+				props = $.isFunction( props ) ?
+					{ click: props, text: name } :
+					props;
+				var button = $('<button type="button"></button>')
+					.click(function() {
+						props.click.apply(self.element[0], arguments);
+					})
+					.appendTo(uiButtonSet);
+				// can't use .attr( props, true ) with jQuery 1.3.2.
+				$.each( props, function( key, value ) {
+					if ( key === "click" ) {
+						return;
+					}
+					if ( key in attrFn ) {
+						button[ key ]( value );
+					} else {
+						button.attr( key, value );
+					}
+				});
+				if ($.fn.button) {
+					button.button();
+				}
+			});
+			uiDialogButtonPane.appendTo(self.uiDialog);
+		}
+	},
+
+	_makeDraggable: function() {
+		var self = this,
+			options = self.options,
+			doc = $(document),
+			heightBeforeDrag;
+
+		function filteredUi(ui) {
+			return {
+				position: ui.position,
+				offset: ui.offset
+			};
+		}
+
+		self.uiDialog.draggable({
+			cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
+			handle: '.ui-dialog-titlebar',
+			containment: 'document',
+			start: function(event, ui) {
+				heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
+				$(this).height($(this).height()).addClass("ui-dialog-dragging");
+				self._trigger('dragStart', event, filteredUi(ui));
+			},
+			drag: function(event, ui) {
+				self._trigger('drag', event, filteredUi(ui));
+			},
+			stop: function(event, ui) {
+				options.position = [ui.position.left - doc.scrollLeft(),
+					ui.position.top - doc.scrollTop()];
+				$(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+				self._trigger('dragStop', event, filteredUi(ui));
+				$.ui.dialog.overlay.resize();
+			}
+		});
+	},
+
+	_makeResizable: function(handles) {
+		handles = (handles === undefined ? this.options.resizable : handles);
+		var self = this,
+			options = self.options,
+			// .ui-resizable has position: relative defined in the stylesheet
+			// but dialogs have to use absolute or fixed positioning
+			position = self.uiDialog.css('position'),
+			resizeHandles = (typeof handles === 'string' ?
+				handles	:
+				'n,e,s,w,se,sw,ne,nw'
+			);
+
+		function filteredUi(ui) {
+			return {
+				originalPosition: ui.originalPosition,
+				originalSize: ui.originalSize,
+				position: ui.position,
+				size: ui.size
+			};
+		}
+
+		self.uiDialog.resizable({
+			cancel: '.ui-dialog-content',
+			containment: 'document',
+			alsoResize: self.element,
+			maxWidth: options.maxWidth,
+			maxHeight: options.maxHeight,
+			minWidth: options.minWidth,
+			minHeight: self._minHeight(),
+			handles: resizeHandles,
+			start: function(event, ui) {
+				$(this).addClass("ui-dialog-resizing");
+				self._trigger('resizeStart', event, filteredUi(ui));
+			},
+			resize: function(event, ui) {
+				self._trigger('resize', event, filteredUi(ui));
+			},
+			stop: function(event, ui) {
+				$(this).removeClass("ui-dialog-resizing");
+				options.height = $(this).height();
+				options.width = $(this).width();
+				self._trigger('resizeStop', event, filteredUi(ui));
+				$.ui.dialog.overlay.resize();
+			}
+		})
+		.css('position', position)
+		.find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+	},
+
+	_minHeight: function() {
+		var options = this.options;
+
+		if (options.height === 'auto') {
+			return options.minHeight;
+		} else {
+			return Math.min(options.minHeight, options.height);
+		}
+	},
+
+	_position: function(position) {
+		var myAt = [],
+			offset = [0, 0],
+			isVisible;
+
+		if (position) {
+			// deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
+	//		if (typeof position == 'string' || $.isArray(position)) {
+	//			myAt = $.isArray(position) ? position : position.split(' ');
+
+			if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
+				myAt = position.split ? position.split(' ') : [position[0], position[1]];
+				if (myAt.length === 1) {
+					myAt[1] = myAt[0];
+				}
+
+				$.each(['left', 'top'], function(i, offsetPosition) {
+					if (+myAt[i] === myAt[i]) {
+						offset[i] = myAt[i];
+						myAt[i] = offsetPosition;
+					}
+				});
+
+				position = {
+					my: myAt.join(" "),
+					at: myAt.join(" "),
+					offset: offset.join(" ")
+				};
+			} 
+
+			position = $.extend({}, $.ui.dialog.prototype.options.position, position);
+		} else {
+			position = $.ui.dialog.prototype.options.position;
+		}
+
+		// need to show the dialog to get the actual offset in the position plugin
+		isVisible = this.uiDialog.is(':visible');
+		if (!isVisible) {
+			this.uiDialog.show();
+		}
+		this.uiDialog
+			// workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+			.css({ top: 0, left: 0 })
+			.position($.extend({ of: window }, position));
+		if (!isVisible) {
+			this.uiDialog.hide();
+		}
+	},
+
+	_setOptions: function( options ) {
+		var self = this,
+			resizableOptions = {},
+			resize = false;
+
+		$.each( options, function( key, value ) {
+			self._setOption( key, value );
+			
+			if ( key in sizeRelatedOptions ) {
+				resize = true;
+			}
+			if ( key in resizableRelatedOptions ) {
+				resizableOptions[ key ] = value;
+			}
+		});
+
+		if ( resize ) {
+			this._size();
+		}
+		if ( this.uiDialog.is( ":data(resizable)" ) ) {
+			this.uiDialog.resizable( "option", resizableOptions );
+		}
+	},
+
+	_setOption: function(key, value){
+		var self = this,
+			uiDialog = self.uiDialog;
+
+		switch (key) {
+			//handling of deprecated beforeclose (vs beforeClose) option
+			//Ticket #4669 http://dev.jqueryui.com/ticket/4669
+			//TODO: remove in 1.9pre
+			case "beforeclose":
+				key = "beforeClose";
+				break;
+			case "buttons":
+				self._createButtons(value);
+				break;
+			case "closeText":
+				// ensure that we always pass a string
+				self.uiDialogTitlebarCloseText.text("" + value);
+				break;
+			case "dialogClass":
+				uiDialog
+					.removeClass(self.options.dialogClass)
+					.addClass(uiDialogClasses + value);
+				break;
+			case "disabled":
+				if (value) {
+					uiDialog.addClass('ui-dialog-disabled');
+				} else {
+					uiDialog.removeClass('ui-dialog-disabled');
+				}
+				break;
+			case "draggable":
+				var isDraggable = uiDialog.is( ":data(draggable)" );
+				if ( isDraggable && !value ) {
+					uiDialog.draggable( "destroy" );
+				}
+				
+				if ( !isDraggable && value ) {
+					self._makeDraggable();
+				}
+				break;
+			case "position":
+				self._position(value);
+				break;
+			case "resizable":
+				// currently resizable, becoming non-resizable
+				var isResizable = uiDialog.is( ":data(resizable)" );
+				if (isResizable && !value) {
+					uiDialog.resizable('destroy');
+				}
+
+				// currently resizable, changing handles
+				if (isResizable && typeof value === 'string') {
+					uiDialog.resizable('option', 'handles', value);
+				}
+
+				// currently non-resizable, becoming resizable
+				if (!isResizable && value !== false) {
+					self._makeResizable(value);
+				}
+				break;
+			case "title":
+				// convert whatever was passed in o a string, for html() to not throw up
+				$(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || '&#160;'));
+				break;
+		}
+
+		$.Widget.prototype._setOption.apply(self, arguments);
+	},
+
+	_size: function() {
+		/* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+		 * divs will both have width and height set, so we need to reset them
+		 */
+		var options = this.options,
+			nonContentHeight,
+			minContentHeight,
+			isVisible = this.uiDialog.is( ":visible" );
+
+		// reset content sizing
+		this.element.show().css({
+			width: 'auto',
+			minHeight: 0,
+			height: 0
+		});
+
+		if (options.minWidth > options.width) {
+			options.width = options.minWidth;
+		}
+
+		// reset wrapper sizing
+		// determine the height of all the non-content elements
+		nonContentHeight = this.uiDialog.css({
+				height: 'auto',
+				width: options.width
+			})
+			.height();
+		minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
+		
+		if ( options.height === "auto" ) {
+			// only needed for IE6 support
+			if ( $.support.minHeight ) {
+				this.element.css({
+					minHeight: minContentHeight,
+					height: "auto"
+				});
+			} else {
+				this.uiDialog.show();
+				var autoHeight = this.element.css( "height", "auto" ).height();
+				if ( !isVisible ) {
+					this.uiDialog.hide();
+				}
+				this.element.height( Math.max( autoHeight, minContentHeight ) );
+			}
+		} else {
+			this.element.height( Math.max( options.height - nonContentHeight, 0 ) );
+		}
+
+		if (this.uiDialog.is(':data(resizable)')) {
+			this.uiDialog.resizable('option', 'minHeight', this._minHeight());
+		}
+	}
+});
+
+$.extend($.ui.dialog, {
+	version: "1.8.17",
+
+	uuid: 0,
+	maxZ: 0,
+
+	getTitleId: function($el) {
+		var id = $el.attr('id');
+		if (!id) {
+			this.uuid += 1;
+			id = this.uuid;
+		}
+		return 'ui-dialog-title-' + id;
+	},
+
+	overlay: function(dialog) {
+		this.$el = $.ui.dialog.overlay.create(dialog);
+	}
+});
+
+$.extend($.ui.dialog.overlay, {
+	instances: [],
+	// reuse old instances due to IE memory leak with alpha transparency (see #5185)
+	oldInstances: [],
+	maxZ: 0,
+	events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+		function(event) { return event + '.dialog-overlay'; }).join(' '),
+	create: function(dialog) {
+		if (this.instances.length === 0) {
+			// prevent use of anchors and inputs
+			// we use a setTimeout in case the overlay is created from an
+			// event that we're going to be cancelling (see #2804)
+			setTimeout(function() {
+				// handle $(el).dialog().dialog('close') (see #4065)
+				if ($.ui.dialog.overlay.instances.length) {
+					$(document).bind($.ui.dialog.overlay.events, function(event) {
+						// stop events if the z-index of the target is < the z-index of the overlay
+						// we cannot return true when we don't want to cancel the event (#3523)
+						if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) {
+							return false;
+						}
+					});
+				}
+			}, 1);
+
+			// allow closing by pressing the escape key
+			$(document).bind('keydown.dialog-overlay', function(event) {
+				if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
+					event.keyCode === $.ui.keyCode.ESCAPE) {
+					
+					dialog.close(event);
+					event.preventDefault();
+				}
+			});
+
+			// handle window resize
+			$(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+		}
+
+		var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
+			.appendTo(document.body)
+			.css({
+				width: this.width(),
+				height: this.height()
+			});
+
+		if ($.fn.bgiframe) {
+			$el.bgiframe();
+		}
+
+		this.instances.push($el);
+		return $el;
+	},
+
+	destroy: function($el) {
+		var indexOf = $.inArray($el, this.instances);
+		if (indexOf != -1){
+			this.oldInstances.push(this.instances.splice(indexOf, 1)[0]);
+		}
+
+		if (this.instances.length === 0) {
+			$([document, window]).unbind('.dialog-overlay');
+		}
+
+		$el.remove();
+		
+		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+		var maxZ = 0;
+		$.each(this.instances, function() {
+			maxZ = Math.max(maxZ, this.css('z-index'));
+		});
+		this.maxZ = maxZ;
+	},
+
+	height: function() {
+		var scrollHeight,
+			offsetHeight;
+		// handle IE 6
+		if ($.browser.msie && $.browser.version < 7) {
+			scrollHeight = Math.max(
+				document.documentElement.scrollHeight,
+				document.body.scrollHeight
+			);
+			offsetHeight = Math.max(
+				document.documentElement.offsetHeight,
+				document.body.offsetHeight
+			);
+
+			if (scrollHeight < offsetHeight) {
+				return $(window).height() + 'px';
+			} else {
+				return scrollHeight + 'px';
+			}
+		// handle "good" browsers
+		} else {
+			return $(document).height() + 'px';
+		}
+	},
+
+	width: function() {
+		var scrollWidth,
+			offsetWidth;
+		// handle IE
+		if ( $.browser.msie ) {
+			scrollWidth = Math.max(
+				document.documentElement.scrollWidth,
+				document.body.scrollWidth
+			);
+			offsetWidth = Math.max(
+				document.documentElement.offsetWidth,
+				document.body.offsetWidth
+			);
+
+			if (scrollWidth < offsetWidth) {
+				return $(window).width() + 'px';
+			} else {
+				return scrollWidth + 'px';
+			}
+		// handle "good" browsers
+		} else {
+			return $(document).width() + 'px';
+		}
+	},
+
+	resize: function() {
+		/* If the dialog is draggable and the user drags it past the
+		 * right edge of the window, the document becomes wider so we
+		 * need to stretch the overlay. If the user then drags the
+		 * dialog back to the left, the document will become narrower,
+		 * so we need to shrink the overlay to the appropriate size.
+		 * This is handled by shrinking the overlay before setting it
+		 * to the full document size.
+		 */
+		var $overlays = $([]);
+		$.each($.ui.dialog.overlay.instances, function() {
+			$overlays = $overlays.add(this);
+		});
+
+		$overlays.css({
+			width: 0,
+			height: 0
+		}).css({
+			width: $.ui.dialog.overlay.width(),
+			height: $.ui.dialog.overlay.height()
+		});
+	}
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+	destroy: function() {
+		$.ui.dialog.overlay.destroy(this.$el);
+	}
+});
+
+}(jQuery));

app/assets/javascripts/app/lib/ui/jquery.ui.draggable.js

@@ -0,0 +1,825 @@
+/*
+ * jQuery UI Draggable 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.draggable", $.ui.mouse, {
+	widgetEventPrefix: "drag",
+	options: {
+		addClasses: true,
+		appendTo: "parent",
+		axis: false,
+		connectToSortable: false,
+		containment: false,
+		cursor: "auto",
+		cursorAt: false,
+		grid: false,
+		handle: false,
+		helper: "original",
+		iframeFix: false,
+		opacity: false,
+		refreshPositions: false,
+		revert: false,
+		revertDuration: 500,
+		scope: "default",
+		scroll: true,
+		scrollSensitivity: 20,
+		scrollSpeed: 20,
+		snap: false,
+		snapMode: "both",
+		snapTolerance: 20,
+		stack: false,
+		zIndex: false
+	},
+	_create: function() {
+
+		if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+			this.element[0].style.position = 'relative';
+
+		(this.options.addClasses && this.element.addClass("ui-draggable"));
+		(this.options.disabled && this.element.addClass("ui-draggable-disabled"));
+
+		this._mouseInit();
+
+	},
+
+	destroy: function() {
+		if(!this.element.data('draggable')) return;
+		this.element
+			.removeData("draggable")
+			.unbind(".draggable")
+			.removeClass("ui-draggable"
+				+ " ui-draggable-dragging"
+				+ " ui-draggable-disabled");
+		this._mouseDestroy();
+
+		return this;
+	},
+
+	_mouseCapture: function(event) {
+
+		var o = this.options;
+
+		// among others, prevent a drag on a resizable-handle
+		if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
+			return false;
+
+		//Quit if we're not on a valid handle
+		this.handle = this._getHandle(event);
+		if (!this.handle)
+			return false;
+		
+		if ( o.iframeFix ) {
+			$(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+				$('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+				.css({
+					width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+					position: "absolute", opacity: "0.001", zIndex: 1000
+				})
+				.css($(this).offset())
+				.appendTo("body");
+			});
+		}
+
+		return true;
+
+	},
+
+	_mouseStart: function(event) {
+
+		var o = this.options;
+
+		//Create and append the visible helper
+		this.helper = this._createHelper(event);
+
+		//Cache the helper size
+		this._cacheHelperProportions();
+
+		//If ddmanager is used for droppables, set the global draggable
+		if($.ui.ddmanager)
+			$.ui.ddmanager.current = this;
+
+		/*
+		 * - Position generation -
+		 * This block generates everything position related - it's the core of draggables.
+		 */
+
+		//Cache the margins of the original element
+		this._cacheMargins();
+
+		//Store the helper's css position
+		this.cssPosition = this.helper.css("position");
+		this.scrollParent = this.helper.scrollParent();
+
+		//The element's absolute position on the page minus margins
+		this.offset = this.positionAbs = this.element.offset();
+		this.offset = {
+			top: this.offset.top - this.margins.top,
+			left: this.offset.left - this.margins.left
+		};
+
+		$.extend(this.offset, {
+			click: { //Where the click happened, relative to the element
+				left: event.pageX - this.offset.left,
+				top: event.pageY - this.offset.top
+			},
+			parent: this._getParentOffset(),
+			relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+		});
+
+		//Generate the original position
+		this.originalPosition = this.position = this._generatePosition(event);
+		this.originalPageX = event.pageX;
+		this.originalPageY = event.pageY;
+
+		//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+		(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+		//Set a containment if given in the options
+		if(o.containment)
+			this._setContainment();
+
+		//Trigger event + callbacks
+		if(this._trigger("start", event) === false) {
+			this._clear();
+			return false;
+		}
+
+		//Recache the helper size
+		this._cacheHelperProportions();
+
+		//Prepare the droppable offsets
+		if ($.ui.ddmanager && !o.dropBehaviour)
+			$.ui.ddmanager.prepareOffsets(this, event);
+
+		this.helper.addClass("ui-draggable-dragging");
+		this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+		
+		//If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003)
+		if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event);
+		
+		return true;
+	},
+
+	_mouseDrag: function(event, noPropagation) {
+
+		//Compute the helpers position
+		this.position = this._generatePosition(event);
+		this.positionAbs = this._convertPositionTo("absolute");
+
+		//Call plugins and callbacks and use the resulting position if something is returned
+		if (!noPropagation) {
+			var ui = this._uiHash();
+			if(this._trigger('drag', event, ui) === false) {
+				this._mouseUp({});
+				return false;
+			}
+			this.position = ui.position;
+		}
+
+		if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+		if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+		if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+		return false;
+	},
+
+	_mouseStop: function(event) {
+
+		//If we are using droppables, inform the manager about the drop
+		var dropped = false;
+		if ($.ui.ddmanager && !this.options.dropBehaviour)
+			dropped = $.ui.ddmanager.drop(this, event);
+
+		//if a drop comes from outside (a sortable)
+		if(this.dropped) {
+			dropped = this.dropped;
+			this.dropped = false;
+		}
+		
+		//if the original element is removed, don't bother to continue if helper is set to "original"
+		if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original")
+			return false;
+
+		if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+			var self = this;
+			$(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+				if(self._trigger("stop", event) !== false) {
+					self._clear();
+				}
+			});
+		} else {
+			if(this._trigger("stop", event) !== false) {
+				this._clear();
+			}
+		}
+
+		return false;
+	},
+	
+	_mouseUp: function(event) {
+		if (this.options.iframeFix === true) {
+			$("div.ui-draggable-iframeFix").each(function() { 
+				this.parentNode.removeChild(this); 
+			}); //Remove frame helpers
+		}
+		
+		//If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003)
+		if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event);
+		
+		return $.ui.mouse.prototype._mouseUp.call(this, event);
+	},
+	
+	cancel: function() {
+		
+		if(this.helper.is(".ui-draggable-dragging")) {
+			this._mouseUp({});
+		} else {
+			this._clear();
+		}
+		
+		return this;
+		
+	},
+
+	_getHandle: function(event) {
+
+		var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+		$(this.options.handle, this.element)
+			.find("*")
+			.andSelf()
+			.each(function() {
+				if(this == event.target) handle = true;
+			});
+
+		return handle;
+
+	},
+
+	_createHelper: function(event) {
+
+		var o = this.options;
+		var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element);
+
+		if(!helper.parents('body').length)
+			helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+		if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+			helper.css("position", "absolute");
+
+		return helper;
+
+	},
+
+	_adjustOffsetFromHelper: function(obj) {
+		if (typeof obj == 'string') {
+			obj = obj.split(' ');
+		}
+		if ($.isArray(obj)) {
+			obj = {left: +obj[0], top: +obj[1] || 0};
+		}
+		if ('left' in obj) {
+			this.offset.click.left = obj.left + this.margins.left;
+		}
+		if ('right' in obj) {
+			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+		}
+		if ('top' in obj) {
+			this.offset.click.top = obj.top + this.margins.top;
+		}
+		if ('bottom' in obj) {
+			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+		}
+	},
+
+	_getParentOffset: function() {
+
+		//Get the offsetParent and cache its position
+		this.offsetParent = this.helper.offsetParent();
+		var po = this.offsetParent.offset();
+
+		// This is a special case where we need to modify a offset calculated on start, since the following happened:
+		// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+		//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+		if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+			po.left += this.scrollParent.scrollLeft();
+			po.top += this.scrollParent.scrollTop();
+		}
+
+		if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+		|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+			po = { top: 0, left: 0 };
+
+		return {
+			top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+			left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+		};
+
+	},
+
+	_getRelativeOffset: function() {
+
+		if(this.cssPosition == "relative") {
+			var p = this.element.position();
+			return {
+				top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+				left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+			};
+		} else {
+			return { top: 0, left: 0 };
+		}
+
+	},
+
+	_cacheMargins: function() {
+		this.margins = {
+			left: (parseInt(this.element.css("marginLeft"),10) || 0),
+			top: (parseInt(this.element.css("marginTop"),10) || 0),
+			right: (parseInt(this.element.css("marginRight"),10) || 0),
+			bottom: (parseInt(this.element.css("marginBottom"),10) || 0)
+		};
+	},
+
+	_cacheHelperProportions: function() {
+		this.helperProportions = {
+			width: this.helper.outerWidth(),
+			height: this.helper.outerHeight()
+		};
+	},
+
+	_setContainment: function() {
+
+		var o = this.options;
+		if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+		if(o.containment == 'document' || o.containment == 'window') this.containment = [
+			o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
+			o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top,
+			(o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+			(o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+		];
+
+		if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+		        var c = $(o.containment);
+			var ce = c[0]; if(!ce) return;
+			var co = c.offset();
+			var over = ($(ce).css("overflow") != 'hidden');
+
+			this.containment = [
+				(parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0),
+				(parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0),
+				(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right,
+				(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top  - this.margins.bottom
+			];
+			this.relative_container = c;
+
+		} else if(o.containment.constructor == Array) {
+			this.containment = o.containment;
+		}
+
+	},
+
+	_convertPositionTo: function(d, pos) {
+
+		if(!pos) pos = this.position;
+		var mod = d == "absolute" ? 1 : -1;
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+		return {
+			top: (
+				pos.top																	// The absolute mouse position
+				+ this.offset.relative.top * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.top * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+			),
+			left: (
+				pos.left																// The absolute mouse position
+				+ this.offset.relative.left * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.left * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+			)
+		};
+
+	},
+
+	_generatePosition: function(event) {
+
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+		var pageX = event.pageX;
+		var pageY = event.pageY;
+
+		/*
+		 * - Position constraining -
+		 * Constrain the position to a mix of grid, containment.
+		 */
+
+		if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+		         var containment;
+		         if(this.containment) {
+				 if (this.relative_container){
+				     var co = this.relative_container.offset();
+				     containment = [ this.containment[0] + co.left,
+						     this.containment[1] + co.top,
+						     this.containment[2] + co.left,
+						     this.containment[3] + co.top ];
+				 }
+				 else {
+				     containment = this.containment;
+				 }
+
+				if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top;
+				if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top;
+			}
+
+			if(o.grid) {
+				//Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950)
+				var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY;
+				pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+				var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX;
+				pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+			}
+
+		}
+
+		return {
+			top: (
+				pageY																// The absolute mouse position
+				- this.offset.click.top													// Click offset (relative to the element)
+				- this.offset.relative.top												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.top												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+			),
+			left: (
+				pageX																// The absolute mouse position
+				- this.offset.click.left												// Click offset (relative to the element)
+				- this.offset.relative.left												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.left												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+			)
+		};
+
+	},
+
+	_clear: function() {
+		this.helper.removeClass("ui-draggable-dragging");
+		if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+		//if($.ui.ddmanager) $.ui.ddmanager.current = null;
+		this.helper = null;
+		this.cancelHelperRemoval = false;
+	},
+
+	// From now on bulk stuff - mainly helpers
+
+	_trigger: function(type, event, ui) {
+		ui = ui || this._uiHash();
+		$.ui.plugin.call(this, type, [event, ui]);
+		if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+		return $.Widget.prototype._trigger.call(this, type, event, ui);
+	},
+
+	plugins: {},
+
+	_uiHash: function(event) {
+		return {
+			helper: this.helper,
+			position: this.position,
+			originalPosition: this.originalPosition,
+			offset: this.positionAbs
+		};
+	}
+
+});
+
+$.extend($.ui.draggable, {
+	version: "1.8.17"
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+	start: function(event, ui) {
+
+		var inst = $(this).data("draggable"), o = inst.options,
+			uiSortable = $.extend({}, ui, { item: inst.element });
+		inst.sortables = [];
+		$(o.connectToSortable).each(function() {
+			var sortable = $.data(this, 'sortable');
+			if (sortable && !sortable.options.disabled) {
+				inst.sortables.push({
+					instance: sortable,
+					shouldRevert: sortable.options.revert
+				});
+				sortable.refreshPositions();	// Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page).
+				sortable._trigger("activate", event, uiSortable);
+			}
+		});
+
+	},
+	stop: function(event, ui) {
+
+		//If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+		var inst = $(this).data("draggable"),
+			uiSortable = $.extend({}, ui, { item: inst.element });
+
+		$.each(inst.sortables, function() {
+			if(this.instance.isOver) {
+
+				this.instance.isOver = 0;
+
+				inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+				this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+				//The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+				if(this.shouldRevert) this.instance.options.revert = true;
+
+				//Trigger the stop of the sortable
+				this.instance._mouseStop(event);
+
+				this.instance.options.helper = this.instance.options._helper;
+
+				//If the helper has been the original item, restore properties in the sortable
+				if(inst.options.helper == 'original')
+					this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+			} else {
+				this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+				this.instance._trigger("deactivate", event, uiSortable);
+			}
+
+		});
+
+	},
+	drag: function(event, ui) {
+
+		var inst = $(this).data("draggable"), self = this;
+
+		var checkPos = function(o) {
+			var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+			var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+			var itemHeight = o.height, itemWidth = o.width;
+			var itemTop = o.top, itemLeft = o.left;
+
+			return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+		};
+
+		$.each(inst.sortables, function(i) {
+			
+			//Copy over some variables to allow calling the sortable's native _intersectsWith
+			this.instance.positionAbs = inst.positionAbs;
+			this.instance.helperProportions = inst.helperProportions;
+			this.instance.offset.click = inst.offset.click;
+			
+			if(this.instance._intersectsWith(this.instance.containerCache)) {
+
+				//If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+				if(!this.instance.isOver) {
+
+					this.instance.isOver = 1;
+					//Now we fake the start of dragging for the sortable instance,
+					//by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+					//We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+					this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true);
+					this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+					this.instance.options.helper = function() { return ui.helper[0]; };
+
+					event.target = this.instance.currentItem[0];
+					this.instance._mouseCapture(event, true);
+					this.instance._mouseStart(event, true, true);
+
+					//Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+					this.instance.offset.click.top = inst.offset.click.top;
+					this.instance.offset.click.left = inst.offset.click.left;
+					this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+					this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+					inst._trigger("toSortable", event);
+					inst.dropped = this.instance.element; //draggable revert needs that
+					//hack so receive/update callbacks work (mostly)
+					inst.currentItem = inst.element;
+					this.instance.fromOutside = inst;
+
+				}
+
+				//Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+				if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+			} else {
+
+				//If it doesn't intersect with the sortable, and it intersected before,
+				//we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+				if(this.instance.isOver) {
+
+					this.instance.isOver = 0;
+					this.instance.cancelHelperRemoval = true;
+					
+					//Prevent reverting on this forced stop
+					this.instance.options.revert = false;
+					
+					// The out event needs to be triggered independently
+					this.instance._trigger('out', event, this.instance._uiHash(this.instance));
+					
+					this.instance._mouseStop(event, true);
+					this.instance.options.helper = this.instance.options._helper;
+
+					//Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+					this.instance.currentItem.remove();
+					if(this.instance.placeholder) this.instance.placeholder.remove();
+
+					inst._trigger("fromSortable", event);
+					inst.dropped = false; //draggable revert needs that
+				}
+
+			};
+
+		});
+
+	}
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+	start: function(event, ui) {
+		var t = $('body'), o = $(this).data('draggable').options;
+		if (t.css("cursor")) o._cursor = t.css("cursor");
+		t.css("cursor", o.cursor);
+	},
+	stop: function(event, ui) {
+		var o = $(this).data('draggable').options;
+		if (o._cursor) $('body').css("cursor", o._cursor);
+	}
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+	start: function(event, ui) {
+		var t = $(ui.helper), o = $(this).data('draggable').options;
+		if(t.css("opacity")) o._opacity = t.css("opacity");
+		t.css('opacity', o.opacity);
+	},
+	stop: function(event, ui) {
+		var o = $(this).data('draggable').options;
+		if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+	}
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+	start: function(event, ui) {
+		var i = $(this).data("draggable");
+		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+	},
+	drag: function(event, ui) {
+
+		var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+			if(!o.axis || o.axis != 'x') {
+				if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+				else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+			}
+
+			if(!o.axis || o.axis != 'y') {
+				if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+				else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+			}
+
+		} else {
+
+			if(!o.axis || o.axis != 'x') {
+				if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+				else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+			}
+
+			if(!o.axis || o.axis != 'y') {
+				if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+				else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+			}
+
+		}
+
+		if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+			$.ui.ddmanager.prepareOffsets(i, event);
+
+	}
+});
+
+$.ui.plugin.add("draggable", "snap", {
+	start: function(event, ui) {
+
+		var i = $(this).data("draggable"), o = i.options;
+		i.snapElements = [];
+
+		$(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+			var $t = $(this); var $o = $t.offset();
+			if(this != i.element[0]) i.snapElements.push({
+				item: this,
+				width: $t.outerWidth(), height: $t.outerHeight(),
+				top: $o.top, left: $o.left
+			});
+		});
+
+	},
+	drag: function(event, ui) {
+
+		var inst = $(this).data("draggable"), o = inst.options;
+		var d = o.snapTolerance;
+
+		var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+			y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+		for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+			var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+				t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+			//Yes, I know, this is insane ;)
+			if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+				if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+				inst.snapElements[i].snapping = false;
+				continue;
+			}
+
+			if(o.snapMode != 'inner') {
+				var ts = Math.abs(t - y2) <= d;
+				var bs = Math.abs(b - y1) <= d;
+				var ls = Math.abs(l - x2) <= d;
+				var rs = Math.abs(r - x1) <= d;
+				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+			}
+
+			var first = (ts || bs || ls || rs);
+
+			if(o.snapMode != 'outer') {
+				var ts = Math.abs(t - y1) <= d;
+				var bs = Math.abs(b - y2) <= d;
+				var ls = Math.abs(l - x1) <= d;
+				var rs = Math.abs(r - x2) <= d;
+				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+			}
+
+			if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+				(inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+			inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+		};
+
+	}
+});
+
+$.ui.plugin.add("draggable", "stack", {
+	start: function(event, ui) {
+
+		var o = $(this).data("draggable").options;
+
+		var group = $.makeArray($(o.stack)).sort(function(a,b) {
+			return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
+		});
+		if (!group.length) { return; }
+		
+		var min = parseInt(group[0].style.zIndex) || 0;
+		$(group).each(function(i) {
+			this.style.zIndex = min + i;
+		});
+
+		this[0].style.zIndex = min + group.length;
+
+	}
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+	start: function(event, ui) {
+		var t = $(ui.helper), o = $(this).data("draggable").options;
+		if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+		t.css('zIndex', o.zIndex);
+	},
+	stop: function(event, ui) {
+		var o = $(this).data("draggable").options;
+		if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+	}
+});
+
+})(jQuery);

app/assets/javascripts/app/lib/ui/jquery.ui.droppable.js

@@ -0,0 +1,296 @@
+/*
+ * jQuery UI Droppable 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.draggable.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.droppable", {
+	widgetEventPrefix: "drop",
+	options: {
+		accept: '*',
+		activeClass: false,
+		addClasses: true,
+		greedy: false,
+		hoverClass: false,
+		scope: 'default',
+		tolerance: 'intersect'
+	},
+	_create: function() {
+
+		var o = this.options, accept = o.accept;
+		this.isover = 0; this.isout = 1;
+
+		this.accept = $.isFunction(accept) ? accept : function(d) {
+			return d.is(accept);
+		};
+
+		//Store the droppable's proportions
+		this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+		// Add the reference and positions to the manager
+		$.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
+		$.ui.ddmanager.droppables[o.scope].push(this);
+
+		(o.addClasses && this.element.addClass("ui-droppable"));
+
+	},
+
+	destroy: function() {
+		var drop = $.ui.ddmanager.droppables[this.options.scope];
+		for ( var i = 0; i < drop.length; i++ )
+			if ( drop[i] == this )
+				drop.splice(i, 1);
+
+		this.element
+			.removeClass("ui-droppable ui-droppable-disabled")
+			.removeData("droppable")
+			.unbind(".droppable");
+
+		return this;
+	},
+
+	_setOption: function(key, value) {
+
+		if(key == 'accept') {
+			this.accept = $.isFunction(value) ? value : function(d) {
+				return d.is(value);
+			};
+		}
+		$.Widget.prototype._setOption.apply(this, arguments);
+	},
+
+	_activate: function(event) {
+		var draggable = $.ui.ddmanager.current;
+		if(this.options.activeClass) this.element.addClass(this.options.activeClass);
+		(draggable && this._trigger('activate', event, this.ui(draggable)));
+	},
+
+	_deactivate: function(event) {
+		var draggable = $.ui.ddmanager.current;
+		if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+		(draggable && this._trigger('deactivate', event, this.ui(draggable)));
+	},
+
+	_over: function(event) {
+
+		var draggable = $.ui.ddmanager.current;
+		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+		if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+			if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
+			this._trigger('over', event, this.ui(draggable));
+		}
+
+	},
+
+	_out: function(event) {
+
+		var draggable = $.ui.ddmanager.current;
+		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+		if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+			this._trigger('out', event, this.ui(draggable));
+		}
+
+	},
+
+	_drop: function(event,custom) {
+
+		var draggable = custom || $.ui.ddmanager.current;
+		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+
+		var childrenIntersection = false;
+		this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
+			var inst = $.data(this, 'droppable');
+			if(
+				inst.options.greedy
+				&& !inst.options.disabled
+				&& inst.options.scope == draggable.options.scope
+				&& inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
+				&& $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
+			) { childrenIntersection = true; return false; }
+		});
+		if(childrenIntersection) return false;
+
+		if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+			if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+			this._trigger('drop', event, this.ui(draggable));
+			return this.element;
+		}
+
+		return false;
+
+	},
+
+	ui: function(c) {
+		return {
+			draggable: (c.currentItem || c.element),
+			helper: c.helper,
+			position: c.position,
+			offset: c.positionAbs
+		};
+	}
+
+});
+
+$.extend($.ui.droppable, {
+	version: "1.8.17"
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+	if (!droppable.offset) return false;
+
+	var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+		y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
+	var l = droppable.offset.left, r = l + droppable.proportions.width,
+		t = droppable.offset.top, b = t + droppable.proportions.height;
+
+	switch (toleranceMode) {
+		case 'fit':
+			return (l <= x1 && x2 <= r
+				&& t <= y1 && y2 <= b);
+			break;
+		case 'intersect':
+			return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
+				&& x2 - (draggable.helperProportions.width / 2) < r // Left Half
+				&& t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
+				&& y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+			break;
+		case 'pointer':
+			var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
+				draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
+				isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
+			return isOver;
+			break;
+		case 'touch':
+			return (
+					(y1 >= t && y1 <= b) ||	// Top edge touching
+					(y2 >= t && y2 <= b) ||	// Bottom edge touching
+					(y1 < t && y2 > b)		// Surrounded vertically
+				) && (
+					(x1 >= l && x1 <= r) ||	// Left edge touching
+					(x2 >= l && x2 <= r) ||	// Right edge touching
+					(x1 < l && x2 > r)		// Surrounded horizontally
+				);
+			break;
+		default:
+			return false;
+			break;
+		}
+
+};
+
+/*
+	This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+	current: null,
+	droppables: { 'default': [] },
+	prepareOffsets: function(t, event) {
+
+		var m = $.ui.ddmanager.droppables[t.options.scope] || [];
+		var type = event ? event.type : null; // workaround for #2317
+		var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+
+		droppablesLoop: for (var i = 0; i < m.length; i++) {
+
+			if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue;	//No disabled and non-accepted
+			for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
+			m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; 									//If the element is not visible, continue
+
+			if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+
+			m[i].offset = m[i].element.offset();
+			m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+		}
+
+	},
+	drop: function(draggable, event) {
+
+		var dropped = false;
+		$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+			if(!this.options) return;
+			if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
+				dropped = this._drop.call(this, event) || dropped;
+
+			if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+				this.isout = 1; this.isover = 0;
+				this._deactivate.call(this, event);
+			}
+
+		});
+		return dropped;
+
+	},
+	dragStart: function( draggable, event ) {
+		//Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003)
+		draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() {
+			if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
+		});
+	},
+	drag: function(draggable, event) {
+
+		//If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+		if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+
+		//Run through all droppables and check their positions based on specific tolerance options
+		$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+			if(this.options.disabled || this.greedyChild || !this.visible) return;
+			var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+
+			var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
+			if(!c) return;
+
+			var parentInstance;
+			if (this.options.greedy) {
+				var parent = this.element.parents(':data(droppable):eq(0)');
+				if (parent.length) {
+					parentInstance = $.data(parent[0], 'droppable');
+					parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+				}
+			}
+
+			// we just moved into a greedy child
+			if (parentInstance && c == 'isover') {
+				parentInstance['isover'] = 0;
+				parentInstance['isout'] = 1;
+				parentInstance._out.call(parentInstance, event);
+			}
+
+			this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
+			this[c == "isover" ? "_over" : "_out"].call(this, event);
+
+			// we just moved out of a greedy child
+			if (parentInstance && c == 'isout') {
+				parentInstance['isout'] = 0;
+				parentInstance['isover'] = 1;
+				parentInstance._over.call(parentInstance, event);
+			}
+		});
+
+	},
+	dragStop: function( draggable, event ) {
+		draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" );
+		//Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003)
+		if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
+	}
+};
+
+})(jQuery);

app/assets/javascripts/app/lib/ui/jquery.ui.mouse.js

@@ -0,0 +1,162 @@
+/*!
+ * jQuery UI Mouse 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var mouseHandled = false;
+$( document ).mouseup( function( e ) {
+	mouseHandled = false;
+});
+
+$.widget("ui.mouse", {
+	options: {
+		cancel: ':input,option',
+		distance: 1,
+		delay: 0
+	},
+	_mouseInit: function() {
+		var self = this;
+
+		this.element
+			.bind('mousedown.'+this.widgetName, function(event) {
+				return self._mouseDown(event);
+			})
+			.bind('click.'+this.widgetName, function(event) {
+				if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) {
+				    $.removeData(event.target, self.widgetName + '.preventClickEvent');
+					event.stopImmediatePropagation();
+					return false;
+				}
+			});
+
+		this.started = false;
+	},
+
+	// TODO: make sure destroying one instance of mouse doesn't mess with
+	// other instances of mouse
+	_mouseDestroy: function() {
+		this.element.unbind('.'+this.widgetName);
+	},
+
+	_mouseDown: function(event) {
+		// don't let more than one widget handle mouseStart
+		if( mouseHandled ) { return };
+
+		// we may have missed mouseup (out of window)
+		(this._mouseStarted && this._mouseUp(event));
+
+		this._mouseDownEvent = event;
+
+		var self = this,
+			btnIsLeft = (event.which == 1),
+			// event.target.nodeName works around a bug in IE 8 with
+			// disabled inputs (#7620)
+			elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
+		if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+			return true;
+		}
+
+		this.mouseDelayMet = !this.options.delay;
+		if (!this.mouseDelayMet) {
+			this._mouseDelayTimer = setTimeout(function() {
+				self.mouseDelayMet = true;
+			}, this.options.delay);
+		}
+
+		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+			this._mouseStarted = (this._mouseStart(event) !== false);
+			if (!this._mouseStarted) {
+				event.preventDefault();
+				return true;
+			}
+		}
+
+		// Click event may never have fired (Gecko & Opera)
+		if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) {
+			$.removeData(event.target, this.widgetName + '.preventClickEvent');
+		}
+
+		// these delegates are required to keep context
+		this._mouseMoveDelegate = function(event) {
+			return self._mouseMove(event);
+		};
+		this._mouseUpDelegate = function(event) {
+			return self._mouseUp(event);
+		};
+		$(document)
+			.bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+			.bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+		event.preventDefault();
+		
+		mouseHandled = true;
+		return true;
+	},
+
+	_mouseMove: function(event) {
+		// IE mouseup check - mouseup happened when mouse was out of window
+		if ($.browser.msie && !(document.documentMode >= 9) && !event.button) {
+			return this._mouseUp(event);
+		}
+
+		if (this._mouseStarted) {
+			this._mouseDrag(event);
+			return event.preventDefault();
+		}
+
+		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+			this._mouseStarted =
+				(this._mouseStart(this._mouseDownEvent, event) !== false);
+			(this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+		}
+
+		return !this._mouseStarted;
+	},
+
+	_mouseUp: function(event) {
+		$(document)
+			.unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+			.unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+		if (this._mouseStarted) {
+			this._mouseStarted = false;
+
+			if (event.target == this._mouseDownEvent.target) {
+			    $.data(event.target, this.widgetName + '.preventClickEvent', true);
+			}
+
+			this._mouseStop(event);
+		}
+
+		return false;
+	},
+
+	_mouseDistanceMet: function(event) {
+		return (Math.max(
+				Math.abs(this._mouseDownEvent.pageX - event.pageX),
+				Math.abs(this._mouseDownEvent.pageY - event.pageY)
+			) >= this.options.distance
+		);
+	},
+
+	_mouseDelayMet: function(event) {
+		return this.mouseDelayMet;
+	},
+
+	// These are placeholder methods, to be overriden by extending plugin
+	_mouseStart: function(event) {},
+	_mouseDrag: function(event) {},
+	_mouseStop: function(event) {},
+	_mouseCapture: function(event) { return true; }
+});
+
+})(jQuery);

app/assets/javascripts/app/lib/ui/jquery.ui.position.js

@@ -0,0 +1,298 @@
+/*
+ * jQuery UI Position 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function( $, undefined ) {
+
+$.ui = $.ui || {};
+
+var horizontalPositions = /left|center|right/,
+	verticalPositions = /top|center|bottom/,
+	center = "center",
+	support = {},
+	_position = $.fn.position,
+	_offset = $.fn.offset;
+
+$.fn.position = function( options ) {
+	if ( !options || !options.of ) {
+		return _position.apply( this, arguments );
+	}
+
+	// make a copy, we don't want to modify arguments
+	options = $.extend( {}, options );
+
+	var target = $( options.of ),
+		targetElem = target[0],
+		collision = ( options.collision || "flip" ).split( " " ),
+		offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
+		targetWidth,
+		targetHeight,
+		basePosition;
+
+	if ( targetElem.nodeType === 9 ) {
+		targetWidth = target.width();
+		targetHeight = target.height();
+		basePosition = { top: 0, left: 0 };
+	// TODO: use $.isWindow() in 1.9
+	} else if ( targetElem.setTimeout ) {
+		targetWidth = target.width();
+		targetHeight = target.height();
+		basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
+	} else if ( targetElem.preventDefault ) {
+		// force left top to allow flipping
+		options.at = "left top";
+		targetWidth = targetHeight = 0;
+		basePosition = { top: options.of.pageY, left: options.of.pageX };
+	} else {
+		targetWidth = target.outerWidth();
+		targetHeight = target.outerHeight();
+		basePosition = target.offset();
+	}
+
+	// force my and at to have valid horizontal and veritcal positions
+	// if a value is missing or invalid, it will be converted to center 
+	$.each( [ "my", "at" ], function() {
+		var pos = ( options[this] || "" ).split( " " );
+		if ( pos.length === 1) {
+			pos = horizontalPositions.test( pos[0] ) ?
+				pos.concat( [center] ) :
+				verticalPositions.test( pos[0] ) ?
+					[ center ].concat( pos ) :
+					[ center, center ];
+		}
+		pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center;
+		pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center;
+		options[ this ] = pos;
+	});
+
+	// normalize collision option
+	if ( collision.length === 1 ) {
+		collision[ 1 ] = collision[ 0 ];
+	}
+
+	// normalize offset option
+	offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
+	if ( offset.length === 1 ) {
+		offset[ 1 ] = offset[ 0 ];
+	}
+	offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
+
+	if ( options.at[0] === "right" ) {
+		basePosition.left += targetWidth;
+	} else if ( options.at[0] === center ) {
+		basePosition.left += targetWidth / 2;
+	}
+
+	if ( options.at[1] === "bottom" ) {
+		basePosition.top += targetHeight;
+	} else if ( options.at[1] === center ) {
+		basePosition.top += targetHeight / 2;
+	}
+
+	basePosition.left += offset[ 0 ];
+	basePosition.top += offset[ 1 ];
+
+	return this.each(function() {
+		var elem = $( this ),
+			elemWidth = elem.outerWidth(),
+			elemHeight = elem.outerHeight(),
+			marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0,
+			marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0,
+			collisionWidth = elemWidth + marginLeft +
+				( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ),
+			collisionHeight = elemHeight + marginTop +
+				( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ),
+			position = $.extend( {}, basePosition ),
+			collisionPosition;
+
+		if ( options.my[0] === "right" ) {
+			position.left -= elemWidth;
+		} else if ( options.my[0] === center ) {
+			position.left -= elemWidth / 2;
+		}
+
+		if ( options.my[1] === "bottom" ) {
+			position.top -= elemHeight;
+		} else if ( options.my[1] === center ) {
+			position.top -= elemHeight / 2;
+		}
+
+		// prevent fractions if jQuery version doesn't support them (see #5280)
+		if ( !support.fractions ) {
+			position.left = Math.round( position.left );
+			position.top = Math.round( position.top );
+		}
+
+		collisionPosition = {
+			left: position.left - marginLeft,
+			top: position.top - marginTop
+		};
+
+		$.each( [ "left", "top" ], function( i, dir ) {
+			if ( $.ui.position[ collision[i] ] ) {
+				$.ui.position[ collision[i] ][ dir ]( position, {
+					targetWidth: targetWidth,
+					targetHeight: targetHeight,
+					elemWidth: elemWidth,
+					elemHeight: elemHeight,
+					collisionPosition: collisionPosition,
+					collisionWidth: collisionWidth,
+					collisionHeight: collisionHeight,
+					offset: offset,
+					my: options.my,
+					at: options.at
+				});
+			}
+		});
+
+		if ( $.fn.bgiframe ) {
+			elem.bgiframe();
+		}
+		elem.offset( $.extend( position, { using: options.using } ) );
+	});
+};
+
+$.ui.position = {
+	fit: {
+		left: function( position, data ) {
+			var win = $( window ),
+				over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft();
+			position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left );
+		},
+		top: function( position, data ) {
+			var win = $( window ),
+				over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop();
+			position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top );
+		}
+	},
+
+	flip: {
+		left: function( position, data ) {
+			if ( data.at[0] === center ) {
+				return;
+			}
+			var win = $( window ),
+				over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(),
+				myOffset = data.my[ 0 ] === "left" ?
+					-data.elemWidth :
+					data.my[ 0 ] === "right" ?
+						data.elemWidth :
+						0,
+				atOffset = data.at[ 0 ] === "left" ?
+					data.targetWidth :
+					-data.targetWidth,
+				offset = -2 * data.offset[ 0 ];
+			position.left += data.collisionPosition.left < 0 ?
+				myOffset + atOffset + offset :
+				over > 0 ?
+					myOffset + atOffset + offset :
+					0;
+		},
+		top: function( position, data ) {
+			if ( data.at[1] === center ) {
+				return;
+			}
+			var win = $( window ),
+				over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(),
+				myOffset = data.my[ 1 ] === "top" ?
+					-data.elemHeight :
+					data.my[ 1 ] === "bottom" ?
+						data.elemHeight :
+						0,
+				atOffset = data.at[ 1 ] === "top" ?
+					data.targetHeight :
+					-data.targetHeight,
+				offset = -2 * data.offset[ 1 ];
+			position.top += data.collisionPosition.top < 0 ?
+				myOffset + atOffset + offset :
+				over > 0 ?
+					myOffset + atOffset + offset :
+					0;
+		}
+	}
+};
+
+// offset setter from jQuery 1.4
+if ( !$.offset.setOffset ) {
+	$.offset.setOffset = function( elem, options ) {
+		// set position first, in-case top/left are set even on static elem
+		if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
+			elem.style.position = "relative";
+		}
+		var curElem   = $( elem ),
+			curOffset = curElem.offset(),
+			curTop    = parseInt( $.curCSS( elem, "top",  true ), 10 ) || 0,
+			curLeft   = parseInt( $.curCSS( elem, "left", true ), 10)  || 0,
+			props     = {
+				top:  (options.top  - curOffset.top)  + curTop,
+				left: (options.left - curOffset.left) + curLeft
+			};
+		
+		if ( 'using' in options ) {
+			options.using.call( elem, props );
+		} else {
+			curElem.css( props );
+		}
+	};
+
+	$.fn.offset = function( options ) {
+		var elem = this[ 0 ];
+		if ( !elem || !elem.ownerDocument ) { return null; }
+		if ( options ) { 
+			return this.each(function() {
+				$.offset.setOffset( this, options );
+			});
+		}
+		return _offset.call( this );
+	};
+}
+
+// fraction support test (older versions of jQuery don't support fractions)
+(function () {
+	var body = document.getElementsByTagName( "body" )[ 0 ], 
+		div = document.createElement( "div" ),
+		testElement, testElementParent, testElementStyle, offset, offsetTotal;
+
+	//Create a "fake body" for testing based on method used in jQuery.support
+	testElement = document.createElement( body ? "div" : "body" );
+	testElementStyle = {
+		visibility: "hidden",
+		width: 0,
+		height: 0,
+		border: 0,
+		margin: 0,
+		background: "none"
+	};
+	if ( body ) {
+		jQuery.extend( testElementStyle, {
+			position: "absolute",
+			left: "-1000px",
+			top: "-1000px"
+		});
+	}
+	for ( var i in testElementStyle ) {
+		testElement.style[ i ] = testElementStyle[ i ];
+	}
+	testElement.appendChild( div );
+	testElementParent = body || document.documentElement;
+	testElementParent.insertBefore( testElement, testElementParent.firstChild );
+
+	div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;";
+
+	offset = $( div ).offset( function( _, offset ) {
+		return offset;
+	}).offset();
+
+	testElement.innerHTML = "";
+	testElementParent.removeChild( testElement );
+
+	offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 );
+	support.fractions = offsetTotal > 21 && offsetTotal < 22;
+})();
+
+}( jQuery ));

app/assets/javascripts/app/lib/ui/jquery.ui.progressbar.js

@@ -0,0 +1,109 @@
+/*
+ * jQuery UI Progressbar 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ *   jquery.ui.core.js
+ *   jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget( "ui.progressbar", {
+	options: {
+		value: 0,
+		max: 100
+	},
+
+	min: 0,
+
+	_create: function() {
+		this.element
+			.addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+			.attr({
+				role: "progressbar",
+				"aria-valuemin": this.min,
+				"aria-valuemax": this.options.max,
+				"aria-valuenow": this._value()
+			});
+
+		this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" )
+			.appendTo( this.element );
+
+		this.oldValue = this._value();
+		this._refreshValue();
+	},
+
+	destroy: function() {
+		this.element
+			.removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+			.removeAttr( "role" )
+			.removeAttr( "aria-valuemin" )
+			.removeAttr( "aria-valuemax" )
+			.removeAttr( "aria-valuenow" );
+
+		this.valueDiv.remove();
+
+		$.Widget.prototype.destroy.apply( this, arguments );
+	},
+
+	value: function( newValue ) {
+		if ( newValue === undefined ) {
+			return this._value();
+		}
+
+		this._setOption( "value", newValue );
+		return this;
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "value" ) {
+			this.options.value = value;
+			this._refreshValue();
+			if ( this._value() === this.options.max ) {
+				this._trigger( "complete" );
+			}
+		}
+
+		$.Widget.prototype._setOption.apply( this, arguments );
+	},
+
+	_value: function() {
+		var val = this.options.value;
+		// normalize invalid value
+		if ( typeof val !== "number" ) {
+			val = 0;
+		}
+		return Math.min( this.options.max, Math.max( this.min, val ) );
+	},
+
+	_percentage: function() {
+		return 100 * this._value() / this.options.max;
+	},
+
+	_refreshValue: function() {
+		var value = this.value();
+		var percentage = this._percentage();
+
+		if ( this.oldValue !== value ) {
+			this.oldValue = value;
+			this._trigger( "change" );
+		}
+
+		this.valueDiv
+			.toggle( value > this.min )
+			.toggleClass( "ui-corner-right", value === this.options.max )
+			.width( percentage.toFixed(0) + "%" );
+		this.element.attr( "aria-valuenow", value );
+	}
+});
+
+$.extend( $.ui.progressbar, {
+	version: "1.8.17"
+});
+
+})( jQuery );

app/assets/javascripts/app/lib/ui/jquery.ui.resizable.js

@@ -0,0 +1,842 @@
+/*
+ * jQuery UI Resizable 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.resizable", $.ui.mouse, {
+	widgetEventPrefix: "resize",
+	options: {
+		alsoResize: false,
+		animate: false,
+		animateDuration: "slow",
+		animateEasing: "swing",
+		aspectRatio: false,
+		autoHide: false,
+		containment: false,
+		ghost: false,
+		grid: false,
+		handles: "e,s,se",
+		helper: false,
+		maxHeight: null,
+		maxWidth: null,
+		minHeight: 10,
+		minWidth: 10,
+		zIndex: 1000
+	},
+	_create: function() {
+
+		var self = this, o = this.options;
+		this.element.addClass("ui-resizable");
+
+		$.extend(this, {
+			_aspectRatio: !!(o.aspectRatio),
+			aspectRatio: o.aspectRatio,
+			originalElement: this.element,
+			_proportionallyResizeElements: [],
+			_helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+		});
+
+		//Wrap the element if it cannot hold child nodes
+		if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+			//Opera fix for relative positioning
+			if (/relative/.test(this.element.css('position')) && $.browser.opera)
+				this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+			//Create a wrapper element and set the wrapper to the new current internal element
+			this.element.wrap(
+				$('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+					position: this.element.css('position'),
+					width: this.element.outerWidth(),
+					height: this.element.outerHeight(),
+					top: this.element.css('top'),
+					left: this.element.css('left')
+				})
+			);
+
+			//Overwrite the original this.element
+			this.element = this.element.parent().data(
+				"resizable", this.element.data('resizable')
+			);
+
+			this.elementIsWrapper = true;
+
+			//Move margins to the wrapper
+			this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+			this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+			//Prevent Safari textarea resize
+			this.originalResizeStyle = this.originalElement.css('resize');
+			this.originalElement.css('resize', 'none');
+
+			//Push the actual element to our proportionallyResize internal array
+			this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+			// avoid IE jump (hard set the margin)
+			this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+			// fix handlers offset
+			this._proportionallyResize();
+
+		}
+
+		this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+		if(this.handles.constructor == String) {
+
+			if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+			var n = this.handles.split(","); this.handles = {};
+
+			for(var i = 0; i < n.length; i++) {
+
+				var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+				var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+				// increase zIndex of sw, se, ne, nw axis
+				//TODO : this modifies original option
+				if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+				//TODO : What's going on here?
+				if ('se' == handle) {
+					axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+				};
+
+				//Insert into internal handles object and append to element
+				this.handles[handle] = '.ui-resizable-'+handle;
+				this.element.append(axis);
+			}
+
+		}
+
+		this._renderAxis = function(target) {
+
+			target = target || this.element;
+
+			for(var i in this.handles) {
+
+				if(this.handles[i].constructor == String)
+					this.handles[i] = $(this.handles[i], this.element).show();
+
+				//Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+				if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+					var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+					//Checking the correct pad and border
+					padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+					//The padding type i have to apply...
+					var padPos = [ 'padding',
+						/ne|nw|n/.test(i) ? 'Top' :
+						/se|sw|s/.test(i) ? 'Bottom' :
+						/^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+					target.css(padPos, padWrapper);
+
+					this._proportionallyResize();
+
+				}
+
+				//TODO: What's that good for? There's not anything to be executed left
+				if(!$(this.handles[i]).length)
+					continue;
+
+			}
+		};
+
+		//TODO: make renderAxis a prototype function
+		this._renderAxis(this.element);
+
+		this._handles = $('.ui-resizable-handle', this.element)
+			.disableSelection();
+
+		//Matching axis name
+		this._handles.mouseover(function() {
+			if (!self.resizing) {
+				if (this.className)
+					var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+				//Axis, default = se
+				self.axis = axis && axis[1] ? axis[1] : 'se';
+			}
+		});
+
+		//If we want to auto hide the elements
+		if (o.autoHide) {
+			this._handles.hide();
+			$(this.element)
+				.addClass("ui-resizable-autohide")
+				.hover(function() {
+					if (o.disabled) return;
+					$(this).removeClass("ui-resizable-autohide");
+					self._handles.show();
+				},
+				function(){
+					if (o.disabled) return;
+					if (!self.resizing) {
+						$(this).addClass("ui-resizable-autohide");
+						self._handles.hide();
+					}
+				});
+		}
+
+		//Initialize the mouse interaction
+		this._mouseInit();
+
+	},
+
+	destroy: function() {
+
+		this._mouseDestroy();
+
+		var _destroy = function(exp) {
+			$(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+				.removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+		};
+
+		//TODO: Unwrap at same DOM position
+		if (this.elementIsWrapper) {
+			_destroy(this.element);
+			var wrapper = this.element;
+			wrapper.after(
+				this.originalElement.css({
+					position: wrapper.css('position'),
+					width: wrapper.outerWidth(),
+					height: wrapper.outerHeight(),
+					top: wrapper.css('top'),
+					left: wrapper.css('left')
+				})
+			).remove();
+		}
+
+		this.originalElement.css('resize', this.originalResizeStyle);
+		_destroy(this.originalElement);
+
+		return this;
+	},
+
+	_mouseCapture: function(event) {
+		var handle = false;
+		for (var i in this.handles) {
+			if ($(this.handles[i])[0] == event.target) {
+				handle = true;
+			}
+		}
+
+		return !this.options.disabled && handle;
+	},
+
+	_mouseStart: function(event) {
+
+		var o = this.options, iniPos = this.element.position(), el = this.element;
+
+		this.resizing = true;
+		this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+		// bugfix for http://dev.jquery.com/ticket/1749
+		if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+			el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+		}
+
+		//Opera fixing relative position
+		if ($.browser.opera && (/relative/).test(el.css('position')))
+			el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+		this._renderProxy();
+
+		var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+		if (o.containment) {
+			curleft += $(o.containment).scrollLeft() || 0;
+			curtop += $(o.containment).scrollTop() || 0;
+		}
+
+		//Store needed variables
+		this.offset = this.helper.offset();
+		this.position = { left: curleft, top: curtop };
+		this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+		this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+		this.originalPosition = { left: curleft, top: curtop };
+		this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+		this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+		//Aspect Ratio
+		this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+	    var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+	    $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+
+		el.addClass("ui-resizable-resizing");
+		this._propagate("start", event);
+		return true;
+	},
+
+	_mouseDrag: function(event) {
+
+		//Increase performance, avoid regex
+		var el = this.helper, o = this.options, props = {},
+			self = this, smp = this.originalMousePosition, a = this.axis;
+
+		var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+		var trigger = this._change[a];
+		if (!trigger) return false;
+
+		// Calculate the attrs that will be change
+		var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+		// Put this in the mouseDrag handler since the user can start pressing shift while resizing
+		this._updateVirtualBoundaries(event.shiftKey);
+		if (this._aspectRatio || event.shiftKey)
+			data = this._updateRatio(data, event);
+
+		data = this._respectSize(data, event);
+
+		// plugins callbacks need to be called first
+		this._propagate("resize", event);
+
+		el.css({
+			top: this.position.top + "px", left: this.position.left + "px",
+			width: this.size.width + "px", height: this.size.height + "px"
+		});
+
+		if (!this._helper && this._proportionallyResizeElements.length)
+			this._proportionallyResize();
+
+		this._updateCache(data);
+
+		// calling the user callback at the end
+		this._trigger('resize', event, this.ui());
+
+		return false;
+	},
+
+	_mouseStop: function(event) {
+
+		this.resizing = false;
+		var o = this.options, self = this;
+
+		if(this._helper) {
+			var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+				soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+				soffsetw = ista ? 0 : self.sizeDiff.width;
+
+			var s = { width: (self.helper.width()  - soffsetw), height: (self.helper.height() - soffseth) },
+				left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+				top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+			if (!o.animate)
+				this.element.css($.extend(s, { top: top, left: left }));
+
+			self.helper.height(self.size.height);
+			self.helper.width(self.size.width);
+
+			if (this._helper && !o.animate) this._proportionallyResize();
+		}
+
+		$('body').css('cursor', 'auto');
+
+		this.element.removeClass("ui-resizable-resizing");
+
+		this._propagate("stop", event);
+
+		if (this._helper) this.helper.remove();
+		return false;
+
+	},
+
+    _updateVirtualBoundaries: function(forceAspectRatio) {
+        var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b;
+
+        b = {
+            minWidth: isNumber(o.minWidth) ? o.minWidth : 0,
+            maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity,
+            minHeight: isNumber(o.minHeight) ? o.minHeight : 0,
+            maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity
+        };
+
+        if(this._aspectRatio || forceAspectRatio) {
+            // We want to create an enclosing box whose aspect ration is the requested one
+            // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension
+            pMinWidth = b.minHeight * this.aspectRatio;
+            pMinHeight = b.minWidth / this.aspectRatio;
+            pMaxWidth = b.maxHeight * this.aspectRatio;
+            pMaxHeight = b.maxWidth / this.aspectRatio;
+
+            if(pMinWidth > b.minWidth) b.minWidth = pMinWidth;
+            if(pMinHeight > b.minHeight) b.minHeight = pMinHeight;
+            if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth;
+            if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight;
+        }
+        this._vBoundaries = b;
+    },
+
+	_updateCache: function(data) {
+		var o = this.options;
+		this.offset = this.helper.offset();
+		if (isNumber(data.left)) this.position.left = data.left;
+		if (isNumber(data.top)) this.position.top = data.top;
+		if (isNumber(data.height)) this.size.height = data.height;
+		if (isNumber(data.width)) this.size.width = data.width;
+	},
+
+	_updateRatio: function(data, event) {
+
+		var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+		if (isNumber(data.height)) data.width = (data.height * this.aspectRatio);
+		else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio);
+
+		if (a == 'sw') {
+			data.left = cpos.left + (csize.width - data.width);
+			data.top = null;
+		}
+		if (a == 'nw') {
+			data.top = cpos.top + (csize.height - data.height);
+			data.left = cpos.left + (csize.width - data.width);
+		}
+
+		return data;
+	},
+
+	_respectSize: function(data, event) {
+
+		var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+				ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+					isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+		if (isminw) data.width = o.minWidth;
+		if (isminh) data.height = o.minHeight;
+		if (ismaxw) data.width = o.maxWidth;
+		if (ismaxh) data.height = o.maxHeight;
+
+		var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+		var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+		if (isminw && cw) data.left = dw - o.minWidth;
+		if (ismaxw && cw) data.left = dw - o.maxWidth;
+		if (isminh && ch)	data.top = dh - o.minHeight;
+		if (ismaxh && ch)	data.top = dh - o.maxHeight;
+
+		// fixing jump error on top/left - bug #2330
+		var isNotwh = !data.width && !data.height;
+		if (isNotwh && !data.left && data.top) data.top = null;
+		else if (isNotwh && !data.top && data.left) data.left = null;
+
+		return data;
+	},
+
+	_proportionallyResize: function() {
+
+		var o = this.options;
+		if (!this._proportionallyResizeElements.length) return;
+		var element = this.helper || this.element;
+
+		for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+
+			var prel = this._proportionallyResizeElements[i];
+
+			if (!this.borderDif) {
+				var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+					p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+				this.borderDif = $.map(b, function(v, i) {
+					var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+					return border + padding;
+				});
+			}
+
+			if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+				continue;
+
+			prel.css({
+				height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+				width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+			});
+
+		};
+
+	},
+
+	_renderProxy: function() {
+
+		var el = this.element, o = this.options;
+		this.elementOffset = el.offset();
+
+		if(this._helper) {
+
+			this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+			// fix ie6 offset TODO: This seems broken
+			var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+			pxyoffset = ( ie6 ? 2 : -1 );
+
+			this.helper.addClass(this._helper).css({
+				width: this.element.outerWidth() + pxyoffset,
+				height: this.element.outerHeight() + pxyoffset,
+				position: 'absolute',
+				left: this.elementOffset.left - ie6offset +'px',
+				top: this.elementOffset.top - ie6offset +'px',
+				zIndex: ++o.zIndex //TODO: Don't modify option
+			});
+
+			this.helper
+				.appendTo("body")
+				.disableSelection();
+
+		} else {
+			this.helper = this.element;
+		}
+
+	},
+
+	_change: {
+		e: function(event, dx, dy) {
+			return { width: this.originalSize.width + dx };
+		},
+		w: function(event, dx, dy) {
+			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+			return { left: sp.left + dx, width: cs.width - dx };
+		},
+		n: function(event, dx, dy) {
+			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+			return { top: sp.top + dy, height: cs.height - dy };
+		},
+		s: function(event, dx, dy) {
+			return { height: this.originalSize.height + dy };
+		},
+		se: function(event, dx, dy) {
+			return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+		},
+		sw: function(event, dx, dy) {
+			return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+		},
+		ne: function(event, dx, dy) {
+			return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+		},
+		nw: function(event, dx, dy) {
+			return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+		}
+	},
+
+	_propagate: function(n, event) {
+		$.ui.plugin.call(this, n, [event, this.ui()]);
+		(n != "resize" && this._trigger(n, event, this.ui()));
+	},
+
+	plugins: {},
+
+	ui: function() {
+		return {
+			originalElement: this.originalElement,
+			element: this.element,
+			helper: this.helper,
+			position: this.position,
+			size: this.size,
+			originalSize: this.originalSize,
+			originalPosition: this.originalPosition
+		};
+	}
+
+});
+
+$.extend($.ui.resizable, {
+	version: "1.8.17"
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+	start: function (event, ui) {
+		var self = $(this).data("resizable"), o = self.options;
+
+		var _store = function (exp) {
+			$(exp).each(function() {
+				var el = $(this);
+				el.data("resizable-alsoresize", {
+					width: parseInt(el.width(), 10), height: parseInt(el.height(), 10),
+					left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10),
+					position: el.css('position') // to reset Opera on stop()
+				});
+			});
+		};
+
+		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+			if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+			else { $.each(o.alsoResize, function (exp) { _store(exp); }); }
+		}else{
+			_store(o.alsoResize);
+		}
+	},
+
+	resize: function (event, ui) {
+		var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+		var delta = {
+			height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+			top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+		},
+
+		_alsoResize = function (exp, c) {
+			$(exp).each(function() {
+				var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, 
+					css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left'];
+
+				$.each(css, function (i, prop) {
+					var sum = (start[prop]||0) + (delta[prop]||0);
+					if (sum && sum >= 0)
+						style[prop] = sum || null;
+				});
+
+				// Opera fixing relative position
+				if ($.browser.opera && /relative/.test(el.css('position'))) {
+					self._revertToRelativePosition = true;
+					el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+				}
+
+				el.css(style);
+			});
+		};
+
+		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+			$.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); });
+		}else{
+			_alsoResize(o.alsoResize);
+		}
+	},
+
+	stop: function (event, ui) {
+		var self = $(this).data("resizable"), o = self.options;
+
+		var _reset = function (exp) {
+			$(exp).each(function() {
+				var el = $(this);
+				// reset position for Opera - no need to verify it was changed
+				el.css({ position: el.data("resizable-alsoresize").position });
+			});
+		};
+
+		if (self._revertToRelativePosition) {
+			self._revertToRelativePosition = false;
+			if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+				$.each(o.alsoResize, function (exp) { _reset(exp); });
+			}else{
+				_reset(o.alsoResize);
+			}
+		}
+
+		$(this).removeData("resizable-alsoresize");
+	}
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+	stop: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options;
+
+		var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+					soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+						soffsetw = ista ? 0 : self.sizeDiff.width;
+
+		var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+					left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+						top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+		self.element.animate(
+			$.extend(style, top && left ? { top: top, left: left } : {}), {
+				duration: o.animateDuration,
+				easing: o.animateEasing,
+				step: function() {
+
+					var data = {
+						width: parseInt(self.element.css('width'), 10),
+						height: parseInt(self.element.css('height'), 10),
+						top: parseInt(self.element.css('top'), 10),
+						left: parseInt(self.element.css('left'), 10)
+					};
+
+					if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+
+					// propagating resize, and updating values for each animation step
+					self._updateCache(data);
+					self._propagate("resize", event);
+
+				}
+			}
+		);
+	}
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+	start: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options, el = self.element;
+		var oc = o.containment,	ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+		if (!ce) return;
+
+		self.containerElement = $(ce);
+
+		if (/document/.test(oc) || oc == document) {
+			self.containerOffset = { left: 0, top: 0 };
+			self.containerPosition = { left: 0, top: 0 };
+
+			self.parentData = {
+				element: $(document), left: 0, top: 0,
+				width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+			};
+		}
+
+		// i'm a node, so compute top, left, right, bottom
+		else {
+			var element = $(ce), p = [];
+			$([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+			self.containerOffset = element.offset();
+			self.containerPosition = element.position();
+			self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+			var co = self.containerOffset, ch = self.containerSize.height,	cw = self.containerSize.width,
+						width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+			self.parentData = {
+				element: ce, left: co.left, top: co.top, width: width, height: height
+			};
+		}
+	},
+
+	resize: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options,
+				ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+				pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+		if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+		if (cp.left < (self._helper ? co.left : 0)) {
+			self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+			if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+			self.position.left = o.helper ? co.left : 0;
+		}
+
+		if (cp.top < (self._helper ? co.top : 0)) {
+			self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+			if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+			self.position.top = self._helper ? co.top : 0;
+		}
+
+		self.offset.left = self.parentData.left+self.position.left;
+		self.offset.top = self.parentData.top+self.position.top;
+
+		var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+					hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+		var isParent = self.containerElement.get(0) == self.element.parent().get(0),
+		    isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+
+		if(isParent && isOffsetRelative) woset -= self.parentData.left;
+
+		if (woset + self.size.width >= self.parentData.width) {
+			self.size.width = self.parentData.width - woset;
+			if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+		}
+
+		if (hoset + self.size.height >= self.parentData.height) {
+			self.size.height = self.parentData.height - hoset;
+			if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+		}
+	},
+
+	stop: function(event, ui){
+		var self = $(this).data("resizable"), o = self.options, cp = self.position,
+				co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+		var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+		if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+		if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+	}
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+	start: function(event, ui) {
+
+		var self = $(this).data("resizable"), o = self.options, cs = self.size;
+
+		self.ghost = self.originalElement.clone();
+		self.ghost
+			.css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+			.addClass('ui-resizable-ghost')
+			.addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+		self.ghost.appendTo(self.helper);
+
+	},
+
+	resize: function(event, ui){
+		var self = $(this).data("resizable"), o = self.options;
+		if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+	},
+
+	stop: function(event, ui){
+		var self = $(this).data("resizable"), o = self.options;
+		if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+	}
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+	resize: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+		o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+		var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+		if (/^(se|s|e)$/.test(a)) {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+		}
+		else if (/^(ne)$/.test(a)) {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+			self.position.top = op.top - oy;
+		}
+		else if (/^(sw)$/.test(a)) {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+			self.position.left = op.left - ox;
+		}
+		else {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+			self.position.top = op.top - oy;
+			self.position.left = op.left - ox;
+		}
+	}
+
+});
+
+var num = function(v) {
+	return parseInt(v, 10) || 0;
+};
+
+var isNumber = function(value) {
+	return !isNaN(parseInt(value, 10));
+};
+
+})(jQuery);

app/assets/javascripts/app/lib/ui/jquery.ui.selectable.js

@@ -0,0 +1,267 @@
+/*
+ * jQuery UI Selectable 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+$.widget("ui.selectable", $.ui.mouse, {
+	options: {
+		appendTo: 'body',
+		autoRefresh: true,
+		distance: 0,
+		filter: '*',
+		tolerance: 'touch'
+	},
+	_create: function() {
+		var self = this;
+
+		this.element.addClass("ui-selectable");
+
+		this.dragged = false;
+
+		// cache selectee children based on filter
+		var selectees;
+		this.refresh = function() {
+			selectees = $(self.options.filter, self.element[0]);
+			selectees.addClass("ui-selectee");
+			selectees.each(function() {
+				var $this = $(this);
+				var pos = $this.offset();
+				$.data(this, "selectable-item", {
+					element: this,
+					$element: $this,
+					left: pos.left,
+					top: pos.top,
+					right: pos.left + $this.outerWidth(),
+					bottom: pos.top + $this.outerHeight(),
+					startselected: false,
+					selected: $this.hasClass('ui-selected'),
+					selecting: $this.hasClass('ui-selecting'),
+					unselecting: $this.hasClass('ui-unselecting')
+				});
+			});
+		};
+		this.refresh();
+
+		this.selectees = selectees.addClass("ui-selectee");
+
+		this._mouseInit();
+
+		this.helper = $("<div class='ui-selectable-helper'></div>");
+	},
+
+	destroy: function() {
+		this.selectees
+			.removeClass("ui-selectee")
+			.removeData("selectable-item");
+		this.element
+			.removeClass("ui-selectable ui-selectable-disabled")
+			.removeData("selectable")
+			.unbind(".selectable");
+		this._mouseDestroy();
+
+		return this;
+	},
+
+	_mouseStart: function(event) {
+		var self = this;
+
+		this.opos = [event.pageX, event.pageY];
+
+		if (this.options.disabled)
+			return;
+
+		var options = this.options;
+
+		this.selectees = $(options.filter, this.element[0]);
+
+		this._trigger("start", event);
+
+		$(options.appendTo).append(this.helper);
+		// position helper (lasso)
+		this.helper.css({
+			"left": event.clientX,
+			"top": event.clientY,
+			"width": 0,
+			"height": 0
+		});
+
+		if (options.autoRefresh) {
+			this.refresh();
+		}
+
+		this.selectees.filter('.ui-selected').each(function() {
+			var selectee = $.data(this, "selectable-item");
+			selectee.startselected = true;
+			if (!event.metaKey && !event.ctrlKey) {
+				selectee.$element.removeClass('ui-selected');
+				selectee.selected = false;
+				selectee.$element.addClass('ui-unselecting');
+				selectee.unselecting = true;
+				// selectable UNSELECTING callback
+				self._trigger("unselecting", event, {
+					unselecting: selectee.element
+				});
+			}
+		});
+
+		$(event.target).parents().andSelf().each(function() {
+			var selectee = $.data(this, "selectable-item");
+			if (selectee) {
+				var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected');
+				selectee.$element
+					.removeClass(doSelect ? "ui-unselecting" : "ui-selected")
+					.addClass(doSelect ? "ui-selecting" : "ui-unselecting");
+				selectee.unselecting = !doSelect;
+				selectee.selecting = doSelect;
+				selectee.selected = doSelect;
+				// selectable (UN)SELECTING callback
+				if (doSelect) {
+					self._trigger("selecting", event, {
+						selecting: selectee.element
+					});
+				} else {
+					self._trigger("unselecting", event, {
+						unselecting: selectee.element
+					});
+				}
+				return false;
+			}
+		});
+
+	},
+
+	_mouseDrag: function(event) {
+		var self = this;
+		this.dragged = true;
+
+		if (this.options.disabled)
+			return;
+
+		var options = this.options;
+
+		var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
+		if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
+		if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
+		this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+		this.selectees.each(function() {
+			var selectee = $.data(this, "selectable-item");
+			//prevent helper from being selected if appendTo: selectable
+			if (!selectee || selectee.element == self.element[0])
+				return;
+			var hit = false;
+			if (options.tolerance == 'touch') {
+				hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+			} else if (options.tolerance == 'fit') {
+				hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+			}
+
+			if (hit) {
+				// SELECT
+				if (selectee.selected) {
+					selectee.$element.removeClass('ui-selected');
+					selectee.selected = false;
+				}
+				if (selectee.unselecting) {
+					selectee.$element.removeClass('ui-unselecting');
+					selectee.unselecting = false;
+				}
+				if (!selectee.selecting) {
+					selectee.$element.addClass('ui-selecting');
+					selectee.selecting = true;
+					// selectable SELECTING callback
+					self._trigger("selecting", event, {
+						selecting: selectee.element
+					});
+				}
+			} else {
+				// UNSELECT
+				if (selectee.selecting) {
+					if ((event.metaKey || event.ctrlKey) && selectee.startselected) {
+						selectee.$element.removeClass('ui-selecting');
+						selectee.selecting = false;
+						selectee.$element.addClass('ui-selected');
+						selectee.selected = true;
+					} else {
+						selectee.$element.removeClass('ui-selecting');
+						selectee.selecting = false;
+						if (selectee.startselected) {
+							selectee.$element.addClass('ui-unselecting');
+							selectee.unselecting = true;
+						}
+						// selectable UNSELECTING callback
+						self._trigger("unselecting", event, {
+							unselecting: selectee.element
+						});
+					}
+				}
+				if (selectee.selected) {
+					if (!event.metaKey && !event.ctrlKey && !selectee.startselected) {
+						selectee.$element.removeClass('ui-selected');
+						selectee.selected = false;
+
+						selectee.$element.addClass('ui-unselecting');
+						selectee.unselecting = true;
+						// selectable UNSELECTING callback
+						self._trigger("unselecting", event, {
+							unselecting: selectee.element
+						});
+					}
+				}
+			}
+		});
+
+		return false;
+	},
+
+	_mouseStop: function(event) {
+		var self = this;
+
+		this.dragged = false;
+
+		var options = this.options;
+
+		$('.ui-unselecting', this.element[0]).each(function() {
+			var selectee = $.data(this, "selectable-item");
+			selectee.$element.removeClass('ui-unselecting');
+			selectee.unselecting = false;
+			selectee.startselected = false;
+			self._trigger("unselected", event, {
+				unselected: selectee.element
+			});
+		});
+		$('.ui-selecting', this.element[0]).each(function() {
+			var selectee = $.data(this, "selectable-item");
+			selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
+			selectee.selecting = false;
+			selectee.selected = true;
+			selectee.startselected = true;
+			self._trigger("selected", event, {
+				selected: selectee.element
+			});
+		});
+		this._trigger("stop", event);
+
+		this.helper.remove();
+
+		return false;
+	}
+
+});
+
+$.extend($.ui.selectable, {
+	version: "1.8.17"
+});
+
+})(jQuery);

app/assets/javascripts/app/lib/ui/jquery.ui.slider.js

@@ -0,0 +1,666 @@
+/*
+ * jQuery UI Slider 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+// number of pages in a slider
+// (how many times can you page up/down to go through the whole range)
+var numPages = 5;
+
+$.widget( "ui.slider", $.ui.mouse, {
+
+	widgetEventPrefix: "slide",
+
+	options: {
+		animate: false,
+		distance: 0,
+		max: 100,
+		min: 0,
+		orientation: "horizontal",
+		range: false,
+		step: 1,
+		value: 0,
+		values: null
+	},
+
+	_create: function() {
+		var self = this,
+			o = this.options,
+			existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ),
+			handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",
+			handleCount = ( o.values && o.values.length ) || 1,
+			handles = [];
+
+		this._keySliding = false;
+		this._mouseSliding = false;
+		this._animateOff = true;
+		this._handleIndex = null;
+		this._detectOrientation();
+		this._mouseInit();
+
+		this.element
+			.addClass( "ui-slider" +
+				" ui-slider-" + this.orientation +
+				" ui-widget" +
+				" ui-widget-content" +
+				" ui-corner-all" +
+				( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) );
+
+		this.range = $([]);
+
+		if ( o.range ) {
+			if ( o.range === true ) {
+				if ( !o.values ) {
+					o.values = [ this._valueMin(), this._valueMin() ];
+				}
+				if ( o.values.length && o.values.length !== 2 ) {
+					o.values = [ o.values[0], o.values[0] ];
+				}
+			}
+
+			this.range = $( "<div></div>" )
+				.appendTo( this.element )
+				.addClass( "ui-slider-range" +
+				// note: this isn't the most fittingly semantic framework class for this element,
+				// but worked best visually with a variety of themes
+				" ui-widget-header" + 
+				( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) );
+		}
+
+		for ( var i = existingHandles.length; i < handleCount; i += 1 ) {
+			handles.push( handle );
+		}
+
+		this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) );
+
+		this.handle = this.handles.eq( 0 );
+
+		this.handles.add( this.range ).filter( "a" )
+			.click(function( event ) {
+				event.preventDefault();
+			})
+			.hover(function() {
+				if ( !o.disabled ) {
+					$( this ).addClass( "ui-state-hover" );
+				}
+			}, function() {
+				$( this ).removeClass( "ui-state-hover" );
+			})
+			.focus(function() {
+				if ( !o.disabled ) {
+					$( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" );
+					$( this ).addClass( "ui-state-focus" );
+				} else {
+					$( this ).blur();
+				}
+			})
+			.blur(function() {
+				$( this ).removeClass( "ui-state-focus" );
+			});
+
+		this.handles.each(function( i ) {
+			$( this ).data( "index.ui-slider-handle", i );
+		});
+
+		this.handles
+			.keydown(function( event ) {
+				var ret = true,
+					index = $( this ).data( "index.ui-slider-handle" ),
+					allowed,
+					curVal,
+					newVal,
+					step;
+	
+				if ( self.options.disabled ) {
+					return;
+				}
+	
+				switch ( event.keyCode ) {
+					case $.ui.keyCode.HOME:
+					case $.ui.keyCode.END:
+					case $.ui.keyCode.PAGE_UP:
+					case $.ui.keyCode.PAGE_DOWN:
+					case $.ui.keyCode.UP:
+					case $.ui.keyCode.RIGHT:
+					case $.ui.keyCode.DOWN:
+					case $.ui.keyCode.LEFT:
+						ret = false;
+						if ( !self._keySliding ) {
+							self._keySliding = true;
+							$( this ).addClass( "ui-state-active" );
+							allowed = self._start( event, index );
+							if ( allowed === false ) {
+								return;
+							}
+						}
+						break;
+				}
+	
+				step = self.options.step;
+				if ( self.options.values && self.options.values.length ) {
+					curVal = newVal = self.values( index );
+				} else {
+					curVal = newVal = self.value();
+				}
+	
+				switch ( event.keyCode ) {
+					case $.ui.keyCode.HOME:
+						newVal = self._valueMin();
+						break;
+					case $.ui.keyCode.END:
+						newVal = self._valueMax();
+						break;
+					case $.ui.keyCode.PAGE_UP:
+						newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) );
+						break;
+					case $.ui.keyCode.PAGE_DOWN:
+						newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) );
+						break;
+					case $.ui.keyCode.UP:
+					case $.ui.keyCode.RIGHT:
+						if ( curVal === self._valueMax() ) {
+							return;
+						}
+						newVal = self._trimAlignValue( curVal + step );
+						break;
+					case $.ui.keyCode.DOWN:
+					case $.ui.keyCode.LEFT:
+						if ( curVal === self._valueMin() ) {
+							return;
+						}
+						newVal = self._trimAlignValue( curVal - step );
+						break;
+				}
+	
+				self._slide( event, index, newVal );
+	
+				return ret;
+	
+			})
+			.keyup(function( event ) {
+				var index = $( this ).data( "index.ui-slider-handle" );
+	
+				if ( self._keySliding ) {
+					self._keySliding = false;
+					self._stop( event, index );
+					self._change( event, index );
+					$( this ).removeClass( "ui-state-active" );
+				}
+	
+			});
+
+		this._refreshValue();
+
+		this._animateOff = false;
+	},
+
+	destroy: function() {
+		this.handles.remove();
+		this.range.remove();
+
+		this.element
+			.removeClass( "ui-slider" +
+				" ui-slider-horizontal" +
+				" ui-slider-vertical" +
+				" ui-slider-disabled" +
+				" ui-widget" +
+				" ui-widget-content" +
+				" ui-corner-all" )
+			.removeData( "slider" )
+			.unbind( ".slider" );
+
+		this._mouseDestroy();
+
+		return this;
+	},
+
+	_mouseCapture: function( event ) {
+		var o = this.options,
+			position,
+			normValue,
+			distance,
+			closestHandle,
+			self,
+			index,
+			allowed,
+			offset,
+			mouseOverHandle;
+
+		if ( o.disabled ) {
+			return false;
+		}
+
+		this.elementSize = {
+			width: this.element.outerWidth(),
+			height: this.element.outerHeight()
+		};
+		this.elementOffset = this.element.offset();
+
+		position = { x: event.pageX, y: event.pageY };
+		normValue = this._normValueFromMouse( position );
+		distance = this._valueMax() - this._valueMin() + 1;
+		self = this;
+		this.handles.each(function( i ) {
+			var thisDistance = Math.abs( normValue - self.values(i) );
+			if ( distance > thisDistance ) {
+				distance = thisDistance;
+				closestHandle = $( this );
+				index = i;
+			}
+		});
+
+		// workaround for bug #3736 (if both handles of a range are at 0,
+		// the first is always used as the one with least distance,
+		// and moving it is obviously prevented by preventing negative ranges)
+		if( o.range === true && this.values(1) === o.min ) {
+			index += 1;
+			closestHandle = $( this.handles[index] );
+		}
+
+		allowed = this._start( event, index );
+		if ( allowed === false ) {
+			return false;
+		}
+		this._mouseSliding = true;
+
+		self._handleIndex = index;
+
+		closestHandle
+			.addClass( "ui-state-active" )
+			.focus();
+		
+		offset = closestHandle.offset();
+		mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" );
+		this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+			left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
+			top: event.pageY - offset.top -
+				( closestHandle.height() / 2 ) -
+				( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) -
+				( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) +
+				( parseInt( closestHandle.css("marginTop"), 10 ) || 0)
+		};
+
+		if ( !this.handles.hasClass( "ui-state-hover" ) ) {
+			this._slide( event, index, normValue );
+		}
+		this._animateOff = true;
+		return true;
+	},
+
+	_mouseStart: function( event ) {
+		return true;
+	},
+
+	_mouseDrag: function( event ) {
+		var position = { x: event.pageX, y: event.pageY },
+			normValue = this._normValueFromMouse( position );
+		
+		this._slide( event, this._handleIndex, normValue );
+
+		return false;
+	},
+
+	_mouseStop: function( event ) {
+		this.handles.removeClass( "ui-state-active" );
+		this._mouseSliding = false;
+
+		this._stop( event, this._handleIndex );
+		this._change( event, this._handleIndex );
+
+		this._handleIndex = null;
+		this._clickOffset = null;
+		this._animateOff = false;
+
+		return false;
+	},
+	
+	_detectOrientation: function() {
+		this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
+	},
+
+	_normValueFromMouse: function( position ) {
+		var pixelTotal,
+			pixelMouse,
+			percentMouse,
+			valueTotal,
+			valueMouse;
+
+		if ( this.orientation === "horizontal" ) {
+			pixelTotal = this.elementSize.width;
+			pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
+		} else {
+			pixelTotal = this.elementSize.height;
+			pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
+		}
+
+		percentMouse = ( pixelMouse / pixelTotal );
+		if ( percentMouse > 1 ) {
+			percentMouse = 1;
+		}
+		if ( percentMouse < 0 ) {
+			percentMouse = 0;
+		}
+		if ( this.orientation === "vertical" ) {
+			percentMouse = 1 - percentMouse;
+		}
+
+		valueTotal = this._valueMax() - this._valueMin();
+		valueMouse = this._valueMin() + percentMouse * valueTotal;
+
+		return this._trimAlignValue( valueMouse );
+	},
+
+	_start: function( event, index ) {
+		var uiHash = {
+			handle: this.handles[ index ],
+			value: this.value()
+		};
+		if ( this.options.values && this.options.values.length ) {
+			uiHash.value = this.values( index );
+			uiHash.values = this.values();
+		}
+		return this._trigger( "start", event, uiHash );
+	},
+
+	_slide: function( event, index, newVal ) {
+		var otherVal,
+			newValues,
+			allowed;
+
+		if ( this.options.values && this.options.values.length ) {
+			otherVal = this.values( index ? 0 : 1 );
+
+			if ( ( this.options.values.length === 2 && this.options.range === true ) && 
+					( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
+				) {
+				newVal = otherVal;
+			}
+
+			if ( newVal !== this.values( index ) ) {
+				newValues = this.values();
+				newValues[ index ] = newVal;
+				// A slide can be canceled by returning false from the slide callback
+				allowed = this._trigger( "slide", event, {
+					handle: this.handles[ index ],
+					value: newVal,
+					values: newValues
+				} );
+				otherVal = this.values( index ? 0 : 1 );
+				if ( allowed !== false ) {
+					this.values( index, newVal, true );
+				}
+			}
+		} else {
+			if ( newVal !== this.value() ) {
+				// A slide can be canceled by returning false from the slide callback
+				allowed = this._trigger( "slide", event, {
+					handle: this.handles[ index ],
+					value: newVal
+				} );
+				if ( allowed !== false ) {
+					this.value( newVal );
+				}
+			}
+		}
+	},
+
+	_stop: function( event, index ) {
+		var uiHash = {
+			handle: this.handles[ index ],
+			value: this.value()
+		};
+		if ( this.options.values && this.options.values.length ) {
+			uiHash.value = this.values( index );
+			uiHash.values = this.values();
+		}
+
+		this._trigger( "stop", event, uiHash );
+	},
+
+	_change: function( event, index ) {
+		if ( !this._keySliding && !this._mouseSliding ) {
+			var uiHash = {
+				handle: this.handles[ index ],
+				value: this.value()
+			};
+			if ( this.options.values && this.options.values.length ) {
+				uiHash.value = this.values( index );
+				uiHash.values = this.values();
+			}
+
+			this._trigger( "change", event, uiHash );
+		}
+	},
+
+	value: function( newValue ) {
+		if ( arguments.length ) {
+			this.options.value = this._trimAlignValue( newValue );
+			this._refreshValue();
+			this._change( null, 0 );
+			return;
+		}
+
+		return this._value();
+	},
+
+	values: function( index, newValue ) {
+		var vals,
+			newValues,
+			i;
+
+		if ( arguments.length > 1 ) {
+			this.options.values[ index ] = this._trimAlignValue( newValue );
+			this._refreshValue();
+			this._change( null, index );
+			return;
+		}
+
+		if ( arguments.length ) {
+			if ( $.isArray( arguments[ 0 ] ) ) {
+				vals = this.options.values;
+				newValues = arguments[ 0 ];
+				for ( i = 0; i < vals.length; i += 1 ) {
+					vals[ i ] = this._trimAlignValue( newValues[ i ] );
+					this._change( null, i );
+				}
+				this._refreshValue();
+			} else {
+				if ( this.options.values && this.options.values.length ) {
+					return this._values( index );
+				} else {
+					return this.value();
+				}
+			}
+		} else {
+			return this._values();
+		}
+	},
+
+	_setOption: function( key, value ) {
+		var i,
+			valsLength = 0;
+
+		if ( $.isArray( this.options.values ) ) {
+			valsLength = this.options.values.length;
+		}
+
+		$.Widget.prototype._setOption.apply( this, arguments );
+
+		switch ( key ) {
+			case "disabled":
+				if ( value ) {
+					this.handles.filter( ".ui-state-focus" ).blur();
+					this.handles.removeClass( "ui-state-hover" );
+					this.handles.propAttr( "disabled", true );
+					this.element.addClass( "ui-disabled" );
+				} else {
+					this.handles.propAttr( "disabled", false );
+					this.element.removeClass( "ui-disabled" );
+				}
+				break;
+			case "orientation":
+				this._detectOrientation();
+				this.element
+					.removeClass( "ui-slider-horizontal ui-slider-vertical" )
+					.addClass( "ui-slider-" + this.orientation );
+				this._refreshValue();
+				break;
+			case "value":
+				this._animateOff = true;
+				this._refreshValue();
+				this._change( null, 0 );
+				this._animateOff = false;
+				break;
+			case "values":
+				this._animateOff = true;
+				this._refreshValue();
+				for ( i = 0; i < valsLength; i += 1 ) {
+					this._change( null, i );
+				}
+				this._animateOff = false;
+				break;
+		}
+	},
+
+	//internal value getter
+	// _value() returns value trimmed by min and max, aligned by step
+	_value: function() {
+		var val = this.options.value;
+		val = this._trimAlignValue( val );
+
+		return val;
+	},
+
+	//internal values getter
+	// _values() returns array of values trimmed by min and max, aligned by step
+	// _values( index ) returns single value trimmed by min and max, aligned by step
+	_values: function( index ) {
+		var val,
+			vals,
+			i;
+
+		if ( arguments.length ) {
+			val = this.options.values[ index ];
+			val = this._trimAlignValue( val );
+
+			return val;
+		} else {
+			// .slice() creates a copy of the array
+			// this copy gets trimmed by min and max and then returned
+			vals = this.options.values.slice();
+			for ( i = 0; i < vals.length; i+= 1) {
+				vals[ i ] = this._trimAlignValue( vals[ i ] );
+			}
+
+			return vals;
+		}
+	},
+	
+	// returns the step-aligned value that val is closest to, between (inclusive) min and max
+	_trimAlignValue: function( val ) {
+		if ( val <= this._valueMin() ) {
+			return this._valueMin();
+		}
+		if ( val >= this._valueMax() ) {
+			return this._valueMax();
+		}
+		var step = ( this.options.step > 0 ) ? this.options.step : 1,
+			valModStep = (val - this._valueMin()) % step,
+			alignValue = val - valModStep;
+
+		if ( Math.abs(valModStep) * 2 >= step ) {
+			alignValue += ( valModStep > 0 ) ? step : ( -step );
+		}
+
+		// Since JavaScript has problems with large floats, round
+		// the final value to 5 digits after the decimal point (see #4124)
+		return parseFloat( alignValue.toFixed(5) );
+	},
+
+	_valueMin: function() {
+		return this.options.min;
+	},
+
+	_valueMax: function() {
+		return this.options.max;
+	},
+	
+	_refreshValue: function() {
+		var oRange = this.options.range,
+			o = this.options,
+			self = this,
+			animate = ( !this._animateOff ) ? o.animate : false,
+			valPercent,
+			_set = {},
+			lastValPercent,
+			value,
+			valueMin,
+			valueMax;
+
+		if ( this.options.values && this.options.values.length ) {
+			this.handles.each(function( i, j ) {
+				valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100;
+				_set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+				$( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+				if ( self.options.range === true ) {
+					if ( self.orientation === "horizontal" ) {
+						if ( i === 0 ) {
+							self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
+						}
+						if ( i === 1 ) {
+							self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+						}
+					} else {
+						if ( i === 0 ) {
+							self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
+						}
+						if ( i === 1 ) {
+							self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+						}
+					}
+				}
+				lastValPercent = valPercent;
+			});
+		} else {
+			value = this.value();
+			valueMin = this._valueMin();
+			valueMax = this._valueMax();
+			valPercent = ( valueMax !== valueMin ) ?
+					( value - valueMin ) / ( valueMax - valueMin ) * 100 :
+					0;
+			_set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+			this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+
+			if ( oRange === "min" && this.orientation === "horizontal" ) {
+				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate );
+			}
+			if ( oRange === "max" && this.orientation === "horizontal" ) {
+				this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+			}
+			if ( oRange === "min" && this.orientation === "vertical" ) {
+				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate );
+			}
+			if ( oRange === "max" && this.orientation === "vertical" ) {
+				this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+			}
+		}
+	}
+
+});
+
+$.extend( $.ui.slider, {
+	version: "1.8.17"
+});
+
+}(jQuery));

app/assets/javascripts/app/lib/ui/jquery.ui.tabs.js

@@ -0,0 +1,758 @@
+/*
+ * jQuery UI Tabs 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ */
+(function( $, undefined ) {
+
+var tabId = 0,
+	listId = 0;
+
+function getNextTabId() {
+	return ++tabId;
+}
+
+function getNextListId() {
+	return ++listId;
+}
+
+$.widget( "ui.tabs", {
+	options: {
+		add: null,
+		ajaxOptions: null,
+		cache: false,
+		cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+		collapsible: false,
+		disable: null,
+		disabled: [],
+		enable: null,
+		event: "click",
+		fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
+		idPrefix: "ui-tabs-",
+		load: null,
+		panelTemplate: "<div></div>",
+		remove: null,
+		select: null,
+		show: null,
+		spinner: "<em>Loading&#8230;</em>",
+		tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>"
+	},
+
+	_create: function() {
+		this._tabify( true );
+	},
+
+	_setOption: function( key, value ) {
+		if ( key == "selected" ) {
+			if (this.options.collapsible && value == this.options.selected ) {
+				return;
+			}
+			this.select( value );
+		} else {
+			this.options[ key ] = value;
+			this._tabify();
+		}
+	},
+
+	_tabId: function( a ) {
+		return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) ||
+			this.options.idPrefix + getNextTabId();
+	},
+
+	_sanitizeSelector: function( hash ) {
+		// we need this because an id may contain a ":"
+		return hash.replace( /:/g, "\\:" );
+	},
+
+	_cookie: function() {
+		var cookie = this.cookie ||
+			( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() );
+		return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) );
+	},
+
+	_ui: function( tab, panel ) {
+		return {
+			tab: tab,
+			panel: panel,
+			index: this.anchors.index( tab )
+		};
+	},
+
+	_cleanup: function() {
+		// restore all former loading tabs labels
+		this.lis.filter( ".ui-state-processing" )
+			.removeClass( "ui-state-processing" )
+			.find( "span:data(label.tabs)" )
+				.each(function() {
+					var el = $( this );
+					el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" );
+				});
+	},
+
+	_tabify: function( init ) {
+		var self = this,
+			o = this.options,
+			fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+
+		this.list = this.element.find( "ol,ul" ).eq( 0 );
+		this.lis = $( " > li:has(a[href])", this.list );
+		this.anchors = this.lis.map(function() {
+			return $( "a", this )[ 0 ];
+		});
+		this.panels = $( [] );
+
+		this.anchors.each(function( i, a ) {
+			var href = $( a ).attr( "href" );
+			// For dynamically created HTML that contains a hash as href IE < 8 expands
+			// such href to the full page url with hash and then misinterprets tab as ajax.
+			// Same consideration applies for an added tab with a fragment identifier
+			// since a[href=#fragment-identifier] does unexpectedly not match.
+			// Thus normalize href attribute...
+			var hrefBase = href.split( "#" )[ 0 ],
+				baseEl;
+			if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] ||
+					( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) {
+				href = a.hash;
+				a.href = href;
+			}
+
+			// inline tab
+			if ( fragmentId.test( href ) ) {
+				self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) );
+			// remote tab
+			// prevent loading the page itself if href is just "#"
+			} else if ( href && href !== "#" ) {
+				// required for restore on destroy
+				$.data( a, "href.tabs", href );
+
+				// TODO until #3808 is fixed strip fragment identifier from url
+				// (IE fails to load from such url)
+				$.data( a, "load.tabs", href.replace( /#.*$/, "" ) );
+
+				var id = self._tabId( a );
+				a.href = "#" + id;
+				var $panel = self.element.find( "#" + id );
+				if ( !$panel.length ) {
+					$panel = $( o.panelTemplate )
+						.attr( "id", id )
+						.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" )
+						.insertAfter( self.panels[ i - 1 ] || self.list );
+					$panel.data( "destroy.tabs", true );
+				}
+				self.panels = self.panels.add( $panel );
+			// invalid tab href
+			} else {
+				o.disabled.push( i );
+			}
+		});
+
+		// initialization from scratch
+		if ( init ) {
+			// attach necessary classes for styling
+			this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" );
+			this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
+			this.lis.addClass( "ui-state-default ui-corner-top" );
+			this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" );
+
+			// Selected tab
+			// use "selected" option or try to retrieve:
+			// 1. from fragment identifier in url
+			// 2. from cookie
+			// 3. from selected class attribute on <li>
+			if ( o.selected === undefined ) {
+				if ( location.hash ) {
+					this.anchors.each(function( i, a ) {
+						if ( a.hash == location.hash ) {
+							o.selected = i;
+							return false;
+						}
+					});
+				}
+				if ( typeof o.selected !== "number" && o.cookie ) {
+					o.selected = parseInt( self._cookie(), 10 );
+				}
+				if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) {
+					o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
+				}
+				o.selected = o.selected || ( this.lis.length ? 0 : -1 );
+			} else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release
+				o.selected = -1;
+			}
+
+			// sanity check - default to first tab...
+			o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 )
+				? o.selected
+				: 0;
+
+			// Take disabling tabs via class attribute from HTML
+			// into account and update option properly.
+			// A selected tab cannot become disabled.
+			o.disabled = $.unique( o.disabled.concat(
+				$.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) {
+					return self.lis.index( n );
+				})
+			) ).sort();
+
+			if ( $.inArray( o.selected, o.disabled ) != -1 ) {
+				o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 );
+			}
+
+			// highlight selected tab
+			this.panels.addClass( "ui-tabs-hide" );
+			this.lis.removeClass( "ui-tabs-selected ui-state-active" );
+			// check for length avoids error when initializing empty list
+			if ( o.selected >= 0 && this.anchors.length ) {
+				self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" );
+				this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" );
+
+				// seems to be expected behavior that the show callback is fired
+				self.element.queue( "tabs", function() {
+					self._trigger( "show", null,
+						self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) );
+				});
+
+				this.load( o.selected );
+			}
+
+			// clean up to avoid memory leaks in certain versions of IE 6
+			// TODO: namespace this event
+			$( window ).bind( "unload", function() {
+				self.lis.add( self.anchors ).unbind( ".tabs" );
+				self.lis = self.anchors = self.panels = null;
+			});
+		// update selected after add/remove
+		} else {
+			o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
+		}
+
+		// update collapsible
+		// TODO: use .toggleClass()
+		this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" );
+
+		// set or update cookie after init and add/remove respectively
+		if ( o.cookie ) {
+			this._cookie( o.selected, o.cookie );
+		}
+
+		// disable tabs
+		for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) {
+			$( li )[ $.inArray( i, o.disabled ) != -1 &&
+				// TODO: use .toggleClass()
+				!$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" );
+		}
+
+		// reset cache if switching from cached to not cached
+		if ( o.cache === false ) {
+			this.anchors.removeData( "cache.tabs" );
+		}
+
+		// remove all handlers before, tabify may run on existing tabs after add or option change
+		this.lis.add( this.anchors ).unbind( ".tabs" );
+
+		if ( o.event !== "mouseover" ) {
+			var addState = function( state, el ) {
+				if ( el.is( ":not(.ui-state-disabled)" ) ) {
+					el.addClass( "ui-state-" + state );
+				}
+			};
+			var removeState = function( state, el ) {
+				el.removeClass( "ui-state-" + state );
+			};
+			this.lis.bind( "mouseover.tabs" , function() {
+				addState( "hover", $( this ) );
+			});
+			this.lis.bind( "mouseout.tabs", function() {
+				removeState( "hover", $( this ) );
+			});
+			this.anchors.bind( "focus.tabs", function() {
+				addState( "focus", $( this ).closest( "li" ) );
+			});
+			this.anchors.bind( "blur.tabs", function() {
+				removeState( "focus", $( this ).closest( "li" ) );
+			});
+		}
+
+		// set up animations
+		var hideFx, showFx;
+		if ( o.fx ) {
+			if ( $.isArray( o.fx ) ) {
+				hideFx = o.fx[ 0 ];
+				showFx = o.fx[ 1 ];
+			} else {
+				hideFx = showFx = o.fx;
+			}
+		}
+
+		// Reset certain styles left over from animation
+		// and prevent IE's ClearType bug...
+		function resetStyle( $el, fx ) {
+			$el.css( "display", "" );
+			if ( !$.support.opacity && fx.opacity ) {
+				$el[ 0 ].style.removeAttribute( "filter" );
+			}
+		}
+
+		// Show a tab...
+		var showTab = showFx
+			? function( clicked, $show ) {
+				$( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
+				$show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way
+					.animate( showFx, showFx.duration || "normal", function() {
+						resetStyle( $show, showFx );
+						self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
+					});
+			}
+			: function( clicked, $show ) {
+				$( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
+				$show.removeClass( "ui-tabs-hide" );
+				self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
+			};
+
+		// Hide a tab, $show is optional...
+		var hideTab = hideFx
+			? function( clicked, $hide ) {
+				$hide.animate( hideFx, hideFx.duration || "normal", function() {
+					self.lis.removeClass( "ui-tabs-selected ui-state-active" );
+					$hide.addClass( "ui-tabs-hide" );
+					resetStyle( $hide, hideFx );
+					self.element.dequeue( "tabs" );
+				});
+			}
+			: function( clicked, $hide, $show ) {
+				self.lis.removeClass( "ui-tabs-selected ui-state-active" );
+				$hide.addClass( "ui-tabs-hide" );
+				self.element.dequeue( "tabs" );
+			};
+
+		// attach tab event handler, unbind to avoid duplicates from former tabifying...
+		this.anchors.bind( o.event + ".tabs", function() {
+			var el = this,
+				$li = $(el).closest( "li" ),
+				$hide = self.panels.filter( ":not(.ui-tabs-hide)" ),
+				$show = self.element.find( self._sanitizeSelector( el.hash ) );
+
+			// If tab is already selected and not collapsible or tab disabled or
+			// or is already loading or click callback returns false stop here.
+			// Check if click handler returns false last so that it is not executed
+			// for a disabled or loading tab!
+			if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) ||
+				$li.hasClass( "ui-state-disabled" ) ||
+				$li.hasClass( "ui-state-processing" ) ||
+				self.panels.filter( ":animated" ).length ||
+				self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) {
+				this.blur();
+				return false;
+			}
+
+			o.selected = self.anchors.index( this );
+
+			self.abort();
+
+			// if tab may be closed
+			if ( o.collapsible ) {
+				if ( $li.hasClass( "ui-tabs-selected" ) ) {
+					o.selected = -1;
+
+					if ( o.cookie ) {
+						self._cookie( o.selected, o.cookie );
+					}
+
+					self.element.queue( "tabs", function() {
+						hideTab( el, $hide );
+					}).dequeue( "tabs" );
+
+					this.blur();
+					return false;
+				} else if ( !$hide.length ) {
+					if ( o.cookie ) {
+						self._cookie( o.selected, o.cookie );
+					}
+
+					self.element.queue( "tabs", function() {
+						showTab( el, $show );
+					});
+
+					// TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
+					self.load( self.anchors.index( this ) );
+
+					this.blur();
+					return false;
+				}
+			}
+
+			if ( o.cookie ) {
+				self._cookie( o.selected, o.cookie );
+			}
+
+			// show new tab
+			if ( $show.length ) {
+				if ( $hide.length ) {
+					self.element.queue( "tabs", function() {
+						hideTab( el, $hide );
+					});
+				}
+				self.element.queue( "tabs", function() {
+					showTab( el, $show );
+				});
+
+				self.load( self.anchors.index( this ) );
+			} else {
+				throw "jQuery UI Tabs: Mismatching fragment identifier.";
+			}
+
+			// Prevent IE from keeping other link focussed when using the back button
+			// and remove dotted border from clicked link. This is controlled via CSS
+			// in modern browsers; blur() removes focus from address bar in Firefox
+			// which can become a usability and annoying problem with tabs('rotate').
+			if ( $.browser.msie ) {
+				this.blur();
+			}
+		});
+
+		// disable click in any case
+		this.anchors.bind( "click.tabs", function(){
+			return false;
+		});
+	},
+
+    _getIndex: function( index ) {
+		// meta-function to give users option to provide a href string instead of a numerical index.
+		// also sanitizes numerical indexes to valid values.
+		if ( typeof index == "string" ) {
+			index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) );
+		}
+
+		return index;
+	},
+
+	destroy: function() {
+		var o = this.options;
+
+		this.abort();
+
+		this.element
+			.unbind( ".tabs" )
+			.removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" )
+			.removeData( "tabs" );
+
+		this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
+
+		this.anchors.each(function() {
+			var href = $.data( this, "href.tabs" );
+			if ( href ) {
+				this.href = href;
+			}
+			var $this = $( this ).unbind( ".tabs" );
+			$.each( [ "href", "load", "cache" ], function( i, prefix ) {
+				$this.removeData( prefix + ".tabs" );
+			});
+		});
+
+		this.lis.unbind( ".tabs" ).add( this.panels ).each(function() {
+			if ( $.data( this, "destroy.tabs" ) ) {
+				$( this ).remove();
+			} else {
+				$( this ).removeClass([
+					"ui-state-default",
+					"ui-corner-top",
+					"ui-tabs-selected",
+					"ui-state-active",
+					"ui-state-hover",
+					"ui-state-focus",
+					"ui-state-disabled",
+					"ui-tabs-panel",
+					"ui-widget-content",
+					"ui-corner-bottom",
+					"ui-tabs-hide"
+				].join( " " ) );
+			}
+		});
+
+		if ( o.cookie ) {
+			this._cookie( null, o.cookie );
+		}
+
+		return this;
+	},
+
+	add: function( url, label, index ) {
+		if ( index === undefined ) {
+			index = this.anchors.length;
+		}
+
+		var self = this,
+			o = this.options,
+			$li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ),
+			id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] );
+
+		$li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true );
+
+		// try to find an existing element before creating a new one
+		var $panel = self.element.find( "#" + id );
+		if ( !$panel.length ) {
+			$panel = $( o.panelTemplate )
+				.attr( "id", id )
+				.data( "destroy.tabs", true );
+		}
+		$panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" );
+
+		if ( index >= this.lis.length ) {
+			$li.appendTo( this.list );
+			$panel.appendTo( this.list[ 0 ].parentNode );
+		} else {
+			$li.insertBefore( this.lis[ index ] );
+			$panel.insertBefore( this.panels[ index ] );
+		}
+
+		o.disabled = $.map( o.disabled, function( n, i ) {
+			return n >= index ? ++n : n;
+		});
+
+		this._tabify();
+
+		if ( this.anchors.length == 1 ) {
+			o.selected = 0;
+			$li.addClass( "ui-tabs-selected ui-state-active" );
+			$panel.removeClass( "ui-tabs-hide" );
+			this.element.queue( "tabs", function() {
+				self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) );
+			});
+
+			this.load( 0 );
+		}
+
+		this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+		return this;
+	},
+
+	remove: function( index ) {
+		index = this._getIndex( index );
+		var o = this.options,
+			$li = this.lis.eq( index ).remove(),
+			$panel = this.panels.eq( index ).remove();
+
+		// If selected tab was removed focus tab to the right or
+		// in case the last tab was removed the tab to the left.
+		if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) {
+			this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) );
+		}
+
+		o.disabled = $.map(
+			$.grep( o.disabled, function(n, i) {
+				return n != index;
+			}),
+			function( n, i ) {
+				return n >= index ? --n : n;
+			});
+
+		this._tabify();
+
+		this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) );
+		return this;
+	},
+
+	enable: function( index ) {
+		index = this._getIndex( index );
+		var o = this.options;
+		if ( $.inArray( index, o.disabled ) == -1 ) {
+			return;
+		}
+
+		this.lis.eq( index ).removeClass( "ui-state-disabled" );
+		o.disabled = $.grep( o.disabled, function( n, i ) {
+			return n != index;
+		});
+
+		this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+		return this;
+	},
+
+	disable: function( index ) {
+		index = this._getIndex( index );
+		var self = this, o = this.options;
+		// cannot disable already selected tab
+		if ( index != o.selected ) {
+			this.lis.eq( index ).addClass( "ui-state-disabled" );
+
+			o.disabled.push( index );
+			o.disabled.sort();
+
+			this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+		}
+
+		return this;
+	},
+
+	select: function( index ) {
+		index = this._getIndex( index );
+		if ( index == -1 ) {
+			if ( this.options.collapsible && this.options.selected != -1 ) {
+				index = this.options.selected;
+			} else {
+				return this;
+			}
+		}
+		this.anchors.eq( index ).trigger( this.options.event + ".tabs" );
+		return this;
+	},
+
+	load: function( index ) {
+		index = this._getIndex( index );
+		var self = this,
+			o = this.options,
+			a = this.anchors.eq( index )[ 0 ],
+			url = $.data( a, "load.tabs" );
+
+		this.abort();
+
+		// not remote or from cache
+		if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) {
+			this.element.dequeue( "tabs" );
+			return;
+		}
+
+		// load remote from here on
+		this.lis.eq( index ).addClass( "ui-state-processing" );
+
+		if ( o.spinner ) {
+			var span = $( "span", a );
+			span.data( "label.tabs", span.html() ).html( o.spinner );
+		}
+
+		this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, {
+			url: url,
+			success: function( r, s ) {
+				self.element.find( self._sanitizeSelector( a.hash ) ).html( r );
+
+				// take care of tab labels
+				self._cleanup();
+
+				if ( o.cache ) {
+					$.data( a, "cache.tabs", true );
+				}
+
+				self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
+				try {
+					o.ajaxOptions.success( r, s );
+				}
+				catch ( e ) {}
+			},
+			error: function( xhr, s, e ) {
+				// take care of tab labels
+				self._cleanup();
+
+				self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
+				try {
+					// Passing index avoid a race condition when this method is
+					// called after the user has selected another tab.
+					// Pass the anchor that initiated this request allows
+					// loadError to manipulate the tab content panel via $(a.hash)
+					o.ajaxOptions.error( xhr, s, index, a );
+				}
+				catch ( e ) {}
+			}
+		} ) );
+
+		// last, so that load event is fired before show...
+		self.element.dequeue( "tabs" );
+
+		return this;
+	},
+
+	abort: function() {
+		// stop possibly running animations
+		this.element.queue( [] );
+		this.panels.stop( false, true );
+
+		// "tabs" queue must not contain more than two elements,
+		// which are the callbacks for the latest clicked tab...
+		this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) );
+
+		// terminate pending requests from other tabs
+		if ( this.xhr ) {
+			this.xhr.abort();
+			delete this.xhr;
+		}
+
+		// take care of tab labels
+		this._cleanup();
+		return this;
+	},
+
+	url: function( index, url ) {
+		this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url );
+		return this;
+	},
+
+	length: function() {
+		return this.anchors.length;
+	}
+});
+
+$.extend( $.ui.tabs, {
+	version: "1.8.17"
+});
+
+/*
+ * Tabs Extensions
+ */
+
+/*
+ * Rotate
+ */
+$.extend( $.ui.tabs.prototype, {
+	rotation: null,
+	rotate: function( ms, continuing ) {
+		var self = this,
+			o = this.options;
+
+		var rotate = self._rotate || ( self._rotate = function( e ) {
+			clearTimeout( self.rotation );
+			self.rotation = setTimeout(function() {
+				var t = o.selected;
+				self.select( ++t < self.anchors.length ? t : 0 );
+			}, ms );
+			
+			if ( e ) {
+				e.stopPropagation();
+			}
+		});
+
+		var stop = self._unrotate || ( self._unrotate = !continuing
+			? function(e) {
+				if (e.clientX) { // in case of a true click
+					self.rotate(null);
+				}
+			}
+			: function( e ) {
+				t = o.selected;
+				rotate();
+			});
+
+		// start rotation
+		if ( ms ) {
+			this.element.bind( "tabsshow", rotate );
+			this.anchors.bind( o.event + ".tabs", stop );
+			rotate();
+		// stop rotation
+		} else {
+			clearTimeout( self.rotation );
+			this.element.unbind( "tabsshow", rotate );
+			this.anchors.unbind( o.event + ".tabs", stop );
+			delete this._rotate;
+			delete this._unrotate;
+		}
+
+		return this;
+	}
+});
+
+})( jQuery );

app/assets/javascripts/app/lib/ui/jquery.ui.widget.js

@@ -0,0 +1,272 @@
+/*!
+ * jQuery UI Widget 1.8.17
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function( $, undefined ) {
+
+// jQuery 1.4+
+if ( $.cleanData ) {
+	var _cleanData = $.cleanData;
+	$.cleanData = function( elems ) {
+		for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+			try {
+				$( elem ).triggerHandler( "remove" );
+			// http://bugs.jquery.com/ticket/8235
+			} catch( e ) {}
+		}
+		_cleanData( elems );
+	};
+} else {
+	var _remove = $.fn.remove;
+	$.fn.remove = function( selector, keepData ) {
+		return this.each(function() {
+			if ( !keepData ) {
+				if ( !selector || $.filter( selector, [ this ] ).length ) {
+					$( "*", this ).add( [ this ] ).each(function() {
+						try {
+							$( this ).triggerHandler( "remove" );
+						// http://bugs.jquery.com/ticket/8235
+						} catch( e ) {}
+					});
+				}
+			}
+			return _remove.call( $(this), selector, keepData );
+		});
+	};
+}
+
+$.widget = function( name, base, prototype ) {
+	var namespace = name.split( "." )[ 0 ],
+		fullName;
+	name = name.split( "." )[ 1 ];
+	fullName = namespace + "-" + name;
+
+	if ( !prototype ) {
+		prototype = base;
+		base = $.Widget;
+	}
+
+	// create selector for plugin
+	$.expr[ ":" ][ fullName ] = function( elem ) {
+		return !!$.data( elem, name );
+	};
+
+	$[ namespace ] = $[ namespace ] || {};
+	$[ namespace ][ name ] = function( options, element ) {
+		// allow instantiation without initializing for simple inheritance
+		if ( arguments.length ) {
+			this._createWidget( options, element );
+		}
+	};
+
+	var basePrototype = new base();
+	// we need to make the options hash a property directly on the new instance
+	// otherwise we'll modify the options hash on the prototype that we're
+	// inheriting from
+//	$.each( basePrototype, function( key, val ) {
+//		if ( $.isPlainObject(val) ) {
+//			basePrototype[ key ] = $.extend( {}, val );
+//		}
+//	});
+	basePrototype.options = $.extend( true, {}, basePrototype.options );
+	$[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+		namespace: namespace,
+		widgetName: name,
+		widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
+		widgetBaseClass: fullName
+	}, prototype );
+
+	$.widget.bridge( name, $[ namespace ][ name ] );
+};
+
+$.widget.bridge = function( name, object ) {
+	$.fn[ name ] = function( options ) {
+		var isMethodCall = typeof options === "string",
+			args = Array.prototype.slice.call( arguments, 1 ),
+			returnValue = this;
+
+		// allow multiple hashes to be passed on init
+		options = !isMethodCall && args.length ?
+			$.extend.apply( null, [ true, options ].concat(args) ) :
+			options;
+
+		// prevent calls to internal methods
+		if ( isMethodCall && options.charAt( 0 ) === "_" ) {
+			return returnValue;
+		}
+
+		if ( isMethodCall ) {
+			this.each(function() {
+				var instance = $.data( this, name ),
+					methodValue = instance && $.isFunction( instance[options] ) ?
+						instance[ options ].apply( instance, args ) :
+						instance;
+				// TODO: add this back in 1.9 and use $.error() (see #5972)
+//				if ( !instance ) {
+//					throw "cannot call methods on " + name + " prior to initialization; " +
+//						"attempted to call method '" + options + "'";
+//				}
+//				if ( !$.isFunction( instance[options] ) ) {
+//					throw "no such method '" + options + "' for " + name + " widget instance";
+//				}
+//				var methodValue = instance[ options ].apply( instance, args );
+				if ( methodValue !== instance && methodValue !== undefined ) {
+					returnValue = methodValue;
+					return false;
+				}
+			});
+		} else {
+			this.each(function() {
+				var instance = $.data( this, name );
+				if ( instance ) {
+					instance.option( options || {} )._init();
+				} else {
+					$.data( this, name, new object( options, this ) );
+				}
+			});
+		}
+
+		return returnValue;
+	};
+};
+
+$.Widget = function( options, element ) {
+	// allow instantiation without initializing for simple inheritance
+	if ( arguments.length ) {
+		this._createWidget( options, element );
+	}
+};
+
+$.Widget.prototype = {
+	widgetName: "widget",
+	widgetEventPrefix: "",
+	options: {
+		disabled: false
+	},
+	_createWidget: function( options, element ) {
+		// $.widget.bridge stores the plugin instance, but we do it anyway
+		// so that it's stored even before the _create function runs
+		$.data( element, this.widgetName, this );
+		this.element = $( element );
+		this.options = $.extend( true, {},
+			this.options,
+			this._getCreateOptions(),
+			options );
+
+		var self = this;
+		this.element.bind( "remove." + this.widgetName, function() {
+			self.destroy();
+		});
+
+		this._create();
+		this._trigger( "create" );
+		this._init();
+	},
+	_getCreateOptions: function() {
+		return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
+	},
+	_create: function() {},
+	_init: function() {},
+
+	destroy: function() {
+		this.element
+			.unbind( "." + this.widgetName )
+			.removeData( this.widgetName );
+		this.widget()
+			.unbind( "." + this.widgetName )
+			.removeAttr( "aria-disabled" )
+			.removeClass(
+				this.widgetBaseClass + "-disabled " +
+				"ui-state-disabled" );
+	},
+
+	widget: function() {
+		return this.element;
+	},
+
+	option: function( key, value ) {
+		var options = key;
+
+		if ( arguments.length === 0 ) {
+			// don't return a reference to the internal hash
+			return $.extend( {}, this.options );
+		}
+
+		if  (typeof key === "string" ) {
+			if ( value === undefined ) {
+				return this.options[ key ];
+			}
+			options = {};
+			options[ key ] = value;
+		}
+
+		this._setOptions( options );
+
+		return this;
+	},
+	_setOptions: function( options ) {
+		var self = this;
+		$.each( options, function( key, value ) {
+			self._setOption( key, value );
+		});
+
+		return this;
+	},
+	_setOption: function( key, value ) {
+		this.options[ key ] = value;
+
+		if ( key === "disabled" ) {
+			this.widget()
+				[ value ? "addClass" : "removeClass"](
+					this.widgetBaseClass + "-disabled" + " " +
+					"ui-state-disabled" )
+				.attr( "aria-disabled", value );
+		}
+
+		return this;
+	},
+
+	enable: function() {
+		return this._setOption( "disabled", false );
+	},
+	disable: function() {
+		return this._setOption( "disabled", true );
+	},
+
+	_trigger: function( type, event, data ) {
+		var prop, orig,
+			callback = this.options[ type ];
+
+		data = data || {};
+		event = $.Event( event );
+		event.type = ( type === this.widgetEventPrefix ?
+			type :
+			this.widgetEventPrefix + type ).toLowerCase();
+		// the original event may come from any element
+		// so we need to reset the target on the new event
+		event.target = this.element[ 0 ];
+
+		// copy original event properties over to the new event
+		orig = event.originalEvent;
+		if ( orig ) {
+			for ( prop in orig ) {
+				if ( !( prop in event ) ) {
+					event[ prop ] = orig[ prop ];
+				}
+			}
+		}
+
+		this.element.trigger( event, data );
+
+		return !( $.isFunction(callback) &&
+			callback.call( this.element[0], event, data ) === false ||
+			event.isDefaultPrevented() );
+	}
+};
+
+})( jQuery );

app/assets/javascripts/app/lib/underscore.coffee

@@ -0,0 +1,682 @@
+# **Underscore.coffee
+# (c) 2011 Jeremy Ashkenas, DocumentCloud Inc.**
+# Underscore is freely distributable under the terms of the
+# [MIT license](http://en.wikipedia.org/wiki/MIT_License).
+# Portions of Underscore are inspired by or borrowed from
+# [Prototype.js](http://prototypejs.org/api), Oliver Steele's
+# [Functional](http://osteele.com), and John Resig's
+# [Micro-Templating](http://ejohn.org).
+# For all details and documentation:
+# http://documentcloud.github.com/underscore/
+
+
+# Baseline setup
+# --------------
+
+# Establish the root object, `window` in the browser, or `global` on the server.
+root = this
+
+
+# Save the previous value of the `_` variable.
+previousUnderscore = root._
+
+
+# Establish the object that gets thrown to break out of a loop iteration.
+# `StopIteration` is SOP on Mozilla.
+breaker = if typeof(StopIteration) is 'undefined' then '__break__' else StopIteration
+
+
+# Helper function to escape **RegExp** contents, because JS doesn't have one.
+escapeRegExp = (string) -> string.replace(/([.*+?^${}()|[\]\/\\])/g, '\\$1')
+
+
+# Save bytes in the minified (but not gzipped) version:
+ArrayProto           = Array.prototype
+ObjProto             = Object.prototype
+
+
+# Create quick reference variables for speed access to core prototypes.
+slice                = ArrayProto.slice
+unshift              = ArrayProto.unshift
+toString             = ObjProto.toString
+hasOwnProperty       = ObjProto.hasOwnProperty
+propertyIsEnumerable = ObjProto.propertyIsEnumerable
+
+
+# All **ECMA5** native implementations we hope to use are declared here.
+nativeForEach        = ArrayProto.forEach
+nativeMap            = ArrayProto.map
+nativeReduce         = ArrayProto.reduce
+nativeReduceRight    = ArrayProto.reduceRight
+nativeFilter         = ArrayProto.filter
+nativeEvery          = ArrayProto.every
+nativeSome           = ArrayProto.some
+nativeIndexOf        = ArrayProto.indexOf
+nativeLastIndexOf    = ArrayProto.lastIndexOf
+nativeIsArray        = Array.isArray
+nativeKeys           = Object.keys
+
+
+# Create a safe reference to the Underscore object for use below.
+_ = (obj) -> new wrapper(obj)
+
+
+# Export the Underscore object for **CommonJS**.
+if typeof(exports) != 'undefined' then exports._ = _
+
+
+# Export Underscore to global scope.
+root._ = _
+
+
+# Current version.
+_.VERSION = '1.1.0'
+
+
+# Collection Functions
+# --------------------
+
+# The cornerstone, an **each** implementation.
+# Handles objects implementing **forEach**, arrays, and raw objects.
+_.each = (obj, iterator, context) ->
+  try
+    if nativeForEach and obj.forEach is nativeForEach
+      obj.forEach iterator, context
+    else if _.isNumber obj.length
+      iterator.call context, obj[i], i, obj for i in [0...obj.length]
+    else
+      iterator.call context, val, key, obj  for own key, val of obj
+  catch e
+    throw e if e isnt breaker
+  obj
+
+
+# Return the results of applying the iterator to each element. Use JavaScript
+# 1.6's version of **map**, if possible.
+_.map = (obj, iterator, context) ->
+  return obj.map(iterator, context) if nativeMap and obj.map is nativeMap
+  results = []
+  _.each obj, (value, index, list) ->
+    results.push iterator.call context, value, index, list
+  results
+
+
+# **Reduce** builds up a single result from a list of values. Also known as
+# **inject**, or **foldl**. Uses JavaScript 1.8's version of **reduce**, if possible.
+_.reduce = (obj, iterator, memo, context) ->
+  if nativeReduce and obj.reduce is nativeReduce
+    iterator = _.bind iterator, context if context
+    return obj.reduce iterator, memo
+  _.each obj, (value, index, list) ->
+    memo = iterator.call context, memo, value, index, list
+  memo
+
+
+# The right-associative version of **reduce**, also known as **foldr**. Uses
+# JavaScript 1.8's version of **reduceRight**, if available.
+_.reduceRight = (obj, iterator, memo, context) ->
+  if nativeReduceRight and obj.reduceRight is nativeReduceRight
+    iterator = _.bind iterator, context if context
+    return obj.reduceRight iterator, memo
+  reversed = _.clone(_.toArray(obj)).reverse()
+  _.reduce reversed, iterator, memo, context
+
+
+# Return the first value which passes a truth test.
+_.detect = (obj, iterator, context) ->
+  result = null
+  _.each obj, (value, index, list) ->
+    if iterator.call context, value, index, list
+      result = value
+      _.breakLoop()
+  result
+
+
+# Return all the elements that pass a truth test. Use JavaScript 1.6's
+# **filter**, if it exists.
+_.filter = (obj, iterator, context) ->
+  return obj.filter iterator, context if nativeFilter and obj.filter is nativeFilter
+  results = []
+  _.each obj, (value, index, list) ->
+    results.push value if iterator.call context, value, index, list
+  results
+
+
+# Return all the elements for which a truth test fails.
+_.reject = (obj, iterator, context) ->
+  results = []
+  _.each obj, (value, index, list) ->
+    results.push value if not iterator.call context, value, index, list
+  results
+
+
+# Determine whether all of the elements match a truth test. Delegate to
+# JavaScript 1.6's **every**, if it is present.
+_.every = (obj, iterator, context) ->
+  iterator ||= _.identity
+  return obj.every iterator, context if nativeEvery and obj.every is nativeEvery
+  result = true
+  _.each obj, (value, index, list) ->
+    _.breakLoop() unless (result = result and iterator.call(context, value, index, list))
+  result
+
+
+# Determine if at least one element in the object matches a truth test. Use
+# JavaScript 1.6's **some**, if it exists.
+_.some = (obj, iterator, context) ->
+  iterator ||= _.identity
+  return obj.some iterator, context if nativeSome and obj.some is nativeSome
+  result = false
+  _.each obj, (value, index, list) ->
+    _.breakLoop() if (result = iterator.call(context, value, index, list))
+  result
+
+
+# Determine if a given value is included in the array or object,
+# based on `===`.
+_.include = (obj, target) ->
+  return _.indexOf(obj, target) isnt -1 if nativeIndexOf and obj.indexOf is nativeIndexOf
+  return true for own key, val of obj when val is target
+  false
+
+
+# Invoke a method with arguments on every item in a collection.
+_.invoke = (obj, method) ->
+  args = _.rest arguments, 2
+  (if method then val[method] else val).apply(val, args) for val in obj
+
+
+# Convenience version of a common use case of **map**: fetching a property.
+_.pluck = (obj, key) ->
+  _.map(obj, (val) -> val[key])
+
+
+# Return the maximum item or (item-based computation).
+_.max = (obj, iterator, context) ->
+  return Math.max.apply(Math, obj) if not iterator and _.isArray(obj)
+  result = computed: -Infinity
+  _.each obj, (value, index, list) ->
+    computed = if iterator then iterator.call(context, value, index, list) else value
+    computed >= result.computed and (result = {value: value, computed: computed})
+  result.value
+
+
+# Return the minimum element (or element-based computation).
+_.min = (obj, iterator, context) ->
+  return Math.min.apply(Math, obj) if not iterator and _.isArray(obj)
+  result = computed: Infinity
+  _.each obj, (value, index, list) ->
+    computed = if iterator then iterator.call(context, value, index, list) else value
+    computed < result.computed and (result = {value: value, computed: computed})
+  result.value
+
+
+# Sort the object's values by a criterion produced by an iterator.
+_.sortBy = (obj, iterator, context) ->
+  _.pluck(((_.map obj, (value, index, list) ->
+    {value: value, criteria: iterator.call(context, value, index, list)}
+  ).sort((left, right) ->
+    a = left.criteria; b = right.criteria
+    if a < b then -1 else if a > b then 1 else 0
+  )), 'value')
+
+
+# Use a comparator function to figure out at what index an object should
+# be inserted so as to maintain order. Uses binary search.
+_.sortedIndex = (array, obj, iterator) ->
+  iterator ||= _.identity
+  low =  0
+  high = array.length
+  while low < high
+    mid = (low + high) >> 1
+    if iterator(array[mid]) < iterator(obj) then low = mid + 1 else high = mid
+  low
+
+
+# Convert anything iterable into a real, live array.
+_.toArray = (iterable) ->
+  return []                   if (!iterable)
+  return iterable.toArray()   if (iterable.toArray)
+  return iterable             if (_.isArray(iterable))
+  return slice.call(iterable) if (_.isArguments(iterable))
+  _.values(iterable)
+
+
+# Return the number of elements in an object.
+_.size = (obj) -> _.toArray(obj).length
+
+
+# Array Functions
+# ---------------
+
+# Get the first element of an array. Passing `n` will return the first N
+# values in the array. Aliased as **head**. The `guard` check allows it to work
+# with **map**.
+_.first = (array, n, guard) ->
+  if n and not guard then slice.call(array, 0, n) else array[0]
+
+
+# Returns everything but the first entry of the array. Aliased as **tail**.
+# Especially useful on the arguments object. Passing an `index` will return
+# the rest of the values in the array from that index onward. The `guard`
+# check allows it to work with **map**.
+_.rest = (array, index, guard) ->
+  slice.call(array, if _.isUndefined(index) or guard then 1 else index)
+
+
+# Get the last element of an array.
+_.last = (array) -> array[array.length - 1]
+
+
+# Trim out all falsy values from an array.
+_.compact = (array) -> item for item in array when item
+
+
+# Return a completely flattened version of an array.
+_.flatten = (array) ->
+  _.reduce array, (memo, value) ->
+    return memo.concat(_.flatten(value)) if _.isArray value
+    memo.push value
+    memo
+  , []
+
+
+# Return a version of the array that does not contain the specified value(s).
+_.without = (array) ->
+  values = _.rest arguments
+  val for val in _.toArray(array) when not _.include values, val
+
+
+# Produce a duplicate-free version of the array. If the array has already
+# been sorted, you have the option of using a faster algorithm.
+_.uniq = (array, isSorted) ->
+  memo = []
+  for el, i in _.toArray array
+    memo.push el if i is 0 || (if isSorted is true then _.last(memo) isnt el else not _.include(memo, el))
+  memo
+
+
+# Produce an array that contains every item shared between all the
+# passed-in arrays.
+_.intersect = (array) ->
+  rest = _.rest arguments
+  _.select _.uniq(array), (item) ->
+    _.all rest, (other) ->
+      _.indexOf(other, item) >= 0
+
+
+# Zip together multiple lists into a single array -- elements that share
+# an index go together.
+_.zip = ->
+  length =  _.max _.pluck arguments, 'length'
+  results = new Array length
+  for i in [0...length]
+    results[i] = _.pluck arguments, String i
+  results
+
+
+# If the browser doesn't supply us with **indexOf** (I'm looking at you, MSIE),
+# we need this function. Return the position of the first occurrence of an
+# item in an array, or -1 if the item is not included in the array.
+_.indexOf = (array, item) ->
+  return array.indexOf item if nativeIndexOf and array.indexOf is nativeIndexOf
+  i = 0; l = array.length
+  while l - i
+    if array[i] is item then return i else i++
+  -1
+
+
+# Provide JavaScript 1.6's **lastIndexOf**, delegating to the native function,
+# if possible.
+_.lastIndexOf = (array, item) ->
+  return array.lastIndexOf(item) if nativeLastIndexOf and array.lastIndexOf is nativeLastIndexOf
+  i = array.length
+  while i
+    if array[i] is item then return i else i--
+  -1
+
+
+# Generate an integer Array containing an arithmetic progression. A port of
+# [the native Python **range** function](http://docs.python.org/library/functions.html#range).
+_.range = (start, stop, step) ->
+  a         = arguments
+  solo      = a.length <= 1
+  i = start = if solo then 0 else a[0]
+  stop      = if solo then a[0] else a[1]
+  step      = a[2] or 1
+  len       = Math.ceil((stop - start) / step)
+  return []   if len <= 0
+  range     = new Array len
+  idx       = 0
+  loop
+    return range if (if step > 0 then i - stop else stop - i) >= 0
+    range[idx] = i
+    idx++
+    i+= step
+
+
+# Function Functions
+# ------------------
+
+# Create a function bound to a given object (assigning `this`, and arguments,
+# optionally). Binding with arguments is also known as **curry**.
+_.bind = (func, obj) ->
+  args = _.rest arguments, 2
+  -> func.apply obj or root, args.concat arguments
+
+
+# Bind all of an object's methods to that object. Useful for ensuring that
+# all callbacks defined on an object belong to it.
+_.bindAll = (obj) ->
+  funcs = if arguments.length > 1 then _.rest(arguments) else _.functions(obj)
+  _.each funcs, (f) -> obj[f] = _.bind obj[f], obj
+  obj
+
+
+# Delays a function for the given number of milliseconds, and then calls
+# it with the arguments supplied.
+_.delay = (func, wait) ->
+  args = _.rest arguments, 2
+  setTimeout((-> func.apply(func, args)), wait)
+
+
+# Memoize an expensive function by storing its results.
+_.memoize = (func, hasher) ->
+  memo = {}
+  hasher or= _.identity
+  ->
+    key = hasher.apply this, arguments
+    return memo[key] if key of memo
+    memo[key] = func.apply this, arguments
+
+
+# Defers a function, scheduling it to run after the current call stack has
+# cleared.
+_.defer = (func) ->
+  _.delay.apply _, [func, 1].concat _.rest arguments
+
+
+# Returns the first function passed as an argument to the second,
+# allowing you to adjust arguments, run code before and after, and
+# conditionally execute the original function.
+_.wrap = (func, wrapper) ->
+  -> wrapper.apply wrapper, [func].concat arguments
+
+
+# Returns a function that is the composition of a list of functions, each
+# consuming the return value of the function that follows.
+_.compose = ->
+  funcs = arguments
+  ->
+    args = arguments
+    for i in [funcs.length - 1..0] by -1
+      args = [funcs[i].apply(this, args)]
+    args[0]
+
+
+# Object Functions
+# ----------------
+
+# Retrieve the names of an object's properties.
+_.keys = nativeKeys or (obj) ->
+  return _.range 0, obj.length if _.isArray(obj)
+  key for key, val of obj
+
+
+# Retrieve the values of an object's properties.
+_.values = (obj) ->
+  _.map obj, _.identity
+
+
+# Return a sorted list of the function names available in Underscore.
+_.functions = (obj) ->
+  _.filter(_.keys(obj), (key) -> _.isFunction(obj[key])).sort()
+
+
+# Extend a given object with all of the properties in a source object.
+_.extend = (obj) ->
+  for source in _.rest(arguments)
+    obj[key] = val for key, val of source
+  obj
+
+
+# Create a (shallow-cloned) duplicate of an object.
+_.clone = (obj) ->
+  return obj.slice 0 if _.isArray obj
+  _.extend {}, obj
+
+
+# Invokes interceptor with the obj, and then returns obj.
+# The primary purpose of this method is to "tap into" a method chain, in order to perform operations on intermediate results within the chain.
+_.tap = (obj, interceptor) ->
+  interceptor obj
+  obj
+
+
+# Perform a deep comparison to check if two objects are equal.
+_.isEqual = (a, b) ->
+  # Check object identity.
+  return true if a is b
+  # Different types?
+  atype = typeof(a); btype = typeof(b)
+  return false if atype isnt btype
+  # Basic equality test (watch out for coercions).
+  return true if `a == b`
+  # One is falsy and the other truthy.
+  return false if (!a and b) or (a and !b)
+  # One of them implements an `isEqual()`?
+  return a.isEqual(b) if a.isEqual
+  # Check dates' integer values.
+  return a.getTime() is b.getTime() if _.isDate(a) and _.isDate(b)
+  # Both are NaN?
+  return false if _.isNaN(a) and _.isNaN(b)
+  # Compare regular expressions.
+  if _.isRegExp(a) and _.isRegExp(b)
+    return a.source     is b.source and
+           a.global     is b.global and
+           a.ignoreCase is b.ignoreCase and
+           a.multiline  is b.multiline
+  # If a is not an object by this point, we can't handle it.
+  return false if atype isnt 'object'
+  # Check for different array lengths before comparing contents.
+  return false if a.length and (a.length isnt b.length)
+  # Nothing else worked, deep compare the contents.
+  aKeys = _.keys(a); bKeys = _.keys(b)
+  # Different object sizes?
+  return false if aKeys.length isnt bKeys.length
+  # Recursive comparison of contents.
+  return false for key, val of a when !(key of b) or !_.isEqual(val, b[key])
+  true
+
+
+# Is a given array or object empty?
+_.isEmpty = (obj) ->
+  return obj.length is 0 if _.isArray(obj) or _.isString(obj)
+  return false for own key of obj
+  true
+
+
+# Is a given value a DOM element?
+_.isElement   = (obj) -> obj and obj.nodeType is 1
+
+
+# Is a given value an array?
+_.isArray     = nativeIsArray or (obj) -> !!(obj and obj.concat and obj.unshift and not obj.callee)
+
+
+# Is a given variable an arguments object?
+_.isArguments = (obj) -> obj and obj.callee
+
+
+# Is the given value a function?
+_.isFunction  = (obj) -> !!(obj and obj.constructor and obj.call and obj.apply)
+
+
+# Is the given value a string?
+_.isString    = (obj) -> !!(obj is '' or (obj and obj.charCodeAt and obj.substr))
+
+
+# Is a given value a number?
+_.isNumber    = (obj) -> (obj is +obj) or toString.call(obj) is '[object Number]'
+
+
+# Is a given value a boolean?
+_.isBoolean   = (obj) -> obj is true or obj is false
+
+
+# Is a given value a Date?
+_.isDate      = (obj) -> !!(obj and obj.getTimezoneOffset and obj.setUTCFullYear)
+
+
+# Is the given value a regular expression?
+_.isRegExp    = (obj) -> !!(obj and obj.exec and (obj.ignoreCase or obj.ignoreCase is false))
+
+
+# Is the given value NaN -- this one is interesting. `NaN != NaN`, and
+# `isNaN(undefined) == true`, so we make sure it's a number first.
+_.isNaN       = (obj) -> _.isNumber(obj) and window.isNaN(obj)
+
+
+# Is a given value equal to null?
+_.isNull      = (obj) -> obj is null
+
+
+# Is a given variable undefined?
+_.isUndefined = (obj) -> typeof obj is 'undefined'
+
+
+# Utility Functions
+# -----------------
+
+# Run Underscore.js in noConflict mode, returning the `_` variable to its
+# previous owner. Returns a reference to the Underscore object.
+_.noConflict = ->
+  root._ = previousUnderscore
+  this
+
+
+# Keep the identity function around for default iterators.
+_.identity = (value) -> value
+
+
+# Run a function `n` times.
+_.times = (n, iterator, context) ->
+  iterator.call context, i for i in [0...n]
+
+
+# Break out of the middle of an iteration.
+_.breakLoop = -> throw breaker
+
+
+# Add your own custom functions to the Underscore object, ensuring that
+# they're correctly added to the OOP wrapper as well.
+_.mixin = (obj) ->
+  for name in _.functions(obj)
+    addToWrapper name, _[name] = obj[name]
+
+
+# Generate a unique integer id (unique within the entire client session).
+# Useful for temporary DOM ids.
+idCounter = 0
+_.uniqueId = (prefix) ->
+  (prefix or '') + idCounter++
+
+
+# By default, Underscore uses **ERB**-style template delimiters, change the
+# following template settings to use alternative delimiters.
+_.templateSettings = {
+  start:        '<%'
+  end:          '%>'
+  interpolate:  /<%=(.+?)%>/g
+}
+
+
+# JavaScript templating a-la **ERB**, pilfered from John Resig's
+# *Secrets of the JavaScript Ninja*, page 83.
+# Single-quote fix from Rick Strahl.
+# With alterations for arbitrary delimiters, and to preserve whitespace.
+_.template = (str, data) ->
+  c = _.templateSettings
+  endMatch = new RegExp("'(?=[^"+c.end.substr(0, 1)+"]*"+escapeRegExp(c.end)+")","g")
+  fn = new Function 'obj',
+    'var p=[],print=function(){p.push.apply(p,arguments);};' +
+    'with(obj||{}){p.push(\'' +
+    str.replace(/\r/g, '\\r')
+       .replace(/\n/g, '\\n')
+       .replace(/\t/g, '\\t')
+       .replace(endMatch,"✄")
+       .split("'").join("\\'")
+       .split("✄").join("'")
+       .replace(c.interpolate, "',$1,'")
+       .split(c.start).join("');")
+       .split(c.end).join("p.push('") +
+       "');}return p.join('');"
+  if data then fn(data) else fn
+
+
+# Aliases
+# -------
+
+_.forEach  = _.each
+_.foldl    = _.inject = _.reduce
+_.foldr    = _.reduceRight
+_.select   = _.filter
+_.all      = _.every
+_.any      = _.some
+_.contains = _.include
+_.head     = _.first
+_.tail     = _.rest
+_.methods  = _.functions
+
+
+# Setup the OOP Wrapper
+# ---------------------
+
+# If Underscore is called as a function, it returns a wrapped object that
+# can be used OO-style. This wrapper holds altered versions of all the
+# underscore functions. Wrapped objects may be chained.
+wrapper = (obj) ->
+  this._wrapped = obj
+  this
+
+
+# Helper function to continue chaining intermediate results.
+result = (obj, chain) ->
+  if chain then _(obj).chain() else obj
+
+
+# A method to easily add functions to the OOP wrapper.
+addToWrapper = (name, func) ->
+  wrapper.prototype[name] = ->
+    args = _.toArray arguments
+    unshift.call args, this._wrapped
+    result func.apply(_, args), this._chain
+
+
+# Add all ofthe Underscore functions to the wrapper object.
+_.mixin _
+
+
+# Add all mutator Array functions to the wrapper.
+_.each ['pop', 'push', 'reverse', 'shift', 'sort', 'splice', 'unshift'], (name) ->
+  method = Array.prototype[name]
+  wrapper.prototype[name] = ->
+    method.apply(this._wrapped, arguments)
+    result(this._wrapped, this._chain)
+
+
+# Add all accessor Array functions to the wrapper.
+_.each ['concat', 'join', 'slice'], (name) ->
+  method = Array.prototype[name]
+  wrapper.prototype[name] = ->
+    result(method.apply(this._wrapped, arguments), this._chain)
+
+
+# Start chaining a wrapped Underscore object.
+wrapper::chain = ->
+  this._chain = true
+  this
+
+
+# Extracts the result from a wrapped and chained object.
+wrapper::value = -> this._wrapped

app/assets/javascripts/app/models/application_model.js.coffee

@@ -0,0 +1,32 @@
+class App.Model extends Spine.Model
+  
+  validate: (data = {}) ->
+#    console.log 'vali', @
+#    console.log 'vali', params, '@', @
+#    console.log 'validate', params, @configure_attributes, @, App.User.configure_attributes
+    # check if @constructor.configure_attributes is used
+    return if !@constructor.configure_attributes
+
+    errors = {}
+    for attribute in @constructor.configure_attributes
+      if !attribute.readonly 
+        
+        # check required
+        if 'null' of attribute && !attribute[null] && !@[attribute.name]
+          errors[attribute.name] = 'is required'
+
+        # check confirm password
+        if data.form && attribute.type is 'password' && @[attribute.name]
+
+          # get confirm password
+          if @[attribute.name] isnt @["#{attribute.name}_confirm"]
+            console.log 'aaa', @[attribute.name], @["#{attribute.name}_confirm"], attribute[null]
+            errors[attribute.name] = 'didn\'t match'
+            errors["#{attribute.name}_confirm"] = ''
+
+    # return error object
+    for key, msg of errors
+#      console.log 'e', errors
+      return errors
+      
+    return

app/assets/javascripts/app/models/group.js.coffee

@@ -0,0 +1,12 @@
+class App.Group extends App.Model
+  @configure 'Group', 'name', 'note', 'active'
+  @extend Spine.Model.Ajax
+  @configure_attributes = [
+    { name: 'name', display: 'Name', tag: 'input', type: 'text', limit: 100, 'null': false, 'class': 'xlarge' },
+    { name: 'note', display: 'Note', note: 'Notes are visible to agents only, never to customers.', tag: 'textarea', limit: 250, 'null': true, 'class': 'xlarge' },
+    { name: 'updated_at', display: 'Updated', type: 'time', readonly: 1 },
+    { name: 'active', display: 'Active', tag: 'boolean', type: 'boolean', 'default': true, 'null': false, 'class': 'xlarge' },
+  ]
+  @configure_overview = [
+    'name',
+  ]

app/assets/javascripts/app/models/history.js.coffee

@@ -0,0 +1,4 @@
+class App.History extends App.Model
+  @configure 'History', 'name'
+  @extend Spine.Model.Ajax
+  @url: '/histories'

app/assets/javascripts/app/models/history_attributes.js.coffee

@@ -0,0 +1,4 @@
+class App.HistoryAttribute extends App.Model
+  @configure 'HistoryAttribute', 'name'
+  @extend Spine.Model.Ajax
+  @url: '/history_attributes'

app/assets/javascripts/app/models/history_object.js.coffee

@@ -0,0 +1,4 @@
+class App.HistoryObject extends App.Model
+  @configure 'HistoryObject', 'name'
+  @extend Spine.Model.Ajax
+  @url: '/history_objects'

app/assets/javascripts/app/models/history_type.js.coffee

@@ -0,0 +1,4 @@
+class App.HistoryType extends App.Model
+  @configure 'HistoryType', 'name'
+  @extend Spine.Model.Ajax
+  @url: '/history_types'

app/assets/javascripts/app/models/network.js.coffee

@@ -0,0 +1,9 @@
+class App.Network extends App.Model
+  @configure 'Network', 'name', 'note', 'active'
+  @extend Spine.Model.Ajax
+  @configure_attributes = [
+    { name: 'name', display: 'Name', tag: 'input', type: 'text', limit: 100, 'null': false, 'class': 'xlarge' },
+    { name: 'note', display: 'Note', note: 'Notes are visible to agents only, never to customers.', tag: 'textarea', limit: 250, 'null': true, 'class': 'xlarge' },
+    { name: 'updated_at', display: 'Updated', type: 'time', readonly: 1 },
+    { name: 'active', display: 'Active', tag: 'boolean', type: 'boolean', 'default': true, 'null': false, 'class': 'xlarge' },
+  ]

app/assets/javascripts/app/models/network_category.js.coffee

@@ -0,0 +1,3 @@
+class App.NetworkCategory extends App.Model
+  @configure 'NetworkCategory', 'name', 'network_id', 'network_category_type_id', 'network_privacy_id', 'note', 'allow_comments', 'active'
+  @extend Spine.Model.Ajax

app/assets/javascripts/app/models/network_category_type.js.coffee

@@ -0,0 +1,3 @@
+class App.NetworkCategoryType extends App.Model
+  @configure 'NetworkCategoryType', 'name', 'note', 'active'
+  @extend Spine.Model.Ajax

app/assets/javascripts/app/models/network_privacy.js.coffee

@@ -0,0 +1,3 @@
+class App.NetworkPrivacy extends App.Model
+  @configure 'NetworkPrivacy', 'name', 'key'
+  @extend Spine.Model.Ajax

app/assets/javascripts/app/models/organization.js.coffee

@@ -0,0 +1,13 @@
+class App.Organization extends App.Model
+  @configure 'Organization', 'name', 'shared', 'note', 'active'
+  @extend Spine.Model.Ajax
+  @configure_attributes = [
+    { name: 'name',       display: 'Name', tag: 'input', type: 'text', limit: 100, 'null': false, 'class': 'xlarge' },
+    { name: 'note',       display: 'Note', note: 'Notes are visible to agents only, never to customers.', tag: 'textarea', limit: 250, 'null': true, 'class': 'xlarge' },
+    { name: 'shared',     display: 'Shared organiztion', note: 'Customers in the organiztion can view each other items.', tag: 'boolean', type: 'boolean', 'default': true, 'null': false, 'class': 'xlarge' },
+    { name: 'updated_at', display: 'Updated', type: 'time', readonly: 1 },
+    { name: 'active',     display: 'Active', tag: 'boolean', type: 'boolean', 'default': true, 'null': false, 'class': 'xlarge' },
+  ]
+  @configure_overview = [
+    'name', 'shared',
+  ]

app/assets/javascripts/app/models/overview.js.coffee

@@ -0,0 +1,3 @@
+class App.Overview extends Spine.Model
+  @configure 'Overview', 'name', 'meta', 'condition', 'order', 'view', 'user_id', 'group_ids'
+  @extend Spine.Model.Ajax

app/assets/javascripts/app/models/post.js.coffee

@@ -0,0 +1,3 @@
+class App.Post extends App.Model
+  @configure 'Post', 'title', 'content'
+  @extend Spine.Model.Ajax

app/assets/javascripts/app/models/role.js.coffee

@@ -0,0 +1,12 @@
+class App.Role extends App.Model
+  @configure 'Role', 'name', 'note', 'active'
+  @extend Spine.Model.Ajax
+  @configure_attributes = [
+    { name: 'name', display: 'Name', tag: 'input', type: 'text', limit: 100, 'null': false, 'class': 'xlarge' },
+    { name: 'note', display: 'Note', note: 'Notes are visible to agents only, never to customers.', tag: 'textarea', limit: 250, 'null': true, 'class': 'xlarge' },
+    { name: 'updated_at', display: 'Updated', type: 'time', readonly: 1 },
+    { name: 'active', display: 'Active', tag: 'boolean', type: 'boolean', 'default': true, 'null': false, 'class': 'xlarge' },
+  ]
+  @configure_overview = [
+    'name',
+  ]

app/assets/javascripts/app/models/session.js.coffee

@@ -0,0 +1,3 @@
+class App.Session extends App.Model
+  @configure 'Session', 'data'
+  @extend Spine.Model.Ajax

app/assets/javascripts/app/models/setting.js.coffee

@@ -0,0 +1,3 @@
+class App.Setting extends App.Model
+  @configure 'Setting', 'name', 'state'
+  @extend Spine.Model.Ajax

app/assets/javascripts/app/models/ticket.js.coffee

@@ -0,0 +1,19 @@
+class App.Ticket extends App.Model
+  @configure 'Ticket', 'number', 'title', 'group_id', 'owner_id', 'customer_id', 'ticket_state_id', 'ticket_priority_id'
+  @extend Spine.Model.Ajax
+#  @url: '/tickets'
+  @configure_attributes = [
+      { name: 'number',                display: '#',        tag: 'input',    type: 'text', limit: 100, null: true, read_only: true },
+      { name: 'customer_id',           display: 'Customer', tag: 'input',    type: 'text', limit: 100, null: false, class: 'span8', autocapitalize: false, help: 'Select the customer of the Ticket or create one.', link: '<a href="" class="customer_new">&raquo;</a>' },
+      { name: 'group_id',              display: 'Group',    tag: 'select',   multiple: false, limit: 100, null: false, class: 'span8', relation: 'Group', },
+      { name: 'owner_id',              display: 'Owner',    tag: 'select',   multiple: false, limit: 100, null: true, class: 'span8', relation: 'User', },
+      { name: 'title',                 display: 'Title',    tag: 'input',    type: 'text', limit: 100, null: false, class: 'span8',  },
+      { name: 'ticket_state_id',       display: 'State',    tag: 'select',   multiple: false, null: false, relation: 'TicketState', default: 'new', class: 'medium' },
+      { name: 'ticket_priority_id',    display: 'Priority', tag: 'select',   multiple: false, null: false, relation: 'TicketPriority', default: '2 normal', class: 'medium' },
+      { name: 'created_at',            display: 'Created',  tag: 'time', },
+      { name: 'last_contact',          display: 'Last contact',            tag: 'time', null: true },
+      { name: 'last_contact_agent',    display: 'Last contact (Agent)',    tag: 'time', null: true },
+      { name: 'last_contact_customer', display: 'Last contact (Customer)', tag: 'time', null: true },
+      { name: 'first_response',        display: 'First response',          tag: 'time', null: true },
+      { name: 'close_time',            display: 'Close time',              tag: 'time', null: true },
+    ]

app/assets/javascripts/app/models/ticket_article.js.coffee

@@ -0,0 +1,15 @@
+class App.TicketArticle extends App.Model
+  @configure 'TicketArticle', 'from', 'to', 'cc', 'subject', 'body', 'ticket_id', 'ticket_article_type_id', 'ticket_article_sender_id', 'internal', 'in_reply_to'
+  @extend Spine.Model.Ajax
+  @url: '/ticket_articles'
+  @configure_attributes = [
+      { name: 'ticket_id',                display: 'TicketID', null: false, readonly: 1, },
+      { name: 'from',                     display: 'From',     tag: 'input',    type: 'text', limit: 100, null: false, class: 'span8',  },
+      { name: 'to',                       display: 'To',       tag: 'input',    type: 'text', limit: 100, null: true, class: 'span8',  },
+      { name: 'cc',                       display: 'Cc',       tag: 'input',    type: 'text', limit: 100, null: true, class: 'span8',  },
+      { name: 'subject',                  display: 'Subject',  tag: 'input',    type: 'text', limit: 100, null: true, class: 'span8',  },
+      { name: 'body',                     display: 'Text',     tag: 'textarea', rows: 5,      limit: 100, null: false, class: 'span8',  },
+      { name: 'ticket_article_type_id',   display: 'Type',     tag: 'select',   multiple: false, null: false, relation: 'TicketArticleType', default: '', class: 'medium' },
+      { name: 'ticket_article_sender_id', display: 'Sender',   tag: 'select',   multiple: false, null: false, relation: 'TicketArticleSender', default: '', class: 'medium' },
+      { name: 'internal',                 display: 'Visability', tag: 'radio',  default: false,  null: true, options: { true: 'internal', false: 'public' }, class: 'medium' },
+    ]

app/assets/javascripts/app/models/ticket_article_sender.js.coffee

@@ -0,0 +1,4 @@
+class App.TicketArticleSender extends App.Model
+  @configure 'TicketArticleSender', 'name'
+  @extend Spine.Model.Ajax
+  @url: '/ticket_article_senders'

app/assets/javascripts/app/models/ticket_article_type.js.coffee

@@ -0,0 +1,4 @@
+class App.TicketArticleType extends App.Model
+  @configure 'TicketArticleType', 'name'
+  @extend Spine.Model.Ajax
+  @url: '/ticket_article_types'

app/assets/javascripts/app/models/ticket_priority.js.coffee

@@ -0,0 +1,4 @@
+class App.TicketPriority extends App.Model
+  @configure 'TicketPriority', 'name', 'note', 'active'
+  @extend Spine.Model.Ajax
+  @url: '/ticket_priorities'

app/assets/javascripts/app/models/ticket_state.js.coffee

@@ -0,0 +1,4 @@
+class App.TicketState extends App.Model
+  @configure 'TicketState', 'name', 'note', 'active'
+  @extend Spine.Model.Ajax
+  @url: '/ticket_states'

app/assets/javascripts/app/models/ticket_state_type.js.coffee

@@ -0,0 +1,4 @@
+class App.TicketStateType extends App.Model
+  @configure 'TicketStateType', 'name', 'note', 'active'
+  @extend Spine.Model.Ajax
+  @url: '/ticket_state_types'

app/assets/javascripts/app/models/user.js.coffee

@@ -0,0 +1,25 @@
+class App.User extends App.Model
+  @configure 'User', 'login', 'firstname', 'lastname', 'email', 'web', 'password', 'phone', 'fax', 'mobile', 'street', 'zip', 'city', 'country', 'organization_id', 'note', 'role_ids', 'group_ids', 'active', 'invite'
+  @extend Spine.Model.Ajax
+#  @hasMany 'roles', 'App.Role'
+  @configure_attributes = [
+    { name: 'login',            display: 'Login',         tag: 'input',    type: 'text',     limit: 100, null: false, class: 'xlarge', autocapitalize: false, signup: false, quick: false },
+    { name: 'firstname',        display: 'Firstname',     tag: 'input',    type: 'text',     limit: 100, null: false, class: 'xlarge', signup: true, quick: true, info: true, invite_agent: true },
+    { name: 'lastname',         display: 'Lastname',      tag: 'input',    type: 'text',     limit: 100, null: false, class: 'xlarge', signup: true, quick: true, info: true, invite_agent: true },
+    { name: 'email',            display: 'Email',         tag: 'input',    type: 'email',    limit: 100, null: false, class: 'xlarge', signup: true, quick: true, info: true, invite_agent: true },
+    { name: 'web',              display: 'Web',           tag: 'input',    type: 'url',      limit: 100, null: true,  class: 'xlarge', signup: false, quick: true, info: true },
+    { name: 'phone',            display: 'Phone',         tag: 'input',    type: 'phone',    limit: 100, null: true,  class: 'xlarge', signup: false, quick: true, info: true },
+    { name: 'mobile',           display: 'Mobile',        tag: 'input',    type: 'phone',    limit: 100, null: true,  class: 'xlarge', signup: false, quick: true, info: true },
+    { name: 'fax',              display: 'Fax',           tag: 'input',    type: 'phone',    limit: 100, null: true,  class: 'xlarge', signup: false, quick: true, info: true },
+    { name: 'password',         display: 'Password',      tag: 'input',    type: 'password', limit: 50,  null: true, class:  'xlarge', signup: true,  quick: false, },
+    { name: 'organization_id',  display: 'Organization',  tag: 'select',   multiple: false, nulloption: true, null: true, relation: 'Organization', class: 'xlarge' },
+    { name: 'note',             display: 'Note',          tag: 'textarea', note: 'Notes are visible to agents only, never to customers.', limit: 250, null: true, class: 'xlarge', quick: true, info: true },
+    { name: 'role_ids',         display: 'Roles',         tag: 'checkbox', multiple: true, null: false, relation: 'Role', class: 'xlarge' },
+    { name: 'group_ids',        display: 'Groups',        tag: 'checkbox', multiple: true, null: true, relation: 'Group', class: 'xlarge', invite_agent: true },
+    { name: 'active',           display: 'Active',        tag: 'boolean',  default: true, null: true, class: 'xlarge' },
+    { name: 'updated_at',       display: 'Updated',       type: 'time',    readonly: 1 },
+  ]
+  @configure_overview = [
+#    'login', 'firstname', 'lastname', 'email', 'updated_at',
+    'login', 'firstname', 'lastname'
+  ]

app/assets/javascripts/app/views/agent_ticket_create.jst.eco

@@ -0,0 +1,27 @@
+<div class="page-header">
+  <h1>New Ticket <small></small></h1>
+</div>
+
+<form class="form-horizontal">
+  <div class="row">
+    <div class="span9">
+      <%- @form %>
+        <!--
+          <legend>Example form legend</legend>
+        -->
+          <!--
+          <div class="clearfix">
+            <label for="fileInput">File input</label>
+            <div class="input">
+              <input class="input-file" id="fileInput" name="fileInput" type="file" />
+            </div>
+          </div><!-- /clearfix -->
+    </div>
+    <div class="span3">
+      <div class="span3" id="customer_info"></div>
+    </div>
+  </div>
+  <div class="form-actions">
+    <button type="reset" class="btn">Cancel</button>&nbsp;<input type="submit" class="btn-primary" value="Create"/>
+  </div>
+</form>

app/assets/javascripts/app/views/agent_ticket_history.jst.eco

@@ -0,0 +1,10 @@
+<div class="modal-header">
+  <a href="#" class="close">&times;</a>
+  <h3>History</h3>
+</div>
+<div class="modal-body">
+  <form class="form-horizontal"></form>
+  <div class="table_history"></div>
+</div>
+<div class="modal-footer">
+</div>